| %!PS-Adobe-3.0 |
| %%Creator: groff version 1.19.2 |
| %%CreationDate: Wed Dec 30 13:07:37 2009 |
| %%DocumentNeededResources: font Times-Roman |
| %%+ font Times-Bold |
| %%+ font Times-Italic |
| %%+ font Courier |
| %%+ font Symbol |
| %%DocumentSuppliedResources: procset grops 1.19 2 |
| %%Pages: 70 |
| %%PageOrder: Ascend |
| %%DocumentMedia: Default 595 842 0 () () |
| %%Orientation: Portrait |
| %%EndComments |
| %%BeginDefaults |
| %%PageMedia: Default |
| %%EndDefaults |
| %%BeginProlog |
| %%BeginResource: procset grops 1.19 2 |
| %!PS-Adobe-3.0 Resource-ProcSet |
| /setpacking where{ |
| pop |
| currentpacking |
| true setpacking |
| }if |
| /grops 120 dict dup begin |
| /SC 32 def |
| /A/show load def |
| /B{0 SC 3 -1 roll widthshow}bind def |
| /C{0 exch ashow}bind def |
| /D{0 exch 0 SC 5 2 roll awidthshow}bind def |
| /E{0 rmoveto show}bind def |
| /F{0 rmoveto 0 SC 3 -1 roll widthshow}bind def |
| /G{0 rmoveto 0 exch ashow}bind def |
| /H{0 rmoveto 0 exch 0 SC 5 2 roll awidthshow}bind def |
| /I{0 exch rmoveto show}bind def |
| /J{0 exch rmoveto 0 SC 3 -1 roll widthshow}bind def |
| /K{0 exch rmoveto 0 exch ashow}bind def |
| /L{0 exch rmoveto 0 exch 0 SC 5 2 roll awidthshow}bind def |
| /M{rmoveto show}bind def |
| /N{rmoveto 0 SC 3 -1 roll widthshow}bind def |
| /O{rmoveto 0 exch ashow}bind def |
| /P{rmoveto 0 exch 0 SC 5 2 roll awidthshow}bind def |
| /Q{moveto show}bind def |
| /R{moveto 0 SC 3 -1 roll widthshow}bind def |
| /S{moveto 0 exch ashow}bind def |
| /T{moveto 0 exch 0 SC 5 2 roll awidthshow}bind def |
| /SF{ |
| findfont exch |
| [exch dup 0 exch 0 exch neg 0 0]makefont |
| dup setfont |
| [exch/setfont cvx]cvx bind def |
| }bind def |
| /MF{ |
| findfont |
| [5 2 roll |
| 0 3 1 roll |
| neg 0 0]makefont |
| dup setfont |
| [exch/setfont cvx]cvx bind def |
| }bind def |
| /level0 0 def |
| /RES 0 def |
| /PL 0 def |
| /LS 0 def |
| /MANUAL{ |
| statusdict begin/manualfeed true store end |
| }bind def |
| /PLG{ |
| gsave newpath clippath pathbbox grestore |
| exch pop add exch pop |
| }bind def |
| /BP{ |
| /level0 save def |
| 1 setlinecap |
| 1 setlinejoin |
| 72 RES div dup scale |
| LS{ |
| 90 rotate |
| }{ |
| 0 PL translate |
| }ifelse |
| 1 -1 scale |
| }bind def |
| /EP{ |
| level0 restore |
| showpage |
| }def |
| /DA{ |
| newpath arcn stroke |
| }bind def |
| /SN{ |
| transform |
| .25 sub exch .25 sub exch |
| round .25 add exch round .25 add exch |
| itransform |
| }bind def |
| /DL{ |
| SN |
| moveto |
| SN |
| lineto stroke |
| }bind def |
| /DC{ |
| newpath 0 360 arc closepath |
| }bind def |
| /TM matrix def |
| /DE{ |
| TM currentmatrix pop |
| translate scale newpath 0 0 .5 0 360 arc closepath |
| TM setmatrix |
| }bind def |
| /RC/rcurveto load def |
| /RL/rlineto load def |
| /ST/stroke load def |
| /MT/moveto load def |
| /CL/closepath load def |
| /Fr{ |
| setrgbcolor fill |
| }bind def |
| /setcmykcolor where{ |
| pop |
| /Fk{ |
| setcmykcolor fill |
| }bind def |
| }if |
| /Fg{ |
| setgray fill |
| }bind def |
| /FL/fill load def |
| /LW/setlinewidth load def |
| /Cr/setrgbcolor load def |
| /setcmykcolor where{ |
| pop |
| /Ck/setcmykcolor load def |
| }if |
| /Cg/setgray load def |
| /RE{ |
| findfont |
| dup maxlength 1 index/FontName known not{1 add}if dict begin |
| { |
| 1 index/FID ne{def}{pop pop}ifelse |
| }forall |
| /Encoding exch def |
| dup/FontName exch def |
| currentdict end definefont pop |
| }bind def |
| /DEFS 0 def |
| /EBEGIN{ |
| moveto |
| DEFS begin |
| }bind def |
| /EEND/end load def |
| /CNT 0 def |
| /level1 0 def |
| /PBEGIN{ |
| /level1 save def |
| translate |
| div 3 1 roll div exch scale |
| neg exch neg exch translate |
| 0 setgray |
| 0 setlinecap |
| 1 setlinewidth |
| 0 setlinejoin |
| 10 setmiterlimit |
| []0 setdash |
| /setstrokeadjust where{ |
| pop |
| false setstrokeadjust |
| }if |
| /setoverprint where{ |
| pop |
| false setoverprint |
| }if |
| newpath |
| /CNT countdictstack def |
| userdict begin |
| /showpage{}def |
| /setpagedevice{}def |
| }bind def |
| /PEND{ |
| countdictstack CNT sub{end}repeat |
| level1 restore |
| }bind def |
| end def |
| /setpacking where{ |
| pop |
| setpacking |
| }if |
| %%EndResource |
| %%EndProlog |
| %%BeginSetup |
| %%BeginFeature: *PageSize Default |
| << /PageSize [ 595 842 ] /ImagingBBox null >> setpagedevice |
| %%EndFeature |
| %%IncludeResource: font Times-Roman |
| %%IncludeResource: font Times-Bold |
| %%IncludeResource: font Times-Italic |
| %%IncludeResource: font Courier |
| %%IncludeResource: font Symbol |
| grops begin/DEFS 1 dict def DEFS begin/u{.001 mul}bind def end/RES 72 |
| def/PL 841.89 def/LS false def/ENC0[/asciicircum/asciitilde/Scaron |
| /Zcaron/scaron/zcaron/Ydieresis/trademark/quotesingle/Euro/.notdef |
| /.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef |
| /.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef/.notdef |
| /.notdef/.notdef/.notdef/space/exclam/quotedbl/numbersign/dollar/percent |
| /ampersand/quoteright/parenleft/parenright/asterisk/plus/comma/hyphen |
| /period/slash/zero/one/two/three/four/five/six/seven/eight/nine/colon |
| /semicolon/less/equal/greater/question/at/A/B/C/D/E/F/G/H/I/J/K/L/M/N/O |
| /P/Q/R/S/T/U/V/W/X/Y/Z/bracketleft/backslash/bracketright/circumflex |
| /underscore/quoteleft/a/b/c/d/e/f/g/h/i/j/k/l/m/n/o/p/q/r/s/t/u/v/w/x/y |
| /z/braceleft/bar/braceright/tilde/.notdef/quotesinglbase/guillemotleft |
| /guillemotright/bullet/florin/fraction/perthousand/dagger/daggerdbl |
| /endash/emdash/ff/fi/fl/ffi/ffl/dotlessi/dotlessj/grave/hungarumlaut |
| /dotaccent/breve/caron/ring/ogonek/quotedblleft/quotedblright/oe/lslash |
| /quotedblbase/OE/Lslash/.notdef/exclamdown/cent/sterling/currency/yen |
| /brokenbar/section/dieresis/copyright/ordfeminine/guilsinglleft |
| /logicalnot/minus/registered/macron/degree/plusminus/twosuperior |
| /threesuperior/acute/mu/paragraph/periodcentered/cedilla/onesuperior |
| /ordmasculine/guilsinglright/onequarter/onehalf/threequarters |
| /questiondown/Agrave/Aacute/Acircumflex/Atilde/Adieresis/Aring/AE |
| /Ccedilla/Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute/Icircumflex |
| /Idieresis/Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis |
| /multiply/Oslash/Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn |
| /germandbls/agrave/aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla |
| /egrave/eacute/ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis |
| /eth/ntilde/ograve/oacute/ocircumflex/otilde/odieresis/divide/oslash |
| /ugrave/uacute/ucircumflex/udieresis/yacute/thorn/ydieresis]def |
| /Courier@0 ENC0/Courier RE/Times-Italic@0 ENC0/Times-Italic RE |
| /Times-Bold@0 ENC0/Times-Bold RE/Times-Roman@0 ENC0/Times-Roman RE |
| %%EndSetup |
| %%Page: 1 1 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10.95/Times-Bold@0 SF -.219(NA)72 84 S(ME).219 E F0 |
| (bash \255 GNU Bourne-Ag)108 96 Q(ain SHell)-.05 E F1(SYNOPSIS)72 112.8 |
| Q/F2 10/Times-Bold@0 SF(bash)108 124.8 Q F0([options] [\214le])2.5 E F1 |
| (COPYRIGHT)72 141.6 Q F0(Bash is Cop)108 153.6 Q |
| (yright \251 1989-2009 by the Free Softw)-.1 E(are F)-.1 E |
| (oundation, Inc.)-.15 E F1(DESCRIPTION)72 170.4 Q F2(Bash)108 182.4 Q F0 |
| .973(is an)3.474 F F2(sh)3.473 E F0 .973 |
| (-compatible command language interpreter that e)B -.15(xe)-.15 G .973 |
| (cutes commands read from the standard).15 F(input or from a \214le.)108 |
| 194.4 Q F2(Bash)5 E F0(also incorporates useful features from the)2.5 E |
| /F3 10/Times-Italic@0 SF -.4(Ko)2.5 G(rn).4 E F0(and)2.5 E F3(C)2.5 E F0 |
| (shells \()2.5 E F2(ksh)A F0(and)2.5 E F2(csh)2.5 E F0(\).)A F2(Bash)108 |
| 211.2 Q F0 .527(is intended to be a conformant implementation of the Sh\ |
| ell and Utilities portion of the IEEE POSIX)3.027 F |
| (speci\214cation \(IEEE Standard 1003.1\).)108 223.2 Q F2(Bash)5 E F0 |
| (can be con\214gured to be POSIX-conformant by def)2.5 E(ault.)-.1 E F1 |
| (OPTIONS)72 240 Q F0 .52(In addition to the single-character shell opti\ |
| ons documented in the description of the)108 252 R F2(set)3.02 E F0 -.2 |
| (bu)3.02 G .52(iltin command,).2 F F2(bash)108 264 Q F0 |
| (interprets the follo)2.5 E(wing options when it is in)-.25 E -.2(vo)-.4 |
| G -.1(ke).2 G(d:).1 E F2<ad63>108 280.8 Q F3(string)4.166 E F0 .796 |
| (If the)12.354 F F2<ad63>3.296 E F0 .796 |
| (option is present, then commands are read from)3.296 F F3(string)3.296 |
| E F0 5.796(.I).22 G 3.297(ft)-5.796 G .797(here are ar)-3.297 F .797 |
| (guments after)-.18 F(the)158 292.8 Q F3(string)2.5 E F0 2.5(,t).22 G |
| (he)-2.5 E 2.5(ya)-.15 G |
| (re assigned to the positional parameters, starting with)-2.5 E F2($0) |
| 2.5 E F0(.)A F2<ad69>108 304.8 Q F0(If the)41.52 E F2<ad69>2.5 E F0 |
| (option is present, the shell is)2.5 E F3(inter)2.5 E(active)-.15 E F0 |
| (.).18 E F2<ad6c>108 316.8 Q F0(Mak)41.52 E(e)-.1 E F2(bash)2.5 E F0 |
| (act as if it had been in)2.5 E -.2(vo)-.4 G -.1(ke).2 G 2.5(da).1 G 2.5 |
| (sal)-2.5 G(ogin shell \(see)-2.5 E/F4 9/Times-Bold@0 SF(INV)2.5 E(OCA) |
| -.405 E(TION)-.855 E F0(belo)2.25 E(w\).)-.25 E F2<ad72>108 328.8 Q F0 |
| (If the)39.86 E F2<ad72>2.5 E F0(option is present, the shell becomes) |
| 2.5 E F3 -.37(re)2.5 G(stricted).37 E F0(\(see)3.27 E F4 |
| (RESTRICTED SHELL)2.5 E F0(belo)2.25 E(w\).)-.25 E F2<ad73>108 340.8 Q |
| F0 .602(If the)40.41 F F2<ad73>3.102 E F0 .602 |
| (option is present, or if no ar)3.102 F .602 |
| (guments remain after option processing, then commands)-.18 F .616 |
| (are read from the standard input.)158 352.8 R .617(This option allo) |
| 5.617 F .617(ws the positional parameters to be set when)-.25 F(in)158 |
| 364.8 Q -.2(vo)-.4 G(king an interacti).2 E .3 -.15(ve s)-.25 H(hell.) |
| .15 E F2<ad44>108 376.8 Q F0 3.184(Al)37.08 G .684 |
| (ist of all double-quoted strings preceded by)-3.184 F F2($)3.184 E F0 |
| .684(is printed on the standard output.)3.184 F .683(These are)5.683 F |
| .458(the strings that are subject to language translation when the curr\ |
| ent locale is not)158 388.8 R F2(C)2.958 E F0(or)2.959 E F2(POSIX)2.959 |
| E F0(.)A(This implies the)158 400.8 Q F2<ad6e>2.5 E F0 |
| (option; no commands will be e)2.5 E -.15(xe)-.15 G(cuted.).15 E F2 |
| ([\255+]O [)108 412.8 Q F3(shopt_option)A F2(])A F3(shopt_option)158 |
| 424.8 Q F0 1.097(is one of the shell options accepted by the)3.597 F F2 |
| (shopt)3.597 E F0 -.2(bu)3.597 G 1.097(iltin \(see).2 F F4 1.096 |
| (SHELL B)3.596 F(UIL)-.09 E(TIN)-.828 E(COMMANDS)158 436.8 Q F0(belo) |
| 3.002 E 3.252(w\). If)-.25 F F3(shopt_option)3.253 E F0 .753 |
| (is present,)3.253 F F2<ad4f>3.253 E F0 .753(sets the v)3.253 F .753 |
| (alue of that option;)-.25 F F2(+O)3.253 E F0(unsets)3.253 E 2.625 |
| (it. If)158 448.8 R F3(shopt_option)2.625 E F0 .125 |
| (is not supplied, the names and v)2.625 F .124 |
| (alues of the shell options accepted by)-.25 F F2(shopt)2.624 E F0 .505 |
| (are printed on the standard output.)158 460.8 R .505(If the in)5.505 F |
| -.2(vo)-.4 G .505(cation option is).2 F F2(+O)3.005 E F0 3.005(,t)C .506 |
| (he output is displayed in a)-3.005 F |
| (format that may be reused as input.)158 472.8 Q F2<adad>108 484.8 Q F0 |
| (A)38.6 E F2<adad>3.364 E F0 .864 |
| (signals the end of options and disables further option processing.) |
| 3.364 F(An)5.863 E 3.363(ya)-.15 G -.18(rg)-3.363 G .863(uments after) |
| .18 F(the)158 496.8 Q F2<adad>2.5 E F0 |
| (are treated as \214lenames and ar)2.5 E 2.5(guments. An)-.18 F(ar)2.5 E |
| (gument of)-.18 E F2<ad>2.5 E F0(is equi)2.5 E -.25(va)-.25 G(lent to) |
| .25 E F2<adad>2.5 E F0(.)A F2(Bash)108 513.6 Q F0 .303 |
| (also interprets a number of multi-character options.)2.803 F .304 |
| (These options must appear on the command line)5.303 F |
| (before the single-character options to be recognized.)108 525.6 Q F2 |
| <adad646562>108 542.4 Q(ugger)-.2 E F0 .475(Arrange for the deb)144 |
| 554.4 R .475(ugger pro\214le to be e)-.2 F -.15(xe)-.15 G .475 |
| (cuted before the shell starts.).15 F -.45(Tu)5.474 G .474(rns on e).45 |
| F .474(xtended deb)-.15 F(ug-)-.2 E .452 |
| (ging mode \(see the description of the)144 566.4 R F2(extdeb)2.952 E |
| (ug)-.2 E F0 .452(option to the)2.952 F F2(shopt)2.952 E F0 -.2(bu)2.952 |
| G .452(iltin belo).2 F .452(w\) and shell func-)-.25 F |
| (tion tracing \(see the description of the)144 578.4 Q F2 |
| (\255o functrace)2.5 E F0(option to the)2.5 E F2(set)2.5 E F0 -.2(bu)2.5 |
| G(iltin belo).2 E(w\).)-.25 E F2(\255\255dump\255po\255strings)108 590.4 |
| Q F0(Equi)144 602.4 Q -.25(va)-.25 G(lent to).25 E F2<ad44>2.5 E F0 2.5 |
| (,b)C(ut the output is in the GNU)-2.7 E F3 -.1(ge)2.5 G(tte).1 E(xt)-.2 |
| E F2(po)2.5 E F0(\(portable object\) \214le format.)2.5 E F2 |
| (\255\255dump\255strings)108 614.4 Q F0(Equi)144 626.4 Q -.25(va)-.25 G |
| (lent to).25 E F2<ad44>2.5 E F0(.)A F2(\255\255help)108 638.4 Q F0 |
| (Display a usage message on standard output and e)6.26 E |
| (xit successfully)-.15 E(.)-.65 E F2<adad696e6974ad8c6c65>108 650.4 Q F3 |
| (\214le)2.5 E F2<adad72>108 662.4 Q(c\214le)-.18 E F3(\214le)2.5 E F0 |
| (Ex)144 674.4 Q 1.599(ecute commands from)-.15 F F3(\214le)6.009 E F0 |
| 1.598(instead of the standard personal initialization \214le)4.279 F F3 |
| (~/.bashr)3.598 E(c)-.37 E F0 1.598(if the)4.408 F(shell is interacti) |
| 144 686.4 Q .3 -.15(ve \()-.25 H(see).15 E F4(INV)2.5 E(OCA)-.405 E |
| (TION)-.855 E F0(belo)2.25 E(w\).)-.25 E F2(\255\255login)108 703.2 Q F0 |
| (Equi)144 715.2 Q -.25(va)-.25 G(lent to).25 E F2<ad6c>2.5 E F0(.)A |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(1)190.955 E 0 Cg EP |
| %%Page: 2 2 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(\255\255noediting)108 84 Q F0 |
| (Do not use the GNU)144 96 Q F1 -.18(re)2.5 G(adline).18 E F0 |
| (library to read command lines when the shell is interacti)2.5 E -.15 |
| (ve)-.25 G(.).15 E F1(\255\255nopr)108 112.8 Q(o\214le)-.18 E F0 .017 |
| (Do not read either the system-wide startup \214le)144 124.8 R/F2 10 |
| /Times-Italic@0 SF(/etc/pr)4.183 E(o\214le)-.45 E F0 .017(or an)4.183 F |
| 2.517(yo)-.15 G 2.517(ft)-2.517 G .018 |
| (he personal initialization \214les)-2.517 F F2(~/.bash_pr)144 136.8 Q |
| (o\214le)-.45 E F0(,).18 E F2(~/.bash_lo)2.698 E(gin)-.1 E F0 2.698(,o) |
| .24 G(r)-2.698 E F2(~/.pr)2.698 E(o\214le)-.45 E F0 5.198(.B).18 G 2.698 |
| (yd)-5.198 G(ef)-2.698 E(ault,)-.1 E F1(bash)2.698 E F0 .198 |
| (reads these \214les when it is in)2.698 F -.2(vo)-.4 G -.1(ke).2 G |
| 2.697(da).1 G(s)-2.697 E 2.5(al)144 148.8 S(ogin shell \(see)-2.5 E/F3 9 |
| /Times-Bold@0 SF(INV)2.5 E(OCA)-.405 E(TION)-.855 E F0(belo)2.25 E(w\).) |
| -.25 E F1<adad6e6f72>108 165.6 Q(c)-.18 E F0 1.228(Do not read and e) |
| 5.34 F -.15(xe)-.15 G 1.228(cute the personal initialization \214le).15 |
| F F2(~/.bashr)3.228 E(c)-.37 E F0 1.228(if the shell is interacti)4.038 |
| F -.15(ve)-.25 G 6.228(.T).15 G(his)-6.228 E(option is on by def)144 |
| 177.6 Q(ault if the shell is in)-.1 E -.2(vo)-.4 G -.1(ke).2 G 2.5(da).1 |
| G(s)-2.5 E F1(sh)2.5 E F0(.)A F1(\255\255posix)108 194.4 Q F0 1.783 |
| (Change the beha)144 206.4 R 1.782(vior of)-.2 F F1(bash)4.282 E F0 |
| 1.782(where the def)4.282 F 1.782(ault operation dif)-.1 F 1.782 |
| (fers from the POSIX standard to)-.25 F(match the standard \()144 218.4 |
| Q F2(posix mode)A F0(\).)A F1<adad72>108 235.2 Q(estricted)-.18 E F0 |
| (The shell becomes restricted \(see)144 247.2 Q F3(RESTRICTED SHELL)2.5 |
| E F0(belo)2.25 E(w\).)-.25 E F1<adad76>108 264 Q(erbose)-.1 E F0(Equi) |
| 144 276 Q -.25(va)-.25 G(lent to).25 E F1<ad76>5 E F0(.)A F1<adad76>108 |
| 292.8 Q(ersion)-.1 E F0(Sho)144 304.8 Q 2.5(wv)-.25 G |
| (ersion information for this instance of)-2.65 E F1(bash)2.5 E F0 |
| (on the standard output and e)2.5 E(xit successfully)-.15 E(.)-.65 E/F4 |
| 10.95/Times-Bold@0 SF(ARGUMENTS)72 321.6 Q F0 .016(If ar)108 333.6 R |
| .016(guments remain after option processing, and neither the)-.18 F F1 |
| <ad63>2.516 E F0 .016(nor the)2.516 F F1<ad73>2.516 E F0 .016 |
| (option has been supplied, the \214rst)2.516 F(ar)108 345.6 Q .041(gume\ |
| nt is assumed to be the name of a \214le containing shell commands.)-.18 |
| F(If)5.041 E F1(bash)2.541 E F0 .041(is in)2.541 F -.2(vo)-.4 G -.1(ke) |
| .2 G 2.541(di).1 G 2.541(nt)-2.541 G .041(his f)-2.541 F(ashion,)-.1 E |
| F1($0)108 357.6 Q F0 .936(is set to the name of the \214le, and the pos\ |
| itional parameters are set to the remaining ar)3.435 F(guments.)-.18 E |
| F1(Bash)5.936 E F0 .234(reads and e)108 369.6 R -.15(xe)-.15 G .234 |
| (cutes commands from this \214le, then e).15 F(xits.)-.15 E F1(Bash) |
| 5.234 E F0 1.334 -.55('s e)D .234(xit status is the e).4 F .233 |
| (xit status of the last com-)-.15 F .348(mand e)108 381.6 R -.15(xe)-.15 |
| G .348(cuted in the script.).15 F .348(If no commands are e)5.348 F -.15 |
| (xe)-.15 G .348(cuted, the e).15 F .349(xit status is 0.)-.15 F .349 |
| (An attempt is \214rst made to)5.349 F .254 |
| (open the \214le in the current directory)108 393.6 R 2.754(,a)-.65 G |
| .253 |
| (nd, if no \214le is found, then the shell searches the directories in) |
| -2.754 F F3 -.666(PA)2.753 G(TH)-.189 E F0(for the script.)108 405.6 Q |
| F4(INV)72 422.4 Q(OCA)-.493 E(TION)-1.04 E F0(A)108 434.4 Q F2(lo)2.5 E |
| (gin shell)-.1 E F0(is one whose \214rst character of ar)2.5 E |
| (gument zero is a)-.18 E F1<ad>2.5 E F0 2.5(,o)C 2.5(ro)-2.5 G |
| (ne started with the)-2.5 E F1(\255\255login)2.5 E F0(option.)2.5 E(An) |
| 108 451.2 Q F2(inter)2.814 E(active)-.15 E F0 .314 |
| (shell is one started without non-option ar)2.814 F .315 |
| (guments and without the)-.18 F F1<ad63>2.815 E F0 .315 |
| (option whose standard)2.815 F 1.5 |
| (input and error are both connected to terminals \(as determined by)108 |
| 463.2 R F2(isatty)4 E F0 1.5(\(3\)\), or one started with the).32 F F1 |
| <ad69>4 E F0(option.)108 475.2 Q F3(PS1)5.289 E F0 .289(is set and)2.539 |
| F F1<24ad>2.789 E F0(includes)2.789 E F1(i)2.789 E F0(if)2.789 E F1 |
| (bash)2.789 E F0 .289(is interacti)2.789 F -.15(ve)-.25 G 2.789(,a).15 G |
| (llo)-2.789 E .29(wing a shell script or a startup \214le to test this) |
| -.25 F(state.)108 487.2 Q .033(The follo)108 504 R .033 |
| (wing paragraphs describe ho)-.25 F(w)-.25 E F1(bash)2.532 E F0 -.15 |
| (exe)2.532 G .032(cutes its startup \214les.).15 F .032(If an)5.032 F |
| 2.532(yo)-.15 G 2.532(ft)-2.532 G .032(he \214les e)-2.532 F .032 |
| (xist b)-.15 F .032(ut cannot be)-.2 F(read,)108 516 Q F1(bash)3.085 E |
| F0 .585(reports an error)3.085 F 5.585(.T)-.55 G .585(ildes are e)-5.935 |
| F .586(xpanded in \214le names as described belo)-.15 F 3.086(wu)-.25 G |
| (nder)-3.086 E F1 -.18(Ti)3.086 G .586(lde Expansion).18 F F0(in the)108 |
| 528 Q F3(EXP)2.5 E(ANSION)-.666 E F0(section.)2.25 E(When)108 544.8 Q F1 |
| (bash)2.896 E F0 .396(is in)2.896 F -.2(vo)-.4 G -.1(ke).2 G 2.896(da).1 |
| G 2.896(sa)-2.896 G 2.896(ni)-2.896 G(nteracti)-2.896 E .696 -.15(ve l) |
| -.25 H .396(ogin shell, or as a non-interacti).15 F .695 -.15(ve s)-.25 |
| H .395(hell with the).15 F F1(\255\255login)2.895 E F0 .395(option, it) |
| 2.895 F 1.333(\214rst reads and e)108 556.8 R -.15(xe)-.15 G 1.333 |
| (cutes commands from the \214le).15 F F2(/etc/pr)3.833 E(o\214le)-.45 E |
| F0 3.834(,i)C 3.834(ft)-3.834 G 1.334(hat \214le e)-3.834 F 3.834 |
| (xists. After)-.15 F 1.334(reading that \214le, it)3.834 F .249 |
| (looks for)108 568.8 R F2(~/.bash_pr)2.749 E(o\214le)-.45 E F0(,)A F2 |
| (~/.bash_lo)2.749 E(gin)-.1 E F0 2.749(,a)C(nd)-2.749 E F2(~/.pr)2.749 E |
| (o\214le)-.45 E F0 2.749(,i)C 2.749(nt)-2.749 G .249(hat order)-2.749 F |
| 2.748(,a)-.4 G .248(nd reads and e)-2.748 F -.15(xe)-.15 G .248 |
| (cutes commands from).15 F .796(the \214rst one that e)108 580.8 R .796 |
| (xists and is readable.)-.15 F(The)5.796 E F1(\255\255nopr)3.296 E |
| (o\214le)-.18 E F0 .797(option may be used when the shell is started to) |
| 3.296 F(inhibit this beha)108 592.8 Q(vior)-.2 E(.)-.55 E |
| (When a login shell e)108 609.6 Q(xits,)-.15 E F1(bash)2.5 E F0 |
| (reads and e)2.5 E -.15(xe)-.15 G(cutes commands from the \214le).15 E |
| F2(~/.bash_lo)2.5 E(gout)-.1 E F0 2.5(,i)C 2.5(fi)-2.5 G 2.5(te)-2.5 G |
| (xists.)-2.65 E 1.698(When an interacti)108 626.4 R 1.998 -.15(ve s)-.25 |
| H 1.698(hell that is not a login shell is started,).15 F F1(bash)4.197 E |
| F0 1.697(reads and e)4.197 F -.15(xe)-.15 G 1.697(cutes commands from) |
| .15 F F2(~/.bashr)108 638.4 Q(c)-.37 E F0 2.535(,i)C 2.535(ft)-2.535 G |
| .035(hat \214le e)-2.535 F 2.535(xists. This)-.15 F .036 |
| (may be inhibited by using the)2.535 F F1<adad6e6f72>2.536 E(c)-.18 E F0 |
| 2.536(option. The)2.536 F F1<adad72>2.536 E(c\214le)-.18 E F2(\214le) |
| 2.536 E F0 .036(option will)2.536 F(force)108 650.4 Q F1(bash)2.5 E F0 |
| (to read and e)2.5 E -.15(xe)-.15 G(cute commands from).15 E F2(\214le) |
| 2.5 E F0(instead of)2.5 E F2(~/.bashr)2.5 E(c)-.37 E F0(.)A(When)108 |
| 667.2 Q F1(bash)5.306 E F0 2.806(is started non-interacti)5.306 F -.15 |
| (ve)-.25 G(ly).15 E 5.306(,t)-.65 G 5.306(or)-5.306 G 2.806 |
| (un a shell script, for e)-5.306 F 2.805(xample, it looks for the v)-.15 |
| F(ariable)-.25 E F3 -.27(BA)108 679.2 S(SH_ENV).27 E F0 1.01(in the en) |
| 3.26 F 1.01(vironment, e)-.4 F 1.01(xpands its v)-.15 F 1.01 |
| (alue if it appears there, and uses the e)-.25 F 1.011(xpanded v)-.15 F |
| 1.011(alue as the)-.25 F(name of a \214le to read and e)108 691.2 Q -.15 |
| (xe)-.15 G(cute.).15 E F1(Bash)5 E F0(beha)2.5 E -.15(ve)-.2 G 2.5(sa) |
| .15 G 2.5(si)-2.5 G 2.5(ft)-2.5 G(he follo)-2.5 E(wing command were e) |
| -.25 E -.15(xe)-.15 G(cuted:).15 E/F5 10/Courier@0 SF |
| (if [ \255n "$BASH_ENV" ]; then . "$BASH_ENV"; fi)144 709.2 Q F0 -.2(bu) |
| 108 727.2 S 2.5(tt).2 G(he v)-2.5 E(alue of the)-.25 E F3 -.666(PA)2.5 G |
| (TH)-.189 E F0 -.25(va)2.25 G |
| (riable is not used to search for the \214le name.).25 E(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(2)190.955 E 0 Cg EP |
| %%Page: 3 3 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(If)108 84 Q/F1 10/Times-Bold@0 SF(bash)3.417 E F0 .917(is in) |
| 3.417 F -.2(vo)-.4 G -.1(ke).2 G 3.417(dw).1 G .917(ith the name)-3.417 |
| F F1(sh)3.417 E F0 3.417(,i)C 3.417(tt)-3.417 G .917 |
| (ries to mimic the startup beha)-3.417 F .917(vior of historical v)-.2 F |
| .917(ersions of)-.15 F F1(sh)3.417 E F0(as)3.417 E .145 |
| (closely as possible, while conforming to the POSIX standard as well.) |
| 108 96 R .145(When in)5.145 F -.2(vo)-.4 G -.1(ke).2 G 2.645(da).1 G |
| 2.645(sa)-2.645 G 2.645(ni)-2.645 G(nteracti)-2.645 E .445 -.15(ve l) |
| -.25 H(ogin).15 E 1.264(shell, or a non-interacti)108 108 R 1.564 -.15 |
| (ve s)-.25 H 1.264(hell with the).15 F F1(\255\255login)3.764 E F0 1.264 |
| (option, it \214rst attempts to read and e)3.764 F -.15(xe)-.15 G 1.263 |
| (cute commands).15 F(from)108 120 Q/F2 10/Times-Italic@0 SF(/etc/pr) |
| 4.142 E(o\214le)-.45 E F0(and)3.172 E F2(~/.pr)2.992 E(o\214le)-.45 E F0 |
| 2.992(,i).18 G 2.992(nt)-2.992 G .492(hat order)-2.992 F 5.492(.T)-.55 G |
| (he)-5.492 E F1(\255\255nopr)2.992 E(o\214le)-.18 E F0 .493 |
| (option may be used to inhibit this beha)2.993 F(vior)-.2 E(.)-.55 E |
| .418(When in)108 132 R -.2(vo)-.4 G -.1(ke).2 G 2.918(da).1 G 2.918(sa) |
| -2.918 G 2.918(ni)-2.918 G(nteracti)-2.918 E .718 -.15(ve s)-.25 H .418 |
| (hell with the name).15 F F1(sh)2.918 E F0(,)A F1(bash)2.918 E F0 .418 |
| (looks for the v)2.918 F(ariable)-.25 E/F3 9/Times-Bold@0 SF(ENV)2.918 E |
| /F4 9/Times-Roman@0 SF(,)A F0 -.15(ex)2.667 G .417(pands its v).15 F |
| (alue)-.25 E .171(if it is de\214ned, and uses the e)108 144 R .171 |
| (xpanded v)-.15 F .171(alue as the name of a \214le to read and e)-.25 F |
| -.15(xe)-.15 G 2.671(cute. Since).15 F 2.671(as)2.671 G .171(hell in) |
| -2.671 F -.2(vo)-.4 G -.1(ke).2 G(d).1 E(as)108 156 Q F1(sh)3.081 E F0 |
| .581(does not attempt to read and e)3.081 F -.15(xe)-.15 G .581 |
| (cute commands from an).15 F 3.08(yo)-.15 G .58 |
| (ther startup \214les, the)-3.08 F F1<adad72>3.08 E(c\214le)-.18 E F0 |
| .58(option has)3.08 F .182(no ef)108 168 R 2.682(fect. A)-.25 F |
| (non-interacti)2.682 E .482 -.15(ve s)-.25 H .182(hell in).15 F -.2(vo) |
| -.4 G -.1(ke).2 G 2.682(dw).1 G .182(ith the name)-2.682 F F1(sh)2.682 E |
| F0 .182(does not attempt to read an)2.682 F 2.683(yo)-.15 G .183 |
| (ther startup \214les.)-2.683 F(When in)108 180 Q -.2(vo)-.4 G -.1(ke).2 |
| G 2.5(da).1 G(s)-2.5 E F1(sh)2.5 E F0(,)A F1(bash)2.5 E F0(enters)2.5 E |
| F2(posix)3.75 E F0(mode after the startup \214les are read.)3.03 E(When) |
| 108 196.8 Q F1(bash)2.727 E F0 .226(is started in)2.727 F F2(posix)3.976 |
| E F0 .226(mode, as with the)3.256 F F1(\255\255posix)2.726 E F0 .226 |
| (command line option, it follo)2.726 F .226(ws the POSIX stan-)-.25 F |
| .341(dard for startup \214les.)108 208.8 R .341(In this mode, interacti) |
| 5.341 F .641 -.15(ve s)-.25 H .341(hells e).15 F .341(xpand the)-.15 F |
| F3(ENV)2.841 E F0 -.25(va)2.591 G .342(riable and commands are read and) |
| .25 F -.15(exe)108 220.8 S(cuted from the \214le whose name is the e).15 |
| E(xpanded v)-.15 E 2.5(alue. No)-.25 F(other startup \214les are read.) |
| 2.5 E F1(Bash)108 237.6 Q F0 .644(attempts to determine when it is bein\ |
| g run with its standard input connected to a a netw)3.144 F .643 |
| (ork connec-)-.1 F .229(tion, as if by the remote shell daemon, usually) |
| 108 249.6 R F2 -.1(rs)2.729 G(hd).1 E F0 2.729(,o)C 2.73(rt)-2.729 G .23 |
| (he secure shell daemon)-2.73 F F2(sshd)2.73 E F0 5.23(.I)C(f)-5.23 E F1 |
| (bash)2.73 E F0 .23(determines it)2.73 F .741(is being run in this f)108 |
| 261.6 R .741(ashion, it reads and e)-.1 F -.15(xe)-.15 G .741 |
| (cutes commands from).15 F F2(~/.bashr)3.241 E(c)-.37 E F0 3.241(,i)C |
| 3.241(ft)-3.241 G .741(hat \214le e)-3.241 F .741(xists and is read-) |
| -.15 F 2.97(able. It)108 273.6 R .47(will not do this if in)2.97 F -.2 |
| (vo)-.4 G -.1(ke).2 G 2.97(da).1 G(s)-2.97 E F1(sh)2.97 E F0 5.47(.T)C |
| (he)-5.47 E F1<adad6e6f72>2.97 E(c)-.18 E F0 .47 |
| (option may be used to inhibit this beha)2.97 F(vior)-.2 E 2.97(,a)-.4 G |
| .47(nd the)-2.97 F F1<adad72>108 285.6 Q(c\214le)-.18 E F0 .886 |
| (option may be used to force another \214le to be read, b)3.387 F(ut)-.2 |
| E F2 -.1(rs)3.386 G(hd).1 E F0 .886(does not generally in)3.386 F -.2 |
| (vo)-.4 G 1.086 -.1(ke t).2 H .886(he shell).1 F |
| (with those options or allo)108 297.6 Q 2.5(wt)-.25 G |
| (hem to be speci\214ed.)-2.5 E 1.207 |
| (If the shell is started with the ef)108 314.4 R(fecti)-.25 E 1.507 -.15 |
| (ve u)-.25 H 1.208 |
| (ser \(group\) id not equal to the real user \(group\) id, and the).15 F |
| F1<ad70>3.708 E F0 .536(option is not supplied, no startup \214les are \ |
| read, shell functions are not inherited from the en)108 326.4 R .535 |
| (vironment, the)-.4 F F3(SHELLOPTS)108 338.4 Q F4(,)A F3 -.27(BA)2.959 G |
| (SHOPTS).27 E F4(,)A F3(CDP)2.959 E -.855(AT)-.666 G(H).855 E F4(,)A F0 |
| (and)2.959 E F3(GLOBIGNORE)3.209 E F0 -.25(va)2.959 G .709 |
| (riables, if the).25 F 3.209(ya)-.15 G .71(ppear in the en)-3.209 F .71 |
| (vironment, are)-.4 F .905(ignored, and the ef)108 350.4 R(fecti)-.25 E |
| 1.205 -.15(ve u)-.25 H .904(ser id is set to the real user id.).15 F |
| .904(If the)5.904 F F1<ad70>3.404 E F0 .904(option is supplied at in) |
| 3.404 F -.2(vo)-.4 G .904(cation, the).2 F(startup beha)108 362.4 Q |
| (vior is the same, b)-.2 E(ut the ef)-.2 E(fecti)-.25 E .3 -.15(ve u) |
| -.25 H(ser id is not reset.).15 E/F5 10.95/Times-Bold@0 SF(DEFINITIONS) |
| 72 379.2 Q F0(The follo)108 391.2 Q |
| (wing de\214nitions are used throughout the rest of this document.)-.25 |
| E F1(blank)108 403.2 Q F0 2.5(As)11.54 G(pace or tab)-2.5 E(.)-.4 E F1 |
| -.1(wo)108 415.2 S(rd).1 E F0 2.5(As)13.88 G |
| (equence of characters considered as a single unit by the shell.)-2.5 E |
| (Also kno)5 E(wn as a)-.25 E F1(tok)2.5 E(en)-.1 E F0(.)A F1(name)108 |
| 427.2 Q F0(A)12.67 E F2(wor)3.005 E(d)-.37 E F0 .165 |
| (consisting only of alphanumeric characters and underscores, and be) |
| 3.435 F .166(ginning with an alpha-)-.15 F |
| (betic character or an underscore.)144 439.2 Q(Also referred to as an)5 |
| E F1(identi\214er)2.5 E F0(.)A F1(metacharacter)108 451.2 Q F0 2.5(Ac) |
| 144 463.2 S(haracter that, when unquoted, separates w)-2.5 E 2.5 |
| (ords. One)-.1 F(of the follo)2.5 E(wing:)-.25 E F1 5(|&;\(\)<>s)144 |
| 475.2 S 2.5(pace tab)-5 F(contr)108 487.2 Q(ol operator)-.18 E F0(A)144 |
| 499.2 Q F2(tok)2.5 E(en)-.1 E F0(that performs a control function.)2.5 E |
| (It is one of the follo)5 E(wing symbols:)-.25 E/F6 10/Symbol SF<efef> |
| 144 511.2 Q F1 5(&&)5 G 5(&;;)-5 G 5(;\(\)||)-5 G 10(&<)-5 G(newline>) |
| -10 E F5(RESER)72 528 Q(VED W)-.602 E(ORDS)-.11 E F2 .307(Reserved wor) |
| 108 540 R(ds)-.37 E F0 .307(are w)2.807 F .307(ords that ha)-.1 F .607 |
| -.15(ve a s)-.2 H .306(pecial meaning to the shell.).15 F .306 |
| (The follo)5.306 F .306(wing w)-.25 F .306(ords are recognized as)-.1 F |
| (reserv)108 552 Q .227(ed when unquoted and either the \214rst w)-.15 F |
| .227(ord of a simple command \(see)-.1 F F3 .227(SHELL GRAMMAR)2.727 F |
| F0(belo)2.477 E .227(w\) or)-.25 F(the third w)108 564 Q(ord of a)-.1 E |
| F1(case)2.5 E F0(or)2.5 E F1 -.25(fo)2.5 G(r).25 E F0(command:)2.5 E F1 |
| 11.916(!c)144 580.8 S 9.416(ase do done elif else esac \214 f)-11.916 F |
| 9.415(or function if in select then until)-.25 F 7.5 |
| (while { } time [[ ]])144 592.8 R F5(SHELL GRAMMAR)72 609.6 Q F1 |
| (Simple Commands)87 621.6 Q F0(A)108 633.6 Q F2 .388(simple command) |
| 2.888 F F0 .388(is a sequence of optional v)2.888 F .389 |
| (ariable assignments follo)-.25 F .389(wed by)-.25 F F1(blank)2.889 E F0 |
| .389(-separated w)B .389(ords and)-.1 F .816 |
| (redirections, and terminated by a)108 645.6 R F2(contr)3.316 E .815 |
| (ol oper)-.45 F(ator)-.15 E F0 5.815(.T)C .815(he \214rst w)-5.815 F |
| .815(ord speci\214es the command to be e)-.1 F -.15(xe)-.15 G(cuted,).15 |
| E(and is passed as ar)108 657.6 Q(gument zero.)-.18 E(The remaining w)5 |
| E(ords are passed as ar)-.1 E(guments to the in)-.18 E -.2(vo)-.4 G -.1 |
| (ke).2 G 2.5(dc).1 G(ommand.)-2.5 E .175(The return v)108 674.4 R .175 |
| (alue of a)-.25 F F2 .175(simple command)2.675 F F0 .175(is its e)2.675 |
| F .175(xit status, or 128+)-.15 F F2(n)A F0 .176 |
| (if the command is terminated by signal)3.508 F F2(n)2.676 E F0(.).24 E |
| F1(Pipelines)87 691.2 Q F0(A)108 703.2 Q F2(pipeline)2.996 E F0 .496(is\ |
| a sequence of one or more commands separated by one of the control ope\ |
| rators)2.996 F F1(|)2.996 E F0(or)2.996 E F1(|&)2.996 E F0 5.496(.T)C |
| (he)-5.496 E(format for a pipeline is:)108 715.2 Q(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(3)190.955 E 0 Cg EP |
| %%Page: 4 4 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E([)144 84 Q/F1 10/Times-Bold@0 SF(time)A F0([)2.5 E F1<ad70>A F0 |
| (]] [ ! ])A/F2 10/Times-Italic@0 SF(command)2.5 E F0 2.5([[)2.5 G F1(|) |
| -2.5 E/F3 10/Symbol SF<ef>A F1(|&)A F0(])A F2(command2)2.5 E F0(... ]) |
| 2.5 E .243(The standard output of)108 100.8 R F2(command)2.943 E F0 .244 |
| (is connected via a pipe to the standard input of)3.513 F F2(command2) |
| 2.744 E F0 5.244(.T).02 G .244(his connec-)-5.244 F .643 |
| (tion is performed before an)108 112.8 R 3.143(yr)-.15 G .642 |
| (edirections speci\214ed by the command \(see)-3.143 F/F4 9/Times-Bold@0 |
| SF(REDIRECTION)3.142 E F0(belo)2.892 E 3.142(w\). If)-.25 F F1(|&)3.142 |
| E F0(is)3.142 E 1.43(used, the standard error of)108 124.8 R F2(command) |
| 3.93 E F0 1.431(is connected to)3.93 F F2(command2)3.931 E F0 2.531 -.55 |
| ('s s)D 1.431(tandard input through the pipe; it is).55 F 1.197 |
| (shorthand for)108 136.8 R F1 1.197(2>&1 |)3.697 F F0 6.197(.T)C 1.197 |
| (his implicit redirection of the standard error is performed after an) |
| -6.197 F 3.696(yr)-.15 G(edirections)-3.696 E |
| (speci\214ed by the command.)108 148.8 Q .48 |
| (The return status of a pipeline is the e)108 165.6 R .48 |
| (xit status of the last command, unless the)-.15 F F1(pipefail)2.98 E F0 |
| .48(option is enabled.)2.98 F(If)108 177.6 Q F1(pipefail)2.687 E F0 .187 |
| (is enabled, the pipeline')2.687 F 2.687(sr)-.55 G .186 |
| (eturn status is the v)-2.687 F .186 |
| (alue of the last \(rightmost\) command to e)-.25 F .186(xit with a)-.15 |
| F .61(non-zero status, or zero if all commands e)108 189.6 R .611 |
| (xit successfully)-.15 F 5.611(.I)-.65 G 3.111(ft)-5.611 G .611 |
| (he reserv)-3.111 F .611(ed w)-.15 F(ord)-.1 E F1(!)3.111 E F0 .611 |
| (precedes a pipeline, the)5.611 F -.15(ex)108 201.6 S .55 |
| (it status of that pipeline is the logical ne).15 F -.05(ga)-.15 G .55 |
| (tion of the e).05 F .55(xit status as described abo)-.15 F -.15(ve)-.15 |
| G 5.55(.T).15 G .55(he shell w)-5.55 F .55(aits for)-.1 F |
| (all commands in the pipeline to terminate before returning a v)108 |
| 213.6 Q(alue.)-.25 E .298(If the)108 230.4 R F1(time)2.799 E F0(reserv) |
| 2.799 E .299(ed w)-.15 F .299(ord precedes a pipeline, the elapsed as w\ |
| ell as user and system time consumed by its)-.1 F -.15(exe)108 242.4 S |
| .14(cution are reported when the pipeline terminates.).15 F(The)5.139 E |
| F1<ad70>2.639 E F0 .139(option changes the output format to that spec-) |
| 2.639 F .779(i\214ed by POSIX.)108 254.4 R(The)5.779 E F4(TIMEFORMA) |
| 3.279 E(T)-.855 E F0 -.25(va)3.029 G .779 |
| (riable may be set to a format string that speci\214es ho).25 F 3.28(wt) |
| -.25 G .78(he timing)-3.28 F |
| (information should be displayed; see the description of)108 266.4 Q F4 |
| (TIMEFORMA)2.5 E(T)-.855 E F0(under)2.25 E F1(Shell V)2.5 E(ariables) |
| -.92 E F0(belo)2.5 E -.65(w.)-.25 G(Each command in a pipeline is e)108 |
| 283.2 Q -.15(xe)-.15 G |
| (cuted as a separate process \(i.e., in a subshell\).).15 E F1(Lists)87 |
| 300 Q F0(A)108 312 Q F2(list)2.601 E F0 .101(is a sequence of one or mo\ |
| re pipelines separated by one of the operators)2.601 F F1(;)2.6 E F0(,)A |
| F1(&)2.6 E F0(,)A F1(&&)2.6 E F0 2.6(,o)C(r)-2.6 E F3<efef>2.6 E F0 2.6 |
| (,a)C .1(nd option-)-2.6 F(ally terminated by one of)108 324 Q F1(;)2.5 |
| E F0(,)A F1(&)2.5 E F0 2.5(,o)C(r)-2.5 E F1(<newline>)2.5 E F0(.)A .656 |
| (Of these list operators,)108 340.8 R F1(&&)3.156 E F0(and)3.156 E F3 |
| <efef>3.156 E F0(ha)3.156 E .956 -.15(ve e)-.2 H .656 |
| (qual precedence, follo).15 F .656(wed by)-.25 F F1(;)3.156 E F0(and) |
| 3.156 E F1(&)3.156 E F0 3.156(,w)C .656(hich ha)-3.156 F .957 -.15(ve e) |
| -.2 H .657(qual prece-).15 F(dence.)108 352.8 Q 2.5(As)108 369.6 S |
| (equence of one or more ne)-2.5 E(wlines may appear in a)-.25 E F2(list) |
| 2.5 E F0(instead of a semicolon to delimit commands.)2.5 E .029 |
| (If a command is terminated by the control operator)108 386.4 R F1(&) |
| 2.529 E F0 2.529(,t)C .029(he shell e)-2.529 F -.15(xe)-.15 G .029 |
| (cutes the command in the).15 F F2(bac)2.528 E(kgr)-.2 E(ound)-.45 E F0 |
| (in)2.528 E 2.875(as)108 398.4 S 2.875(ubshell. The)-2.875 F .375 |
| (shell does not w)2.875 F .375 |
| (ait for the command to \214nish, and the return status is 0.)-.1 F .376 |
| (Commands sepa-)5.376 F .849(rated by a)108 410.4 R F1(;)3.349 E F0 .849 |
| (are e)3.349 F -.15(xe)-.15 G .848(cuted sequentially; the shell w).15 F |
| .848(aits for each command to terminate in turn.)-.1 F .848(The return) |
| 5.848 F(status is the e)108 422.4 Q(xit status of the last command e) |
| -.15 E -.15(xe)-.15 G(cuted.).15 E .632(AND and OR lists are sequences \ |
| of one of more pipelines separated by the)108 439.2 R F1(&&)3.132 E F0 |
| (and)3.133 E F3<efef>3.133 E F0 .633(control operators,)3.133 F |
| (respecti)108 451.2 Q -.15(ve)-.25 G(ly).15 E 5(.A)-.65 G |
| (ND and OR lists are e)-5 E -.15(xe)-.15 G(cuted with left associati).15 |
| E(vity)-.25 E 5(.A)-.65 G 2.5(nA)-5 G(ND list has the form)-2.5 E F2 |
| (command1)144 468 Q F1(&&)2.5 E F2(command2)2.5 E(command2)108.2 484.8 Q |
| F0(is e)2.52 E -.15(xe)-.15 G(cuted if, and only if,).15 E F2(command1) |
| 2.7 E F0(returns an e)2.5 E(xit status of zero.)-.15 E |
| (An OR list has the form)108 501.6 Q F2(command1)144 518.4 Q F3<efef>2.5 |
| E F2(command2)2.5 E(command2)108.2 540 Q F0 .729(is e)3.249 F -.15(xe) |
| -.15 G .729(cuted if and only if).15 F F2(command1)3.429 E F0 .729 |
| (returns a non-zero e)3.229 F .729(xit status.)-.15 F .728 |
| (The return status of AND)5.729 F(and OR lists is the e)108 552 Q |
| (xit status of the last command e)-.15 E -.15(xe)-.15 G |
| (cuted in the list.).15 E F1(Compound Commands)87 568.8 Q F0(A)108 580.8 |
| Q F2(compound command)2.5 E F0(is one of the follo)2.5 E(wing:)-.25 E |
| (\()108 597.6 Q F2(list)A F0(\))A F2(list)17.11 E F0 .011(is e)2.511 F |
| -.15(xe)-.15 G .011(cuted in a subshell en).15 F .011(vironment \(see) |
| -.4 F F4 .011(COMMAND EXECUTION ENVIR)2.511 F(ONMENT)-.27 E F0(belo) |
| 2.262 E(w\).)-.25 E -1.11(Va)144 609.6 S 1.064(riable assignments and b) |
| 1.11 F 1.064(uiltin commands that af)-.2 F 1.064(fect the shell')-.25 F |
| 3.564(se)-.55 G -.4(nv)-3.564 G 1.064(ironment do not remain in).4 F(ef) |
| 144 621.6 Q(fect after the command completes.)-.25 E |
| (The return status is the e)5 E(xit status of)-.15 E F2(list)2.5 E F0(.) |
| A({)108 638.4 Q F2(list)2.5 E F0 2.5(;})C F2(list)3.89 E F0 .401 |
| (is simply e)2.901 F -.15(xe)-.15 G .401(cuted in the current shell en) |
| .15 F(vironment.)-.4 E F2(list)5.401 E F0 .402 |
| (must be terminated with a ne)2.901 F .402(wline or)-.25 F 3.215 |
| (semicolon. This)144 650.4 R .715(is kno)3.215 F .715(wn as a)-.25 F F2 |
| (gr)3.215 E .715(oup command)-.45 F F0 5.715(.T)C .715 |
| (he return status is the e)-5.715 F .714(xit status of)-.15 F F2(list) |
| 3.214 E F0 5.714(.N)C(ote)-5.714 E .219(that unlik)144 662.4 R 2.719(et) |
| -.1 G .219(he metacharacters)-2.719 F F1(\()2.719 E F0(and)2.719 E F1 |
| (\))2.719 E F0(,)A F1({)2.719 E F0(and)2.719 E F1(})2.719 E F0(are)2.719 |
| E F2 -.37(re)2.72 G .22(served wor).37 F(ds)-.37 E F0 .22 |
| (and must occur where a reserv)2.72 F(ed)-.15 E -.1(wo)144 674.4 S .257 |
| (rd is permitted to be recognized.).1 F .257(Since the)5.257 F 2.757(yd) |
| -.15 G 2.756(on)-2.757 G .256(ot cause a w)-2.756 F .256(ord break, the) |
| -.1 F 2.756(ym)-.15 G .256(ust be separated)-2.756 F(from)144 686.4 Q F2 |
| (list)2.5 E F0(by whitespace or another shell metacharacter)2.5 E(.)-.55 |
| E(\(\()108 703.2 Q F2 -.2(ex)C(pr).2 E(ession)-.37 E F0(\)\))A(The)144 |
| 715.2 Q F2 -.2(ex)2.551 G(pr).2 E(ession)-.37 E F0 .051(is e)2.551 F |
| -.25(va)-.25 G .051(luated according to the rules described belo).25 F |
| 2.552(wu)-.25 G(nder)-2.552 E F4 .052(ARITHMETIC EV)2.552 F(ALU)-1.215 E |
| (A-)-.54 E(TION)144 727.2 Q/F5 9/Times-Roman@0 SF(.)A F0 .411(If the v) |
| 4.911 F .411(alue of the e)-.25 F .411(xpression is non-zero, the retur\ |
| n status is 0; otherwise the return status)-.15 F(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(4)190.955 E 0 Cg EP |
| %%Page: 5 5 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(is 1.)144 84 Q(This is e)5 E(xactly equi)-.15 E -.25(va)-.25 G |
| (lent to).25 E/F1 10/Times-Bold@0 SF(let ")2.5 E/F2 10/Times-Italic@0 SF |
| -.2(ex)C(pr).2 E(ession)-.37 E F1(")A F0(.)A F1([[)108 100.8 Q F2 -.2 |
| (ex)2.5 G(pr).2 E(ession)-.37 E F1(]])2.5 E F0 1.299 |
| (Return a status of 0 or 1 depending on the e)144 112.8 R -.25(va)-.25 G |
| 1.3(luation of the conditional e).25 F(xpression)-.15 E F2 -.2(ex)3.8 G |
| (pr).2 E(ession)-.37 E F0(.)A 2.274 |
| (Expressions are composed of the primaries described belo)144 124.8 R |
| 4.773(wu)-.25 G(nder)-4.773 E/F3 9/Times-Bold@0 SF(CONDITION)4.773 E |
| 2.273(AL EXPRES-)-.18 F(SIONS)144 136.8 Q/F4 9/Times-Roman@0 SF(.)A F0 |
| -.8(Wo)5.632 G 1.133(rd splitting and pathname e).8 F 1.133 |
| (xpansion are not performed on the w)-.15 F 1.133(ords between the)-.1 F |
| F1([[)3.633 E F0(and)144 148.8 Q F1(]])2.964 E F0 2.964(;t)C .464 |
| (ilde e)-2.964 F .464(xpansion, parameter and v)-.15 F .464(ariable e) |
| -.25 F .463(xpansion, arithmetic e)-.15 F .463 |
| (xpansion, command substi-)-.15 F 1.081 |
| (tution, process substitution, and quote remo)144 160.8 R -.25(va)-.15 G |
| 3.581(la).25 G 1.081(re performed.)-3.581 F 1.081 |
| (Conditional operators such as)6.081 F F1<ad66>3.581 E F0 |
| (must be unquoted to be recognized as primaries.)144 172.8 Q |
| (When used with)144 190.8 Q F1([[)2.5 E F0 2.5(,T)C(he)-2.5 E F1(<)2.5 E |
| F0(and)2.5 E F1(>)2.5 E F0(operators sort le)2.5 E |
| (xicographically using the current locale.)-.15 E .503(When the)144 |
| 208.8 R F1(==)3.003 E F0(and)3.002 E F1(!=)3.002 E F0 .502(operators ar\ |
| e used, the string to the right of the operator is considered a pat-) |
| 3.002 F 1.224(tern and matched according to the rules described belo)144 |
| 220.8 R 3.724(wu)-.25 G(nder)-3.724 E F1 -.1(Pa)3.724 G(tter).1 E 3.725 |
| (nM)-.15 G(atching)-3.725 E F0 6.225(.I)C 3.725(ft)-6.225 G 1.225 |
| (he shell)-3.725 F(option)144 232.8 Q F1(nocasematch)3.405 E F0 .904 |
| (is enabled, the match is performed without re)3.405 F -.05(ga)-.15 G |
| .904(rd to the case of alphabetic).05 F 2.751(characters. The)144 244.8 |
| R .251(return v)2.751 F .251(alue is 0 if the string matches \()-.25 F |
| F1(==)A F0 2.751(\)o)C 2.751(rd)-2.751 G .251(oes not match \()-2.751 F |
| F1(!=)A F0 2.751(\)t)C .252(he pattern, and)-2.751 F 2.5(1o)144 256.8 S |
| 2.5(therwise. An)-2.5 F 2.5(yp)-.15 G(art of the pattern may be quoted \ |
| to force it to be matched as a string.)-2.5 E .243 |
| (An additional binary operator)144 274.8 R(,)-.4 E F1(=~)2.743 E F0 |
| 2.743(,i)C 2.743(sa)-2.743 G -.25(va)-2.943 G .243 |
| (ilable, with the same precedence as).25 F F1(==)2.743 E F0(and)2.743 E |
| F1(!=)2.743 E F0 5.243(.W)C .243(hen it is)-5.243 F 1.953 |
| (used, the string to the right of the operator is considered an e)144 |
| 286.8 R 1.954(xtended re)-.15 F 1.954(gular e)-.15 F 1.954 |
| (xpression and)-.15 F .207(matched accordingly \(as in)144 298.8 R F2 |
| -.37(re)2.707 G -.1(ge)-.03 G(x)-.1 E F0 2.707(\(3\)\). The)B .207 |
| (return v)2.707 F .207 |
| (alue is 0 if the string matches the pattern, and 1)-.25 F 3.345 |
| (otherwise. If)144 310.8 R .845(the re)3.345 F .845(gular e)-.15 F .846 |
| (xpression is syntactically incorrect, the conditional e)-.15 F |
| (xpression')-.15 E 3.346(sr)-.55 G(eturn)-3.346 E -.25(va)144 322.8 S |
| .667(lue is 2.).25 F .667(If the shell option)5.667 F F1(nocasematch) |
| 3.167 E F0 .667(is enabled, the match is performed without re)3.167 F |
| -.05(ga)-.15 G .666(rd to).05 F .378(the case of alphabetic characters.) |
| 144 334.8 R(An)5.378 E 2.878(yp)-.15 G .378 |
| (art of the pattern may be quoted to force it to be matched)-2.878 F |
| .265(as a string.)144 346.8 R .265 |
| (Substrings matched by parenthesized sube)5.265 F .265 |
| (xpressions within the re)-.15 F .265(gular e)-.15 F .265(xpression are) |
| -.15 F(sa)144 358.8 Q -.15(ve)-.2 G 3.096(di).15 G 3.097(nt)-3.096 G |
| .597(he array v)-3.097 F(ariable)-.25 E F3 -.27(BA)3.097 G(SH_REMA).27 E |
| (TCH)-.855 E F4(.)A F0 .597(The element of)5.097 F F3 -.27(BA)3.097 G |
| (SH_REMA).27 E(TCH)-.855 E F0 .597(with inde)2.847 F 3.097(x0i)-.15 G(s) |
| -3.097 E .049(the portion of the string matching the entire re)144 370.8 |
| R .049(gular e)-.15 F 2.549(xpression. The)-.15 F .049(element of)2.549 |
| F F3 -.27(BA)2.549 G(SH_REMA).27 E(TCH)-.855 E F0(with inde)144 382.8 Q |
| (x)-.15 E F2(n)2.5 E F0(is the portion of the string matching the)2.5 E |
| F2(n)2.5 E F0(th parenthesized sube)A(xpression.)-.15 E .785 |
| (Expressions may be combined using the follo)144 400.8 R .786 |
| (wing operators, listed in decreasing order of prece-)-.25 F(dence:)144 |
| 412.8 Q F1(\()144 430.8 Q F2 -.2(ex)2.5 G(pr).2 E(ession)-.37 E F1(\)) |
| 2.5 E F0 .523(Returns the v)180 442.8 R .522(alue of)-.25 F F2 -.2(ex) |
| 3.022 G(pr).2 E(ession)-.37 E F0 5.522(.T)C .522(his may be used to o) |
| -5.522 F -.15(ve)-.15 G .522(rride the normal precedence of).15 F |
| (operators.)180 454.8 Q F1(!)144 466.8 Q F2 -.2(ex)2.5 G(pr).2 E(ession) |
| -.37 E F0 -.35(Tr)180 478.8 S(ue if).35 E F2 -.2(ex)2.5 G(pr).2 E |
| (ession)-.37 E F0(is f)2.74 E(alse.)-.1 E F2 -.2(ex)144 490.8 S(pr).2 E |
| (ession1)-.37 E F1(&&)2.5 E F2 -.2(ex)2.5 G(pr).2 E(ession2)-.37 E F0 |
| -.35(Tr)180 502.8 S(ue if both).35 E F2 -.2(ex)2.5 G(pr).2 E(ession1) |
| -.37 E F0(and)2.5 E F2 -.2(ex)2.5 G(pr).2 E(ession2)-.37 E F0(are true.) |
| 2.52 E F2 -.2(ex)144 514.8 S(pr).2 E(ession1)-.37 E/F5 10/Symbol SF |
| <efef>2.5 E F2 -.2(ex)2.5 G(pr).2 E(ession2)-.37 E F0 -.35(Tr)180 526.8 |
| S(ue if either).35 E F2 -.2(ex)2.5 G(pr).2 E(ession1)-.37 E F0(or)2.5 E |
| F2 -.2(ex)2.5 G(pr).2 E(ession2)-.37 E F0(is true.)2.52 E(The)144 543.6 |
| Q F1(&&)3.298 E F0(and)3.298 E F5<efef>3.298 E F0 .798 |
| (operators do not e)3.298 F -.25(va)-.25 G(luate).25 E F2 -.2(ex)3.298 G |
| (pr).2 E(ession2)-.37 E F0 .798(if the v)3.298 F .798(alue of)-.25 F F2 |
| -.2(ex)3.298 G(pr).2 E(ession1)-.37 E F0 .799(is suf)3.298 F .799 |
| (\214cient to)-.25 F(determine the return v)144 555.6 Q |
| (alue of the entire conditional e)-.25 E(xpression.)-.15 E F1 -.25(fo) |
| 108 572.4 S(r).25 E F2(name)2.5 E F0 2.5([[)2.5 G F1(in)A F0([)2.5 E F2 |
| (wor)2.5 E 2.5(d.)-.37 G(..)-2.5 E F0 2.5(]];])2.5 G F1(do)A F2(list)2.5 |
| E F0(;)2.5 E F1(done)2.5 E F0 .424(The list of w)144 584.4 R .424 |
| (ords follo)-.1 F(wing)-.25 E F1(in)2.924 E F0 .423(is e)2.924 F .423 |
| (xpanded, generating a list of items.)-.15 F .423(The v)5.423 F(ariable) |
| -.25 E F2(name)2.923 E F0 .423(is set to)2.923 F .653 |
| (each element of this list in turn, and)144 596.4 R F2(list)3.153 E F0 |
| .653(is e)3.153 F -.15(xe)-.15 G .653(cuted each time.).15 F .653 |
| (If the)5.653 F F1(in)3.153 E F2(wor)3.153 E(d)-.37 E F0 .653 |
| (is omitted, the)3.153 F F1 -.25(fo)3.153 G(r).25 E F0 .649(command e) |
| 144 608.4 R -.15(xe)-.15 G(cutes).15 E F2(list)3.149 E F0 .648 |
| (once for each positional parameter that is set \(see)3.148 F F3 -.666 |
| (PA)3.148 G(RAMETERS).666 E F0(belo)2.898 E(w\).)-.25 E .153 |
| (The return status is the e)144 620.4 R .153 |
| (xit status of the last command that e)-.15 F -.15(xe)-.15 G 2.654 |
| (cutes. If).15 F .154(the e)2.654 F .154(xpansion of the items)-.15 F |
| (follo)144 632.4 Q(wing)-.25 E F1(in)2.5 E F0 |
| (results in an empty list, no commands are e)2.5 E -.15(xe)-.15 G |
| (cuted, and the return status is 0.).15 E F1 -.25(fo)108 649.2 S(r).25 E |
| F0(\(\()2.5 E F2 -.2(ex)2.5 G(pr1).2 E F0(;)2.5 E F2 -.2(ex)2.5 G(pr2).2 |
| E F0(;)2.5 E F2 -.2(ex)2.5 G(pr3).2 E F0(\)\) ;)2.5 E F1(do)2.5 E F2 |
| (list)2.5 E F0(;)2.5 E F1(done)2.5 E F0 1.236(First, the arithmetic e) |
| 144 661.2 R(xpression)-.15 E F2 -.2(ex)3.736 G(pr1).2 E F0 1.235(is e) |
| 3.736 F -.25(va)-.25 G 1.235 |
| (luated according to the rules described belo).25 F 3.735(wu)-.25 G |
| (nder)-3.735 E F3 .561(ARITHMETIC EV)144 673.2 R(ALU)-1.215 E -.855(AT) |
| -.54 G(ION).855 E F4(.)A F0 .561(The arithmetic e)5.061 F(xpression)-.15 |
| E F2 -.2(ex)3.061 G(pr2).2 E F0 .562(is then e)3.062 F -.25(va)-.25 G |
| .562(luated repeatedly until).25 F .592(it e)144 685.2 R -.25(va)-.25 G |
| .592(luates to zero.).25 F .592(Each time)5.592 F F2 -.2(ex)3.092 G(pr2) |
| .2 E F0 -.25(eva)3.092 G .592(luates to a non-zero v).25 F(alue,)-.25 E |
| F2(list)3.092 E F0 .591(is e)3.092 F -.15(xe)-.15 G .591 |
| (cuted and the arith-).15 F .228(metic e)144 697.2 R(xpression)-.15 E F2 |
| -.2(ex)2.728 G(pr3).2 E F0 .229(is e)2.728 F -.25(va)-.25 G 2.729 |
| (luated. If).25 F(an)2.729 E 2.729(ye)-.15 G .229 |
| (xpression is omitted, it beha)-2.879 F -.15(ve)-.2 G 2.729(sa).15 G |
| 2.729(si)-2.729 G 2.729(fi)-2.729 G 2.729(te)-2.729 G -.25(va)-2.979 G |
| .229(luates to 1.).25 F .228(The return v)144 709.2 R .228 |
| (alue is the e)-.25 F .228(xit status of the last command in)-.15 F F2 |
| (list)2.728 E F0 .227(that is e)2.728 F -.15(xe)-.15 G .227(cuted, or f) |
| .15 F .227(alse if an)-.1 F 2.727(yo)-.15 G 2.727(ft)-2.727 G(he)-2.727 |
| E -.15(ex)144 721.2 S(pressions is in).15 E -.25(va)-.4 G(lid.).25 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(5)190.955 E 0 Cg EP |
| %%Page: 6 6 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(select)108 84 Q/F2 10/Times-Italic@0 SF |
| (name)2.5 E F0([)2.5 E F1(in)2.5 E F2(wor)2.5 E(d)-.37 E F0 2.5(];)2.5 G |
| F1(do)A F2(list)2.5 E F0(;)2.5 E F1(done)2.5 E F0 .432(The list of w)144 |
| 96 R .432(ords follo)-.1 F(wing)-.25 E F1(in)2.932 E F0 .432(is e)2.932 |
| F .432(xpanded, generating a list of items.)-.15 F .433(The set of e) |
| 5.433 F .433(xpanded w)-.15 F(ords)-.1 E .843 |
| (is printed on the standard error)144 108 R 3.342(,e)-.4 G .842 |
| (ach preceded by a number)-3.342 F 5.842(.I)-.55 G 3.342(ft)-5.842 G(he) |
| -3.342 E F1(in)3.342 E F2(wor)3.342 E(d)-.37 E F0 .842 |
| (is omitted, the posi-)3.342 F .201(tional parameters are printed \(see) |
| 144 120 R/F3 9/Times-Bold@0 SF -.666(PA)2.701 G(RAMETERS).666 E F0(belo) |
| 2.451 E 2.701(w\). The)-.25 F F3(PS3)2.701 E F0 .201 |
| (prompt is then displayed and a)2.451 F .214 |
| (line read from the standard input.)144 132 R .213 |
| (If the line consists of a number corresponding to one of the dis-)5.214 |
| F 1.537(played w)144 144 R 1.537(ords, then the v)-.1 F 1.537(alue of) |
| -.25 F F2(name)4.397 E F0 1.537(is set to that w)4.217 F 4.037(ord. If) |
| -.1 F 1.538(the line is empty)4.038 F 4.038(,t)-.65 G 1.538(he w)-4.038 |
| F 1.538(ords and)-.1 F .066(prompt are displayed ag)144 156 R 2.566 |
| (ain. If)-.05 F .065(EOF is read, the command completes.)2.566 F(An) |
| 5.065 E 2.565(yo)-.15 G .065(ther v)-2.565 F .065(alue read causes)-.25 |
| F F2(name)144 168 Q F0 .972(to be set to null.)3.652 F .972 |
| (The line read is sa)5.972 F -.15(ve)-.2 G 3.473(di).15 G 3.473(nt) |
| -3.473 G .973(he v)-3.473 F(ariable)-.25 E F3(REPL)3.473 E(Y)-.828 E/F4 |
| 9/Times-Roman@0 SF(.)A F0(The)5.473 E F2(list)3.563 E F0 .973(is e)4.153 |
| F -.15(xe)-.15 G .973(cuted after).15 F .072(each selection until a)144 |
| 180 R F1(br)2.571 E(eak)-.18 E F0 .071(command is e)2.571 F -.15(xe)-.15 |
| G 2.571(cuted. The).15 F -.15(ex)2.571 G .071(it status of).15 F F1 |
| (select)2.571 E F0 .071(is the e)2.571 F .071(xit status of the)-.15 F |
| (last command e)144 192 Q -.15(xe)-.15 G(cuted in).15 E F2(list)2.5 E F0 |
| 2.5(,o).68 G 2.5(rz)-2.5 G(ero if no commands were e)-2.5 E -.15(xe)-.15 |
| G(cuted.).15 E F1(case)108 208.8 Q F2(wor)2.5 E(d)-.37 E F1(in)2.5 E F0 |
| 2.5([[)2.5 G(\(])-2.5 E F2(pattern)2.5 E F0([)2.5 E F1(|)2.5 E F2 |
| (pattern)2.5 E F0 2.5(].)2.5 G(.. \))-2.5 E F2(list)2.5 E F0(;; ] ...) |
| 2.5 E F1(esac)2.5 E F0(A)144 220.8 Q F1(case)3.264 E F0 .764 |
| (command \214rst e)3.264 F(xpands)-.15 E F2(wor)3.264 E(d)-.37 E F0 |
| 3.264(,a)C .764(nd tries to match it ag)-3.264 F .764(ainst each)-.05 F |
| F2(pattern)3.264 E F0 .765(in turn, using the)3.264 F .596 |
| (same matching rules as for pathname e)144 232.8 R .595(xpansion \(see) |
| -.15 F F1 -.1(Pa)3.095 G .595(thname Expansion).1 F F0(belo)3.095 E |
| 3.095(w\). The)-.25 F F2(wor)3.095 E(d)-.37 E F0(is)3.095 E -.15(ex)144 |
| 244.8 S 1.092(panded using tilde e).15 F 1.092 |
| (xpansion, parameter and v)-.15 F 1.092(ariable e)-.25 F 1.092 |
| (xpansion, arithmetic substitution, com-)-.15 F 1.268 |
| (mand substitution, process substitution and quote remo)144 256.8 R -.25 |
| (va)-.15 G 3.768(l. Each).25 F F2(pattern)3.768 E F0 -.15(ex)3.768 G |
| 1.268(amined is e).15 F(xpanded)-.15 E .353(using tilde e)144 268.8 R |
| .353(xpansion, parameter and v)-.15 F .353(ariable e)-.25 F .353 |
| (xpansion, arithmetic substitution, command substi-)-.15 F 1.517 |
| (tution, and process substitution.)144 280.8 R 1.517 |
| (If the shell option)6.517 F F1(nocasematch)4.016 E F0 1.516 |
| (is enabled, the match is per)4.016 F(-)-.2 E 1.346(formed without re) |
| 144 292.8 R -.05(ga)-.15 G 1.346 |
| (rd to the case of alphabetic characters.).05 F 1.347 |
| (When a match is found, the corre-)6.347 F(sponding)144 304.8 Q F2(list) |
| 2.777 E F0 .277(is e)2.777 F -.15(xe)-.15 G 2.777(cuted. If).15 F(the) |
| 2.777 E F1(;;)2.777 E F0 .277 |
| (operator is used, no subsequent matches are attempted after the)2.777 F |
| .848(\214rst pattern match.)144 316.8 R(Using)5.848 E F1(;&)3.348 E F0 |
| .849(in place of)3.349 F F1(;;)3.349 E F0 .849(causes e)3.349 F -.15(xe) |
| -.15 G .849(cution to continue with the).15 F F2(list)3.349 E F0 |
| (associated)3.349 E .078(with the ne)144 328.8 R .078 |
| (xt set of patterns.)-.15 F(Using)5.078 E F1(;;&)2.578 E F0 .078 |
| (in place of)2.578 F F1(;;)2.578 E F0 .077 |
| (causes the shell to test the ne)2.578 F .077(xt pattern list in)-.15 F |
| .227(the statement, if an)144 340.8 R 1.527 -.65(y, a)-.15 H .227(nd e) |
| .65 F -.15(xe)-.15 G .227(cute an).15 F 2.727(ya)-.15 G(ssociated)-2.727 |
| E F2(list)2.727 E F0 .227(on a successful match.)2.727 F .227(The e) |
| 5.227 F .227(xit status is zero)-.15 F(if no pattern matches.)144 352.8 |
| Q(Otherwise, it is the e)5 E(xit status of the last command e)-.15 E |
| -.15(xe)-.15 G(cuted in).15 E F2(list)2.5 E F0(.)A F1(if)108 369.6 Q F2 |
| (list)2.5 E F0(;)A F1(then)2.5 E F2(list;)2.5 E F0([)2.5 E F1(elif)2.5 E |
| F2(list)2.5 E F0(;)A F1(then)2.5 E F2(list)2.5 E F0 2.5(;].)C(.. [)-2.5 |
| E F1(else)2.5 E F2(list)2.5 E F0 2.5(;])C F1<8c>A F0(The)144 381.6 Q F1 |
| (if)2.978 E F2(list)3.068 E F0 .478(is e)3.658 F -.15(xe)-.15 G 2.978 |
| (cuted. If).15 F .478(its e)2.978 F .478(xit status is zero, the)-.15 F |
| F1(then)2.978 E F2(list)2.978 E F0 .478(is e)2.978 F -.15(xe)-.15 G |
| 2.978(cuted. Otherwise,).15 F(each)2.978 E F1(elif)2.977 E F2(list)2.977 |
| E F0 1.087(is e)144 393.6 R -.15(xe)-.15 G 1.087 |
| (cuted in turn, and if its e).15 F 1.087 |
| (xit status is zero, the corresponding)-.15 F F1(then)3.587 E F2(list) |
| 3.587 E F0 1.088(is e)3.588 F -.15(xe)-.15 G 1.088(cuted and the).15 F |
| .104(command completes.)144 405.6 R .103(Otherwise, the)5.104 F F1(else) |
| 2.603 E F2(list)2.603 E F0 .103(is e)2.603 F -.15(xe)-.15 G .103 |
| (cuted, if present.).15 F .103(The e)5.103 F .103(xit status is the e) |
| -.15 F .103(xit sta-)-.15 F(tus of the last command e)144 417.6 Q -.15 |
| (xe)-.15 G(cuted, or zero if no condition tested true.).15 E F1(while) |
| 108 434.4 Q F2(list)2.5 E F0(;)A F1(do)2.5 E F2(list)2.5 E F0(;)A F1 |
| (done)2.5 E(until)108 446.4 Q F2(list)2.5 E F0(;)A F1(do)2.5 E F2(list) |
| 2.5 E F0(;)A F1(done)2.5 E F0(The)144 458.4 Q F1(while)3.103 E F0 .603 |
| (command continuously e)3.103 F -.15(xe)-.15 G .603(cutes the).15 F F1 |
| (do)3.103 E F2(list)3.103 E F0 .603(as long as the last command in)3.103 |
| F F2(list)3.104 E F0(returns)3.104 E .471(an e)144 470.4 R .471 |
| (xit status of zero.)-.15 F(The)5.471 E F1(until)2.971 E F0 .471 |
| (command is identical to the)2.971 F F1(while)2.97 E F0 .47(command, e) |
| 2.97 F .47(xcept that the test)-.15 F .095(is ne)144 482.4 R -.05(ga) |
| -.15 G .095(ted; the).05 F F1(do)2.595 E F2(list)2.685 E F0 .095(is e) |
| 3.275 F -.15(xe)-.15 G .095(cuted as long as the last command in).15 F |
| F2(list)2.685 E F0 .096(returns a non-zero e)3.276 F .096(xit status.) |
| -.15 F 1.307(The e)144 494.4 R 1.307(xit status of the)-.15 F F1(while) |
| 3.807 E F0(and)3.807 E F1(until)3.807 E F0 1.307(commands is the e)3.807 |
| F 1.306(xit status of the last)-.15 F F1(do)3.806 E F2(list)3.806 E F0 |
| (command)3.806 E -.15(exe)144 506.4 S(cuted, or zero if none w).15 E |
| (as e)-.1 E -.15(xe)-.15 G(cuted.).15 E F1(Copr)87 523.2 Q(ocesses)-.18 |
| E F0(A)108 535.2 Q F2(copr)3.712 E(ocess)-.45 E F0 1.212 |
| (is a shell command preceded by the)3.712 F F1(copr)3.713 E(oc)-.18 E F0 |
| (reserv)3.713 E 1.213(ed w)-.15 F 3.713(ord. A)-.1 F 1.213 |
| (coprocess is e)3.713 F -.15(xe)-.15 G 1.213(cuted asyn-).15 F .575(chr\ |
| onously in a subshell, as if the command had been terminated with the) |
| 108 547.2 R F1(&)3.074 E F0 .574(control operator)3.074 F 3.074(,w)-.4 G |
| .574(ith a tw)-3.074 F(o-)-.1 E -.1(wa)108 559.2 S 2.5(yp).1 G |
| (ipe established between the e)-2.5 E -.15(xe)-.15 G |
| (cuting shell and the coprocess.).15 E(The format for a coprocess is:) |
| 108 576 Q F1(copr)144 592.8 Q(oc)-.18 E F0([)2.5 E F2 -.27(NA)C(ME).27 E |
| F0(])A F2(command)2.5 E F0([)2.5 E F2 -.37(re)C(dir).37 E(ections)-.37 E |
| F0(])A .922(This creates a coprocess named)108 609.6 R F2 -.27(NA)3.422 |
| G(ME).27 E F0 5.922(.I)C(f)-5.922 E F2 -.27(NA)3.422 G(ME).27 E F0 .923 |
| (is not supplied, the def)3.422 F .923(ault name is)-.1 F F2(COPR)3.423 |
| E(OC)-.4 E F0(.)A F2 -.27(NA)5.923 G(ME).27 E F0 .64 |
| (must not be supplied if)108 621.6 R F2(command)3.14 E F0 .64(is a)3.14 |
| F F2 .64(simple command)3.14 F F0 .64(\(see abo)3.14 F -.15(ve)-.15 G |
| .64(\); otherwise, it is interpreted as the \214rst).15 F -.1(wo)108 |
| 633.6 S .163(rd of the simple command.).1 F .163(When the coproc is e) |
| 5.163 F -.15(xe)-.15 G .163(cuted, the shell creates an array v).15 F |
| .163(ariable \(see)-.25 F F1(Arrays)2.663 E F0(belo)108 645.6 Q .512 |
| (w\) named)-.25 F F2 -.27(NA)3.012 G(ME).27 E F0 .512(in the conte)3.012 |
| F .511(xt of the e)-.15 F -.15(xe)-.15 G .511(cuting shell.).15 F .511 |
| (The standard output of)5.511 F F2(command)3.211 E F0 .511(is connected) |
| 3.781 F .81(via a pipe to a \214le descriptor in the e)108 657.6 R -.15 |
| (xe)-.15 G .811(cuting shell, and that \214le descriptor is assigned to) |
| .15 F F2 -.27(NA)3.311 G(ME).27 E F0 3.311([0]. The)B .717 |
| (standard input of)108 669.6 R F2(command)3.417 E F0 .716 |
| (is connected via a pipe to a \214le descriptor in the e)3.987 F -.15 |
| (xe)-.15 G .716(cuting shell, and that \214le).15 F .702 |
| (descriptor is assigned to)108 681.6 R F2 -.27(NA)3.202 G(ME).27 E F0 |
| 3.202([1]. This)B .703(pipe is established before an)3.203 F 3.203(yr) |
| -.15 G .703(edirections speci\214ed by the com-)-3.203 F 1.184 |
| (mand \(see)108 693.6 R F3(REDIRECTION)3.684 E F0(belo)3.434 E 3.684 |
| (w\). The)-.25 F 1.183(\214le descriptors can be utilized as ar)3.684 F |
| 1.183(guments to shell commands)-.18 F .07 |
| (and redirections using standard w)108 705.6 R .07(ord e)-.1 F 2.57 |
| (xpansions. The)-.15 F .07(process id of the shell spa)2.57 F .07 |
| (wned to e)-.15 F -.15(xe)-.15 G .07(cute the copro-).15 F .632 |
| (cess is a)108 717.6 R -.25(va)-.2 G .631(ilable as the v).25 F .631 |
| (alue of the v)-.25 F(ariable)-.25 E F2 -.27(NA)3.131 G(ME).27 E F0 |
| 3.131(_PID. The)B F1(wait)3.131 E F0 -.2(bu)3.131 G .631 |
| (iltin command may be used to w).2 F(ait)-.1 E |
| (for the coprocess to terminate.)108 729.6 Q(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(6)190.955 E 0 Cg EP |
| %%Page: 7 7 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(The return status of a coprocess is the e)108 84 Q(xit status of) |
| -.15 E/F1 10/Times-Italic@0 SF(command)2.5 E F0(.)A/F2 10/Times-Bold@0 |
| SF(Shell Function De\214nitions)87 100.8 Q F0 2.697(As)108 112.8 S .198 |
| (hell function is an object that is called lik)-2.697 F 2.698(eas)-.1 G |
| .198(imple command and e)-2.698 F -.15(xe)-.15 G .198 |
| (cutes a compound command with).15 F 2.5(an)108 124.8 S .5 -.25(ew s) |
| -2.5 H(et of positional parameters.).25 E |
| (Shell functions are declared as follo)5 E(ws:)-.25 E([)108 141.6 Q F2 |
| (function)2.5 E F0(])2.5 E F1(name)2.5 E F0(\(\))2.5 E F1 |
| (compound\255command)2.5 E F0([)2.5 E F1 -.37(re)C(dir).37 E(ection)-.37 |
| E F0(])A 1.403(This de\214nes a function named)144 153.6 R F1(name)3.902 |
| E F0 6.402(.T)C 1.402(he reserv)-6.402 F 1.402(ed w)-.15 F(ord)-.1 E F2 |
| (function)3.902 E F0 1.402(is optional.)3.902 F 1.402(If the)6.402 F F2 |
| (function)3.902 E F0(reserv)144 165.6 Q .162(ed w)-.15 F .162 |
| (ord is supplied, the parentheses are optional.)-.1 F(The)5.162 E F1 |
| (body)2.662 E F0 .162(of the function is the compound)2.662 F(command) |
| 144 177.6 Q F1(compound\255command)2.784 E F0(\(see)3.354 E F2 .084 |
| (Compound Commands)2.584 F F0(abo)2.584 E -.15(ve)-.15 G 2.584(\). That) |
| .15 F .084(command is usually a)2.584 F F1(list)144 189.6 Q F0 .044 |
| (of commands between { and }, b)2.544 F .044(ut may be an)-.2 F 2.544 |
| (yc)-.15 G .044(ommand listed under)-2.544 F F2 .044(Compound Commands) |
| 2.544 F F0(abo)144 201.6 Q -.15(ve)-.15 G(.).15 E F1 |
| (compound\255command)6.671 E F0 1.671(is e)4.171 F -.15(xe)-.15 G 1.671 |
| (cuted whene).15 F -.15(ve)-.25 G(r).15 E F1(name)4.171 E F0 1.671 |
| (is speci\214ed as the name of a simple)4.171 F 3.008(command. An)144 |
| 213.6 R 3.009(yr)-.15 G .509(edirections \(see)-3.009 F/F3 9 |
| /Times-Bold@0 SF(REDIRECTION)3.009 E F0(belo)2.759 E .509 |
| (w\) speci\214ed when a function is de\214ned are)-.25 F .581 |
| (performed when the function is e)144 225.6 R -.15(xe)-.15 G 3.081 |
| (cuted. The).15 F -.15(ex)3.081 G .58 |
| (it status of a function de\214nition is zero unless a).15 F .177(synta\ |
| x error occurs or a readonly function with the same name already e)144 |
| 237.6 R 2.678(xists. When)-.15 F -.15(exe)2.678 G .178(cuted, the).15 F |
| -.15(ex)144 249.6 S .64(it status of a function is the e).15 F .64 |
| (xit status of the last command e)-.15 F -.15(xe)-.15 G .64 |
| (cuted in the body).15 F 5.64(.\()-.65 G(See)-5.64 E F3(FUNC-)3.14 E |
| (TIONS)144 261.6 Q F0(belo)2.25 E -.65(w.)-.25 G(\)).65 E/F4 10.95 |
| /Times-Bold@0 SF(COMMENTS)72 278.4 Q F0 .982(In a non-interacti)108 |
| 290.4 R 1.282 -.15(ve s)-.25 H .982(hell, or an interacti).15 F 1.282 |
| -.15(ve s)-.25 H .982(hell in which the).15 F F2(interacti)3.482 E -.1 |
| (ve)-.1 G(_comments).1 E F0 .982(option to the)3.482 F F2(shopt)3.482 E |
| F0 -.2(bu)108 302.4 S .952(iltin is enabled \(see).2 F F3 .952(SHELL B) |
| 3.452 F(UIL)-.09 E .952(TIN COMMANDS)-.828 F F0(belo)3.202 E .952 |
| (w\), a w)-.25 F .952(ord be)-.1 F .952(ginning with)-.15 F F2(#)3.451 E |
| F0 .951(causes that w)3.451 F(ord)-.1 E .604 |
| (and all remaining characters on that line to be ignored.)108 314.4 R |
| .605(An interacti)5.605 F .905 -.15(ve s)-.25 H .605(hell without the) |
| .15 F F2(interacti)3.105 E -.1(ve)-.1 G(_com-).1 E(ments)108 326.4 Q F0 |
| 1.337(option enabled does not allo)3.837 F 3.837(wc)-.25 G 3.836 |
| (omments. The)-3.837 F F2(interacti)3.836 E -.1(ve)-.1 G(_comments).1 E |
| F0 1.336(option is on by def)3.836 F 1.336(ault in)-.1 F(interacti)108 |
| 338.4 Q .3 -.15(ve s)-.25 H(hells.).15 E F4 -.11(QU)72 355.2 S -.438(OT) |
| .11 G(ING).438 E F1(Quoting)108 367.2 Q F0 .477(is used to remo)2.977 F |
| .777 -.15(ve t)-.15 H .477 |
| (he special meaning of certain characters or w).15 F .477 |
| (ords to the shell.)-.1 F .478(Quoting can be)5.478 F .185 |
| (used to disable special treatment for special characters, to pre)108 |
| 379.2 R -.15(ve)-.25 G .185(nt reserv).15 F .184(ed w)-.15 F .184 |
| (ords from being recognized as)-.1 F(such, and to pre)108 391.2 Q -.15 |
| (ve)-.25 G(nt parameter e).15 E(xpansion.)-.15 E .288(Each of the)108 |
| 408 R F1(metac)2.788 E(har)-.15 E(acter)-.15 E(s)-.1 E F0 .288 |
| (listed abo)2.788 F .588 -.15(ve u)-.15 H(nder).15 E F3(DEFINITIONS) |
| 2.788 E F0 .288(has special meaning to the shell and must be)2.538 F |
| (quoted if it is to represent itself.)108 420 Q 1.345 |
| (When the command history e)108 436.8 R 1.344(xpansion f)-.15 F 1.344 |
| (acilities are being used \(see)-.1 F F3(HIST)3.844 E(OR)-.162 E 3.594 |
| (YE)-.315 G(XP)-3.594 E(ANSION)-.666 E F0(belo)3.594 E 1.344(w\), the) |
| -.25 F F1(history e)108 448.8 Q(xpansion)-.2 E F0(character)2.5 E 2.5 |
| (,u)-.4 G(sually)-2.5 E F2(!)2.5 E F0 2.5(,m)C(ust be quoted to pre)-2.5 |
| E -.15(ve)-.25 G(nt history e).15 E(xpansion.)-.15 E |
| (There are three quoting mechanisms: the)108 465.6 Q F1(escape c)2.5 E |
| (har)-.15 E(acter)-.15 E F0 2.5(,s).73 G |
| (ingle quotes, and double quotes.)-2.5 E 2.974(An)108 482.4 S .474 |
| (on-quoted backslash \()-2.974 F F2(\\)A F0 2.974(\)i)C 2.974(st)-2.974 |
| G(he)-2.974 E F1 .474(escape c)2.974 F(har)-.15 E(acter)-.15 E F0 5.474 |
| (.I).73 G 2.974(tp)-5.474 G(reserv)-2.974 E .474(es the literal v)-.15 F |
| .474(alue of the ne)-.25 F .475(xt character that)-.15 F(follo)108 494.4 |
| Q 1.554(ws, with the e)-.25 F 1.553(xception of <ne)-.15 F 4.053 |
| (wline>. If)-.25 F(a)4.053 E F2(\\)4.053 E F0(<ne)A 1.553 |
| (wline> pair appears, and the backslash is not itself)-.25 F 1.122 |
| (quoted, the)108 506.4 R F2(\\)3.622 E F0(<ne)A 1.122 |
| (wline> is treated as a line continuation \(that is, it is remo)-.25 F |
| -.15(ve)-.15 G 3.622(df).15 G 1.123(rom the input stream and)-3.622 F |
| (ef)108 518.4 Q(fecti)-.25 E -.15(ve)-.25 G(ly ignored\).).15 E .295 |
| (Enclosing characters in single quotes preserv)108 535.2 R .295 |
| (es the literal v)-.15 F .295(alue of each character within the quotes.) |
| -.25 F 2.795(As)5.295 G(in-)-2.795 E |
| (gle quote may not occur between single quotes, e)108 547.2 Q -.15(ve) |
| -.25 G 2.5(nw).15 G(hen preceded by a backslash.)-2.5 E .033 |
| (Enclosing characters in double quotes preserv)108 564 R .034 |
| (es the literal v)-.15 F .034 |
| (alue of all characters within the quotes, with the)-.25 F -.15(ex)108 |
| 576 S .828(ception of).15 F F2($)3.328 E F0(,)A F2<92>3.328 E F0(,)A F2 |
| (\\)3.328 E F0 3.328(,a)C .828(nd, when history e)-3.328 F .828 |
| (xpansion is enabled,)-.15 F F2(!)3.328 E F0 5.828(.T)C .828 |
| (he characters)-5.828 F F2($)3.328 E F0(and)3.328 E F2<92>3.328 E F0 |
| .827(retain their special)3.328 F .074(meaning within double quotes.)108 |
| 588 R .074(The backslash retains its special meaning only when follo) |
| 5.074 F .075(wed by one of the)-.25 F(follo)108 600 Q .205 |
| (wing characters:)-.25 F F2($)2.705 E F0(,)A F2<92>2.705 E F0(,)A F2(") |
| 3.538 E F0(,).833 E F2(\\)2.705 E F0 2.705(,o)C(r)-2.705 E F2(<newline>) |
| 2.705 E F0 5.205(.A)C .204 |
| (double quote may be quoted within double quotes by pre-)-2.5 F .081 |
| (ceding it with a backslash.)108 612 R .082(If enabled, history e)5.082 |
| F .082(xpansion will be performed unless an)-.15 F F2(!)2.582 E F0 .082 |
| (appearing in double)5.082 F(quotes is escaped using a backslash.)108 |
| 624 Q(The backslash preceding the)5 E F2(!)2.5 E F0(is not remo)5 E -.15 |
| (ve)-.15 G(d.).15 E(The special parameters)108 640.8 Q F2(*)2.5 E F0 |
| (and)2.5 E F2(@)2.5 E F0(ha)2.5 E .3 -.15(ve s)-.2 H |
| (pecial meaning when in double quotes \(see).15 E F3 -.666(PA)2.5 G |
| (RAMETERS).666 E F0(belo)2.25 E(w\).)-.25 E -.8(Wo)108 657.6 S .212 |
| (rds of the form).8 F F2($)2.712 E F0<08>A F1(string)A F0 2.712<0861>C |
| .211(re treated specially)-2.712 F 5.211(.T)-.65 G .211(he w)-5.211 F |
| .211(ord e)-.1 F .211(xpands to)-.15 F F1(string)2.711 E F0 2.711(,w)C |
| .211(ith backslash-escaped char)-2.711 F(-)-.2 E .604 |
| (acters replaced as speci\214ed by the ANSI C standard.)108 669.6 R .605 |
| (Backslash escape sequences, if present, are decoded)5.605 F(as follo) |
| 108 681.6 Q(ws:)-.25 E F2(\\a)144 693.6 Q F0(alert \(bell\))28.22 E F2 |
| (\\b)144 705.6 Q F0(backspace)27.66 E F2(\\e)144 717.6 Q F0 |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(7)190.955 E 0 Cg EP |
| %%Page: 8 8 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(\\E)144 84 Q F0(an escape character)26.55 E |
| F1(\\f)144 96 Q F0(form feed)29.89 E F1(\\n)144 108 Q F0(ne)27.66 E 2.5 |
| (wl)-.25 G(ine)-2.5 E F1(\\r)144 120 Q F0(carriage return)28.78 E F1 |
| (\\t)144 132 Q F0(horizontal tab)29.89 E F1(\\v)144 144 Q F0 -.15(ve) |
| 28.22 G(rtical tab).15 E F1(\\\\)144 156 Q F0(backslash)30.44 E F1<5c08> |
| 144 168 Q F0(single quote)30.44 E F1(\\")144 180 Q F0(double quote)27.67 |
| E F1(\\)144 192 Q/F2 10/Times-Italic@0 SF(nnn)A F0 |
| (the eight-bit character whose v)18.22 E(alue is the octal v)-.25 E |
| (alue)-.25 E F2(nnn)2.5 E F0(\(one to three digits\))2.5 E F1(\\x)144 |
| 204 Q F2(HH)A F0(the eight-bit character whose v)13.78 E(alue is the he) |
| -.25 E(xadecimal v)-.15 E(alue)-.25 E F2(HH)2.5 E F0(\(one or tw)2.5 E |
| 2.5(oh)-.1 G .3 -.15(ex d)-2.5 H(igits\)).15 E F1(\\c)144 216 Q F2(x)A |
| F0 2.5(ac)24.34 G(ontrol-)-2.5 E F2(x)A F0(character)2.5 E(The e)108 |
| 232.8 Q(xpanded result is single-quoted, as if the dollar sign had not \ |
| been present.)-.15 E 2.64(Ad)108 249.6 S .14 |
| (ouble-quoted string preceded by a dollar sign \()-2.64 F F1($)A F0(")A |
| F2(string)A F0 .14("\) will cause the string to be translated according) |
| B .495(to the current locale.)108 261.6 R .495(If the current locale is) |
| 5.495 F F1(C)2.995 E F0(or)2.995 E F1(POSIX)2.995 E F0 2.995(,t)C .495 |
| (he dollar sign is ignored.)-2.995 F .496(If the string is trans-)5.496 |
| F(lated and replaced, the replacement is double-quoted.)108 273.6 Q/F3 |
| 10.95/Times-Bold@0 SF -.81(PA)72 290.4 S(RAMETERS).81 E F0(A)108 302.4 Q |
| F2(par)4.593 E(ameter)-.15 E F0 .843(is an entity that stores v)4.073 F |
| 3.343(alues. It)-.25 F .843(can be a)3.343 F F2(name)3.342 E F0 3.342 |
| (,an).18 G(umber)-3.342 E 3.342(,o)-.4 G 3.342(ro)-3.342 G .842 |
| (ne of the special characters)-3.342 F .822(listed belo)108 314.4 R |
| 3.323(wu)-.25 G(nder)-3.323 E F1 .823(Special P)3.323 F(arameters)-.1 E |
| F0 5.823(.A)C F2(variable)-2.21 E F0 .823(is a parameter denoted by a) |
| 3.503 F F2(name)3.323 E F0 5.823(.A).18 G -.25(va)-2.5 G .823 |
| (riable has a).25 F F2(value)108 326.4 Q F0 .369(and zero or more)2.869 |
| F F2(attrib)2.869 E(utes)-.2 E F0 5.369(.A)C(ttrib)-5.369 E .369 |
| (utes are assigned using the)-.2 F F1(declar)2.868 E(e)-.18 E F0 -.2(bu) |
| 2.868 G .368(iltin command \(see).2 F F1(declar)2.868 E(e)-.18 E F0 |
| (belo)108 338.4 Q 2.5(wi)-.25 G(n)-2.5 E/F4 9/Times-Bold@0 SF(SHELL B) |
| 2.5 E(UIL)-.09 E(TIN COMMANDS)-.828 E/F5 9/Times-Roman@0 SF(\).)A F0 |
| 2.754(Ap)108 355.2 S .254(arameter is set if it has been assigned a v) |
| -2.754 F 2.754(alue. The)-.25 F .254(null string is a v)2.754 F .255 |
| (alid v)-.25 F 2.755(alue. Once)-.25 F 2.755(av)2.755 G .255 |
| (ariable is set, it)-3.005 F(may be unset only by using the)108 367.2 Q |
| F1(unset)2.5 E F0 -.2(bu)2.5 G(iltin command \(see).2 E F4(SHELL B)2.5 E |
| (UIL)-.09 E(TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).)-.25 E(A)108 384 Q |
| F2(variable)2.79 E F0(may be assigned to by a statement of the form)2.68 |
| E F2(name)144 400.8 Q F0(=[)A F2(value)A F0(])A(If)108 417.6 Q F2(value) |
| 3.023 E F0 .233(is not gi)2.913 F -.15(ve)-.25 G .233(n, the v).15 F |
| .232(ariable is assigned the null string.)-.25 F(All)5.232 E F2(values) |
| 3.022 E F0(under)3.002 E .232(go tilde e)-.18 F .232 |
| (xpansion, parameter)-.15 F .515(and v)108 429.6 R .515(ariable e)-.25 F |
| .515(xpansion, command substitution, arithmetic e)-.15 F .515 |
| (xpansion, and quote remo)-.15 F -.25(va)-.15 G 3.015(l\().25 G(see) |
| -3.015 E F4(EXP)3.015 E(ANSION)-.666 E F0(belo)108 441.6 Q 2.699 |
| (w\). If)-.25 F .199(the v)2.699 F .199(ariable has its)-.25 F F1 |
| (integer)2.698 E F0(attrib)2.698 E .198(ute set, then)-.2 F F2(value) |
| 2.988 E F0 .198(is e)2.878 F -.25(va)-.25 G .198 |
| (luated as an arithmetic e).25 F .198(xpression e)-.15 F -.15(ve)-.25 G |
| (n).15 E .901(if the $\(\(...\)\) e)108 453.6 R .901 |
| (xpansion is not used \(see)-.15 F F1 .901(Arithmetic Expansion)3.401 F |
| F0(belo)3.401 E 3.402(w\). W)-.25 F .902 |
| (ord splitting is not performed,)-.8 F 1.179(with the e)108 465.6 R |
| 1.179(xception of)-.15 F F1("$@")3.679 E F0 1.179(as e)3.679 F 1.179 |
| (xplained belo)-.15 F 3.679(wu)-.25 G(nder)-3.679 E F1 1.178(Special P) |
| 3.678 F(arameters)-.1 E F0 6.178(.P)C 1.178(athname e)-6.328 F 1.178 |
| (xpansion is not)-.15 F 3.648(performed. Assignment)108 477.6 R 1.148 |
| (statements may also appear as ar)3.648 F 1.149(guments to the)-.18 F F1 |
| (alias)3.649 E F0(,)A F1(declar)3.649 E(e)-.18 E F0(,)A F1(typeset)3.649 |
| E F0(,)A F1(export)3.649 E F0(,)A F1 -.18(re)108 489.6 S(adonly).18 E F0 |
| 2.5(,a)C(nd)-2.5 E F1(local)2.5 E F0 -.2(bu)2.5 G(iltin commands.).2 E |
| .377(In the conte)108 506.4 R .377 |
| (xt where an assignment statement is assigning a v)-.15 F .376 |
| (alue to a shell v)-.25 F .376(ariable or array inde)-.25 F .376 |
| (x, the +=)-.15 F .257 |
| (operator can be used to append to or add to the v)108 518.4 R(ariable') |
| -.25 E 2.757(sp)-.55 G(re)-2.757 E .257(vious v)-.25 F 2.757(alue. When) |
| -.25 F .257(+= is applied to a v)2.757 F(ariable)-.25 E .373 |
| (for which the inte)108 530.4 R .373(ger attrib)-.15 F .372 |
| (ute has been set,)-.2 F F2(value)2.872 E F0 .372(is e)2.872 F -.25(va) |
| -.25 G .372(luated as an arithmetic e).25 F .372 |
| (xpression and added to the)-.15 F -.25(va)108 542.4 S(riable').25 E |
| 2.888(sc)-.55 G .388(urrent v)-2.888 F .388(alue, which is also e)-.25 F |
| -.25(va)-.25 G 2.889(luated. When).25 F .389 |
| (+= is applied to an array v)2.889 F .389(ariable using compound)-.25 F |
| .186(assignment \(see)108 554.4 R F1(Arrays)2.686 E F0(belo)2.686 E .186 |
| (w\), the v)-.25 F(ariable')-.25 E 2.685(sv)-.55 G .185 |
| (alue is not unset \(as it is when using =\), and ne)-2.935 F 2.685(wv) |
| -.25 G .185(alues are)-2.935 F 1.384(appended to the array be)108 566.4 |
| R 1.384(ginning at one greater than the array')-.15 F 3.885(sm)-.55 G |
| 1.385(aximum inde)-3.885 F 3.885(x\()-.15 G 1.385(for inde)-3.885 F -.15 |
| (xe)-.15 G 3.885(da).15 G 1.385(rrays\) or)-3.885 F .123 |
| (added as additional k)108 578.4 R -.15(ey)-.1 G<ad76>.15 E .123 |
| (alue pairs in an associati)-.25 F .423 -.15(ve a)-.25 H(rray).15 E |
| 5.123(.W)-.65 G .122(hen applied to a string-v)-5.123 F .122(alued v) |
| -.25 F(ariable,)-.25 E F2(value)2.622 E F0(is e)108 590.4 Q |
| (xpanded and appended to the v)-.15 E(ariable')-.25 E 2.5(sv)-.55 G |
| (alue.)-2.75 E F1 -.2(Po)87 607.2 S(sitional P).2 E(arameters)-.1 E F0 |
| (A)108 619.2 Q F2 .705(positional par)4.455 F(ameter)-.15 E F0 .706(is \ |
| a parameter denoted by one or more digits, other than the single digit \ |
| 0.)3.935 F(Posi-)5.706 E .445 |
| (tional parameters are assigned from the shell')108 631.2 R 2.944(sa) |
| -.55 G -.18(rg)-2.944 G .444(uments when it is in).18 F -.2(vo)-.4 G -.1 |
| (ke).2 G .444(d, and may be reassigned using).1 F(the)108 643.2 Q F1 |
| (set)3.333 E F0 -.2(bu)3.333 G .833(iltin command.).2 F .834(Positional\ |
| parameters may not be assigned to with assignment statements.)5.833 F |
| (The)5.834 E .334(positional parameters are temporarily replaced when a\ |
| shell function is e)108 655.2 R -.15(xe)-.15 G .333(cuted \(see).15 F |
| F4(FUNCTIONS)2.833 E F0(belo)2.583 E(w\).)-.25 E 1.403(When a positiona\ |
| l parameter consisting of more than a single digit is e)108 672 R 1.404 |
| (xpanded, it must be enclosed in)-.15 F(braces \(see)108 684 Q F4(EXP) |
| 2.5 E(ANSION)-.666 E F0(belo)2.25 E(w\).)-.25 E F1(Special P)87 700.8 Q |
| (arameters)-.1 E F0 1.675(The shell treats se)108 712.8 R -.15(ve)-.25 G |
| 1.675(ral parameters specially).15 F 6.675(.T)-.65 G 1.674 |
| (hese parameters may only be referenced; assignment to)-6.675 F |
| (them is not allo)108 724.8 Q(wed.)-.25 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(8)190.955 E 0 Cg EP |
| %%Page: 9 9 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(*)108 84 Q F0 .605 |
| (Expands to the positional parameters, starting from one.)31 F .606 |
| (When the e)5.605 F .606(xpansion occurs within dou-)-.15 F .084 |
| (ble quotes, it e)144 96 R .084(xpands to a single w)-.15 F .084 |
| (ord with the v)-.1 F .084 |
| (alue of each parameter separated by the \214rst char)-.25 F(-)-.2 E |
| .003(acter of the)144 108 R/F2 9/Times-Bold@0 SF(IFS)2.503 E F0 .003 |
| (special v)2.253 F 2.503(ariable. That)-.25 F .003(is, ")2.503 F F1($*)A |
| F0 2.503("i)C 2.503(se)-2.503 G(qui)-2.503 E -.25(va)-.25 G .003 |
| (lent to ").25 F F1($1)A/F3 10/Times-Italic@0 SF(c)A F1($2)A F3(c)A F1 |
| (...)A F0 .003(", where)B F3(c)2.703 E F0 .004(is the \214rst char)2.813 |
| F(-)-.2 E .769(acter of the v)144 120 R .769(alue of the)-.25 F F2(IFS) |
| 3.269 E F0 -.25(va)3.019 G 3.269(riable. If).25 F F2(IFS)3.268 E F0 .768 |
| (is unset, the parameters are separated by spaces.)3.018 F(If)5.768 E F2 |
| (IFS)144 132 Q F0(is null, the parameters are joined without interv)2.25 |
| E(ening separators.)-.15 E F1(@)108 144 Q F0 .605 |
| (Expands to the positional parameters, starting from one.)26.7 F .606 |
| (When the e)5.605 F .606(xpansion occurs within dou-)-.15 F .114 |
| (ble quotes, each parameter e)144 156 R .114(xpands to a separate w)-.15 |
| F 2.614(ord. That)-.1 F .113(is, ")2.613 F F1($@)A F0 2.613("i)C 2.613 |
| (se)-2.613 G(qui)-2.613 E -.25(va)-.25 G .113(lent to ").25 F F1($1)A F0 |
| 2.613("")C F1($2)-2.613 E F0 2.613(".)C(..)-2.613 E .134 |
| (If the double-quoted e)144 168 R .134(xpansion occurs within a w)-.15 F |
| .135(ord, the e)-.1 F .135(xpansion of the \214rst parameter is joined) |
| -.15 F .151(with the be)144 180 R .151(ginning part of the original w) |
| -.15 F .151(ord, and the e)-.1 F .15 |
| (xpansion of the last parameter is joined with)-.15 F .337 |
| (the last part of the original w)144 192 R 2.837(ord. When)-.1 F .338 |
| (there are no positional parameters, ")2.837 F F1($@)A F0 2.838("a)C(nd) |
| -2.838 E F1($@)2.838 E F0 -.15(ex)2.838 G(pand).15 E |
| (to nothing \(i.e., the)144 204 Q 2.5(ya)-.15 G(re remo)-2.5 E -.15(ve) |
| -.15 G(d\).).15 E F1(#)108 216 Q F0 |
| (Expands to the number of positional parameters in decimal.)31 E F1(?) |
| 108 228 Q F0(Expands to the e)31 E(xit status of the most recently e) |
| -.15 E -.15(xe)-.15 G(cuted fore).15 E(ground pipeline.)-.15 E F1<ad>108 |
| 240 Q F0 .882 |
| (Expands to the current option \215ags as speci\214ed upon in)30.3 F -.2 |
| (vo)-.4 G .881(cation, by the).2 F F1(set)3.381 E F0 -.2(bu)3.381 G .881 |
| (iltin command, or).2 F(those set by the shell itself \(such as the)144 |
| 252 Q F1<ad69>2.5 E F0(option\).)2.5 E F1($)108 264 Q F0 .214 |
| (Expands to the process ID of the shell.)31 F .214 |
| (In a \(\) subshell, it e)5.214 F .214 |
| (xpands to the process ID of the current)-.15 F |
| (shell, not the subshell.)144 276 Q F1(!)108 288 Q F0 |
| (Expands to the process ID of the most recently e)32.67 E -.15(xe)-.15 G |
| (cuted background \(asynchronous\) command.).15 E F1(0)108 300 Q F0 |
| 1.692(Expands to the name of the shell or shell script.)31 F 1.691 |
| (This is set at shell initialization.)6.692 F(If)6.691 E F1(bash)4.191 E |
| F0(is)4.191 E(in)144 312 Q -.2(vo)-.4 G -.1(ke).2 G 3.077(dw).1 G .577 |
| (ith a \214le of commands,)-3.077 F F1($0)3.077 E F0 .578 |
| (is set to the name of that \214le.)3.077 F(If)5.578 E F1(bash)3.078 E |
| F0 .578(is started with the)3.078 F F1<ad63>3.078 E F0 .369 |
| (option, then)144 324 R F1($0)2.869 E F0 .369(is set to the \214rst ar) |
| 2.869 F .369(gument after the string to be e)-.18 F -.15(xe)-.15 G .369 |
| (cuted, if one is present.).15 F(Other)5.368 E(-)-.2 E |
| (wise, it is set to the \214le name used to in)144 336 Q -.2(vo)-.4 G |
| -.1(ke).2 G F1(bash)2.6 E F0 2.5(,a)C 2.5(sg)-2.5 G -2.15 -.25(iv e)-2.5 |
| H 2.5(nb).25 G 2.5(ya)-2.5 G -.18(rg)-2.5 G(ument zero.).18 E F1(_)108 |
| 348 Q F0 .054(At shell startup, set to the absolute pathname used to in) |
| 31 F -.2(vo)-.4 G .255 -.1(ke t).2 H .055 |
| (he shell or shell script being e).1 F -.15(xe)-.15 G(cuted).15 E .692 |
| (as passed in the en)144 360 R .692(vironment or ar)-.4 F .691 |
| (gument list.)-.18 F(Subsequently)5.691 E 3.191(,e)-.65 G .691 |
| (xpands to the last ar)-3.341 F .691(gument to the)-.18 F(pre)144 372 Q |
| .57(vious command, after e)-.25 F 3.07(xpansion. Also)-.15 F .571 |
| (set to the full pathname used to in)3.071 F -.2(vo)-.4 G .771 -.1(ke e) |
| .2 H .571(ach command).1 F -.15(exe)144 384 S 1.6 |
| (cuted and placed in the en).15 F 1.6(vironment e)-.4 F 1.6 |
| (xported to that command.)-.15 F 1.6(When checking mail, this)6.6 F |
| (parameter holds the name of the mail \214le currently being check)144 |
| 396 Q(ed.)-.1 E F1(Shell V)87 412.8 Q(ariables)-.92 E F0(The follo)108 |
| 424.8 Q(wing v)-.25 E(ariables are set by the shell:)-.25 E F1 -.3(BA) |
| 108 441.6 S(SH).3 E F0(Expands to the full \214le name used to in)9.07 E |
| -.2(vo)-.4 G .2 -.1(ke t).2 H(his instance of).1 E F1(bash)2.5 E F0(.)A |
| F1 -.3(BA)108 453.6 S(SHOPTS).3 E F0 2.548(Ac)144 465.6 S .049 |
| (olon-separated list of enabled shell options.)-2.548 F .049(Each w) |
| 5.049 F .049(ord in the list is a v)-.1 F .049(alid ar)-.25 F .049 |
| (gument for the)-.18 F F1<ad73>2.549 E F0 1.398(option to the)144 477.6 |
| R F1(shopt)3.898 E F0 -.2(bu)3.898 G 1.398(iltin command \(see).2 F F2 |
| 1.398(SHELL B)3.898 F(UIL)-.09 E 1.398(TIN COMMANDS)-.828 F F0(belo) |
| 3.648 E 3.898(w\). The)-.25 F(options)3.898 E .476(appearing in)144 |
| 489.6 R F2 -.27(BA)2.976 G(SHOPTS).27 E F0 .476(are those reported as) |
| 2.726 F F3(on)3.206 E F0(by)3.217 E F1(shopt)2.977 E F0 5.477(.I)C 2.977 |
| (ft)-5.477 G .477(his v)-2.977 F .477(ariable is in the en)-.25 F |
| (vironment)-.4 E(when)144 501.6 Q F1(bash)3.142 E F0 .642(starts up, ea\ |
| ch shell option in the list will be enabled before reading an)3.142 F |
| 3.141(ys)-.15 G .641(tartup \214les.)-3.141 F(This v)144 513.6 Q |
| (ariable is read-only)-.25 E(.)-.65 E F1 -.3(BA)108 525.6 S(SHPID).3 E |
| F0 .36(Expands to the process id of the current)144 537.6 R F1(bash) |
| 2.861 E F0 2.861(process. This)2.861 F(dif)2.861 E .361(fers from)-.25 F |
| F1($$)2.861 E F0 .361(under certain circum-)2.861 F |
| (stances, such as subshells that do not require)144 549.6 Q F1(bash)2.5 |
| E F0(to be re-initialized.)2.5 E F1 -.3(BA)108 561.6 S(SH_ALIASES).3 E |
| F0 1.195(An associati)144 573.6 R 1.495 -.15(ve a)-.25 H 1.195(rray v) |
| .15 F 1.195(ariable whose members correspond to the internal list of al\ |
| iases as main-)-.25 F .318(tained by the)144 585.6 R F1(alias)2.818 E F0 |
| -.2(bu)2.818 G .318(iltin Elements added to this array appear in the al\ |
| ias list; unsetting array ele-).2 F(ments cause aliases to be remo)144 |
| 597.6 Q -.15(ve)-.15 G 2.5(df).15 G(rom the alias list.)-2.5 E F1 -.3 |
| (BA)108 609.6 S(SH_ARGC).3 E F0 .935(An array v)144 621.6 R .935 |
| (ariable whose v)-.25 F .934 |
| (alues are the number of parameters in each frame of the current)-.25 F |
| F1(bash)3.434 E F0 -.15(exe)144 633.6 S .535(cution call stack.).15 F |
| .535(The number of parameters to the current subroutine \(shell functio\ |
| n or script)5.535 F -.15(exe)144 645.6 S .142(cuted with).15 F F1(.) |
| 2.642 E F0(or)2.642 E F1(sour)2.642 E(ce)-.18 E F0 2.642(\)i)C 2.642(sa) |
| -2.642 G 2.642(tt)-2.642 G .142(he top of the stack.)-2.642 F .141 |
| (When a subroutine is e)5.141 F -.15(xe)-.15 G .141 |
| (cuted, the number of).15 F 2.63(parameters passed is pushed onto)144 |
| 657.6 R F2 -.27(BA)5.13 G(SH_ARGC).27 E/F4 9/Times-Roman@0 SF(.)A F0 |
| 2.63(The shell sets)7.13 F F2 -.27(BA)5.131 G(SH_ARGC).27 E F0 2.631 |
| (only when in)4.881 F -.15(ex)144 669.6 S(tended deb).15 E |
| (ugging mode \(see the description of the)-.2 E F1(extdeb)2.5 E(ug)-.2 E |
| F0(option to the)2.5 E F1(shopt)2.5 E F0 -.2(bu)2.5 G(iltin belo).2 E |
| (w\))-.25 E F1 -.3(BA)108 681.6 S(SH_ARGV).3 E F0 .98(An array v)144 |
| 693.6 R .979(ariable containing all of the parameters in the current) |
| -.25 F F1(bash)3.479 E F0 -.15(exe)3.479 G .979(cution call stack.).15 F |
| (The)5.979 E .275(\214nal parameter of the last subroutine call is at t\ |
| he top of the stack; the \214rst parameter of the initial)144 705.6 R |
| 1.424(call is at the bottom.)144 717.6 R 1.424(When a subroutine is e) |
| 6.424 F -.15(xe)-.15 G 1.424 |
| (cuted, the parameters supplied are pushed onto).15 F F2 -.27(BA)144 |
| 729.6 S(SH_ARGV).27 E F4(.)A F0 2.197(The shell sets)6.697 F F2 -.27(BA) |
| 4.697 G(SH_ARGV).27 E F0 2.197(only when in e)4.447 F 2.197(xtended deb) |
| -.15 F 2.197(ugging mode \(see the)-.2 F(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(9)190.955 E 0 Cg EP |
| %%Page: 10 10 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(description of the)144 84 Q/F1 10/Times-Bold@0 SF(extdeb)2.5 E |
| (ug)-.2 E F0(option to the)2.5 E F1(shopt)2.5 E F0 -.2(bu)2.5 G |
| (iltin belo).2 E(w\))-.25 E F1 -.3(BA)108 96 S(SH_CMDS).3 E F0 .668 |
| (An associati)144 108 R .968 -.15(ve a)-.25 H .668(rray v).15 F .668(ar\ |
| iable whose members correspond to the internal hash table of commands) |
| -.25 F .146(as maintained by the)144 120 R F1(hash)2.646 E F0 -.2(bu) |
| 2.646 G 2.646(iltin. Elements).2 F .146 |
| (added to this array appear in the hash table; unsetting)2.646 F |
| (array elements cause commands to be remo)144 132 Q -.15(ve)-.15 G 2.5 |
| (df).15 G(rom the hash table.)-2.5 E F1 -.3(BA)108 144 S(SH_COMMAND).3 E |
| F0 1.243(The command currently being e)144 156 R -.15(xe)-.15 G 1.243 |
| (cuted or about to be e).15 F -.15(xe)-.15 G 1.242 |
| (cuted, unless the shell is e).15 F -.15(xe)-.15 G 1.242(cuting a).15 F |
| (command as the result of a trap, in which case it is the command e)144 |
| 168 Q -.15(xe)-.15 G(cuting at the time of the trap.).15 E F1 -.3(BA)108 |
| 180 S(SH_EXECUTION_STRING).3 E F0(The command ar)144 192 Q |
| (gument to the)-.18 E F1<ad63>2.5 E F0(in)2.5 E -.2(vo)-.4 G |
| (cation option.).2 E F1 -.3(BA)108 204 S(SH_LINENO).3 E F0 .034 |
| (An array v)144 216 R .034(ariable whose members are the line numbers i\ |
| n source \214les corresponding to each mem-)-.25 F 3.491(ber of)144 228 |
| R/F2 9/Times-Bold@0 SF(FUNCN)5.991 E(AME)-.18 E/F3 9/Times-Roman@0 SF(.) |
| A F1(${B)7.991 E(ASH_LINENO[)-.3 E/F4 10/Times-Italic@0 SF($i)A F1(]})A |
| F0 3.491(is the line number in the source \214le where)5.991 F F1 |
| (${FUNCN)144 240 Q(AME[)-.2 E F4($i)A F1(]})A F0 -.1(wa)3.311 G 3.311 |
| (sc).1 G .811(alled \(or)-3.311 F F1(${B)3.311 E(ASH_LINENO[)-.3 E F4 |
| ($i-1)A F1(]})A F0 .811(if referenced within another shell)3.311 F 4.987 |
| (function\). The)144 252 R 2.487(corresponding source \214le name is) |
| 4.987 F F1(${B)4.986 E(ASH_SOURCE[)-.3 E F4($i)A F1(]})A F0 7.486(.U)C |
| (se)-7.486 E F2(LINENO)4.986 E F0(to)4.736 E |
| (obtain the current line number)144 264 Q(.)-.55 E F1 -.3(BA)108 276 S |
| (SH_REMA).3 E(TCH)-.95 E F0 .005(An array v)144 288 R .005 |
| (ariable whose members are assigned by the)-.25 F F1(=~)2.506 E F0 .006 |
| (binary operator to the)2.506 F F1([[)2.506 E F0 .006(conditional com-) |
| 2.506 F 2.507(mand. The)144 300 R .007(element with inde)2.507 F 2.507 |
| (x0i)-.15 G 2.507(st)-2.507 G .007 |
| (he portion of the string matching the entire re)-2.507 F .006(gular e) |
| -.15 F(xpression.)-.15 E .997(The element with inde)144 312 R(x)-.15 E |
| F4(n)3.497 E F0 .997(is the portion of the string matching the)3.497 F |
| F4(n)3.498 E F0 .998(th parenthesized sube)B(xpres-)-.15 E 2.5 |
| (sion. This)144 324 R -.25(va)2.5 G(riable is read-only).25 E(.)-.65 E |
| F1 -.3(BA)108 336 S(SH_SOURCE).3 E F0 .89(An array v)144 348 R .889(ari\ |
| able whose members are the source \214lenames corresponding to the elem\ |
| ents in the)-.25 F F2(FUNCN)144 360 Q(AME)-.18 E F0(array v)2.25 E |
| (ariable.)-.25 E F1 -.3(BA)108 372 S(SH_SUBSHELL).3 E F0 .401 |
| (Incremented by one each time a subshell or subshell en)144 384 R .401 |
| (vironment is spa)-.4 F 2.902(wned. The)-.15 F .402(initial v)2.902 F |
| .402(alue is)-.25 F(0.)144 396 Q F1 -.3(BA)108 408 S(SH_VERSINFO).3 E F0 |
| 2.645(Ar)144 420 S .145(eadonly array v)-2.645 F .144 |
| (ariable whose members hold v)-.25 F .144 |
| (ersion information for this instance of)-.15 F F1(bash)2.644 E F0 5.144 |
| (.T)C(he)-5.144 E -.25(va)144 432 S |
| (lues assigned to the array members are as follo).25 E(ws:)-.25 E F1 -.3 |
| (BA)144 450 S(SH_VERSINFO[).3 E F0(0)A F1(])A F0(The major v)24.74 E |
| (ersion number \(the)-.15 E F4 -.37(re)2.5 G(lease).37 E F0(\).)A F1 -.3 |
| (BA)144 462 S(SH_VERSINFO[).3 E F0(1)A F1(])A F0(The minor v)24.74 E |
| (ersion number \(the)-.15 E F4(ver)2.5 E(sion)-.1 E F0(\).)A F1 -.3(BA) |
| 144 474 S(SH_VERSINFO[).3 E F0(2)A F1(])A F0(The patch le)24.74 E -.15 |
| (ve)-.25 G(l.).15 E F1 -.3(BA)144 486 S(SH_VERSINFO[).3 E F0(3)A F1(])A |
| F0(The b)24.74 E(uild v)-.2 E(ersion.)-.15 E F1 -.3(BA)144 498 S |
| (SH_VERSINFO[).3 E F0(4)A F1(])A F0(The release status \(e.g.,)24.74 E |
| F4(beta1)2.5 E F0(\).)A F1 -.3(BA)144 510 S(SH_VERSINFO[).3 E F0(5)A F1 |
| (])A F0(The v)24.74 E(alue of)-.25 E F2(MA)2.5 E(CHTYPE)-.495 E F3(.)A |
| F1 -.3(BA)108 526.8 S(SH_VERSION).3 E F0 |
| (Expands to a string describing the v)144 538.8 Q |
| (ersion of this instance of)-.15 E F1(bash)2.5 E F0(.)A F1(COMP_CW)108 |
| 555.6 Q(ORD)-.1 E F0 .396(An inde)144 567.6 R 2.896(xi)-.15 G(nto)-2.896 |
| E F1(${COMP_W)2.896 E(ORDS})-.1 E F0 .396(of the w)2.896 F .396 |
| (ord containing the current cursor position.)-.1 F .397(This v)5.397 F |
| (ari-)-.25 E 1.181(able is a)144 579.6 R -.25(va)-.2 G 1.181 |
| (ilable only in shell functions in).25 F -.2(vo)-.4 G -.1(ke).2 G 3.681 |
| (db).1 G 3.681(yt)-3.681 G 1.18(he programmable completion f)-3.681 F |
| 1.18(acilities \(see)-.1 F F1(Pr)144 591.6 Q(ogrammable Completion)-.18 |
| E F0(belo)2.5 E(w\).)-.25 E F1(COMP_KEY)108 608.4 Q F0(The k)144 620.4 Q |
| .3 -.15(ey \()-.1 H(or \214nal k).15 E .3 -.15(ey o)-.1 H 2.5(fak).15 G |
| .3 -.15(ey s)-2.6 H(equence\) used to in).15 E -.2(vo)-.4 G .2 -.1(ke t) |
| .2 H(he current completion function.).1 E F1(COMP_LINE)108 637.2 Q F0 |
| 1.207(The current command line.)144 649.2 R 1.208(This v)6.208 F 1.208 |
| (ariable is a)-.25 F -.25(va)-.2 G 1.208 |
| (ilable only in shell functions and e).25 F 1.208(xternal com-)-.15 F |
| 2.849(mands in)144 661.2 R -.2(vo)-.4 G -.1(ke).2 G 5.349(db).1 G 5.349 |
| (yt)-5.349 G 2.849(he programmable completion f)-5.349 F 2.849 |
| (acilities \(see)-.1 F F1(Pr)5.349 E 2.848(ogrammable Completion)-.18 F |
| F0(belo)144 673.2 Q(w\).)-.25 E F1(COMP_POINT)108 690 Q F0 .666 |
| (The inde)144 702 R 3.166(xo)-.15 G 3.166(ft)-3.166 G .666 |
| (he current cursor position relati)-3.166 F .966 -.15(ve t)-.25 H 3.166 |
| (ot).15 G .666(he be)-3.166 F .666(ginning of the current command.)-.15 |
| F .667(If the)5.667 F .535 |
| (current cursor position is at the end of the current command, the v)144 |
| 714 R .534(alue of this v)-.25 F .534(ariable is equal to)-.25 F F1 |
| (${#COMP_LINE})144 726 Q F0 7.005(.T)C 2.005(his v)-7.005 F 2.005 |
| (ariable is a)-.25 F -.25(va)-.2 G 2.006 |
| (ilable only in shell functions and e).25 F 2.006(xternal commands)-.15 |
| F(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(10)185.955 E 0 Cg EP |
| %%Page: 11 11 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(in)144 84 Q -.2(vo)-.4 G -.1(ke).2 G 2.5(db).1 G 2.5(yt)-2.5 G |
| (he programmable completion f)-2.5 E(acilities \(see)-.1 E/F1 10 |
| /Times-Bold@0 SF(Pr)2.5 E(ogrammable Completion)-.18 E F0(belo)2.5 E |
| (w\).)-.25 E F1(COMP_TYPE)108 100.8 Q F0 .042(Set to an inte)144 112.8 R |
| .042(ger v)-.15 F .041(alue corresponding to the type of completion att\ |
| empted that caused a completion)-.25 F .337(function to be called:)144 |
| 124.8 R/F2 10/Times-Italic@0 SF -.5(TA)2.837 G(B).5 E F0 2.837(,f)C .337 |
| (or normal completion,)-2.837 F F2(?)2.837 E F0 2.837(,f)C .337 |
| (or listing completions after successi)-2.837 F .638 -.15(ve t)-.25 H |
| (abs,).15 E F2(!)144 136.8 Q F0 4.092(,f)C 1.592(or listing alternati) |
| -4.092 F -.15(ve)-.25 G 4.092(so).15 G 4.092(np)-4.092 G 1.592(artial w) |
| -4.092 F 1.592(ord completion,)-.1 F F2(@)4.092 E F0 4.092(,t)C 4.092 |
| (ol)-4.092 G 1.592(ist completions if the w)-4.092 F 1.591(ord is not) |
| -.1 F 1.552(unmodi\214ed, or)144 148.8 R F2(%)4.052 E F0 4.052(,f)C |
| 1.552(or menu completion.)-4.052 F 1.552(This v)6.552 F 1.552 |
| (ariable is a)-.25 F -.25(va)-.2 G 1.552 |
| (ilable only in shell functions and).25 F -.15(ex)144 160.8 S 2.929 |
| (ternal commands in).15 F -.2(vo)-.4 G -.1(ke).2 G 5.429(db).1 G 5.429 |
| (yt)-5.429 G 2.929(he programmable completion f)-5.429 F 2.929 |
| (acilities \(see)-.1 F F1(Pr)5.428 E(ogrammable)-.18 E(Completion)144 |
| 172.8 Q F0(belo)2.5 E(w\).)-.25 E F1(COMP_W)108 189.6 Q(ORDBREAKS)-.1 E |
| F0 1.335(The set of characters that the)144 201.6 R F1 -.18(re)3.836 G |
| (adline).18 E F0 1.336(library treats as w)3.836 F 1.336 |
| (ord separators when performing w)-.1 F(ord)-.1 E 3.126(completion. If) |
| 144 213.6 R/F3 9/Times-Bold@0 SF(COMP_W)3.126 E(ORDBREAKS)-.09 E F0 .626 |
| (is unset, it loses its special properties, e)2.876 F -.15(ve)-.25 G |
| 3.125(ni).15 G 3.125(fi)-3.125 G 3.125(ti)-3.125 G 3.125(ss)-3.125 G |
| (ubse-)-3.125 E(quently reset.)144 225.6 Q F1(COMP_W)108 242.4 Q(ORDS) |
| -.1 E F0 .653(An array v)144 254.4 R .653(ariable \(see)-.25 F F1 |
| (Arrays)3.153 E F0(belo)3.153 E .654(w\) consisting of the indi)-.25 F |
| .654(vidual w)-.25 F .654(ords in the current command)-.1 F 4.333 |
| (line. The)144 266.4 R 1.832(line is split into w)4.332 F 1.832(ords as) |
| -.1 F F1 -.18(re)4.332 G(adline).18 E F0 -.1(wo)4.332 G 1.832 |
| (uld split it, using).1 F F3(COMP_W)4.332 E(ORDBREAKS)-.09 E F0(as)4.082 |
| E .831(described abo)144 278.4 R -.15(ve)-.15 G 5.831(.T).15 G .831 |
| (his v)-5.831 F .831(ariable is a)-.25 F -.25(va)-.2 G .832 |
| (ilable only in shell functions in).25 F -.2(vo)-.4 G -.1(ke).2 G 3.332 |
| (db).1 G 3.332(yt)-3.332 G .832(he programmable)-3.332 F(completion f) |
| 144 290.4 Q(acilities \(see)-.1 E F1(Pr)2.5 E(ogrammable Completion)-.18 |
| E F0(belo)2.5 E(w\).)-.25 E F1(DIRST)108 307.2 Q -.55(AC)-.9 G(K).55 E |
| F0 2.26(An array v)144 319.2 R 2.26(ariable \(see)-.25 F F1(Arrays)4.76 |
| E F0(belo)4.76 E 2.26 |
| (w\) containing the current contents of the directory stack.)-.25 F |
| 1.094(Directories appear in the stack in the order the)144 331.2 R 3.594 |
| (ya)-.15 G 1.095(re displayed by the)-3.594 F F1(dirs)3.595 E F0 -.2(bu) |
| 3.595 G 3.595(iltin. Assigning).2 F(to)3.595 E 1.432 |
| (members of this array v)144 343.2 R 1.432 |
| (ariable may be used to modify directories already in the stack, b)-.25 |
| F 1.431(ut the)-.2 F F1(pushd)144 355.2 Q F0(and)2.746 E F1(popd)2.746 E |
| F0 -.2(bu)2.746 G .246(iltins must be used to add and remo).2 F .546 |
| -.15(ve d)-.15 H 2.746(irectories. Assignment).15 F .246(to this v)2.746 |
| F(ariable)-.25 E .351(will not change the current directory)144 367.2 R |
| 5.35(.I)-.65 G(f)-5.35 E F3(DIRST)2.85 E -.495(AC)-.81 G(K).495 E F0 .35 |
| (is unset, it loses its special properties, e)2.6 F -.15(ve)-.25 G 2.85 |
| (ni).15 G(f)-2.85 E(it is subsequently reset.)144 379.2 Q F1(EUID)108 |
| 396 Q F0 1.103(Expands to the ef)11 F(fecti)-.25 E 1.403 -.15(ve u)-.25 |
| H 1.103(ser ID of the current user).15 F 3.603(,i)-.4 G 1.103 |
| (nitialized at shell startup.)-3.603 F 1.104(This v)6.103 F 1.104 |
| (ariable is)-.25 F(readonly)144 408 Q(.)-.65 E F1(FUNCN)108 424.8 Q(AME) |
| -.2 E F0 .479(An array v)144 436.8 R .479 |
| (ariable containing the names of all shell functions currently in the e) |
| -.25 F -.15(xe)-.15 G .478(cution call stack.).15 F .276 |
| (The element with inde)144 448.8 R 2.776(x0i)-.15 G 2.776(st)-2.776 G |
| .276(he name of an)-2.776 F 2.777(yc)-.15 G(urrently-e)-2.777 E -.15(xe) |
| -.15 G .277(cuting shell function.).15 F .277(The bottom-most)5.277 F |
| .25(element is)144 460.8 R/F4 10/Courier@0 SF("main")2.75 E F0 5.25(.T)C |
| .25(his v)-5.25 F .25(ariable e)-.25 F .25 |
| (xists only when a shell function is e)-.15 F -.15(xe)-.15 G 2.75 |
| (cuting. Assignments).15 F(to)2.75 E F3(FUNCN)144 472.8 Q(AME)-.18 E F0 |
| (ha)2.634 E .684 -.15(ve n)-.2 H 2.884(oe).15 G -.25(ff)-2.884 G .384 |
| (ect and return an error status.).25 F(If)5.385 E F3(FUNCN)2.885 E(AME) |
| -.18 E F0 .385(is unset, it loses its special)2.635 F(properties, e)144 |
| 484.8 Q -.15(ve)-.25 G 2.5(ni).15 G 2.5(fi)-2.5 G 2.5(ti)-2.5 G 2.5(ss) |
| -2.5 G(ubsequently reset.)-2.5 E F1(GR)108 501.6 Q(OUPS)-.3 E F0 1.229 |
| (An array v)144 513.6 R 1.228(ariable containing the list of groups of \ |
| which the current user is a member)-.25 F 6.228(.A)-.55 G(ssign-)-6.228 |
| E .596(ments to)144 525.6 R F3(GR)3.096 E(OUPS)-.27 E F0(ha)2.847 E .897 |
| -.15(ve n)-.2 H 3.097(oe).15 G -.25(ff)-3.097 G .597 |
| (ect and return an error status.).25 F(If)5.597 E F3(GR)3.097 E(OUPS) |
| -.27 E F0 .597(is unset, it loses its spe-)2.847 F(cial properties, e) |
| 144 537.6 Q -.15(ve)-.25 G 2.5(ni).15 G 2.5(fi)-2.5 G 2.5(ti)-2.5 G 2.5 |
| (ss)-2.5 G(ubsequently reset.)-2.5 E F1(HISTCMD)108 554.4 Q F0 .356 |
| (The history number)144 566.4 R 2.856(,o)-.4 G 2.856(ri)-2.856 G(nde) |
| -2.856 E 2.856(xi)-.15 G 2.856(nt)-2.856 G .356 |
| (he history list, of the current command.)-2.856 F(If)5.356 E F3 |
| (HISTCMD)2.855 E F0 .355(is unset, it)2.605 F |
| (loses its special properties, e)144 578.4 Q -.15(ve)-.25 G 2.5(ni).15 G |
| 2.5(fi)-2.5 G 2.5(ti)-2.5 G 2.5(ss)-2.5 G(ubsequently reset.)-2.5 E F1 |
| (HOSTN)108 595.2 Q(AME)-.2 E F0 |
| (Automatically set to the name of the current host.)144 607.2 Q F1 |
| (HOSTTYPE)108 624 Q F0 .222(Automatically set to a string that uniquely\ |
| describes the type of machine on which)144 636 R F1(bash)2.723 E F0 |
| .223(is e)2.723 F -.15(xe)-.15 G(cut-).15 E 2.5(ing. The)144 648 R(def) |
| 2.5 E(ault is system-dependent.)-.1 E F1(LINENO)108 664.8 Q F0 1.408(Ea\ |
| ch time this parameter is referenced, the shell substitutes a decimal n\ |
| umber representing the)144 676.8 R .078(current sequential line number \ |
| \(starting with 1\) within a script or function.)144 688.8 R .079 |
| (When not in a script or)5.078 F .307(function, the v)144 700.8 R .307 |
| (alue substituted is not guaranteed to be meaningful.)-.25 F(If)5.306 E |
| F3(LINENO)2.806 E F0 .306(is unset, it loses its)2.556 F |
| (special properties, e)144 712.8 Q -.15(ve)-.25 G 2.5(ni).15 G 2.5(fi) |
| -2.5 G 2.5(ti)-2.5 G 2.5(ss)-2.5 G(ubsequently reset.)-2.5 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(11)185.955 E 0 Cg EP |
| %%Page: 12 12 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(MA)108 84 Q(CHTYPE)-.55 E F0 .898(Automati\ |
| cally set to a string that fully describes the system type on which)144 |
| 96 R F1(bash)3.398 E F0 .899(is e)3.398 F -.15(xe)-.15 G .899 |
| (cuting, in).15 F(the standard GNU)144 108 Q/F2 10/Times-Italic@0 SF |
| (cpu-company-system)2.5 E F0 2.5(format. The)2.5 F(def)2.5 E |
| (ault is system-dependent.)-.1 E F1(OLDPWD)108 124.8 Q F0(The pre)144 |
| 136.8 Q(vious w)-.25 E(orking directory as set by the)-.1 E F1(cd)2.5 E |
| F0(command.)2.5 E F1(OPT)108 153.6 Q(ARG)-.9 E F0 1.627(The v)144 165.6 |
| R 1.627(alue of the last option ar)-.25 F 1.627(gument processed by the) |
| -.18 F F1(getopts)4.127 E F0 -.2(bu)4.127 G 1.626(iltin command \(see).2 |
| F/F3 9/Times-Bold@0 SF(SHELL)4.126 E -.09(BU)144 177.6 S(IL).09 E |
| (TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).)-.25 E F1(OPTIND)108 194.4 Q |
| F0 1.651(The inde)144 206.4 R 4.151(xo)-.15 G 4.151(ft)-4.151 G 1.651 |
| (he ne)-4.151 F 1.651(xt ar)-.15 F 1.652(gument to be processed by the) |
| -.18 F F1(getopts)4.152 E F0 -.2(bu)4.152 G 1.652(iltin command \(see).2 |
| F F3(SHELL)4.152 E -.09(BU)144 218.4 S(IL).09 E(TIN COMMANDS)-.828 E F0 |
| (belo)2.25 E(w\).)-.25 E F1(OSTYPE)108 235.2 Q F0 .329(Automatically se\ |
| t to a string that describes the operating system on which)144 247.2 R |
| F1(bash)2.829 E F0 .329(is e)2.829 F -.15(xe)-.15 G 2.829(cuting. The) |
| .15 F(def)144 259.2 Q(ault is system-dependent.)-.1 E F1(PIPEST)108 276 |
| Q -.95(AT)-.9 G(US).95 E F0 .61(An array v)144 288 R .61(ariable \(see) |
| -.25 F F1(Arrays)3.11 E F0(belo)3.11 E .61(w\) containing a list of e) |
| -.25 F .61(xit status v)-.15 F .61(alues from the processes in)-.25 F |
| (the most-recently-e)144 300 Q -.15(xe)-.15 G(cuted fore).15 E |
| (ground pipeline \(which may contain only a single command\).)-.15 E F1 |
| (PPID)108 316.8 Q F0(The process ID of the shell')12.67 E 2.5(sp)-.55 G |
| 2.5(arent. This)-2.5 F -.25(va)2.5 G(riable is readonly).25 E(.)-.65 E |
| F1(PWD)108 333.6 Q F0(The current w)12.67 E |
| (orking directory as set by the)-.1 E F1(cd)2.5 E F0(command.)2.5 E F1 |
| (RANDOM)108 350.4 Q F0 .566 |
| (Each time this parameter is referenced, a random inte)144 362.4 R .565 |
| (ger between 0 and 32767 is generated.)-.15 F(The)5.565 E .01 |
| (sequence of random numbers may be initialized by assigning a v)144 |
| 374.4 R .01(alue to)-.25 F F3(RANDOM)2.51 E/F4 9/Times-Roman@0 SF(.)A F0 |
| (If)4.51 E F3(RANDOM)2.51 E F0(is)2.26 E |
| (unset, it loses its special properties, e)144 386.4 Q -.15(ve)-.25 G |
| 2.5(ni).15 G 2.5(fi)-2.5 G 2.5(ti)-2.5 G 2.5(ss)-2.5 G |
| (ubsequently reset.)-2.5 E F1(REPL)108 403.2 Q(Y)-.92 E F0 |
| (Set to the line of input read by the)144 415.2 Q F1 -.18(re)2.5 G(ad) |
| .18 E F0 -.2(bu)2.5 G(iltin command when no ar).2 E |
| (guments are supplied.)-.18 E F1(SECONDS)108 432 Q F0 .795(Each time th\ |
| is parameter is referenced, the number of seconds since shell in)144 444 |
| R -.2(vo)-.4 G .795(cation is returned.).2 F .712(If a v)144 456 R .712 |
| (alue is assigned to)-.25 F F3(SECONDS)3.212 E F4(,)A F0 .712(the v) |
| 2.962 F .712(alue returned upon subsequent references is the number)-.25 |
| F .408(of seconds since the assignment plus the v)144 468 R .408 |
| (alue assigned.)-.25 F(If)5.408 E F3(SECONDS)2.908 E F0 .407 |
| (is unset, it loses its special)2.658 F(properties, e)144 480 Q -.15(ve) |
| -.25 G 2.5(ni).15 G 2.5(fi)-2.5 G 2.5(ti)-2.5 G 2.5(ss)-2.5 G |
| (ubsequently reset.)-2.5 E F1(SHELLOPTS)108 496.8 Q F0 3.262(Ac)144 |
| 508.8 S .763(olon-separated list of enabled shell options.)-3.262 F .763 |
| (Each w)5.763 F .763(ord in the list is a v)-.1 F .763(alid ar)-.25 F |
| .763(gument for the)-.18 F F1<ad6f>144 520.8 Q F0 1.174(option to the) |
| 3.674 F F1(set)3.674 E F0 -.2(bu)3.674 G 1.174(iltin command \(see).2 F |
| F3 1.173(SHELL B)3.673 F(UIL)-.09 E 1.173(TIN COMMANDS)-.828 F F0(belo) |
| 3.423 E 3.673(w\). The)-.25 F(options)3.673 E .019(appearing in)144 |
| 532.8 R F3(SHELLOPTS)2.519 E F0 .019(are those reported as)2.269 F F2 |
| (on)2.749 E F0(by)2.759 E F1 .019(set \255o)2.519 F F0 5.019(.I)C 2.519 |
| (ft)-5.019 G .019(his v)-2.519 F .02(ariable is in the en)-.25 F |
| (vironment)-.4 E(when)144 544.8 Q F1(bash)3.142 E F0 .642(starts up, ea\ |
| ch shell option in the list will be enabled before reading an)3.142 F |
| 3.141(ys)-.15 G .641(tartup \214les.)-3.141 F(This v)144 556.8 Q |
| (ariable is read-only)-.25 E(.)-.65 E F1(SHL)108 573.6 Q(VL)-.92 E F0 |
| (Incremented by one each time an instance of)144 585.6 Q F1(bash)2.5 E |
| F0(is started.)2.5 E F1(UID)108 602.4 Q F0 |
| (Expands to the user ID of the current user)17.67 E 2.5(,i)-.4 G |
| (nitialized at shell startup.)-2.5 E(This v)5 E(ariable is readonly)-.25 |
| E(.)-.65 E .993(The follo)108 619.2 R .993(wing v)-.25 F .994 |
| (ariables are used by the shell.)-.25 F .994(In some cases,)5.994 F F1 |
| (bash)3.494 E F0 .994(assigns a def)3.494 F .994(ault v)-.1 F .994 |
| (alue to a v)-.25 F(ariable;)-.25 E(these cases are noted belo)108 631.2 |
| Q -.65(w.)-.25 G F1 -.3(BA)108 648 S(SH_ENV).3 E F0 .506 |
| (If this parameter is set when)144 660 R F1(bash)3.006 E F0 .506(is e) |
| 3.006 F -.15(xe)-.15 G .505(cuting a shell script, its v).15 F .505 |
| (alue is interpreted as a \214lename)-.25 F .354 |
| (containing commands to initialize the shell, as in)144 672 R F2 |
| (~/.bashr)2.855 E(c)-.37 E F0 5.355(.T).31 G .355(he v)-5.355 F .355 |
| (alue of)-.25 F F3 -.27(BA)2.855 G(SH_ENV).27 E F0 .355(is subjected) |
| 2.605 F .525(to parameter e)144 684 R .525 |
| (xpansion, command substitution, and arithmetic e)-.15 F .525 |
| (xpansion before being interpreted)-.15 F(as a \214le name.)144 696 Q F3 |
| -.666(PA)5 G(TH)-.189 E F0 |
| (is not used to search for the resultant \214le name.)2.25 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(12)185.955 E 0 Cg EP |
| %%Page: 13 13 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(CDP)108 84 Q -.95(AT)-.74 G(H).95 E F0 |
| 1.247(The search path for the)144 96 R F1(cd)3.747 E F0 3.747 |
| (command. This)3.747 F 1.248 |
| (is a colon-separated list of directories in which the)3.747 F 3.796 |
| (shell looks for destination directories speci\214ed by the)144 108 R F1 |
| (cd)6.295 E F0 6.295(command. A)6.295 F 3.795(sample v)6.295 F 3.795 |
| (alue is)-.25 F/F2 10/Courier@0 SF(".:~:/usr")144 120 Q F0(.)A F1 -.3 |
| (BA)108 132 S(SH_XTRA).3 E(CEFD)-.55 E F0 .48(If set to an inte)144 144 |
| R .48(ger corresponding to a v)-.15 F .481(alid \214le descriptor)-.25 F |
| (,)-.4 E F1(bash)2.981 E F0 .481(will write the trace output gener)2.981 |
| F(-)-.2 E 3.114(ated when)144 156 R F2 3.114(set -x)5.614 F F0 3.114 |
| (is enabled to that \214le descriptor)5.614 F 8.114(.T)-.55 G 3.114 |
| (he \214le descriptor is closed when)-8.114 F/F3 9/Times-Bold@0 SF -.27 |
| (BA)144 168 S(SH_XTRA).27 E(CEFD)-.495 E F0 .138 |
| (is unset or assigned a ne)2.388 F 2.638(wv)-.25 G 2.638 |
| (alue. Unsetting)-2.888 F F3 -.27(BA)2.638 G(SH_XTRA).27 E(CEFD)-.495 E |
| F0 .138(or assigning it)2.388 F 2.531(the empty string causes the trace\ |
| output to be sent to the standard error)144 180 R 7.53(.N)-.55 G 2.53 |
| (ote that setting)-7.53 F F3 -.27(BA)144 192 S(SH_XTRA).27 E(CEFD)-.495 |
| E F0 .74(to 2 \(the standard error \214le descriptor\) and then unsetti\ |
| ng it will result in the)2.99 F(standard error being closed.)144 204 Q |
| F1(COLUMNS)108 216 Q F0 .425(Used by the)144 228 R F1(select)2.925 E F0 |
| -.2(bu)2.925 G .425(iltin command to determine the terminal width when \ |
| printing selection lists.).2 F |
| (Automatically set upon receipt of a SIGWINCH.)144 240 Q F1(COMPREPL)108 |
| 252 Q(Y)-.92 E F0 .847(An array v)144 264 R .848(ariable from which)-.25 |
| F F1(bash)3.348 E F0 .848 |
| (reads the possible completions generated by a shell function)3.348 F |
| (in)144 276 Q -.2(vo)-.4 G -.1(ke).2 G 2.5(db).1 G 2.5(yt)-2.5 G |
| (he programmable completion f)-2.5 E(acility \(see)-.1 E F1(Pr)2.5 E |
| (ogrammable Completion)-.18 E F0(belo)2.5 E(w\).)-.25 E F1(EMA)108 288 Q |
| (CS)-.55 E F0(If)144 300 Q F1(bash)2.536 E F0 .036(\214nds this v)2.536 |
| F .036(ariable in the en)-.25 F .036 |
| (vironment when the shell starts with v)-.4 F(alue)-.25 E F2(t)2.535 E |
| F0 2.535(,i)C 2.535(ta)-2.535 G .035(ssumes that the)-2.535 F |
| (shell is running in an emacs shell b)144 312 Q(uf)-.2 E |
| (fer and disables line editing.)-.25 E F1(FCEDIT)108 324 Q F0(The def) |
| 144 336 Q(ault editor for the)-.1 E F1(fc)2.5 E F0 -.2(bu)2.5 G |
| (iltin command.).2 E F1(FIGNORE)108 348 Q F0 2.598(Ac)144 360 S .098 |
| (olon-separated list of suf)-2.598 F<8c78>-.25 E .098 |
| (es to ignore when performing \214lename completion \(see)-.15 F F3 |
| (READLINE)2.599 E F0(belo)144 372 Q 2.705(w\). A)-.25 F .205 |
| (\214lename whose suf)2.705 F .205(\214x matches one of the entries in) |
| -.25 F F3(FIGNORE)2.705 E F0 .205(is e)2.455 F .204 |
| (xcluded from the list)-.15 F(of matched \214lenames.)144 384 Q 2.5(As)5 |
| G(ample v)-2.5 E(alue is)-.25 E F2(".o:~")2.5 E F0(.)A F1(GLOBIGNORE)108 |
| 396 Q F0 3.118(Ac)144 408 S .618(olon-separated list of patterns de\214\ |
| ning the set of \214lenames to be ignored by pathname e)-3.118 F(xpan-) |
| -.15 E 3.132(sion. If)144 420 R 3.132<618c>3.132 G .632 |
| (lename matched by a pathname e)-3.132 F .632 |
| (xpansion pattern also matches one of the patterns in)-.15 F F3 |
| (GLOBIGNORE)144 432 Q/F4 9/Times-Roman@0 SF(,)A F0(it is remo)2.25 E |
| -.15(ve)-.15 G 2.5(df).15 G(rom the list of matches.)-2.5 E F1 |
| (HISTCONTR)108 444 Q(OL)-.3 E F0 2.653(Ac)144 456 S .153 |
| (olon-separated list of v)-2.653 F .153(alues controlling ho)-.25 F |
| 2.653(wc)-.25 G .153(ommands are sa)-2.653 F -.15(ve)-.2 G 2.653(do).15 |
| G 2.653(nt)-2.653 G .153(he history list.)-2.653 F .154(If the list) |
| 5.153 F .491(of v)144 468 R .491(alues includes)-.25 F/F5 10 |
| /Times-Italic@0 SF(ignor)2.991 E(espace)-.37 E F0 2.991(,l).18 G .491 |
| (ines which be)-2.991 F .491(gin with a)-.15 F F1(space)2.991 E F0 .49 |
| (character are not sa)2.991 F -.15(ve)-.2 G 2.99(di).15 G 2.99(nt)-2.99 |
| G .49(he his-)-2.99 F .557(tory list.)144 480 R 3.057(Av)5.557 G .557 |
| (alue of)-3.307 F F5(ignor)3.067 E(edups)-.37 E F0 .557 |
| (causes lines matching the pre)3.327 F .558 |
| (vious history entry to not be sa)-.25 F -.15(ve)-.2 G(d.).15 E 2.959 |
| (Av)144 492 S .459(alue of)-3.209 F F5(ignor)2.969 E(eboth)-.37 E F0 |
| .459(is shorthand for)3.239 F F5(ignor)2.959 E(espace)-.37 E F0(and) |
| 2.959 E F5(ignor)2.958 E(edups)-.37 E F0 5.458(.A)C -.25(va)-2.5 G .458 |
| (lue of).25 F F5(er)2.958 E(asedups)-.15 E F0(causes)2.958 E .698 |
| (all pre)144 504 R .698 |
| (vious lines matching the current line to be remo)-.25 F -.15(ve)-.15 G |
| 3.198(df).15 G .699(rom the history list before that line is)-3.198 F |
| (sa)144 516 Q -.15(ve)-.2 G 2.764(d. An).15 F 2.764(yv)-.15 G .264 |
| (alue not in the abo)-3.014 F .563 -.15(ve l)-.15 H .263 |
| (ist is ignored.).15 F(If)5.263 E F3(HISTCONTR)2.763 E(OL)-.27 E F0 .263 |
| (is unset, or does not include)2.513 F 2.941(av)144 528 S .441(alid v) |
| -3.191 F .441(alue, all lines read by the shell parser are sa)-.25 F |
| -.15(ve)-.2 G 2.942(do).15 G 2.942(nt)-2.942 G .442 |
| (he history list, subject to the v)-2.942 F .442(alue of)-.25 F F3 |
| (HISTIGNORE)144 540 Q F4(.)A F0 1.981(The second and subsequent lines o\ |
| f a multi-line compound command are not)6.482 F |
| (tested, and are added to the history re)144 552 Q -.05(ga)-.15 G |
| (rdless of the v).05 E(alue of)-.25 E F3(HISTCONTR)2.5 E(OL)-.27 E F4(.) |
| A F1(HISTFILE)108 564 Q F0 .181 |
| (The name of the \214le in which command history is sa)144 576 R -.15 |
| (ve)-.2 G 2.681(d\().15 G(see)-2.681 E F3(HIST)2.681 E(OR)-.162 E(Y) |
| -.315 E F0(belo)2.431 E 2.682(w\). The)-.25 F(def)2.682 E .182(ault v) |
| -.1 F(alue)-.25 E(is)144 588 Q F5(~/.bash_history)2.5 E F0 5(.I)C 2.5 |
| (fu)-5 G(nset, the command history is not sa)-2.5 E -.15(ve)-.2 G 2.5 |
| (dw).15 G(hen an interacti)-2.5 E .3 -.15(ve s)-.25 H(hell e).15 E |
| (xits.)-.15 E F1(HISTFILESIZE)108 600 Q F0 1.623 |
| (The maximum number of lines contained in the history \214le.)144 612 R |
| 1.622(When this v)6.623 F 1.622(ariable is assigned a)-.25 F -.25(va)144 |
| 624 S .305(lue, the history \214le is truncated, if necessary).25 F |
| 2.805(,b)-.65 G 2.805(yr)-2.805 G(emo)-2.805 E .305 |
| (ving the oldest entries, to contain no more)-.15 F .602 |
| (than that number of lines.)144 636 R .602(The def)5.602 F .602(ault v) |
| -.1 F .602(alue is 500.)-.25 F .601 |
| (The history \214le is also truncated to this size)5.602 F |
| (after writing it when an interacti)144 648 Q .3 -.15(ve s)-.25 H |
| (hell e).15 E(xits.)-.15 E F1(HISTIGNORE)108 660 Q F0 2.657(Ac)144 672 S |
| .157(olon-separated list of patterns used to decide which command lines\ |
| should be sa)-2.657 F -.15(ve)-.2 G 2.658(do).15 G 2.658(nt)-2.658 G |
| .158(he his-)-2.658 F .708(tory list.)144 684 R .708 |
| (Each pattern is anchored at the be)5.708 F .707 |
| (ginning of the line and must match the complete line)-.15 F .625 |
| (\(no implicit `)144 696 R F1(*)A F0 3.125('i)C 3.125(sa)-3.125 G 3.125 |
| (ppended\). Each)-3.125 F .626(pattern is tested ag)3.125 F .626 |
| (ainst the line after the checks speci\214ed by)-.05 F F3(HISTCONTR)144 |
| 708 Q(OL)-.27 E F0 1.793(are applied.)4.043 F 1.793 |
| (In addition to the normal shell pattern matching characters, `)6.793 F |
| F1(&)A F0(')A 2.514(matches the pre)144 720 R 2.514(vious history line.) |
| -.25 F(`)7.514 E F1(&)A F0 5.014('m)C 2.514 |
| (ay be escaped using a backslash; the backslash is)-5.014 F |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(13)185.955 E 0 Cg EP |
| %%Page: 14 14 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(remo)144 84 Q -.15(ve)-.15 G 3.353(db).15 G .853 |
| (efore attempting a match.)-3.353 F .852 |
| (The second and subsequent lines of a multi-line compound)5.852 F |
| (command are not tested, and are added to the history re)144 96 Q -.05 |
| (ga)-.15 G(rdless of the v).05 E(alue of)-.25 E/F1 9/Times-Bold@0 SF |
| (HISTIGNORE)2.5 E/F2 9/Times-Roman@0 SF(.)A/F3 10/Times-Bold@0 SF |
| (HISTSIZE)108 108 Q F0 1.942 |
| (The number of commands to remember in the command history \(see)144 120 |
| R F1(HIST)4.443 E(OR)-.162 E(Y)-.315 E F0(belo)4.193 E 4.443(w\). The) |
| -.25 F(def)144 132 Q(ault v)-.1 E(alue is 500.)-.25 E F3(HISTTIMEFORMA) |
| 108 144 Q(T)-.95 E F0 .952(If this v)144 156 R .952 |
| (ariable is set and not null, its v)-.25 F .951 |
| (alue is used as a format string for)-.25 F/F4 10/Times-Italic@0 SF |
| (strftime)3.451 E F0 .951(\(3\) to print the)B .672 |
| (time stamp associated with each history entry displayed by the)144 168 |
| R F3(history)3.173 E F0 -.2(bu)3.173 G 3.173(iltin. If).2 F .673(this v) |
| 3.173 F .673(ariable is)-.25 F .144 |
| (set, time stamps are written to the history \214le so the)144 180 R |
| 2.644(ym)-.15 G .144(ay be preserv)-2.644 F .144 |
| (ed across shell sessions.)-.15 F(This)5.144 E(uses the history comment\ |
| character to distinguish timestamps from other history lines.)144 192 Q |
| F3(HOME)108 204 Q F0 1.27 |
| (The home directory of the current user; the def)144 216 R 1.27(ault ar) |
| -.1 F 1.27(gument for the)-.18 F F3(cd)3.77 E F0 -.2(bu)3.77 G 1.27 |
| (iltin command.).2 F(The)6.27 E -.25(va)144 228 S(lue of this v).25 E |
| (ariable is also used when performing tilde e)-.25 E(xpansion.)-.15 E F3 |
| (HOSTFILE)108 240 Q F0 1.015 |
| (Contains the name of a \214le in the same format as)144 252 R F4 |
| (/etc/hosts)5.181 E F0 1.015(that should be read when the shell)5.181 F |
| .55(needs to complete a hostname.)144 264 R .551 |
| (The list of possible hostname completions may be changed while)5.551 F |
| 1.059(the shell is running; the ne)144 276 R 1.059 |
| (xt time hostname completion is attempted after the v)-.15 F 1.058 |
| (alue is changed,)-.25 F F3(bash)144 288 Q F0 .138 |
| (adds the contents of the ne)2.638 F 2.638<778c>-.25 G .138(le to the e) |
| -2.638 F .138(xisting list.)-.15 F(If)5.138 E F1(HOSTFILE)2.638 E F0 |
| .138(is set, b)2.388 F .139(ut has no v)-.2 F .139(alue, or)-.25 F .518 |
| (does not name a readable \214le,)144 300 R F3(bash)3.018 E F0 .518 |
| (attempts to read)3.018 F F4(/etc/hosts)4.683 E F0 .517 |
| (to obtain the list of possible host-)4.683 F(name completions.)144 312 |
| Q(When)5 E F1(HOSTFILE)2.5 E F0(is unset, the hostname list is cleared.) |
| 2.25 E F3(IFS)108 324 Q F0(The)20.44 E F4 .555(Internal F)3.635 F .555 |
| (ield Separ)-.45 F(ator)-.15 E F0 .555(that is used for w)3.785 F .556 |
| (ord splitting after e)-.1 F .556(xpansion and to split lines into)-.15 |
| F -.1(wo)144 336 S(rds with the).1 E F3 -.18(re)2.5 G(ad).18 E F0 -.2 |
| (bu)2.5 G(iltin command.).2 E(The def)5 E(ault v)-.1 E(alue is `)-.25 E |
| (`<space><tab><ne)-.74 E(wline>')-.25 E('.)-.74 E F3(IGNOREEOF)108 348 Q |
| F0 .503(Controls the action of an interacti)144 360 R .803 -.15(ve s) |
| -.25 H .503(hell on receipt of an).15 F F1(EOF)3.003 E F0 .503 |
| (character as the sole input.)2.753 F .503(If set,)5.503 F .426(the v) |
| 144 372 R .426(alue is the number of consecuti)-.25 F -.15(ve)-.25 G F1 |
| (EOF)3.076 E F0 .426 |
| (characters which must be typed as the \214rst characters)2.676 F .303 |
| (on an input line before)144 384 R F3(bash)2.802 E F0 -.15(ex)2.802 G |
| 2.802(its. If).15 F .302(the v)2.802 F .302(ariable e)-.25 F .302 |
| (xists b)-.15 F .302(ut does not ha)-.2 F .602 -.15(ve a n)-.2 H .302 |
| (umeric v).15 F .302(alue, or has)-.25 F(no v)144 396 Q(alue, the def) |
| -.25 E(ault v)-.1 E(alue is 10.)-.25 E(If it does not e)5 E(xist,)-.15 E |
| F1(EOF)2.5 E F0(signi\214es the end of input to the shell.)2.25 E F3 |
| (INPUTRC)108 408 Q F0 1.435(The \214lename for the)144 420 R F3 -.18(re) |
| 3.936 G(adline).18 E F0 1.436(startup \214le, o)3.936 F -.15(ve)-.15 G |
| 1.436(rriding the def).15 F 1.436(ault of)-.1 F F4(~/.inputr)5.602 E(c) |
| -.37 E F0(\(see)5.602 E F1(READLINE)3.936 E F0(belo)144 432 Q(w\).)-.25 |
| E F3(LANG)108 444 Q F0 1.24(Used to determine the locale cate)7.11 F |
| 1.239(gory for an)-.15 F 3.739(yc)-.15 G(ate)-3.739 E 1.239 |
| (gory not speci\214cally selected with a v)-.15 F(ariable)-.25 E |
| (starting with)144 456 Q F3(LC_)2.5 E F0(.)A F3(LC_ALL)108 468 Q F0 .973 |
| (This v)144 480 R .973(ariable o)-.25 F -.15(ve)-.15 G .973 |
| (rrides the v).15 F .973(alue of)-.25 F F1(LANG)3.473 E F0 .973(and an) |
| 3.223 F 3.473(yo)-.15 G(ther)-3.473 E F3(LC_)3.473 E F0 -.25(va)3.473 G |
| .974(riable specifying a locale cate-).25 F(gory)144 492 Q(.)-.65 E F3 |
| (LC_COLLA)108 504 Q(TE)-.95 E F0 .412(This v)144 516 R .412(ariable det\ |
| ermines the collation order used when sorting the results of pathname e) |
| -.25 F(xpansion,)-.15 E 1.464(and determines the beha)144 528 R 1.464 |
| (vior of range e)-.2 F 1.465(xpressions, equi)-.15 F -.25(va)-.25 G |
| 1.465(lence classes, and collating sequences).25 F(within pathname e)144 |
| 540 Q(xpansion and pattern matching.)-.15 E F3(LC_CTYPE)108 552 Q F0 |
| 1.936(This v)144 564 R 1.936 |
| (ariable determines the interpretation of characters and the beha)-.25 F |
| 1.935(vior of character classes)-.2 F(within pathname e)144 576 Q |
| (xpansion and pattern matching.)-.15 E F3(LC_MESSA)108 588 Q(GES)-.55 E |
| F0(This v)144 600 Q(ariable determines the locale used to translate dou\ |
| ble-quoted strings preceded by a)-.25 E F3($)2.5 E F0(.)A F3(LC_NUMERIC) |
| 108 612 Q F0(This v)144 624 Q(ariable determines the locale cate)-.25 E |
| (gory used for number formatting.)-.15 E F3(LINES)108 636 Q F0 1.218 |
| (Used by the)5.99 F F3(select)3.718 E F0 -.2(bu)3.718 G 1.219(iltin com\ |
| mand to determine the column length for printing selection lists.).2 F |
| (Automatically set upon receipt of a)144 648 Q F1(SIGWINCH)2.5 E F2(.)A |
| F3(MAIL)108 660 Q F0 .188 |
| (If this parameter is set to a \214le name and the)8.78 F F1(MAILP)2.687 |
| E -.855(AT)-.666 G(H).855 E F0 -.25(va)2.437 G .187(riable is not set,) |
| .25 F F3(bash)2.687 E F0 .187(informs the user)2.687 F(of the arri)144 |
| 672 Q -.25(va)-.25 G 2.5(lo).25 G 2.5(fm)-2.5 G |
| (ail in the speci\214ed \214le.)-2.5 E F3(MAILCHECK)108 684 Q F0 .098 |
| (Speci\214es ho)144 696 R 2.598(wo)-.25 G .098(ften \(in seconds\)) |
| -2.598 F F3(bash)2.598 E F0 .098(checks for mail.)2.598 F .098(The def) |
| 5.098 F .098(ault is 60 seconds.)-.1 F .099(When it is time)5.099 F .224 |
| (to check for mail, the shell does so before displaying the primary pro\ |
| mpt.)144 708 R .223(If this v)5.223 F .223(ariable is unset,)-.25 F .066 |
| (or set to a v)144 720 R .066(alue that is not a number greater than or\ |
| equal to zero, the shell disables mail checking.)-.25 F(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(14)185.955 E 0 Cg EP |
| %%Page: 15 15 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(MAILP)108 84 Q -.95(AT)-.74 G(H).95 E F0 |
| 2.815(Ac)144 96 S .314(olon-separated list of \214le names to be check) |
| -2.815 F .314(ed for mail.)-.1 F .314 |
| (The message to be printed when mail)5.314 F(arri)144 108 Q -.15(ve)-.25 |
| G 3.42(si).15 G 3.42(nap)-3.42 G .92(articular \214le may be speci\214e\ |
| d by separating the \214le name from the message with a)-3.42 F 2.808 |
| (`?'. When)144 120 R .308(used in the te)2.808 F .308 |
| (xt of the message,)-.15 F F1($_)2.808 E F0 -.15(ex)2.808 G .308 |
| (pands to the name of the current mail\214le.).15 F(Exam-)5.307 E(ple:) |
| 144 132 Q F1(MAILP)144 144 Q -.95(AT)-.74 G(H).95 E F0(=\010/v)A |
| (ar/mail/bfox?"Y)-.25 E(ou ha)-1.1 E .3 -.15(ve m)-.2 H |
| (ail":~/shell\255mail?"$_ has mail!"\010).15 E F1(Bash)144 156 Q F0 .388 |
| (supplies a def)2.888 F .388(ault v)-.1 F .388(alue for this v)-.25 F |
| .388(ariable, b)-.25 F .389 |
| (ut the location of the user mail \214les that it uses is)-.2 F |
| (system dependent \(e.g., /v)144 168 Q(ar/mail/)-.25 E F1($USER)A F0 |
| (\).)A F1(OPTERR)108 180 Q F0 .39(If set to the v)144 192 R .39(alue 1,) |
| -.25 F F1(bash)2.89 E F0 .389(displays error messages generated by the) |
| 2.889 F F1(getopts)2.889 E F0 -.2(bu)2.889 G .389(iltin command \(see).2 |
| F/F2 9/Times-Bold@0 SF .359(SHELL B)144 204 R(UIL)-.09 E .359 |
| (TIN COMMANDS)-.828 F F0(belo)2.609 E(w\).)-.25 E F2(OPTERR)5.359 E F0 |
| .36(is initialized to 1 each time the shell is in)2.609 F -.2(vo)-.4 G |
| -.1(ke).2 G(d).1 E(or a shell script is e)144 216 Q -.15(xe)-.15 G |
| (cuted.).15 E F1 -.74(PA)108 228 S(TH)-.21 E F0 .588 |
| (The search path for commands.)9.91 F .587 |
| (It is a colon-separated list of directories in which the shell looks) |
| 5.588 F .471(for commands \(see)144 240 R F2 .471(COMMAND EXECUTION) |
| 2.971 F F0(belo)2.722 E 2.972(w\). A)-.25 F .472 |
| (zero-length \(null\) directory name in the)2.972 F -.25(va)144 252 S |
| .536(lue of).25 F F2 -.666(PA)3.036 G(TH)-.189 E F0 .535 |
| (indicates the current directory)2.786 F 5.535(.A)-.65 G .535 |
| (null directory name may appear as tw)-2.5 F 3.035(oa)-.1 G(djacent) |
| -3.035 E .867(colons, or as an initial or trailing colon.)144 264 R .868 |
| (The def)5.868 F .868(ault path is system-dependent, and is set by the) |
| -.1 F 26.329(administrator who installs)144 276 R F1(bash)28.829 E F0 |
| 31.329(.A)C 26.328(common v)-2.501 F 26.328(alue is)-.25 F/F3 10 |
| /Courier@0 SF(/usr/gnu/bin:/usr/local/bin:/usr/ucb:/bin:/usr/bin)144 288 |
| Q F0(.)A F1(POSIXL)108 300 Q(Y_CORRECT)-.92 E F0 .471(If this v)144 312 |
| R .471(ariable is in the en)-.25 F .471(vironment when)-.4 F F1(bash) |
| 2.971 E F0 .471(starts, the shell enters)2.971 F/F4 10/Times-Italic@0 SF |
| .472(posix mode)2.972 F F0 .472(before reading)2.972 F .011 |
| (the startup \214les, as if the)144 324 R F1(\255\255posix)2.511 E F0 |
| (in)2.511 E -.2(vo)-.4 G .011(cation option had been supplied.).2 F .011 |
| (If it is set while the shell is)5.011 F(running,)144 336 Q F1(bash)2.5 |
| E F0(enables)2.5 E F4(posix mode)2.5 E F0 2.5(,a)C 2.5(si)-2.5 G 2.5(ft) |
| -2.5 G(he command)-2.5 E F3(set -o posix)2.5 E F0(had been e)2.5 E -.15 |
| (xe)-.15 G(cuted.).15 E F1(PR)108 348 Q(OMPT_COMMAND)-.3 E F0 |
| (If set, the v)144 360 Q(alue is e)-.25 E -.15(xe)-.15 G |
| (cuted as a command prior to issuing each primary prompt.).15 E F1(PR) |
| 108 372 Q(OMPT_DIR)-.3 E(TRIM)-.4 E F0 .676 |
| (If set to a number greater than zero, the v)144 384 R .676 |
| (alue is used as the number of trailing directory compo-)-.25 F .923 |
| (nents to retain when e)144 396 R .923(xpanding the)-.15 F F1(\\w)3.423 |
| E F0(and)3.423 E F1(\\W)3.423 E F0 .923(prompt string escapes \(see) |
| 3.423 F F2(PR)3.423 E(OMPTING)-.27 E F0(belo)3.173 E(w\).)-.25 E |
| (Characters remo)144 408 Q -.15(ve)-.15 G 2.5(da).15 G |
| (re replaced with an ellipsis.)-2.5 E F1(PS1)108 420 Q F0 .064(The v) |
| 19.33 F .065(alue of this parameter is e)-.25 F .065(xpanded \(see)-.15 |
| F F2(PR)2.565 E(OMPTING)-.27 E F0(belo)2.315 E .065 |
| (w\) and used as the primary prompt)-.25 F 2.5(string. The)144 432 R |
| (def)2.5 E(ault v)-.1 E(alue is `)-.25 E(`)-.74 E F1(\\s\255\\v\\$)A F0 |
| -.74('')2.5 G(.).74 E F1(PS2)108 444 Q F0 .118(The v)19.33 F .118 |
| (alue of this parameter is e)-.25 F .118(xpanded as with)-.15 F F2(PS1) |
| 2.617 E F0 .117(and used as the secondary prompt string.)2.367 F(The) |
| 5.117 E(def)144 456 Q(ault is `)-.1 E(`)-.74 E F1(>)A F0 -.74('')2.5 G |
| (.).74 E F1(PS3)108 468 Q F0 1.115(The v)19.33 F 1.115 |
| (alue of this parameter is used as the prompt for the)-.25 F F1(select) |
| 3.615 E F0 1.116(command \(see)3.616 F F2 1.116(SHELL GRAM-)3.616 F(MAR) |
| 144 480 Q F0(abo)2.25 E -.15(ve)-.15 G(\).).15 E F1(PS4)108 492 Q F0 |
| .101(The v)19.33 F .101(alue of this parameter is e)-.25 F .101 |
| (xpanded as with)-.15 F F2(PS1)2.6 E F0 .1(and the v)2.35 F .1 |
| (alue is printed before each command)-.25 F F1(bash)144 504 Q F0 .291 |
| (displays during an e)2.791 F -.15(xe)-.15 G .292(cution trace.).15 F |
| .292(The \214rst character of)5.292 F F2(PS4)2.792 E F0 .292 |
| (is replicated multiple times, as)2.542 F(necessary)144 516 Q 2.5(,t) |
| -.65 G 2.5(oi)-2.5 G(ndicate multiple le)-2.5 E -.15(ve)-.25 G |
| (ls of indirection.).15 E(The def)5 E(ault is `)-.1 E(`)-.74 E F1(+)A F0 |
| -.74('')2.5 G(.).74 E F1(SHELL)108 528 Q F0 .664 |
| (The full pathname to the shell is k)144 540 R .664(ept in this en)-.1 F |
| .664(vironment v)-.4 F 3.164(ariable. If)-.25 F .663 |
| (it is not set when the shell)3.164 F(starts,)144 552 Q F1(bash)2.5 E F0 |
| (assigns to it the full pathname of the current user')2.5 E 2.5(sl)-.55 |
| G(ogin shell.)-2.5 E F1(TIMEFORMA)108 564 Q(T)-.95 E F0 .826(The v)144 |
| 576 R .826 |
| (alue of this parameter is used as a format string specifying ho)-.25 F |
| 3.327(wt)-.25 G .827(he timing information for)-3.327 F .649 |
| (pipelines pre\214x)144 588 R .649(ed with the)-.15 F F1(time)3.149 E F0 |
| (reserv)3.149 E .649(ed w)-.15 F .648(ord should be displayed.)-.1 F |
| (The)5.648 E F1(%)3.148 E F0 .648(character introduces)3.148 F .711 |
| (an escape sequence that is e)144 600 R .711(xpanded to a time v)-.15 F |
| .712(alue or other information.)-.25 F .712(The escape sequences)5.712 F |
| (and their meanings are as follo)144 612 Q |
| (ws; the braces denote optional portions.)-.25 E F1(%%)144 630 Q F0 2.5 |
| (Al)30 G(iteral)-2.5 E F1(%)2.5 E F0(.)A F1(%[)144 642 Q F4(p)A F1 |
| (][l]R)A F0(The elapsed time in seconds.)11.68 E F1(%[)144 654 Q F4(p)A |
| F1(][l]U)A F0(The number of CPU seconds spent in user mode.)11.68 E F1 |
| (%[)144 666 Q F4(p)A F1(][l]S)A F0 |
| (The number of CPU seconds spent in system mode.)13.34 E F1(%P)144 678 Q |
| F0(The CPU percentage, computed as \(%U + %S\) / %R.)33.89 E .87 |
| (The optional)144 694.8 R F4(p)3.37 E F0 .87(is a digit specifying the) |
| 3.37 F F4(pr)3.37 E(ecision)-.37 E F0 3.37(,t)C .87 |
| (he number of fractional digits after a decimal)-3.37 F 2.525(point. A) |
| 144 706.8 R -.25(va)2.525 G .025 |
| (lue of 0 causes no decimal point or fraction to be output.).25 F .026 |
| (At most three places after the)5.025 F .538 |
| (decimal point may be speci\214ed; v)144 718.8 R .538(alues of)-.25 F F4 |
| (p)3.038 E F0 .537(greater than 3 are changed to 3.)3.037 F(If)5.537 E |
| F4(p)3.037 E F0 .537(is not speci\214ed,)3.037 F(the v)144 730.8 Q |
| (alue 3 is used.)-.25 E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E |
| (15)185.955 E 0 Cg EP |
| %%Page: 16 16 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .667(The optional)144 84 R/F1 10/Times-Bold@0 SF(l)3.167 E F0 |
| .668(speci\214es a longer format, including minutes, of the form)3.168 F |
| /F2 10/Times-Italic@0 SF(MM)3.168 E F0(m)A F2(SS)A F0(.)A F2(FF)A F0 |
| 3.168(s. The)B -.25(va)3.168 G(lue).25 E(of)144 96 Q F2(p)2.5 E F0 |
| (determines whether or not the fraction is included.)2.5 E .001 |
| (If this v)144 112.8 R .001(ariable is not set,)-.25 F F1(bash)2.501 E |
| F0 .001(acts as if it had the v)2.501 F(alue)-.25 E F1($\010\\nr)2.5 E |
| (eal\\t%3lR\\nuser\\t%3lU\\nsys%3lS\010)-.18 E F0(.)A .494(If the v)144 |
| 124.8 R .494(alue is null, no timing information is displayed.)-.25 F |
| 2.994(At)5.494 G .494(railing ne)-2.994 F .494 |
| (wline is added when the for)-.25 F(-)-.2 E(mat string is displayed.)144 |
| 136.8 Q F1(TMOUT)108 153.6 Q F0 .941(If set to a v)144 165.6 R .941 |
| (alue greater than zero,)-.25 F/F3 9/Times-Bold@0 SF(TMOUT)3.441 E F0 |
| .941(is treated as the def)3.191 F .941(ault timeout for the)-.1 F F1 |
| -.18(re)3.441 G(ad).18 E F0 -.2(bu)3.441 G(iltin.).2 E(The)144 177.6 Q |
| F1(select)2.81 E F0 .31(command terminates if input does not arri)2.81 F |
| .611 -.15(ve a)-.25 H(fter).15 E F3(TMOUT)2.811 E F0 .311 |
| (seconds when input is com-)2.561 F .886(ing from a terminal.)144 189.6 |
| R .886(In an interacti)5.886 F 1.185 -.15(ve s)-.25 H .885(hell, the v) |
| .15 F .885(alue is interpreted as the number of seconds to)-.25 F -.1 |
| (wa)144 201.6 S .546(it for input after issuing the primary prompt.).1 F |
| F1(Bash)5.546 E F0 .546(terminates after w)3.046 F .546 |
| (aiting for that number of)-.1 F(seconds if input does not arri)144 |
| 213.6 Q -.15(ve)-.25 G(.).15 E F1(TMPDIR)108 230.4 Q F0 .274(If set,)144 |
| 242.4 R F1(Bash)2.774 E F0 .274(uses its v)2.774 F .274 |
| (alue as the name of a directory in which)-.25 F F1(Bash)2.773 E F0 .273 |
| (creates temporary \214les for the)2.773 F(shell')144 254.4 Q 2.5(su) |
| -.55 G(se.)-2.5 E F1(auto_r)108 271.2 Q(esume)-.18 E F0 .53(This v)144 |
| 283.2 R .53(ariable controls ho)-.25 F 3.03(wt)-.25 G .531 |
| (he shell interacts with the user and job control.)-3.03 F .531 |
| (If this v)5.531 F .531(ariable is set,)-.25 F .539(single w)144 295.2 R |
| .538(ord simple commands without redirections are treated as candidates\ |
| for resumption of an)-.1 F -.15(ex)144 307.2 S .366(isting stopped job) |
| .15 F 5.366(.T)-.4 G .366(here is no ambiguity allo)-5.366 F .366 |
| (wed; if there is more than one job be)-.25 F .367(ginning with)-.15 F |
| 1.125(the string typed, the job most recently accessed is selected.)144 |
| 319.2 R(The)6.125 E F2(name)3.985 E F0 1.124(of a stopped job, in this) |
| 3.805 F(conte)144 331.2 Q 1.132 |
| (xt, is the command line used to start it.)-.15 F 1.133(If set to the v) |
| 6.133 F(alue)-.25 E F2 -.2(ex)3.633 G(act).2 E F0 3.633(,t).68 G 1.133 |
| (he string supplied must)-3.633 F .625 |
| (match the name of a stopped job e)144 343.2 R .624(xactly; if set to) |
| -.15 F F2(substring)3.124 E F0 3.124(,t).22 G .624 |
| (he string supplied needs to match a)-3.124 F .884 |
| (substring of the name of a stopped job)144 355.2 R 5.884(.T)-.4 G(he) |
| -5.884 E F2(substring)3.724 E F0 -.25(va)3.604 G .885(lue pro).25 F .885 |
| (vides functionality analogous to)-.15 F(the)144 367.2 Q F1(%?)3.334 E |
| F0 .834(job identi\214er \(see)5.834 F F3 .834(JOB CONTR)3.334 F(OL)-.27 |
| E F0(belo)3.084 E 3.334(w\). If)-.25 F .834(set to an)3.334 F 3.334(yo) |
| -.15 G .834(ther v)-3.334 F .833(alue, the supplied string)-.25 F .315 |
| (must be a pre\214x of a stopped job')144 379.2 R 2.816(sn)-.55 G .316 |
| (ame; this pro)-2.816 F .316(vides functionality analogous to the)-.15 F |
| F1(%)2.816 E F2(string)A F0(job)2.816 E(identi\214er)144 391.2 Q(.)-.55 |
| E F1(histchars)108 408 Q F0 2.07(The tw)144 420 R 4.57(oo)-.1 G 4.57(rt) |
| -4.57 G 2.07(hree characters which control history e)-4.57 F 2.07 |
| (xpansion and tok)-.15 F 2.07(enization \(see)-.1 F F3(HIST)4.569 E(OR) |
| -.162 E(Y)-.315 E(EXP)144 432 Q(ANSION)-.666 E F0(belo)3.465 E 3.715 |
| (w\). The)-.25 F 1.215(\214rst character is the)3.715 F F2 1.216 |
| (history e)3.715 F(xpansion)-.2 E F0(character)3.716 E 3.716(,t)-.4 G |
| 1.216(he character which)-3.716 F .798(signals the start of a history e) |
| 144 444 R .798(xpansion, normally `)-.15 F F1(!)A F0 3.298('. The)B .798 |
| (second character is the)3.298 F F2(quic)3.298 E 3.298(ks)-.2 G |
| (ubstitu-)-3.298 E(tion)144 456 Q F0(character)2.739 E 2.739(,w)-.4 G |
| .239(hich is used as shorthand for re-running the pre)-2.739 F .24 |
| (vious command entered, substitut-)-.25 F .576 |
| (ing one string for another in the command.)144 468 R .575(The def)5.575 |
| F .575(ault is `)-.1 F F1(^)A F0 3.075('. The)B .575 |
| (optional third character is the)3.075 F .223(character which indicates\ |
| that the remainder of the line is a comment when found as the \214rst \ |
| char)144 480 R(-)-.2 E 1.294(acter of a w)144 492 R 1.294 |
| (ord, normally `)-.1 F F1(#)A F0 3.794('. The)B 1.293 |
| (history comment character causes history substitution to be)3.794 F |
| .379(skipped for the remaining w)144 504 R .379(ords on the line.)-.1 F |
| .38(It does not necessarily cause the shell parser to treat)5.379 F |
| (the rest of the line as a comment.)144 516 Q F1(Arrays)87 532.8 Q(Bash) |
| 108 544.8 Q F0(pro)3.391 E .891(vides one-dimensional inde)-.15 F -.15 |
| (xe)-.15 G 3.391(da).15 G .891(nd associati)-3.391 F 1.191 -.15(ve a) |
| -.25 H .891(rray v).15 F 3.391(ariables. An)-.25 F 3.391(yv)-.15 G .89 |
| (ariable may be used as an)-3.641 F(inde)108 556.8 Q -.15(xe)-.15 G |
| 2.573(da).15 G .073(rray; the)-2.573 F F1(declar)2.573 E(e)-.18 E F0 -.2 |
| (bu)2.573 G .073(iltin will e).2 F .073(xplicitly declare an array)-.15 |
| F 5.073(.T)-.65 G .074(here is no maximum limit on the size of)-5.073 F |
| .329(an array)108 568.8 R 2.829(,n)-.65 G .329(or an)-2.829 F 2.829(yr) |
| -.15 G .329(equirement that members be inde)-2.829 F -.15(xe)-.15 G |
| 2.829(do).15 G 2.829(ra)-2.829 G .328(ssigned contiguously)-2.829 F |
| 5.328(.I)-.65 G(nde)-5.328 E -.15(xe)-.15 G 2.828(da).15 G .328 |
| (rrays are refer)-2.828 F(-)-.2 E 1.386(enced using inte)108 580.8 R |
| 1.386(gers \(including arithmetic e)-.15 F 3.887(xpressions\) and)-.15 F |
| 1.387(are zero-based; associati)3.887 F 1.687 -.15(ve a)-.25 H 1.387 |
| (rrays are refer).15 F(-)-.2 E(enced using arbitrary strings.)108 592.8 |
| Q 2.463(An inde)108 609.6 R -.15(xe)-.15 G 4.963(da).15 G 2.463 |
| (rray is created automatically if an)-4.963 F 4.963(yv)-.15 G 2.462 |
| (ariable is assigned to using the syntax)-5.213 F F2(name)4.962 E F0([)A |
| F2(sub-)A(script)108 621.6 Q F0(]=)A F2(value)A F0 5.682(.T)C(he)-5.682 |
| E F2(subscript)3.522 E F0 .682(is treated as an arithmetic e)3.862 F |
| .682(xpression that must e)-.15 F -.25(va)-.25 G .682 |
| (luate to a number greater).25 F .75(than or equal to zero.)108 633.6 R |
| 2.349 -.8(To e)5.749 H .749(xplicitly declare an inde).65 F -.15(xe)-.15 |
| G 3.249(da).15 G(rray)-3.249 E 3.249(,u)-.65 G(se)-3.249 E F1(declar) |
| 3.249 E 3.249<65ad>-.18 G(a)-3.249 E F2(name)3.249 E F0(\(see)3.249 E F3 |
| .749(SHELL B)3.249 F(UIL)-.09 E(TIN)-.828 E(COMMANDS)108 645.6 Q F0 |
| (belo)2.25 E(w\).)-.25 E F1(declar)5 E 2.5<65ad>-.18 G(a)-2.5 E F2(name) |
| 2.5 E F1([)A F2(subscript)A F1(])A F0(is also accepted; the)2.5 E F2 |
| (subscript)2.5 E F0(is ignored.)2.5 E(Associati)108 662.4 Q .3 -.15 |
| (ve a)-.25 H(rrays are created using).15 E F1(declar)2.5 E 2.5<65ad>-.18 |
| G(A)-2.5 E F2(name)2.5 E F0(.)A(Attrib)108 679.2 Q .94 |
| (utes may be speci\214ed for an array v)-.2 F .941(ariable using the) |
| -.25 F F1(declar)3.441 E(e)-.18 E F0(and)3.441 E F1 -.18(re)3.441 G |
| (adonly).18 E F0 -.2(bu)3.441 G 3.441(iltins. Each).2 F(attrib)3.441 E |
| (ute)-.2 E(applies to all members of an array)108 691.2 Q(.)-.65 E 1.647 |
| (Arrays are assigned to using compound assignments of the form)108 708 R |
| F2(name)4.147 E F0(=)A F1(\()A F0 -.25(va)C(lue).25 E F2(1)A F0 1.647 |
| (... v)4.147 F(alue)-.25 E F2(n)A F1(\))A F0 4.147(,w)C 1.647(here each) |
| -4.147 F F2(value)108 720 Q F0 .122(is of the form [)2.622 F F2 |
| (subscript)A F0(]=)A F2(string)A F0 5.122(.I)C(nde)-5.122 E -.15(xe)-.15 |
| G 2.622(da).15 G .122(rray assignments do not require the brack)-2.622 F |
| .122(et and subscript.)-.1 F(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(16)185.955 E 0 Cg EP |
| %%Page: 17 17 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .164(When assigning to inde)108 84 R -.15(xe)-.15 G 2.663(da).15 |
| G .163(rrays, if the optional brack)-2.663 F .163 |
| (ets and subscript are supplied, that inde)-.1 F 2.663(xi)-.15 G 2.663 |
| (sa)-2.663 G(ssigned)-2.663 E 1.41(to; otherwise the inde)108 96 R 3.91 |
| (xo)-.15 G 3.91(ft)-3.91 G 1.41(he element assigned is the last inde) |
| -3.91 F 3.911(xa)-.15 G 1.411(ssigned to by the statement plus one.) |
| -3.911 F(Inde)108 108 Q(xing starts at zero.)-.15 E |
| (When assigning to an associati)108 124.8 Q .3 -.15(ve a)-.25 H(rray).15 |
| E 2.5(,t)-.65 G(he subscript is required.)-2.5 E .24 |
| (This syntax is also accepted by the)108 141.6 R/F1 10/Times-Bold@0 SF |
| (declar)2.74 E(e)-.18 E F0 -.2(bu)2.739 G 2.739(iltin. Indi).2 F .239 |
| (vidual array elements may be assigned to using the)-.25 F/F2 10 |
| /Times-Italic@0 SF(name)108 153.6 Q F0([)A F2(subscript)A F0(]=)A F2 |
| (value)A F0(syntax introduced abo)2.5 E -.15(ve)-.15 G(.).15 E(An)108 |
| 170.4 Q 3.575(ye)-.15 G 1.075 |
| (lement of an array may be referenced using ${)-3.575 F F2(name)A F0([)A |
| F2(subscript)A F0 3.575(]}. The)B 1.076(braces are required to a)3.576 F |
| -.2(vo)-.2 G(id).2 E 1.542(con\215icts with pathname e)108 182.4 R 4.041 |
| (xpansion. If)-.15 F F2(subscript)4.041 E F0(is)4.041 E F1(@)4.041 E F0 |
| (or)4.041 E F1(*)4.041 E F0 4.041(,t)C 1.541(he w)-4.041 F 1.541(ord e) |
| -.1 F 1.541(xpands to all members of)-.15 F F2(name)4.041 E F0(.)A 1.056 |
| (These subscripts dif)108 194.4 R 1.056(fer only when the w)-.25 F 1.057 |
| (ord appears within double quotes.)-.1 F 1.057(If the w)6.057 F 1.057 |
| (ord is double-quoted,)-.1 F(${)108 206.4 Q F2(name)A F0 .521([*]} e)B |
| .521(xpands to a single w)-.15 F .521(ord with the v)-.1 F .52 |
| (alue of each array member separated by the \214rst character)-.25 F |
| 1.374(of the)108 218.4 R/F3 9/Times-Bold@0 SF(IFS)3.874 E F0 1.374 |
| (special v)3.624 F 1.375(ariable, and ${)-.25 F F2(name)A F0 1.375 |
| ([@]} e)B 1.375(xpands each element of)-.15 F F2(name)3.875 E F0 1.375 |
| (to a separate w)3.875 F 3.875(ord. When)-.1 F 2.028 |
| (there are no array members, ${)108 230.4 R F2(name)A F0 2.028([@]} e)B |
| 2.028(xpands to nothing.)-.15 F 2.027(If the double-quoted e)7.028 F |
| 2.027(xpansion occurs)-.15 F .758(within a w)108 242.4 R .759 |
| (ord, the e)-.1 F .759 |
| (xpansion of the \214rst parameter is joined with the be)-.15 F .759 |
| (ginning part of the original w)-.15 F(ord,)-.1 E .516(and the e)108 |
| 254.4 R .516(xpansion of the last parameter is joined with the last par\ |
| t of the original w)-.15 F 3.015(ord. This)-.1 F .515(is analogous)3.015 |
| F .227(to the e)108 266.4 R .228(xpansion of the special parameters)-.15 |
| F F1(*)2.728 E F0(and)2.728 E F1(@)2.728 E F0(\(see)2.728 E F1 .228 |
| (Special P)2.728 F(arameters)-.1 E F0(abo)2.728 E -.15(ve)-.15 G 2.728 |
| (\). ${#).15 F F2(name)A F0([)A F2(subscript)A F0(]})A -.15(ex)108 278.4 |
| S .886(pands to the length of ${).15 F F2(name)A F0([)A F2(subscript)A |
| F0 3.386(]}. If)B F2(subscript)3.386 E F0(is)3.386 E F1(*)3.386 E F0(or) |
| 3.386 E F1(@)3.386 E F0 3.386(,t)C .886(he e)-3.386 F .886 |
| (xpansion is the number of ele-)-.15 F .462(ments in the array)108 290.4 |
| R 5.462(.R)-.65 G .462(eferencing an array v)-5.462 F .463 |
| (ariable without a subscript is equi)-.25 F -.25(va)-.25 G .463 |
| (lent to referencing the array).25 F(with a subscript of 0.)108 302.4 Q |
| .168(An array v)108 319.2 R .168 |
| (ariable is considered set if a subscript has been assigned a v)-.25 F |
| 2.668(alue. The)-.25 F .168(null string is a v)2.668 F .168(alid v)-.25 |
| F(alue.)-.25 E(The)108 336 Q F1(unset)2.766 E F0 -.2(bu)2.766 G .267 |
| (iltin is used to destro).2 F 2.767(ya)-.1 G(rrays.)-2.767 E F1(unset) |
| 5.267 E F2(name)2.767 E F0([)A F2(subscript)A F0 2.767(]d)C(estro)-2.767 |
| E .267(ys the array element at inde)-.1 F(x)-.15 E F2(sub-)2.767 E |
| (script)108 348 Q F0 6.205(.C)C 1.205(are must be tak)-6.205 F 1.205 |
| (en to a)-.1 F -.2(vo)-.2 G 1.205(id unw).2 F 1.205(anted side ef)-.1 F |
| 1.204(fects caused by pathname e)-.25 F(xpansion.)-.15 E F1(unset)6.204 |
| E F2(name)3.704 E F0(,)A(where)108 360 Q F2(name)2.5 E F0(is an array) |
| 2.5 E 2.5(,o)-.65 G(r)-2.5 E F1(unset)2.5 E F2(name)2.5 E F0([)A F2 |
| (subscript)A F0(], where)A F2(subscript)2.5 E F0(is)2.5 E F1(*)2.5 E F0 |
| (or)2.5 E F1(@)2.5 E F0 2.5(,r)C(emo)-2.5 E -.15(ve)-.15 G 2.5(st).15 G |
| (he entire array)-2.5 E(.)-.65 E(The)108 376.8 Q F1(declar)3.573 E(e) |
| -.18 E F0(,)A F1(local)3.573 E F0 3.573(,a)C(nd)-3.573 E F1 -.18(re) |
| 3.573 G(adonly).18 E F0 -.2(bu)3.573 G 1.073(iltins each accept a).2 F |
| F1<ad61>3.573 E F0 1.073(option to specify an inde)3.573 F -.15(xe)-.15 |
| G 3.574(da).15 G 1.074(rray and a)-3.574 F F1<ad41>3.574 E F0 .752 |
| (option to specify an associati)108 388.8 R 1.052 -.15(ve a)-.25 H(rray) |
| .15 E 5.752(.T)-.65 G(he)-5.752 E F1 -.18(re)3.252 G(ad).18 E F0 -.2(bu) |
| 3.252 G .752(iltin accepts a).2 F F1<ad61>3.252 E F0 .751 |
| (option to assign a list of w)3.251 F .751(ords read)-.1 F .502 |
| (from the standard input to an array)108 400.8 R 5.502(.T)-.65 G(he) |
| -5.502 E F1(set)3.002 E F0(and)3.002 E F1(declar)3.002 E(e)-.18 E F0 -.2 |
| (bu)3.002 G .502(iltins display array v).2 F .502(alues in a w)-.25 F |
| .503(ay that allo)-.1 F(ws)-.25 E(them to be reused as assignments.)108 |
| 412.8 Q/F4 10.95/Times-Bold@0 SF(EXP)72 429.6 Q(ANSION)-.81 E F0 .76(Ex\ |
| pansion is performed on the command line after it has been split into w) |
| 108 441.6 R 3.26(ords. There)-.1 F .76(are se)3.26 F -.15(ve)-.25 G 3.26 |
| (nk).15 G .76(inds of)-3.26 F -.15(ex)108 453.6 S .369 |
| (pansion performed:).15 F F2(br)2.869 E .369(ace e)-.15 F(xpansion)-.2 E |
| F0(,).24 E F2 .369(tilde e)2.869 F(xpansion)-.2 E F0(,).24 E F2(par) |
| 2.869 E .369(ameter and variable e)-.15 F(xpansion)-.2 E F0(,).24 E F2 |
| .37(command sub-)2.869 F(stitution)108 465.6 Q F0(,).24 E F2 |
| (arithmetic e)2.5 E(xpansion)-.2 E F0(,).24 E F2(wor)2.5 E 2.5(ds)-.37 G |
| (plitting)-2.5 E F0 2.5(,a).22 G(nd)-2.5 E F2(pathname e)2.5 E(xpansion) |
| -.2 E F0(.).24 E .471(The order of e)108 482.4 R .471 |
| (xpansions is: brace e)-.15 F .471(xpansion, tilde e)-.15 F .471 |
| (xpansion, parameter)-.15 F 2.971(,v)-.4 G .47(ariable and arithmetic e) |
| -3.221 F(xpansion)-.15 E |
| (and command substitution \(done in a left-to-right f)108 494.4 Q |
| (ashion\), w)-.1 E(ord splitting, and pathname e)-.1 E(xpansion.)-.15 E |
| (On systems that can support it, there is an additional e)108 511.2 Q |
| (xpansion a)-.15 E -.25(va)-.2 G(ilable:).25 E F2(pr)2.5 E |
| (ocess substitution)-.45 E F0(.)A 1.486(Only brace e)108 528 R 1.486 |
| (xpansion, w)-.15 F 1.486(ord splitting, and pathname e)-.1 F 1.487 |
| (xpansion can change the number of w)-.15 F 1.487(ords of the)-.1 F -.15 |
| (ex)108 540 S 1.165(pansion; other e).15 F 1.165(xpansions e)-.15 F |
| 1.165(xpand a single w)-.15 F 1.165(ord to a single w)-.1 F 3.665 |
| (ord. The)-.1 F 1.164(only e)3.665 F 1.164(xceptions to this are the) |
| -.15 F -.15(ex)108 552 S(pansions of ").15 E F1($@)A F0 2.5("a)C(nd ") |
| -2.5 E F1(${)A F2(name)A F1([@]})A F0 2.5("a)C 2.5(se)-2.5 G |
| (xplained abo)-2.65 E .3 -.15(ve \()-.15 H(see).15 E F3 -.666(PA)2.5 G |
| (RAMETERS).666 E/F5 9/Times-Roman@0 SF(\).)A F1(Brace Expansion)87 568.8 |
| Q F2(Br)108.58 580.8 Q .606(ace e)-.15 F(xpansion)-.2 E F0 .606 |
| (is a mechanism by which arbitrary strings may be generated.)3.346 F |
| .606(This mechanism is similar)5.606 F(to)108 592.8 Q F2 .415 |
| (pathname e)2.915 F(xpansion)-.2 E F0 2.915(,b)C .415 |
| (ut the \214lenames generated need not e)-3.115 F 2.915(xist. P)-.15 F |
| .415(atterns to be brace e)-.15 F .415(xpanded tak)-.15 F 2.915(et)-.1 G |
| (he)-2.915 E .151(form of an optional)108 604.8 R F2(pr)2.651 E(eamble) |
| -.37 E F0 2.651(,f).18 G(ollo)-2.651 E .151 |
| (wed by either a series of comma-separated strings or a sequence e)-.25 |
| F(xpres-)-.15 E .563(sion between a pair of braces, follo)108 616.8 R |
| .563(wed by an optional)-.25 F F2(postscript)3.063 E F0 5.563(.T).68 G |
| .563(he preamble is pre\214x)-5.563 F .563(ed to each string)-.15 F .659 |
| (contained within the braces, and the postscript is then appended to ea\ |
| ch resulting string, e)108 628.8 R .659(xpanding left to)-.15 F(right.) |
| 108 640.8 Q .719(Brace e)108 657.6 R .719(xpansions may be nested.)-.15 |
| F .719(The results of each e)5.719 F .719 |
| (xpanded string are not sorted; left to right order is)-.15 F(preserv) |
| 108 669.6 Q 2.5(ed. F)-.15 F(or e)-.15 E(xample, a)-.15 E F1({)A F0 |
| (d,c,b)A F1(})A F0 2.5(ee)C(xpands into `ade ace abe'.)-2.65 E 3.242(As) |
| 108 686.4 S .742(equence e)-3.242 F .742(xpression tak)-.15 F .742 |
| (es the form)-.1 F F1({)3.242 E F2(x)A F1(..)A F2(y)A F1([..)A F2(incr)A |
| F1(]})A F0 3.242(,w)C(here)-3.242 E F2(x)3.242 E F0(and)3.243 E F2(y) |
| 3.243 E F0 .743(are either inte)3.243 F .743(gers or single characters,) |
| -.15 F(and)108 698.4 Q F2(incr)3.032 E F0 3.032(,a)C 3.032(no)-3.032 G |
| .532(ptional increment, is an inte)-3.032 F(ger)-.15 E 5.532(.W)-.55 G |
| .532(hen inte)-5.532 F .532(gers are supplied, the e)-.15 F .532 |
| (xpression e)-.15 F .531(xpands to each)-.15 F .077(number between)108 |
| 710.4 R F2(x)2.577 E F0(and)2.577 E F2(y)2.577 E F0 2.577(,i)C(nclusi) |
| -2.577 E -.15(ve)-.25 G 5.077(.S).15 G .077(upplied inte)-5.077 F .077 |
| (gers may be pre\214x)-.15 F .077(ed with)-.15 F F2(0)2.577 E F0 .078 |
| (to force each term to ha)2.578 F .378 -.15(ve t)-.2 H(he).15 E .015 |
| (same width.)108 722.4 R .015(When either)5.015 F F2(x)2.515 E F0(or) |
| 2.515 E F2(y)2.515 E F0(be)2.515 E .014(gins with a zero, the shell att\ |
| empts to force all generated terms to contain)-.15 F(GNU Bash-4.1)72 768 |
| Q(2009 December 29)135.965 E(17)185.955 E 0 Cg EP |
| %%Page: 18 18 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 1.143(the same number of digits, zero-padding where necessary)108 |
| 84 R 6.143(.W)-.65 G 1.143(hen characters are supplied, the e)-6.143 F |
| (xpression)-.15 E -.15(ex)108 96 S .542(pands to each character le).15 F |
| .542(xicographically between)-.15 F/F1 10/Times-Italic@0 SF(x)3.042 E F0 |
| (and)3.042 E F1(y)3.042 E F0 3.042(,i)C(nclusi)-3.042 E -.15(ve)-.25 G |
| 5.542(.N).15 G .542(ote that both)-5.542 F F1(x)3.041 E F0(and)3.041 E |
| F1(y)3.041 E F0 .541(must be of)3.041 F .182(the same type.)108 108 R |
| .182(When the increment is supplied, it is used as the dif)5.182 F .183 |
| (ference between each term.)-.25 F .183(The def)5.183 F(ault)-.1 E |
| (increment is 1 or -1 as appropriate.)108 120 Q .582(Brace e)108 136.8 R |
| .582(xpansion is performed before an)-.15 F 3.082(yo)-.15 G .581(ther e) |
| -3.082 F .581(xpansions, and an)-.15 F 3.081(yc)-.15 G .581 |
| (haracters special to other e)-3.081 F(xpansions)-.15 E .015 |
| (are preserv)108 148.8 R .015(ed in the result.)-.15 F .015 |
| (It is strictly te)5.015 F(xtual.)-.15 E/F2 10/Times-Bold@0 SF(Bash) |
| 5.016 E F0 .016(does not apply an)2.516 F 2.516(ys)-.15 G .016 |
| (yntactic interpretation to the con-)-2.516 F(te)108 160.8 Q |
| (xt of the e)-.15 E(xpansion or the te)-.15 E(xt between the braces.) |
| -.15 E 3.633(Ac)108 177.6 S 1.133(orrectly-formed brace e)-3.633 F 1.132 |
| (xpansion must contain unquoted opening and closing braces, and at leas\ |
| t one)-.15 F 3.44(unquoted comma or a v)108 189.6 R 3.441 |
| (alid sequence e)-.25 F 5.941(xpression. An)-.15 F 5.941(yi)-.15 G 3.441 |
| (ncorrectly formed brace e)-5.941 F 3.441(xpansion is left)-.15 F 2.755 |
| (unchanged. A)108 201.6 R F2({)2.755 E F0(or)2.755 E F2(,)2.755 E F0 |
| .255(may be quoted with a backslash to pre)2.755 F -.15(ve)-.25 G .255 |
| (nt its being considered part of a brace e).15 F(xpres-)-.15 E 2.91 |
| (sion. T)108 213.6 R 2.91(oa)-.8 G -.2(vo)-3.11 G .41 |
| (id con\215icts with parameter e).2 F .411(xpansion, the string)-.15 F |
| F2(${)2.911 E F0 .411(is not considered eligible for brace e)2.911 F |
| (xpan-)-.15 E(sion.)108 225.6 Q 1.476(This construct is typically used \ |
| as shorthand when the common pre\214x of the strings to be generated is) |
| 108 242.4 R(longer than in the abo)108 254.4 Q .3 -.15(ve ex)-.15 H |
| (ample:).15 E(mkdir /usr/local/src/bash/{old,ne)144 271.2 Q -.65(w,)-.25 |
| G(dist,b).65 E(ugs})-.2 E(or)108 283.2 Q(cho)144 295.2 Q |
| (wn root /usr/{ucb/{e)-.25 E(x,edit},lib/{e)-.15 E(x?.?*,ho)-.15 E(w_e) |
| -.25 E(x}})-.15 E .618(Brace e)108 312 R .618 |
| (xpansion introduces a slight incompatibility with historical v)-.15 F |
| .618(ersions of)-.15 F F2(sh)3.118 E F0(.)A F2(sh)5.618 E F0 .618 |
| (does not treat open-)3.118 F .248 |
| (ing or closing braces specially when the)108 324 R 2.748(ya)-.15 G .247 |
| (ppear as part of a w)-2.748 F .247(ord, and preserv)-.1 F .247 |
| (es them in the output.)-.15 F F2(Bash)5.247 E F0(remo)108 336 Q -.15 |
| (ve)-.15 G 3.53(sb).15 G 1.03(races from w)-3.53 F 1.03 |
| (ords as a consequence of brace e)-.1 F 3.53(xpansion. F)-.15 F 1.03 |
| (or e)-.15 F 1.03(xample, a w)-.15 F 1.03(ord entered to)-.1 F F2(sh) |
| 3.53 E F0(as)3.53 E F1(\214le{1,2})108 348 Q F0 .515 |
| (appears identically in the output.)3.015 F .515(The same w)5.515 F .515 |
| (ord is output as)-.1 F F1 .514(\214le1 \214le2)4.925 F F0 .514(after e) |
| 3.034 F .514(xpansion by)-.15 F F2(bash)3.014 E F0(.)A .436 |
| (If strict compatibility with)108 360 R F2(sh)2.936 E F0 .436 |
| (is desired, start)2.936 F F2(bash)2.936 E F0 .436(with the)2.936 F F2 |
| (+B)2.936 E F0 .436(option or disable brace e)2.936 F .437 |
| (xpansion with the)-.15 F F2(+B)108 372 Q F0(option to the)2.5 E F2(set) |
| 2.5 E F0(command \(see)2.5 E/F3 9/Times-Bold@0 SF(SHELL B)2.5 E(UIL)-.09 |
| E(TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).)-.25 E F2 -.18(Ti)87 388.8 S |
| (lde Expansion).18 E F0 1.087(If a w)108 400.8 R 1.087(ord be)-.1 F |
| 1.087(gins with an unquoted tilde character \(`)-.15 F F2(~)A F0 1.086 |
| ('\), all of the characters preceding the \214rst unquoted)B .185(slash\ |
| \(or all characters, if there is no unquoted slash\) are considered a) |
| 108 412.8 R F1(tilde-pr)2.685 E(e\214x)-.37 E F0 5.185(.I)C 2.685(fn) |
| -5.185 G .185(one of the characters)-2.685 F .726(in the tilde-pre\214x\ |
| are quoted, the characters in the tilde-pre\214x follo)108 424.8 R .725 |
| (wing the tilde are treated as a possible)-.25 F F1(lo)108 436.8 Q .522 |
| (gin name)-.1 F F0 5.522(.I)C 3.022(ft)-5.522 G .522 |
| (his login name is the null string, the tilde is replaced with the v) |
| -3.022 F .523(alue of the shell parameter)-.25 F F3(HOME)108 448.8 Q/F4 |
| 9/Times-Roman@0 SF(.)A F0(If)4.787 E F3(HOME)2.787 E F0 .287 |
| (is unset, the home directory of the user e)2.537 F -.15(xe)-.15 G .286 |
| (cuting the shell is substituted instead.).15 F(Other)5.286 E(-)-.2 E(w\ |
| ise, the tilde-pre\214x is replaced with the home directory associated \ |
| with the speci\214ed login name.)108 460.8 Q .092 |
| (If the tilde-pre\214x is a `~+', the v)108 477.6 R .092 |
| (alue of the shell v)-.25 F(ariable)-.25 E F3(PWD)2.592 E F0 .092 |
| (replaces the tilde-pre\214x.)2.342 F .093(If the tilde-pre\214x is) |
| 5.093 F 3.404(a`)108 489.6 S .904(~\255', the v)-3.404 F .904 |
| (alue of the shell v)-.25 F(ariable)-.25 E F3(OLDPWD)3.404 E F4(,)A F0 |
| .904(if it is set, is substituted.)3.154 F .903(If the characters follo) |
| 5.903 F .903(wing the)-.25 F 1.641 |
| (tilde in the tilde-pre\214x consist of a number)108 501.6 R F1(N)4.141 |
| E F0 4.142(,o)C 1.642(ptionally pre\214x)-4.142 F 1.642 |
| (ed by a `+' or a `\255', the tilde-pre\214x is)-.15 F 1.438(replaced w\ |
| ith the corresponding element from the directory stack, as it w)108 |
| 513.6 R 1.437(ould be displayed by the)-.1 F F2(dirs)3.937 E F0 -.2(bu) |
| 108 525.6 S .454(iltin in).2 F -.2(vo)-.4 G -.1(ke).2 G 2.954(dw).1 G |
| .454(ith the tilde-pre\214x as an ar)-2.954 F 2.954(gument. If)-.18 F |
| .454(the characters follo)2.954 F .455 |
| (wing the tilde in the tilde-pre\214x)-.25 F |
| (consist of a number without a leading `+' or `\255', `+' is assumed.) |
| 108 537.6 Q(If the login name is in)108 554.4 Q -.25(va)-.4 G |
| (lid, or the tilde e).25 E(xpansion f)-.15 E(ails, the w)-.1 E |
| (ord is unchanged.)-.1 E .167(Each v)108 571.2 R .167 |
| (ariable assignment is check)-.25 F .167(ed for unquoted tilde-pre\214x) |
| -.1 F .167(es immediately follo)-.15 F .167(wing a)-.25 F F2(:)2.667 E |
| F0 .167(or the \214rst)2.667 F F2(=)2.666 E F0 5.166(.I)C(n)-5.166 E |
| .281(these cases, tilde e)108 583.2 R .282(xpansion is also performed.) |
| -.15 F(Consequently)5.282 E 2.782(,o)-.65 G .282 |
| (ne may use \214le names with tildes in assign-)-2.782 F(ments to)108 |
| 595.2 Q F3 -.666(PA)2.5 G(TH)-.189 E F4(,)A F3(MAILP)2.25 E -.855(AT) |
| -.666 G(H).855 E F4(,)A F0(and)2.25 E F3(CDP)2.5 E -.855(AT)-.666 G(H) |
| .855 E F4(,)A F0(and the shell assigns the e)2.25 E(xpanded v)-.15 E |
| (alue.)-.25 E F2 -.1(Pa)87 612 S(rameter Expansion).1 E F0 1.606(The `) |
| 108 624 R F2($)A F0 4.106('c)C 1.606(haracter introduces parameter e) |
| -4.106 F 1.605(xpansion, command substitution, or arithmetic e)-.15 F |
| 4.105(xpansion. The)-.15 F .406(parameter name or symbol to be e)108 636 |
| R .407(xpanded may be enclosed in braces, which are optional b)-.15 F |
| .407(ut serv)-.2 F 2.907(et)-.15 G 2.907(op)-2.907 G(ro-)-2.907 E .033 |
| (tect the v)108 648 R .033(ariable to be e)-.25 F .033 |
| (xpanded from characters immediately follo)-.15 F .032 |
| (wing it which could be interpreted as part)-.25 F(of the name.)108 660 |
| Q 1.189 |
| (When braces are used, the matching ending brace is the \214rst `)108 |
| 676.8 R F2(})A F0 3.69('n)C 1.19(ot escaped by a backslash or within a) |
| -3.69 F 2.15(quoted string, and not within an embedded arithmetic e)108 |
| 688.8 R 2.15(xpansion, command substitution, or parameter)-.15 F -.15 |
| (ex)108 700.8 S(pansion.).15 E(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(18)185.955 E 0 Cg EP |
| %%Page: 19 19 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(${)108 84 Q/F1 10/Times-Italic@0 SF(par)A(ameter)-.15 E F0(})A |
| 1.204(The v)144 96 R 1.204(alue of)-.25 F F1(par)3.704 E(ameter)-.15 E |
| F0 1.204(is substituted.)3.704 F 1.204(The braces are required when) |
| 6.204 F F1(par)4.955 E(ameter)-.15 E F0 1.205(is a positional)4.435 F |
| .264(parameter with more than one digit, or when)144 108 R F1(par)4.014 |
| E(ameter)-.15 E F0 .264(is follo)3.494 F .264 |
| (wed by a character which is not to)-.25 F |
| (be interpreted as part of its name.)144 120 Q .685 |
| (If the \214rst character of)108 136.8 R F1(par)3.185 E(ameter)-.15 E F0 |
| .685(is an e)3.185 F .685(xclamation point \()-.15 F/F2 10/Times-Bold@0 |
| SF(!)A F0 .685(\), a le)B -.15(ve)-.25 G 3.186(lo).15 G 3.186(fv)-3.186 |
| G .686(ariable indirection is introduced.)-3.436 F F2(Bash)108 148.8 Q |
| F0 .106(uses the v)2.606 F .106(alue of the v)-.25 F .106 |
| (ariable formed from the rest of)-.25 F F1(par)2.606 E(ameter)-.15 E F0 |
| .106(as the name of the v)2.606 F .106(ariable; this v)-.25 F(ari-)-.25 |
| E .351(able is then e)108 160.8 R .351(xpanded and that v)-.15 F .352 |
| (alue is used in the rest of the substitution, rather than the v)-.25 F |
| .352(alue of)-.25 F F1(par)2.852 E(ame-)-.15 E(ter)108 172.8 Q F0 2.52 |
| (itself. This)2.52 F .02(is kno)2.52 F .02(wn as)-.25 F F1(indir)2.52 E |
| .02(ect e)-.37 F(xpansion)-.2 E F0 5.019(.T)C .019(he e)-5.019 F .019 |
| (xceptions to this are the e)-.15 F .019(xpansions of ${!)-.15 F F1(pr)A |
| (e\214x)-.37 E F0 .019(*} and)B(${)108 184.8 Q F2(!)A F1(name)A F0([)A |
| F1(@)A F0 .762(]} described belo)B 4.563 -.65(w. T)-.25 H .763(he e).65 |
| F .763(xclamation point must immediately follo)-.15 F 3.263(wt)-.25 G |
| .763(he left brace in order to)-3.263 F(introduce indirection.)108 196.8 |
| Q .334(In each of the cases belo)108 213.6 R -.65(w,)-.25 G F1(wor)3.484 |
| E(d)-.37 E F0 .334(is subject to tilde e)2.834 F .334 |
| (xpansion, parameter e)-.15 F .334(xpansion, command substitution,)-.15 |
| F(and arithmetic e)108 225.6 Q(xpansion.)-.15 E .697 |
| (When not performing substring e)108 242.4 R .698 |
| (xpansion, using the forms documented belo)-.15 F -.65(w,)-.25 G F2 |
| (bash)3.848 E F0 .698(tests for a parameter)3.198 F |
| (that is unset or null.)108 254.4 Q(Omitting the colon results in a tes\ |
| t only for a parameter that is unset.)5 E(${)108 271.2 Q F1(par)A |
| (ameter)-.15 E F2<3aad>A F1(wor)A(d)-.37 E F0(})A F2 .723(Use Default V) |
| 144 283.2 R(alues)-.92 E F0 5.723(.I)C(f)-5.723 E F1(par)4.473 E(ameter) |
| -.15 E F0 .723(is unset or null, the e)3.953 F .722(xpansion of)-.15 F |
| F1(wor)3.562 E(d)-.37 E F0 .722(is substituted.)3.992 F(Other)5.722 E(-) |
| -.2 E(wise, the v)144 295.2 Q(alue of)-.25 E F1(par)3.75 E(ameter)-.15 E |
| F0(is substituted.)3.23 E(${)108 307.2 Q F1(par)A(ameter)-.15 E F2(:=)A |
| F1(wor)A(d)-.37 E F0(})A F2 2.004(Assign Default V)144 319.2 R(alues) |
| -.92 E F0 7.004(.I)C(f)-7.004 E F1(par)5.754 E(ameter)-.15 E F0 2.005 |
| (is unset or null, the e)5.234 F 2.005(xpansion of)-.15 F F1(wor)4.845 E |
| (d)-.37 E F0 2.005(is assigned to)5.275 F F1(par)144 331.2 Q(ameter)-.15 |
| E F0 5.279(.T).73 G .279(he v)-5.279 F .279(alue of)-.25 F F1(par)4.029 |
| E(ameter)-.15 E F0 .278(is then substituted.)3.508 F .278 |
| (Positional parameters and special param-)5.278 F |
| (eters may not be assigned to in this w)144 343.2 Q(ay)-.1 E(.)-.65 E |
| (${)108 355.2 Q F1(par)A(ameter)-.15 E F2(:?)A F1(wor)A(d)-.37 E F0(})A |
| F2 .535(Display Err)144 367.2 R .535(or if Null or Unset)-.18 F F0 5.535 |
| (.I)C(f)-5.535 E F1(par)4.285 E(ameter)-.15 E F0 .535 |
| (is null or unset, the e)3.765 F .535(xpansion of)-.15 F F1(wor)3.035 E |
| (d)-.37 E F0 .535(\(or a mes-)3.035 F .662(sage to that ef)144 379.2 R |
| .662(fect if)-.25 F F1(wor)3.502 E(d)-.37 E F0 .661(is not present\) is\ |
| written to the standard error and the shell, if it is not)3.932 F |
| (interacti)144 391.2 Q -.15(ve)-.25 G 2.5(,e).15 G 2.5(xits. Otherwise,) |
| -2.65 F(the v)2.5 E(alue of)-.25 E F1(par)2.5 E(ameter)-.15 E F0 |
| (is substituted.)2.5 E(${)108 403.2 Q F1(par)A(ameter)-.15 E F2(:+)A F1 |
| (wor)A(d)-.37 E F0(})A F2 .745(Use Alter)144 415.2 R .745(nate V)-.15 F |
| (alue)-.92 E F0 5.745(.I)C(f)-5.745 E F1(par)4.495 E(ameter)-.15 E F0 |
| .745(is null or unset, nothing is substituted, otherwise the e)3.975 F |
| (xpan-)-.15 E(sion of)144 427.2 Q F1(wor)2.84 E(d)-.37 E F0 |
| (is substituted.)3.27 E(${)108 439.2 Q F1(par)A(ameter)-.15 E F2(:)A F1 |
| (of)A(fset)-.18 E F0(})A(${)108 451.2 Q F1(par)A(ameter)-.15 E F2(:)A F1 |
| (of)A(fset)-.18 E F2(:)A F1(length)A F0(})A F2 .797 |
| (Substring Expansion.)144 463.2 R F0 .796(Expands to up to)5.797 F F1 |
| (length)3.296 E F0 .796(characters of)3.296 F F1(par)3.296 E(ameter)-.15 |
| E F0 .796(starting at the character)3.296 F .228(speci\214ed by)144 |
| 475.2 R F1(of)2.728 E(fset)-.18 E F0 5.228(.I)C(f)-5.228 E F1(length) |
| 2.728 E F0 .229(is omitted, e)2.729 F .229(xpands to the substring of) |
| -.15 F F1(par)2.729 E(ameter)-.15 E F0 .229(starting at the char)2.729 F |
| (-)-.2 E .433(acter speci\214ed by)144 487.2 R F1(of)2.933 E(fset)-.18 E |
| F0(.)A F1(length)5.433 E F0(and)2.933 E F1(of)2.933 E(fset)-.18 E F0 |
| .433(are arithmetic e)2.933 F .433(xpressions \(see)-.15 F/F3 9 |
| /Times-Bold@0 SF .432(ARITHMETIC EV)2.933 F(ALU-)-1.215 E -.855(AT)144 |
| 499.2 S(ION).855 E F0(belo)2.576 E(w\).)-.25 E F1(length)5.326 E F0 .326 |
| (must e)2.826 F -.25(va)-.25 G .326 |
| (luate to a number greater than or equal to zero.).25 F(If)5.327 E F1 |
| (of)2.827 E(fset)-.18 E F0 -.25(eva)2.827 G(luates).25 E .016 |
| (to a number less than zero, the v)144 511.2 R .015 |
| (alue is used as an of)-.25 F .015(fset from the end of the v)-.25 F |
| .015(alue of)-.25 F F1(par)2.515 E(ameter)-.15 E F0 5.015(.I)C(f)-5.015 |
| E F1(par)144 523.2 Q(ameter)-.15 E F0(is)3.25 E F2(@)3.25 E F0 3.25(,t)C |
| .75(he result is)-3.25 F F1(length)3.25 E F0 .75 |
| (positional parameters be)3.25 F .75(ginning at)-.15 F F1(of)3.25 E |
| (fset)-.18 E F0 5.75(.I)C(f)-5.75 E F1(par)3.25 E(ameter)-.15 E F0 .75 |
| (is an)3.25 F(inde)144 535.2 Q -.15(xe)-.15 G 2.702(da).15 G .201 |
| (rray name subscripted by @ or *, the result is the)-2.702 F F1(length) |
| 2.701 E F0 .201(members of the array be)2.701 F(ginning)-.15 E 1.282 |
| (with ${)144 547.2 R F1(par)A(ameter)-.15 E F0([)A F1(of)A(fset)-.18 E |
| F0 3.782(]}. A)B(ne)3.782 E -.05(ga)-.15 G(ti).05 E -.15(ve)-.25 G F1 |
| (of)3.932 E(fset)-.18 E F0 1.282(is tak)3.782 F 1.282(en relati)-.1 F |
| 1.582 -.15(ve t)-.25 H 3.782(oo).15 G 1.283(ne greater than the maximum) |
| -3.782 F(inde)144 559.2 Q 3.435(xo)-.15 G 3.435(ft)-3.435 G .935 |
| (he speci\214ed array)-3.435 F 5.935(.S)-.65 G .935(ubstring e)-5.935 F |
| .935(xpansion applied to an associati)-.15 F 1.234 -.15(ve a)-.25 H .934 |
| (rray produces unde-).15 F .261(\214ned results.)144 571.2 R .261 |
| (Note that a ne)5.261 F -.05(ga)-.15 G(ti).05 E .561 -.15(ve o)-.25 H |
| -.25(ff).15 G .261 |
| (set must be separated from the colon by at least one space to).25 F -.2 |
| (avo)144 583.2 S .155(id being confused with the :- e).2 F 2.655 |
| (xpansion. Substring)-.15 F(inde)2.655 E .154 |
| (xing is zero-based unless the positional)-.15 F .532 |
| (parameters are used, in which case the inde)144 595.2 R .532 |
| (xing starts at 1 by def)-.15 F 3.032(ault. If)-.1 F F1(of)3.032 E(fset) |
| -.18 E F0 .532(is 0, and the posi-)3.032 F(tional parameters are used,) |
| 144 607.2 Q F2($0)2.5 E F0(is pre\214x)2.5 E(ed to the list.)-.15 E(${) |
| 108 624 Q F2(!)A F1(pr)A(e\214x)-.37 E F2(*)A F0(})A(${)108 636 Q F2(!)A |
| F1(pr)A(e\214x)-.37 E F2(@)A F0(})A F2 .085(Names matching pr)144 648 R |
| (e\214x.)-.18 E F0 .084(Expands to the names of v)5.085 F .084 |
| (ariables whose names be)-.25 F .084(gin with)-.15 F F1(pr)2.584 E |
| (e\214x)-.37 E F0 2.584(,s)C(epa-)-2.584 E .257 |
| (rated by the \214rst character of the)144 660 R F3(IFS)2.757 E F0 .257 |
| (special v)2.507 F 2.757(ariable. When)-.25 F F1(@)2.758 E F0 .258 |
| (is used and the e)2.758 F .258(xpansion appears)-.15 F |
| (within double quotes, each v)144 672 Q(ariable name e)-.25 E |
| (xpands to a separate w)-.15 E(ord.)-.1 E(${)108 688.8 Q F2(!)A F1(name) |
| A F0([)A F1(@)A F0(]})A(${)108 700.8 Q F2(!)A F1(name)A F0([)A F1(*)A F0 |
| (]})A F2 2.036(List of array k)144 712.8 R(eys.)-.1 E F0(If)7.036 E F1 |
| (name)4.536 E F0 2.036(is an array v)4.536 F 2.036(ariable, e)-.25 F |
| 2.036(xpands to the list of array indices \(k)-.15 F -.15(ey)-.1 G(s\)) |
| .15 E .595(assigned in)144 724.8 R F1(name)3.095 E F0 5.595(.I)C(f) |
| -5.595 E F1(name)3.095 E F0 .595(is not an array)3.095 F 3.095(,e)-.65 G |
| .595(xpands to 0 if)-3.245 F F1(name)3.095 E F0 .596 |
| (is set and null otherwise.)3.095 F(When)5.596 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(19)185.955 E 0 Cg EP |
| %%Page: 20 20 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Italic@0 SF(@)144 84 Q F0(is used and the e)2.5 E |
| (xpansion appears within double quotes, each k)-.15 E .3 -.15(ey ex)-.1 |
| H(pands to a separate w).15 E(ord.)-.1 E(${)108 100.8 Q/F2 10 |
| /Times-Bold@0 SF(#)A F1(par)A(ameter)-.15 E F0(})A F2 -.1(Pa)144 112.8 S |
| .471(rameter length.).1 F F0 .471(The length in characters of the v) |
| 5.471 F .471(alue of)-.25 F F1(par)2.971 E(ameter)-.15 E F0 .47 |
| (is substituted.)2.97 F(If)5.47 E F1(par)4.22 E(ame-)-.15 E(ter)144 |
| 124.8 Q F0(is)4.438 E F2(*)3.708 E F0(or)3.708 E F2(@)3.708 E F0 3.708 |
| (,t)C 1.208(he v)-3.708 F 1.208 |
| (alue substituted is the number of positional parameters.)-.25 F(If) |
| 6.209 E F1(par)4.959 E(ameter)-.15 E F0 1.209(is an)4.439 F |
| (array name subscripted by)144 136.8 Q F2(*)2.5 E F0(or)2.5 E F2(@)2.5 E |
| F0 2.5(,t)C(he v)-2.5 E |
| (alue substituted is the number of elements in the array)-.25 E(.)-.65 E |
| (${)108 153.6 Q F1(par)A(ameter)-.15 E F2(#)A F1(wor)A(d)-.37 E F0(})A |
| (${)108 165.6 Q F1(par)A(ameter)-.15 E F2(##)A F1(wor)A(d)-.37 E F0(})A |
| F2(Remo)144 177.6 Q 1.396 -.1(ve m)-.1 H 1.196(atching pr).1 F 1.196 |
| (e\214x patter)-.18 F(n.)-.15 E F0(The)6.196 E F1(wor)4.036 E(d)-.37 E |
| F0 1.196(is e)4.466 F 1.196 |
| (xpanded to produce a pattern just as in path-)-.15 F .151(name e)144 |
| 189.6 R 2.651(xpansion. If)-.15 F .152(the pattern matches the be)2.652 |
| F .152(ginning of the v)-.15 F .152(alue of)-.25 F F1(par)2.652 E |
| (ameter)-.15 E F0 2.652(,t).73 G .152(hen the result of)-2.652 F 1.4 |
| (the e)144 201.6 R 1.4(xpansion is the e)-.15 F 1.4(xpanded v)-.15 F 1.4 |
| (alue of)-.25 F F1(par)5.15 E(ameter)-.15 E F0 1.4 |
| (with the shortest matching pattern \(the `)4.63 F(`)-.74 E F2(#)A F0 |
| -.74('')C .281(case\) or the longest matching pattern \(the `)144 213.6 |
| R(`)-.74 E F2(##)A F0 1.761 -.74('' c)D .281(ase\) deleted.).74 F(If) |
| 5.281 E F1(par)4.031 E(ameter)-.15 E F0(is)3.511 E F2(@)2.781 E F0(or) |
| 2.781 E F2(*)2.782 E F0 2.782(,t)C .282(he pattern)-2.782 F(remo)144 |
| 225.6 Q -.25(va)-.15 G 3.274(lo).25 G .774 |
| (peration is applied to each positional parameter in turn, and the e) |
| -3.274 F .774(xpansion is the resul-)-.15 F .401(tant list.)144 237.6 R |
| (If)5.401 E F1(par)4.151 E(ameter)-.15 E F0 .401(is an array v)3.631 F |
| .401(ariable subscripted with)-.25 F F2(@)2.901 E F0(or)2.901 E F2(*) |
| 2.901 E F0 2.902(,t)C .402(he pattern remo)-2.902 F -.25(va)-.15 G 2.902 |
| (lo).25 G(peration)-2.902 E |
| (is applied to each member of the array in turn, and the e)144 249.6 Q |
| (xpansion is the resultant list.)-.15 E(${)108 266.4 Q F1(par)A(ameter) |
| -.15 E F2(%)A F1(wor)A(d)-.37 E F0(})A(${)108 278.4 Q F1(par)A(ameter) |
| -.15 E F2(%%)A F1(wor)A(d)-.37 E F0(})A F2(Remo)144 290.4 Q .347 -.1 |
| (ve m)-.1 H .147(atching suf\214x patter).1 F(n.)-.15 E F0(The)5.147 E |
| F1(wor)2.647 E(d)-.37 E F0 .147(is e)2.647 F .146 |
| (xpanded to produce a pattern just as in pathname)-.15 F -.15(ex)144 |
| 302.4 S 3.088(pansion. If).15 F .588 |
| (the pattern matches a trailing portion of the e)3.088 F .588(xpanded v) |
| -.15 F .588(alue of)-.25 F F1(par)3.088 E(ameter)-.15 E F0 3.088(,t).73 |
| G .588(hen the)-3.088 F .226(result of the e)144 314.4 R .226 |
| (xpansion is the e)-.15 F .226(xpanded v)-.15 F .226(alue of)-.25 F F1 |
| (par)3.976 E(ameter)-.15 E F0 .226 |
| (with the shortest matching pattern \(the)3.456 F -.74(``)144 326.4 S F2 |
| (%).74 E F0 1.521 -.74('' c)D .042 |
| (ase\) or the longest matching pattern \(the `).74 F(`)-.74 E F2(%%)A F0 |
| 1.522 -.74('' c)D .042(ase\) deleted.).74 F(If)5.042 E F1(par)3.792 E |
| (ameter)-.15 E F0(is)3.272 E F2(@)2.542 E F0(or)2.542 E F2(*)2.542 E F0 |
| 2.542(,t)C(he)-2.542 E .441(pattern remo)144 338.4 R -.25(va)-.15 G |
| 2.941(lo).25 G .441 |
| (peration is applied to each positional parameter in turn, and the e) |
| -2.941 F .44(xpansion is the)-.15 F .24(resultant list.)144 350.4 R(If) |
| 5.24 E F1(par)3.99 E(ameter)-.15 E F0 .24(is an array v)3.47 F .241 |
| (ariable subscripted with)-.25 F F2(@)2.741 E F0(or)2.741 E F2(*)2.741 E |
| F0 2.741(,t)C .241(he pattern remo)-2.741 F -.25(va)-.15 G 2.741(lo).25 |
| G(per)-2.741 E(-)-.2 E |
| (ation is applied to each member of the array in turn, and the e)144 |
| 362.4 Q(xpansion is the resultant list.)-.15 E(${)108 379.2 Q F1(par)A |
| (ameter)-.15 E F2(/)A F1(pattern)A F2(/)A F1(string)A F0(})A F2 -.1(Pa) |
| 144 391.2 S(tter).1 E 3.607(ns)-.15 G(ubstitution.)-3.607 E F0(The)6.107 |
| E F1(pattern)3.607 E F0 1.107(is e)3.607 F 1.106 |
| (xpanded to produce a pattern just as in pathname e)-.15 F(xpan-)-.15 E |
| (sion.)144 403.2 Q F1 -.8(Pa)6.033 G -.15(ra).8 G(meter).15 E F0 1.033 |
| (is e)3.533 F 1.033(xpanded and the longest match of)-.15 F F1(pattern) |
| 3.533 E F0(ag)3.533 E 1.034(ainst its v)-.05 F 1.034 |
| (alue is replaced with)-.25 F F1(string)144 415.2 Q F0 5.161(.I)C(f) |
| -5.161 E F1(pattern)2.661 E F0(be)2.661 E .161(gins with)-.15 F F2(/) |
| 2.661 E F0 2.661(,a)C .161(ll matches of)-2.661 F F1(pattern)2.661 E F0 |
| .16(are replaced with)2.661 F F1(string)2.66 E F0 5.16(.N)C .16 |
| (ormally only the)-5.16 F .806(\214rst match is replaced.)144 427.2 R |
| (If)5.806 E F1(pattern)3.306 E F0(be)3.306 E .806(gins with)-.15 F F2(#) |
| 3.306 E F0 3.306(,i)C 3.307(tm)-3.306 G .807(ust match at the be)-3.307 |
| F .807(ginning of the e)-.15 F(xpanded)-.15 E -.25(va)144 439.2 S .621 |
| (lue of).25 F F1(par)3.121 E(ameter)-.15 E F0 5.621(.I)C(f)-5.621 E F1 |
| (pattern)3.121 E F0(be)3.121 E .621(gins with)-.15 F F2(%)3.121 E F0 |
| 3.121(,i)C 3.121(tm)-3.121 G .62(ust match at the end of the e)-3.121 F |
| .62(xpanded v)-.15 F .62(alue of)-.25 F F1(par)144 451.2 Q(ameter)-.15 E |
| F0 6.253(.I)C(f)-6.253 E F1(string)3.753 E F0 1.253(is null, matches of) |
| 3.753 F F1(pattern)3.753 E F0 1.253(are deleted and the)3.753 F F2(/) |
| 3.753 E F0(follo)3.753 E(wing)-.25 E F1(pattern)3.753 E F0 1.254(may be) |
| 3.754 F 2.679(omitted. If)144 463.2 R F1(par)3.929 E(ameter)-.15 E F0 |
| (is)3.409 E F2(@)2.679 E F0(or)2.679 E F2(*)2.679 E F0 2.679(,t)C .178 |
| (he substitution operation is applied to each positional parameter) |
| -2.679 F .618(in turn, and the e)144 475.2 R .619 |
| (xpansion is the resultant list.)-.15 F(If)5.619 E F1(par)4.369 E |
| (ameter)-.15 E F0 .619(is an array v)3.849 F .619 |
| (ariable subscripted with)-.25 F F2(@)144 487.2 Q F0(or)3.224 E F2(*) |
| 3.224 E F0 3.224(,t)C .723(he substitution operation is applied to each\ |
| member of the array in turn, and the e)-3.224 F(xpan-)-.15 E |
| (sion is the resultant list.)144 499.2 Q(${)108 516 Q F1(par)A(ameter) |
| -.15 E F2(^)A F1(pattern)A F0(})A(${)108 528 Q F1(par)A(ameter)-.15 E F2 |
| (^^)A F1(pattern)A F0(})A(${)108 540 Q F1(par)A(ameter)-.15 E F2(,)A F1 |
| (pattern)A F0(})A(${)108 552 Q F1(par)A(ameter)-.15 E F2(,,)A F1 |
| (pattern)A F0(})A F2 .437(Case modi\214cation.)144 564 R F0 .437(This e) |
| 5.437 F .438(xpansion modi\214es the case of alphabetic characters in) |
| -.15 F F1(par)2.938 E(ameter)-.15 E F0 5.438(.T)C(he)-5.438 E F1 |
| (pattern)144 576 Q F0 .814(is e)3.314 F .813 |
| (xpanded to produce a pattern just as in pathname e)-.15 F 3.313 |
| (xpansion. The)-.15 F F2(^)3.313 E F0 .813(operator con)3.313 F -.15(ve) |
| -.4 G(rts).15 E(lo)144 588 Q .18(wercase letters matching)-.25 F F1 |
| (pattern)2.681 E F0 .181(to uppercase; the)2.681 F F2(,)2.681 E F0 .181 |
| (operator con)2.681 F -.15(ve)-.4 G .181(rts matching uppercase letters) |
| .15 F .085(to lo)144 600 R 2.585(wercase. The)-.25 F F2(^^)2.585 E F0 |
| (and)2.585 E F2(,,)2.585 E F0 -.15(ex)2.585 G .085(pansions con).15 F |
| -.15(ve)-.4 G .085(rt each matched character in the e).15 F .085 |
| (xpanded v)-.15 F .085(alue; the)-.25 F F2(^)2.585 E F0(and)144 612 Q F2 |
| (,)3.434 E F0 -.15(ex)3.434 G .934(pansions match and con).15 F -.15(ve) |
| -.4 G .934(rt only the \214rst character in the e).15 F .935(xpanded v) |
| -.15 F 3.435(alue.. If)-.25 F F1(pattern)3.435 E F0(is)3.435 E 1.121 |
| (omitted, it is treated lik)144 624 R 3.621(ea)-.1 G F2(?)A F0 3.621(,w) |
| C 1.121(hich matches e)-3.621 F -.15(ve)-.25 G 1.121(ry character).15 F |
| 6.12(.I)-.55 G(f)-6.12 E F1(par)4.87 E(ameter)-.15 E F0(is)4.35 E F2(@) |
| 3.62 E F0(or)3.62 E F2(*)3.62 E F0 3.62(,t)C 1.12(he case)-3.62 F 1.335 |
| (modi\214cation operation is applied to each positional parameter in tu\ |
| rn, and the e)144 636 R 1.335(xpansion is the)-.15 F 1.308 |
| (resultant list.)144 648 R(If)6.308 E F1(par)5.058 E(ameter)-.15 E F0 |
| 1.308(is an array v)4.538 F 1.308(ariable subscripted with)-.25 F F2(@) |
| 3.808 E F0(or)3.808 E F2(*)3.808 E F0 3.808(,t)C 1.308 |
| (he case modi\214cation)-3.808 F |
| (operation is applied to each member of the array in turn, and the e)144 |
| 660 Q(xpansion is the resultant list.)-.15 E F2(Command Substitution)87 |
| 676.8 Q F1 1.697(Command substitution)108 688.8 R F0(allo)4.197 E 1.697 |
| (ws the output of a command to replace the command name.)-.25 F 1.698 |
| (There are tw)6.698 F(o)-.1 E(forms:)108 700.8 Q F2($\()144 722.4 Q F1 |
| (command)A F2(\))1.666 E F0(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(20)185.955 E 0 Cg EP |
| %%Page: 21 21 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(or)108 84 Q/F1 10/Times-Bold@0 SF<92>144 96 Q/F2 10 |
| /Times-Italic@0 SF(command)A F1<92>A(Bash)108 112.8 Q F0 .02 |
| (performs the e)2.52 F .02(xpansion by e)-.15 F -.15(xe)-.15 G(cuting) |
| .15 E F2(command)2.519 E F0 .019 |
| (and replacing the command substitution with the stan-)2.519 F .768 |
| (dard output of the command, with an)108 124.8 R 3.268(yt)-.15 G .768 |
| (railing ne)-3.268 F .768(wlines deleted.)-.25 F .768(Embedded ne)5.768 |
| F .768(wlines are not deleted, b)-.25 F(ut)-.2 E(the)108 136.8 Q 3.219 |
| (ym)-.15 G .719(ay be remo)-3.219 F -.15(ve)-.15 G 3.219(dd).15 G .719 |
| (uring w)-3.219 F .719(ord splitting.)-.1 F .719 |
| (The command substitution)5.719 F F1($\(cat)3.219 E F2(\214le)3.219 E F1 |
| (\))A F0 .718(can be replaced by the)3.219 F(equi)108 148.8 Q -.25(va) |
| -.25 G(lent b).25 E(ut f)-.2 E(aster)-.1 E F1($\(<)2.5 E F2(\214le)2.5 E |
| F1(\))A F0(.)A 1.724(When the old-style backquote form of substitution \ |
| is used, backslash retains its literal meaning e)108 165.6 R(xcept)-.15 |
| E .315(when follo)108 177.6 R .315(wed by)-.25 F F1($)2.815 E F0(,)A F1 |
| <92>2.815 E F0 2.815(,o)C(r)-2.815 E F1(\\)2.815 E F0 5.315(.T)C .314(h\ |
| e \214rst backquote not preceded by a backslash terminates the command \ |
| sub-)-5.315 F 3.886(stitution. When)108 189.6 R 1.386(using the $\() |
| 3.886 F F2(command).833 E F0 3.886(\)f)1.666 G 1.387 |
| (orm, all characters between the parentheses mak)-3.886 F 3.887(eu)-.1 G |
| 3.887(pt)-3.887 G 1.387(he com-)-3.887 F |
| (mand; none are treated specially)108 201.6 Q(.)-.65 E .894 |
| (Command substitutions may be nested.)108 218.4 R 2.494 -.8(To n)5.894 H |
| .894(est when using the backquoted form, escape the inner back-).8 F |
| (quotes with backslashes.)108 230.4 Q .422 |
| (If the substitution appears within double quotes, w)108 247.2 R .422 |
| (ord splitting and pathname e)-.1 F .423(xpansion are not performed)-.15 |
| F(on the results.)108 259.2 Q F1(Arithmetic Expansion)87 276 Q F0 1.035 |
| (Arithmetic e)108 288 R 1.035(xpansion allo)-.15 F 1.035(ws the e)-.25 F |
| -.25(va)-.25 G 1.034(luation of an arithmetic e).25 F 1.034 |
| (xpression and the substitution of the result.)-.15 F |
| (The format for arithmetic e)108 300 Q(xpansion is:)-.15 E F1($\(\()144 |
| 316.8 Q F2 -.2(ex)C(pr).2 E(ession)-.37 E F1(\)\))A F0(The)108 333.6 Q |
| F2 -.2(ex)2.665 G(pr).2 E(ession)-.37 E F0 .165 |
| (is treated as if it were within double quotes, b)2.905 F .166 |
| (ut a double quote inside the parentheses is not)-.2 F 1.075 |
| (treated specially)108 345.6 R 6.075(.A)-.65 G 1.074(ll tok)-6.075 F |
| 1.074(ens in the e)-.1 F 1.074(xpression under)-.15 F 1.074 |
| (go parameter e)-.18 F 1.074(xpansion, string e)-.15 F 1.074 |
| (xpansion, command)-.15 F(substitution, and quote remo)108 357.6 Q -.25 |
| (va)-.15 G 2.5(l. Arithmetic).25 F -.15(ex)2.5 G |
| (pansions may be nested.).15 E 1.378(The e)108 374.4 R -.25(va)-.25 G |
| 1.378(luation is performed according to the rules listed belo).25 F |
| 3.878(wu)-.25 G(nder)-3.878 E/F3 9/Times-Bold@0 SF 1.378(ARITHMETIC EV) |
| 3.878 F(ALU)-1.215 E -.855(AT)-.54 G(ION).855 E/F4 9/Times-Roman@0 SF(.) |
| A F0(If)5.879 E F2 -.2(ex)108 386.4 S(pr).2 E(ession)-.37 E F0(is in) |
| 2.74 E -.25(va)-.4 G(lid,).25 E F1(bash)2.5 E F0 |
| (prints a message indicating f)2.5 E(ailure and no substitution occurs.) |
| -.1 E F1(Pr)87 403.2 Q(ocess Substitution)-.18 E F2(Pr)108 415.2 Q .971 |
| (ocess substitution)-.45 F F0 .971 |
| (is supported on systems that support named pipes \()3.471 F F2(FIFOs)A |
| F0 3.47(\)o)C 3.47(rt)-3.47 G(he)-3.47 E F1(/de)3.47 E(v/fd)-.15 E F0 |
| .97(method of)3.47 F .021(naming open \214les.)108 427.2 R .021(It tak) |
| 5.021 F .021(es the form of)-.1 F F1(<\()2.521 E F2(list)A F1(\)).833 E |
| F0(or)2.521 E F1(>\()2.521 E F2(list)A F1(\)).833 E F0 5.021(.T)C .021 |
| (he process)-5.021 F F2(list)2.521 E F0 .021 |
| (is run with its input or output con-)2.521 F .059(nected to a)108 439.2 |
| R F2(FIFO)2.559 E F0 .058(or some \214le in)2.559 F F1(/de)2.558 E(v/fd) |
| -.15 E F0 5.058(.T)C .058(he name of this \214le is passed as an ar) |
| -5.058 F .058(gument to the current com-)-.18 F .13 |
| (mand as the result of the e)108 451.2 R 2.63(xpansion. If)-.15 F(the) |
| 2.63 E F1(>\()2.63 E F2(list)A F1(\)).833 E F0 .13 |
| (form is used, writing to the \214le will pro)2.63 F .131 |
| (vide input for)-.15 F F2(list)2.631 E F0(.)A(If the)108 463.2 Q F1(<\() |
| 2.5 E F2(list)A F1(\)).833 E F0 |
| (form is used, the \214le passed as an ar)2.5 E |
| (gument should be read to obtain the output of)-.18 E F2(list)2.5 E F0 |
| (.)A .897(When a)108 480 R -.25(va)-.2 G .896(ilable, process substitut\ |
| ion is performed simultaneously with parameter and v).25 F .896 |
| (ariable e)-.25 F(xpansion,)-.15 E |
| (command substitution, and arithmetic e)108 492 Q(xpansion.)-.15 E F1 |
| -.75(Wo)87 508.8 S(rd Splitting).75 E F0 1.142 |
| (The shell scans the results of parameter e)108 520.8 R 1.143 |
| (xpansion, command substitution, and arithmetic e)-.15 F 1.143 |
| (xpansion that)-.15 F(did not occur within double quotes for)108 532.8 Q |
| F2(wor)2.5 E 2.5(ds)-.37 G(plitting)-2.5 E F0(.).22 E .063 |
| (The shell treats each character of)108 549.6 R F3(IFS)2.563 E F0 .063 |
| (as a delimiter)2.313 F 2.563(,a)-.4 G .063 |
| (nd splits the results of the other e)-2.563 F .063(xpansions into w) |
| -.15 F(ords)-.1 E 1.788(on these characters.)108 561.6 R(If)6.788 E F3 |
| (IFS)4.288 E F0 1.788(is unset, or its v)4.038 F 1.789(alue is e)-.25 F |
| (xactly)-.15 E F1(<space><tab><newline>)4.289 E F0 4.289(,t)C 1.789 |
| (he def)-4.289 F 1.789(ault, then)-.1 F .022(sequences of)108 573.6 R F1 |
| (<space>)2.522 E F0(,)A F1(<tab>)2.522 E F0 2.521(,a)C(nd)-2.521 E F1 |
| (<newline>)2.521 E F0 .021(at the be)2.521 F .021 |
| (ginning and end of the results of the pre)-.15 F .021(vious e)-.25 F |
| (xpan-)-.15 E .585(sions are ignored, and an)108 585.6 R 3.086(ys)-.15 G |
| .586(equence of)-3.086 F F3(IFS)3.086 E F0 .586 |
| (characters not at the be)2.836 F .586(ginning or end serv)-.15 F .586 |
| (es to delimit w)-.15 F(ords.)-.1 E(If)108 597.6 Q F3(IFS)3.617 E F0 |
| 1.117(has a v)3.367 F 1.117(alue other than the def)-.25 F 1.117 |
| (ault, then sequences of the whitespace characters)-.1 F F1(space)3.617 |
| E F0(and)3.617 E F1(tab)3.617 E F0(are)3.617 E .315(ignored at the be) |
| 108 609.6 R .315(ginning and end of the w)-.15 F .315 |
| (ord, as long as the whitespace character is in the v)-.1 F .315 |
| (alue of)-.25 F F3(IFS)2.815 E F0(\(an)2.566 E F3(IFS)108 621.6 Q F0 |
| 1.054(whitespace character\).)3.304 F(An)6.054 E 3.554(yc)-.15 G 1.054 |
| (haracter in)-3.554 F F3(IFS)3.554 E F0 1.053(that is not)3.303 F F3 |
| (IFS)3.553 E F0 1.053(whitespace, along with an)3.303 F 3.553(ya)-.15 G |
| (djacent)-3.553 E F3(IFS)3.553 E F0 .331 |
| (whitespace characters, delimits a \214eld.)108 633.6 R 2.831(As)5.331 G |
| .332(equence of)-2.831 F F3(IFS)2.832 E F0 .332 |
| (whitespace characters is also treated as a delim-)2.582 F(iter)108 |
| 645.6 Q 5(.I)-.55 G 2.5(ft)-5 G(he v)-2.5 E(alue of)-.25 E F3(IFS)2.5 E |
| F0(is null, no w)2.25 E(ord splitting occurs.)-.1 E 1.879 |
| (Explicit null ar)108 662.4 R 1.879(guments \()-.18 F F1 .833("").833 G |
| F0(or)3.545 E F1 .833<0808>5.211 G F0 4.378(\)a)C 1.878(re retained.) |
| -4.378 F 1.878(Unquoted implicit null ar)6.878 F 1.878 |
| (guments, resulting from the)-.18 F -.15(ex)108 674.4 S .176 |
| (pansion of parameters that ha).15 F .476 -.15(ve n)-.2 H 2.676(ov).15 G |
| .176(alues, are remo)-2.926 F -.15(ve)-.15 G 2.676(d. If).15 F 2.677(ap) |
| 2.677 G .177(arameter with no v)-2.677 F .177(alue is e)-.25 F .177 |
| (xpanded within)-.15 F(double quotes, a null ar)108 686.4 Q |
| (gument results and is retained.)-.18 E(Note that if no e)108 703.2 Q |
| (xpansion occurs, no splitting is performed.)-.15 E(GNU Bash-4.1)72 768 |
| Q(2009 December 29)135.965 E(21)185.955 E 0 Cg EP |
| %%Page: 22 22 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF -.1(Pa)87 84 S(thname Expansion).1 E F0 |
| .371(After w)108 96 R .371(ord splitting, unless the)-.1 F F1<ad66>2.871 |
| E F0 .371(option has been set,)2.871 F F1(bash)2.871 E F0 .37 |
| (scans each w)2.87 F .37(ord for the characters)-.1 F F1(*)2.87 E F0(,)A |
| F1(?)2.87 E F0 2.87(,a)C(nd)-2.87 E F1([)2.87 E F0(.)A .677 |
| (If one of these characters appears, then the w)108 108 R .677 |
| (ord is re)-.1 F -.05(ga)-.15 G .677(rded as a).05 F/F2 10 |
| /Times-Italic@0 SF(pattern)3.177 E F0 3.177(,a).24 G .678 |
| (nd replaced with an alphabeti-)-3.177 F 1.457 |
| (cally sorted list of \214le names matching the pattern.)108 120 R 1.456 |
| (If no matching \214le names are found, and the shell)6.457 F(option)108 |
| 132 Q F1(nullglob)2.537 E F0 .038(is not enabled, the w)2.537 F .038 |
| (ord is left unchanged.)-.1 F .038(If the)5.038 F F1(nullglob)2.538 E F0 |
| .038(option is set, and no matches are)2.538 F .306(found, the w)108 144 |
| R .306(ord is remo)-.1 F -.15(ve)-.15 G 2.806(d. If).15 F(the)2.805 E F1 |
| (failglob)2.805 E F0 .305 |
| (shell option is set, and no matches are found, an error message)2.805 F |
| .928(is printed and the command is not e)108 156 R -.15(xe)-.15 G 3.428 |
| (cuted. If).15 F .928(the shell option)3.428 F F1(nocaseglob)3.428 E F0 |
| .929(is enabled, the match is per)3.429 F(-)-.2 E .033 |
| (formed without re)108 168 R -.05(ga)-.15 G .033 |
| (rd to the case of alphabetic characters.).05 F .032 |
| (When a pattern is used for pathname e)5.032 F(xpansion,)-.15 E .104 |
| (the character)108 180 R F1 -.63(``)2.604 G -.55(.').63 G(')-.08 E F0 |
| .104(at the start of a name or immediately follo)5.104 F .105 |
| (wing a slash must be matched e)-.25 F(xplicitly)-.15 E 2.605(,u)-.65 G |
| (nless)-2.605 E .888(the shell option)108 192 R F1(dotglob)3.388 E F0 |
| .888(is set.)3.388 F .887 |
| (When matching a pathname, the slash character must al)5.888 F -.1(wa) |
| -.1 G .887(ys be matched).1 F -.15(ex)108 204 S(plicitly).15 E 6.165(.I) |
| -.65 G 3.665(no)-6.165 G 1.165(ther cases, the)-3.665 F F1 -.63(``)3.665 |
| G -.55(.').63 G(')-.08 E F0 1.166(character is not treated specially) |
| 6.165 F 6.166(.S)-.65 G 1.166(ee the description of)-6.166 F F1(shopt) |
| 3.666 E F0(belo)3.666 E(w)-.25 E(under)108 216 Q/F3 9/Times-Bold@0 SF |
| .478(SHELL B)2.978 F(UIL)-.09 E .478(TIN COMMANDS)-.828 F F0 .477 |
| (for a description of the)2.728 F F1(nocaseglob)2.977 E F0(,)A F1 |
| (nullglob)2.977 E F0(,)A F1(failglob)2.977 E F0 2.977(,a)C(nd)-2.977 E |
| F1(dotglob)2.977 E F0(shell options.)108 228 Q(The)108 244.8 Q F3 |
| (GLOBIGNORE)2.63 E F0 .13(shell v)2.38 F .131 |
| (ariable may be used to restrict the set of \214le names matching a)-.25 |
| F F2(pattern)2.631 E F0 5.131(.I).24 G(f)-5.131 E F3(GLO-)2.631 E |
| (BIGNORE)108 256.8 Q F0 2.015(is set, each matching \214le name that al\ |
| so matches one of the patterns in)4.265 F F3(GLOBIGNORE)4.515 E F0(is) |
| 4.264 E(remo)108 268.8 Q -.15(ve)-.15 G 2.503(df).15 G .003 |
| (rom the list of matches.)-2.503 F .003(The \214le names)5.003 F F1 -.63 |
| (``)2.503 G -.55(.').63 G(')-.08 E F0(and)5.003 E F1 -.63(``)2.503 G(..) |
| .63 E -.63('')-.55 G F0 .004(are al)5.633 F -.1(wa)-.1 G .004 |
| (ys ignored when).1 F F3(GLOBIGNORE)2.504 E F0(is)2.254 E .046 |
| (set and not null.)108 280.8 R(Ho)5.046 E(we)-.25 E -.15(ve)-.25 G .846 |
| -.4(r, s).15 H(etting).4 E F3(GLOBIGNORE)2.546 E F0 .046 |
| (to a non-null v)2.296 F .045(alue has the ef)-.25 F .045 |
| (fect of enabling the)-.25 F F1(dotglob)2.545 E F0 .613 |
| (shell option, so all other \214le names be)108 292.8 R .614 |
| (ginning with a)-.15 F F1 -.63(``)3.114 G -.55(.').63 G(')-.08 E F0 .614 |
| (will match.)5.614 F 2.214 -.8(To g)5.614 H .614(et the old beha).8 F |
| .614(vior of ignoring)-.2 F .457(\214le names be)108 304.8 R .457 |
| (ginning with a)-.15 F F1 -.63(``)2.957 G -.55(.').63 G(')-.08 E F0 |
| 2.957(,m)C(ak)-2.957 E(e)-.1 E F1 -.63(``)2.957 G(.*').63 E(')-.63 E F0 |
| .457(one of the patterns in)5.457 F F3(GLOBIGNORE)2.957 E/F4 9 |
| /Times-Roman@0 SF(.)A F0(The)4.957 E F1(dotglob)2.956 E F0 .456 |
| (option is)2.956 F(disabled when)108 316.8 Q F3(GLOBIGNORE)2.5 E F0 |
| (is unset.)2.25 E F1 -.1(Pa)108 333.6 S(tter).1 E 2.5(nM)-.15 G(atching) |
| -2.5 E F0(An)108 350.4 Q 3.138(yc)-.15 G .638(haracter that appears in \ |
| a pattern, other than the special pattern characters described belo) |
| -3.138 F 1.938 -.65(w, m)-.25 H(atches).65 E 3.62(itself. The)108 362.4 |
| R 1.12(NUL character may not occur in a pattern.)3.62 F 3.62(Ab)6.12 G |
| 1.12(ackslash escapes the follo)-3.62 F 1.12(wing character; the)-.25 F |
| .576(escaping backslash is discarded when matching.)108 374.4 R .576 |
| (The special pattern characters must be quoted if the)5.576 F 3.076(ya) |
| -.15 G(re)-3.076 E(to be matched literally)108 386.4 Q(.)-.65 E |
| (The special pattern characters ha)108 403.2 Q .3 -.15(ve t)-.2 H |
| (he follo).15 E(wing meanings:)-.25 E F1(*)108 420 Q F0 .455(Matches an) |
| 31 F 2.955(ys)-.15 G .455(tring, including the null string.)-2.955 F |
| .455(When the)5.455 F F1(globstar)2.955 E F0 .455 |
| (shell option is enabled, and)2.955 F F1(*)2.955 E F0(is)2.955 E .314 |
| (used in a pathname e)144 432 R .314(xpansion conte)-.15 F .314(xt, tw) |
| -.15 F 2.814(oa)-.1 G(djacent)-2.814 E F1(*)2.814 E F0 2.814(su)C .314 |
| (sed as a single pattern will match all \214les)-2.814 F 1.183 |
| (and zero or more directories and subdirectories.)144 444 R 1.183 |
| (If follo)6.183 F 1.183(wed by a)-.25 F F1(/)3.683 E F0 3.683(,t)C 1.383 |
| -.1(wo a)-3.683 H(djacent).1 E F1(*)3.683 E F0 3.683(sw)C 1.183 |
| (ill match)-3.683 F(only directories and subdirectories.)144 456 Q F1(?) |
| 108 468 Q F0(Matches an)31 E 2.5(ys)-.15 G(ingle character)-2.5 E(.)-.55 |
| E F1([...])108 480 Q F0 .256(Matches an)21.84 F 2.756(yo)-.15 G .257 |
| (ne of the enclosed characters.)-2.756 F 2.757(Ap)5.257 G .257 |
| (air of characters separated by a h)-2.757 F .257(yphen denotes a)-.05 F |
| F2 -.15(ra)144 492 S(ng).15 E 3.29(ee)-.1 G(xpr)-3.49 E(ession)-.37 E F0 |
| 3.29(;a)C 1.09 -.15(ny c)-3.29 H .789 |
| (haracter that sorts between those tw).15 F 3.289(oc)-.1 G .789 |
| (haracters, inclusi)-3.289 F -.15(ve)-.25 G 3.289(,u).15 G .789 |
| (sing the cur)-3.289 F(-)-.2 E .349(rent locale')144 504 R 2.849(sc)-.55 |
| G .349(ollating sequence and character set, is matched.)-2.849 F .35 |
| (If the \214rst character follo)5.349 F .35(wing the)-.25 F F1([)2.85 E |
| F0 .564(is a)144 516 R F1(!)3.064 E F0 .564(or a)5.564 F F1(^)3.064 E F0 |
| .564(then an)3.064 F 3.064(yc)-.15 G .564 |
| (haracter not enclosed is matched.)-3.064 F .563 |
| (The sorting order of characters in range)5.564 F -.15(ex)144 528 S .467 |
| (pressions is determined by the current locale and the v).15 F .467 |
| (alue of the)-.25 F F3(LC_COLLA)2.967 E(TE)-.855 E F0 .467(shell v)2.717 |
| F(ariable,)-.25 E 1.077(if set.)144 540 R(A)6.077 E F1<ad>3.577 E F0 |
| 1.077(may be matched by including it as the \214rst or last character i\ |
| n the set.)3.577 F(A)6.076 E F1(])3.576 E F0 1.076(may be)3.576 F |
| (matched by including it as the \214rst character in the set.)144 552 Q |
| -.4(Wi)144 570 S(thin).4 E F1([)2.914 E F0(and)2.914 E F1(])2.914 E F0 |
| (,)A F2 -.15(ch)2.914 G(ar).15 E .414(acter classes)-.15 F F0 .415 |
| (can be speci\214ed using the syntax)2.915 F F1([:)2.915 E F2(class)A F1 |
| (:])A F0 2.915(,w)C(here)-2.915 E F2(class)2.915 E F0 .415(is one of) |
| 2.915 F(the follo)144 582 Q |
| (wing classes de\214ned in the POSIX standard:)-.25 E F1 5.421 |
| (alnum alpha ascii blank cntrl digit graph lo)144 594 R 5.421 |
| (wer print punct space upper w)-.1 F(ord)-.1 E(xdigit)144 606 Q F0 2.518 |
| (Ac)144 618 S .018(haracter class matches an)-2.518 F 2.518(yc)-.15 G |
| .019(haracter belonging to that class.)-2.518 F(The)5.019 E F1 -.1(wo) |
| 2.519 G(rd).1 E F0 .019(character class matches)2.519 F |
| (letters, digits, and the character _.)144 630 Q -.4(Wi)144 648 S(thin) |
| .4 E F1([)3.547 E F0(and)3.547 E F1(])3.547 E F0 3.547(,a)C(n)-3.547 E |
| F2 1.046(equivalence class)3.546 F F0 1.046 |
| (can be speci\214ed using the syntax)3.546 F F1([=)3.546 E F2(c)A F1(=]) |
| A F0 3.546(,w)C 1.046(hich matches all)-3.546 F(characters with the sam\ |
| e collation weight \(as de\214ned by the current locale\) as the charac\ |
| ter)144 660 Q F2(c)2.5 E F0(.)A -.4(Wi)144 678 S(thin).4 E F1([)2.5 E F0 |
| (and)2.5 E F1(])2.5 E F0 2.5(,t)C(he syntax)-2.5 E F1([.)2.5 E F2 |
| (symbol)A F1(.])A F0(matches the collating symbol)2.5 E F2(symbol)2.5 E |
| F0(.)A .704(If the)108 694.8 R F1(extglob)3.204 E F0 .705 |
| (shell option is enabled using the)3.204 F F1(shopt)3.205 E F0 -.2(bu) |
| 3.205 G .705(iltin, se).2 F -.15(ve)-.25 G .705(ral e).15 F .705 |
| (xtended pattern matching operators)-.15 F .256(are recognized.)108 |
| 706.8 R .256(In the follo)5.256 F .256(wing description, a)-.25 F F2 |
| (pattern-list)2.755 E F0 .255 |
| (is a list of one or more patterns separated by a)2.755 F F1(|)2.755 E |
| F0(.)A(Composite patterns may be formed using one or more of the follo) |
| 108 718.8 Q(wing sub-patterns:)-.25 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(22)185.955 E 0 Cg EP |
| %%Page: 23 23 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(?\()144 84 Q/F2 10/Times-Italic@0 SF |
| (pattern-list).833 E F1(\)).833 E F0 |
| (Matches zero or one occurrence of the gi)180 96 Q -.15(ve)-.25 G 2.5 |
| (np).15 G(atterns)-2.5 E F1(*\()144 108 Q F2(pattern-list).833 E F1(\)) |
| .833 E F0(Matches zero or more occurrences of the gi)180 120 Q -.15(ve) |
| -.25 G 2.5(np).15 G(atterns)-2.5 E F1(+\()144 132 Q F2(pattern-list).833 |
| E F1(\)).833 E F0(Matches one or more occurrences of the gi)180 144 Q |
| -.15(ve)-.25 G 2.5(np).15 G(atterns)-2.5 E F1(@\()144 156 Q F2 |
| (pattern-list).833 E F1(\)).833 E F0(Matches one of the gi)180 168 Q |
| -.15(ve)-.25 G 2.5(np).15 G(atterns)-2.5 E F1(!\()144 180 Q F2 |
| (pattern-list).833 E F1(\)).833 E F0(Matches an)180 192 Q(ything e)-.15 |
| E(xcept one of the gi)-.15 E -.15(ve)-.25 G 2.5(np).15 G(atterns)-2.5 E |
| F1(Quote Remo)87 208.8 Q -.1(va)-.1 G(l).1 E F0 1.112 |
| (After the preceding e)108 220.8 R 1.112 |
| (xpansions, all unquoted occurrences of the characters)-.15 F F1(\\) |
| 3.613 E F0(,)A F1<08>3.613 E F0 3.613(,a)C(nd)-3.613 E F1(")4.446 E F0 |
| 1.113(that did not result)4.446 F(from one of the abo)108 232.8 Q .3 |
| -.15(ve ex)-.15 H(pansions are remo).15 E -.15(ve)-.15 G(d.).15 E/F3 |
| 10.95/Times-Bold@0 SF(REDIRECTION)72 249.6 Q F0 .545 |
| (Before a command is e)108 261.6 R -.15(xe)-.15 G .545 |
| (cuted, its input and output may be).15 F F2 -.37(re)3.045 G(dir).37 E |
| (ected)-.37 E F0 .545(using a special notation interpreted)3.815 F .616 |
| (by the shell.)108 273.6 R .617(Redirection may also be used to open an\ |
| d close \214les for the current shell e)5.616 F -.15(xe)-.15 G .617 |
| (cution en).15 F(viron-)-.4 E 3.275(ment. The)108 285.6 R(follo)3.275 E |
| .774(wing redirection operators may precede or appear an)-.25 F .774 |
| (ywhere within a)-.15 F F2 .774(simple command)3.614 F F0(or)4.044 E |
| (may follo)108 297.6 Q 2.5(wa)-.25 G F2(command)A F0 5(.R).77 G |
| (edirections are processed in the order the)-5 E 2.5(ya)-.15 G(ppear) |
| -2.5 E 2.5(,f)-.4 G(rom left to right.)-2.5 E .771(Each redirection tha\ |
| t may be preceded by a \214le descriptor number may instead be preceded\ |
| by a w)108 314.4 R .772(ord of)-.1 F .293(the form {)108 326.4 R F2 |
| (varname)A F0 2.793(}. In)B .293 |
| (this case, for each redirection operator e)2.793 F .293 |
| (xcept >&- and <&-, the shell will allocate)-.15 F 3.498<618c>108 338.4 |
| S .999(le descriptor greater than 10 and assign it to)-3.498 F F2 |
| (varname)3.499 E F0 5.999(.I)C 3.499(f>)-5.999 G .999 |
| (&- or <&- is preceded by {)-3.499 F F2(varname)A F0 .999(}, the)B -.25 |
| (va)108 350.4 S(lue of).25 E F2(varname)2.5 E F0 |
| (de\214nes the \214le descriptor to close.)2.5 E .284(In the follo)108 |
| 367.2 R .283(wing descriptions, if the \214le descriptor number is omit\ |
| ted, and the \214rst character of the redirect-)-.25 F .512 |
| (ion operator is)108 379.2 R F1(<)3.012 E F0 3.012(,t)C .512 |
| (he redirection refers to the standard input \(\214le descriptor 0\).) |
| -3.012 F .512(If the \214rst character of the)5.512 F |
| (redirection operator is)108 391.2 Q F1(>)2.5 E F0 2.5(,t)C |
| (he redirection refers to the standard output \(\214le descriptor 1\).) |
| -2.5 E .825(The w)108 408 R .825(ord follo)-.1 F .824 |
| (wing the redirection operator in the follo)-.25 F .824 |
| (wing descriptions, unless otherwise noted, is sub-)-.25 F .772 |
| (jected to brace e)108 420 R .773(xpansion, tilde e)-.15 F .773 |
| (xpansion, parameter e)-.15 F .773 |
| (xpansion, command substitution, arithmetic e)-.15 F(xpan-)-.15 E .844 |
| (sion, quote remo)108 432 R -.25(va)-.15 G .843(l, pathname e).25 F .843 |
| (xpansion, and w)-.15 F .843(ord splitting.)-.1 F .843(If it e)5.843 F |
| .843(xpands to more than one w)-.15 F(ord,)-.1 E F1(bash)3.343 E F0 |
| (reports an error)108 444 Q(.)-.55 E |
| (Note that the order of redirections is signi\214cant.)108 460.8 Q -.15 |
| (Fo)5 G 2.5(re).15 G(xample, the command)-2.65 E(ls)144 477.6 Q F1(>)2.5 |
| E F0(dirlist 2)2.5 E F1(>&)A F0(1)A |
| (directs both standard output and standard error to the \214le)108 494.4 |
| Q F2(dirlist)2.5 E F0 2.5(,w).68 G(hile the command)-2.5 E(ls 2)144 |
| 511.2 Q F1(>&)A F0(1)A F1(>)2.5 E F0(dirlist)2.5 E .527 |
| (directs only the standard output to \214le)108 528 R F2(dirlist)3.027 E |
| F0 3.027(,b).68 G .527(ecause the standard error w)-3.027 F .527 |
| (as duplicated from the standard)-.1 F |
| (output before the standard output w)108 540 Q(as redirected to)-.1 E F2 |
| (dirlist)2.5 E F0(.).68 E F1(Bash)108 556.8 Q F0 .599(handles se)3.099 F |
| -.15(ve)-.25 G .599(ral \214lenames specially when the).15 F 3.099(ya) |
| -.15 G .598(re used in redirections, as described in the follo)-3.099 F |
| (wing)-.25 E(table:)108 568.8 Q F1(/de)144 585.6 Q(v/fd/)-.15 E F2(fd)A |
| F0(If)180 597.6 Q F2(fd)2.5 E F0(is a v)2.5 E(alid inte)-.25 E(ger)-.15 |
| E 2.5<2c8c>-.4 G(le descriptor)-2.5 E F2(fd)2.5 E F0(is duplicated.)2.5 |
| E F1(/de)144 609.6 Q(v/stdin)-.15 E F0(File descriptor 0 is duplicated.) |
| 180 621.6 Q F1(/de)144 633.6 Q(v/stdout)-.15 E F0 |
| (File descriptor 1 is duplicated.)180 645.6 Q F1(/de)144 657.6 Q |
| (v/stderr)-.15 E F0(File descriptor 2 is duplicated.)180 669.6 Q F1(/de) |
| 144 681.6 Q(v/tcp/)-.15 E F2(host)A F1(/)A F2(port)A F0(If)180 693.6 Q |
| F2(host)2.996 E F0 .496(is a v)2.996 F .496 |
| (alid hostname or Internet address, and)-.25 F F2(port)2.997 E F0 .497 |
| (is an inte)2.997 F .497(ger port number or ser)-.15 F(-)-.2 E |
| (vice name,)180 705.6 Q F1(bash)2.5 E F0 |
| (attempts to open a TCP connection to the corresponding sock)2.5 E(et.) |
| -.1 E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(23)185.955 E 0 Cg |
| EP |
| %%Page: 24 24 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(/de)144 84 Q(v/udp/)-.15 E/F2 10 |
| /Times-Italic@0 SF(host)A F1(/)A F2(port)A F0(If)180 96 Q F2(host)2.997 |
| E F0 .497(is a v)2.997 F .497(alid hostname or Internet address, and) |
| -.25 F F2(port)2.996 E F0 .496(is an inte)2.996 F .496 |
| (ger port number or ser)-.15 F(-)-.2 E(vice name,)180 108 Q F1(bash)2.5 |
| E F0(attempts to open a UDP connection to the corresponding sock)2.5 E |
| (et.)-.1 E 2.5(Af)108 124.8 S |
| (ailure to open or create a \214le causes the redirection to f)-2.6 E |
| (ail.)-.1 E .946(Redirections using \214le descriptors greater than 9 s\ |
| hould be used with care, as the)108 141.6 R 3.447(ym)-.15 G .947 |
| (ay con\215ict with \214le)-3.447 F |
| (descriptors the shell uses internally)108 153.6 Q(.)-.65 E F1(Redir)87 |
| 170.4 Q(ecting Input)-.18 E F0 .391 |
| (Redirection of input causes the \214le whose name results from the e) |
| 108 182.4 R .391(xpansion of)-.15 F F2(wor)3.231 E(d)-.37 E F0 .391 |
| (to be opened for read-)3.661 F(ing on \214le descriptor)108 194.4 Q F2 |
| (n)2.5 E F0 2.5(,o).24 G 2.5(rt)-2.5 G |
| (he standard input \(\214le descriptor 0\) if)-2.5 E F2(n)2.86 E F0 |
| (is not speci\214ed.)2.74 E |
| (The general format for redirecting input is:)108 211.2 Q([)144 228 Q F2 |
| (n)A F0(])A F1(<)A F2(wor)A(d)-.37 E F1(Redir)87 244.8 Q(ecting Output) |
| -.18 E F0 .174 |
| (Redirection of output causes the \214le whose name results from the e) |
| 108 256.8 R .175(xpansion of)-.15 F F2(wor)3.015 E(d)-.37 E F0 .175 |
| (to be opened for writ-)3.445 F .825(ing on \214le descriptor)108 268.8 |
| R F2(n)3.325 E F0 3.325(,o).24 G 3.325(rt)-3.325 G .824 |
| (he standard output \(\214le descriptor 1\) if)-3.325 F F2(n)3.684 E F0 |
| .824(is not speci\214ed.)3.564 F .824(If the \214le does not)5.824 F |
| -.15(ex)108 280.8 S(ist it is created; if it does e).15 E |
| (xist it is truncated to zero size.)-.15 E |
| (The general format for redirecting output is:)108 297.6 Q([)144 314.4 Q |
| F2(n)A F0(])A F1(>)A F2(wor)A(d)-.37 E F0 .154 |
| (If the redirection operator is)108 331.2 R F1(>)2.654 E F0 2.654(,a)C |
| .154(nd the)-2.654 F F1(noclob)2.654 E(ber)-.1 E F0 .154(option to the) |
| 2.654 F F1(set)2.655 E F0 -.2(bu)2.655 G .155 |
| (iltin has been enabled, the redirection).2 F .658(will f)108 343.2 R |
| .658(ail if the \214le whose name results from the e)-.1 F .658 |
| (xpansion of)-.15 F F2(wor)3.158 E(d)-.37 E F0 -.15(ex)3.158 G .657 |
| (ists and is a re).15 F .657(gular \214le.)-.15 F .657(If the redi-) |
| 5.657 F .408(rection operator is)108 355.2 R F1(>|)2.909 E F0 2.909(,o)C |
| 2.909(rt)-2.909 G .409(he redirection operator is)-2.909 F F1(>)2.909 E |
| F0 .409(and the)2.909 F F1(noclob)2.909 E(ber)-.1 E F0 .409 |
| (option to the)2.909 F F1(set)2.909 E F0 -.2(bu)2.909 G .409 |
| (iltin command).2 F(is not enabled, the redirection is attempted e)108 |
| 367.2 Q -.15(ve)-.25 G 2.5(ni).15 G 2.5(ft)-2.5 G(he \214le named by) |
| -2.5 E F2(wor)2.5 E(d)-.37 E F0 -.15(ex)2.5 G(ists.).15 E F1 -.25(Ap)87 |
| 384 S(pending Redir).25 E(ected Output)-.18 E F0 .642 |
| (Redirection of output in this f)108 396 R .642 |
| (ashion causes the \214le whose name results from the e)-.1 F .641 |
| (xpansion of)-.15 F F2(wor)3.481 E(d)-.37 E F0 .641(to be)3.911 F .473 |
| (opened for appending on \214le descriptor)108 408 R F2(n)2.973 E F0 |
| 2.974(,o).24 G 2.974(rt)-2.974 G .474 |
| (he standard output \(\214le descriptor 1\) if)-2.974 F F2(n)3.334 E F0 |
| .474(is not speci\214ed.)3.214 F(If)5.474 E(the \214le does not e)108 |
| 420 Q(xist it is created.)-.15 E |
| (The general format for appending output is:)108 436.8 Q([)144 453.6 Q |
| F2(n)A F0(])A F1(>>)A F2(wor)A(d)-.37 E F1(Redir)87 475.2 Q |
| (ecting Standard Output and Standard Err)-.18 E(or)-.18 E F0 .249 |
| (This construct allo)108 487.2 R .249(ws both the standard output \(\ |
| \214le descriptor 1\) and the standard error output \(\214le descrip-) |
| -.25 F(tor 2\) to be redirected to the \214le whose name is the e)108 |
| 499.2 Q(xpansion of)-.15 E F2(wor)2.5 E(d)-.37 E F0(.).77 E |
| (There are tw)108 516 Q 2.5(of)-.1 G |
| (ormats for redirecting standard output and standard error:)-2.5 E F1 |
| (&>)144 532.8 Q F2(wor)A(d)-.37 E F0(and)108 544.8 Q F1(>&)144 556.8 Q |
| F2(wor)A(d)-.37 E F0(Of the tw)108 573.6 Q 2.5(of)-.1 G |
| (orms, the \214rst is preferred.)-2.5 E(This is semantically equi)5 E |
| -.25(va)-.25 G(lent to).25 E F1(>)144 590.4 Q F2(wor)A(d)-.37 E F0(2)2.5 |
| E F1(>&)A F0(1)A F1 -.25(Ap)87 612 S |
| (pending Standard Output and Standard Err).25 E(or)-.18 E F0 .248 |
| (This construct allo)108 624 R .249(ws both the standard output \(\214l\ |
| e descriptor 1\) and the standard error output \(\214le descrip-)-.25 F |
| (tor 2\) to be appended to the \214le whose name is the e)108 636 Q |
| (xpansion of)-.15 E F2(wor)2.5 E(d)-.37 E F0(.).77 E |
| (The format for appending standard output and standard error is:)108 |
| 652.8 Q F1(&>>)144 669.6 Q F2(wor)A(d)-.37 E F0 |
| (This is semantically equi)108 686.4 Q -.25(va)-.25 G(lent to).25 E F1 |
| (>>)144 703.2 Q F2(wor)A(d)-.37 E F0(2)2.5 E F1(>&)A F0(1)A |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(24)185.955 E 0 Cg EP |
| %%Page: 25 25 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(Her)87 84 Q 2.5(eD)-.18 G(ocuments)-2.5 E |
| F0 .33(This type of redirection instructs the shell to read input from \ |
| the current source until a line containing only)108 96 R/F2 10 |
| /Times-Italic@0 SF(delimiter)108.35 108 Q F0 .614 |
| (\(with no trailing blanks\) is seen.)3.844 F .615 |
| (All of the lines read up to that point are then used as the stan-)5.615 |
| F(dard input for a command.)108 120 Q(The format of here-documents is:) |
| 108 136.8 Q F1(<<)144 153.6 Q F0([)A F1<ad>A F0(])A F2(wor)A(d)-.37 E |
| (her)164 165.6 Q(e-document)-.37 E(delimiter)144 177.6 Q F0 .128 |
| (No parameter e)108 194.4 R .127 |
| (xpansion, command substitution, arithmetic e)-.15 F .127 |
| (xpansion, or pathname e)-.15 F .127(xpansion is performed)-.15 F(on)108 |
| 206.4 Q F2(wor)3.274 E(d)-.37 E F0 5.774(.I).77 G 3.274(fa)-5.774 G |
| 1.074 -.15(ny c)-3.274 H .774(haracters in).15 F F2(wor)3.614 E(d)-.37 E |
| F0 .774(are quoted, the)4.044 F F2(delimiter)3.624 E F0 .774 |
| (is the result of quote remo)4.004 F -.25(va)-.15 G 3.275(lo).25 G(n) |
| -3.275 E F2(wor)3.275 E(d)-.37 E F0 3.275(,a).77 G(nd)-3.275 E .905 |
| (the lines in the here-document are not e)108 218.4 R 3.405(xpanded. If) |
| -.15 F F2(wor)3.405 E(d)-.37 E F0 .904 |
| (is unquoted, all lines of the here-document are)3.405 F .694 |
| (subjected to parameter e)108 230.4 R .695 |
| (xpansion, command substitution, and arithmetic e)-.15 F 3.195 |
| (xpansion. In)-.15 F .695(the latter case, the)3.195 F |
| (character sequence)108 242.4 Q F1(\\<newline>)2.5 E F0(is ignored, and) |
| 2.5 E F1(\\)2.5 E F0(must be used to quote the characters)2.5 E F1(\\) |
| 2.5 E F0(,)A F1($)2.5 E F0 2.5(,a)C(nd)-2.5 E F1<92>2.5 E F0(.)A .602 |
| (If the redirection operator is)108 259.2 R F1(<<\255)3.101 E F0 3.101 |
| (,t)C .601(hen all leading tab characters are stripped from input lines\ |
| and the line)-3.101 F(containing)108 271.2 Q F2(delimiter)2.5 E F0 5 |
| (.T).73 G(his allo)-5 E |
| (ws here-documents within shell scripts to be indented in a natural f) |
| -.25 E(ashion.)-.1 E F1(Her)87 288 Q 2.5(eS)-.18 G(trings)-2.5 E F0 2.5 |
| (Av)108 300 S(ariant of here documents, the format is:)-2.75 E F1(<<<) |
| 144 316.8 Q F2(wor)A(d)-.37 E F0(The)108 333.6 Q F2(wor)2.5 E(d)-.37 E |
| F0(is e)2.5 E |
| (xpanded and supplied to the command on its standard input.)-.15 E F1 |
| (Duplicating File Descriptors)87 350.4 Q F0(The redirection operator)108 |
| 362.4 Q([)144 379.2 Q F2(n)A F0(])A F1(<&)A F2(wor)A(d)-.37 E F0 .126 |
| (is used to duplicate input \214le descriptors.)108 396 R(If)5.127 E F2 |
| (wor)2.967 E(d)-.37 E F0 -.15(ex)3.397 G .127 |
| (pands to one or more digits, the \214le descriptor denoted).15 F(by)108 |
| 408 Q F2(n)3.318 E F0 .458(is made to be a cop)3.198 F 2.958(yo)-.1 G |
| 2.958(ft)-2.958 G .457(hat \214le descriptor)-2.958 F 5.457(.I)-.55 G |
| 2.957(ft)-5.457 G .457(he digits in)-2.957 F F2(wor)3.297 E(d)-.37 E F0 |
| .457(do not specify a \214le descriptor open)3.727 F .149 |
| (for input, a redirection error occurs.)108 420 R(If)5.149 E F2(wor) |
| 2.989 E(d)-.37 E F0 -.25(eva)3.419 G .149(luates to).25 F F1<ad>2.649 E |
| F0 2.65<2c8c>C .15(le descriptor)-2.65 F F2(n)3.01 E F0 .15(is closed.) |
| 2.89 F(If)5.15 E F2(n)3.01 E F0 .15(is not speci\214ed,)2.89 F |
| (the standard input \(\214le descriptor 0\) is used.)108 432 Q |
| (The operator)108 448.8 Q([)144 465.6 Q F2(n)A F0(])A F1(>&)A F2(wor)A |
| (d)-.37 E F0 .444 |
| (is used similarly to duplicate output \214le descriptors.)108 482.4 R |
| (If)5.444 E F2(n)3.304 E F0 .443 |
| (is not speci\214ed, the standard output \(\214le descrip-)3.183 F 1.357 |
| (tor 1\) is used.)108 494.4 R 1.357(If the digits in)6.357 F F2(wor) |
| 4.197 E(d)-.37 E F0 1.358(do not specify a \214le descriptor open for o\ |
| utput, a redirection error)4.627 F 2.597(occurs. As)108 506.4 R 2.597 |
| (as)2.597 G .097(pecial case, if)-2.597 F F2(n)2.596 E F0 .096 |
| (is omitted, and)2.596 F F2(wor)2.596 E(d)-.37 E F0 .096(does not e) |
| 2.596 F .096(xpand to one or more digits, the standard out-)-.15 F |
| (put and standard error are redirected as described pre)108 518.4 Q |
| (viously)-.25 E(.)-.65 E F1(Mo)87 535.2 Q(ving File Descriptors)-.1 E F0 |
| (The redirection operator)108 547.2 Q([)144 564 Q F2(n)A F0(])A F1(<&)A |
| F2(digit)A F1<ad>A F0(mo)108 580.8 Q -.15(ve)-.15 G 3.035(st).15 G .535 |
| (he \214le descriptor)-3.035 F F2(digit)3.035 E F0 .535 |
| (to \214le descriptor)3.035 F F2(n)3.035 E F0 3.035(,o).24 G 3.035(rt) |
| -3.035 G .536(he standard input \(\214le descriptor 0\) if)-3.035 F F2 |
| (n)3.036 E F0 .536(is not speci-)3.036 F(\214ed.)108 592.8 Q F2(digit)5 |
| E F0(is closed after being duplicated to)2.5 E F2(n)2.5 E F0(.)A |
| (Similarly)108 609.6 Q 2.5(,t)-.65 G(he redirection operator)-2.5 E([) |
| 144 626.4 Q F2(n)A F0(])A F1(>&)A F2(digit)A F1<ad>A F0(mo)108 643.2 Q |
| -.15(ve)-.15 G 2.786(st).15 G .286(he \214le descriptor)-2.786 F F2 |
| (digit)2.786 E F0 .286(to \214le descriptor)2.786 F F2(n)2.786 E F0 |
| 2.786(,o).24 G 2.786(rt)-2.786 G .285 |
| (he standard output \(\214le descriptor 1\) if)-2.786 F F2(n)2.785 E F0 |
| .285(is not speci-)2.785 F(\214ed.)108 655.2 Q F1 |
| (Opening File Descriptors f)87 672 Q(or Reading and Writing)-.25 E F0 |
| (The redirection operator)108 684 Q([)144 700.8 Q F2(n)A F0(])A F1(<>)A |
| F2(wor)A(d)-.37 E F0 1.349(causes the \214le whose name is the e)108 |
| 717.6 R 1.349(xpansion of)-.15 F F2(wor)4.189 E(d)-.37 E F0 1.349 |
| (to be opened for both reading and writing on \214le)4.619 F(descriptor) |
| 108 729.6 Q F2(n)2.5 E F0 2.5(,o).24 G 2.5(ro)-2.5 G 2.5<6e8c>-2.5 G |
| (le descriptor 0 if)-2.5 E F2(n)2.86 E F0(is not speci\214ed.)2.74 E |
| (If the \214le does not e)5 E(xist, it is created.)-.15 E(GNU Bash-4.1) |
| 72 768 Q(2009 December 29)135.965 E(25)185.955 E 0 Cg EP |
| %%Page: 26 26 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10.95/Times-Bold@0 SF(ALIASES)72 84 Q/F2 10/Times-Italic@0 SF |
| (Aliases)108 96 Q F0(allo)3.174 E 3.174(was)-.25 G .674 |
| (tring to be substituted for a w)-3.174 F .674 |
| (ord when it is used as the \214rst w)-.1 F .673 |
| (ord of a simple command.)-.1 F .394(The shell maintains a list of alia\ |
| ses that may be set and unset with the)108 108 R/F3 10/Times-Bold@0 SF |
| (alias)2.894 E F0(and)2.894 E F3(unalias)2.894 E F0 -.2(bu)2.894 G .394 |
| (iltin commands).2 F(\(see)108 120 Q/F4 9/Times-Bold@0 SF 1.98(SHELL B) |
| 4.48 F(UIL)-.09 E 1.98(TIN COMMANDS)-.828 F F0(belo)4.23 E 4.48 |
| (w\). The)-.25 F 1.98(\214rst w)4.48 F 1.979 |
| (ord of each simple command, if unquoted, is)-.1 F(check)108 132 Q .472 |
| (ed to see if it has an alias.)-.1 F .472(If so, that w)5.472 F .473 |
| (ord is replaced by the te)-.1 F .473(xt of the alias.)-.15 F .473 |
| (The characters)5.473 F F3(/)2.973 E F0(,)A F3($)2.973 E F0(,)A F3<92> |
| 2.973 E F0(,)A(and)108 144 Q F3(=)3.612 E F0 1.112(and an)3.612 F 3.612 |
| (yo)-.15 G 3.612(ft)-3.612 G 1.112(he shell)-3.612 F F2(metac)3.612 E |
| (har)-.15 E(acter)-.15 E(s)-.1 E F0 1.112 |
| (or quoting characters listed abo)3.612 F 1.411 -.15(ve m)-.15 H 1.111 |
| (ay not appear in an alias).15 F 3.619(name. The)108 156 R 1.119 |
| (replacement te)3.619 F 1.119(xt may contain an)-.15 F 3.619(yv)-.15 G |
| 1.119(alid shell input, including shell metacharacters.)-3.869 F 1.12 |
| (The \214rst)6.12 F -.1(wo)108 168 S .514(rd of the replacement te).1 F |
| .514(xt is tested for aliases, b)-.15 F .514(ut a w)-.2 F .513 |
| (ord that is identical to an alias being e)-.1 F .513(xpanded is)-.15 F |
| .295(not e)108 180 R .295(xpanded a second time.)-.15 F .296 |
| (This means that one may alias)5.295 F F3(ls)2.796 E F0(to)2.796 E F3 |
| .296(ls \255F)2.796 F F0 2.796(,f)C .296(or instance, and)-2.796 F F3 |
| (bash)2.796 E F0 .296(does not try)2.796 F .543(to recursi)108 192 R |
| -.15(ve)-.25 G .543(ly e).15 F .543(xpand the replacement te)-.15 F |
| 3.043(xt. If)-.15 F .543(the last character of the alias v)3.043 F .542 |
| (alue is a)-.25 F F2(blank)3.042 E F0 3.042(,t).67 G .542(hen the ne) |
| -3.042 F(xt)-.15 E(command w)108 204 Q(ord follo)-.1 E |
| (wing the alias is also check)-.25 E(ed for alias e)-.1 E(xpansion.)-.15 |
| E(Aliases are created and listed with the)108 220.8 Q F3(alias)2.5 E F0 |
| (command, and remo)2.5 E -.15(ve)-.15 G 2.5(dw).15 G(ith the)-2.5 E F3 |
| (unalias)2.5 E F0(command.)2.5 E .284 |
| (There is no mechanism for using ar)108 237.6 R .284 |
| (guments in the replacement te)-.18 F 2.784(xt. If)-.15 F(ar)2.784 E |
| .284(guments are needed, a shell func-)-.18 F(tion should be used \(see) |
| 108 249.6 Q F4(FUNCTIONS)2.5 E F0(belo)2.25 E(w\).)-.25 E 1.22 |
| (Aliases are not e)108 266.4 R 1.22 |
| (xpanded when the shell is not interacti)-.15 F -.15(ve)-.25 G 3.72(,u) |
| .15 G 1.22(nless the)-3.72 F F3(expand_aliases)3.72 E F0 1.22 |
| (shell option is set)3.72 F(using)108 278.4 Q F3(shopt)2.5 E F0 |
| (\(see the description of)2.5 E F3(shopt)2.5 E F0(under)2.5 E F4 |
| (SHELL B)2.5 E(UIL)-.09 E(TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).)-.25 |
| E .435 |
| (The rules concerning the de\214nition and use of aliases are some)108 |
| 295.2 R .436(what confusing.)-.25 F F3(Bash)5.436 E F0(al)2.936 E -.1 |
| (wa)-.1 G .436(ys reads at least).1 F .338 |
| (one complete line of input before e)108 307.2 R -.15(xe)-.15 G .338 |
| (cuting an).15 F 2.838(yo)-.15 G 2.838(ft)-2.838 G .338 |
| (he commands on that line.)-2.838 F .337(Aliases are e)5.337 F .337 |
| (xpanded when)-.15 F 3.403(ac)108 319.2 S .904 |
| (ommand is read, not when it is e)-3.403 F -.15(xe)-.15 G 3.404 |
| (cuted. Therefore,).15 F .904 |
| (an alias de\214nition appearing on the same line as)3.404 F 1.162 |
| (another command does not tak)108 331.2 R 3.662(ee)-.1 G -.25(ff)-3.662 |
| G 1.162(ect until the ne).25 F 1.162(xt line of input is read.)-.15 F |
| 1.161(The commands follo)6.161 F 1.161(wing the)-.25 F .277 |
| (alias de\214nition on that line are not af)108 343.2 R .277 |
| (fected by the ne)-.25 F 2.777(wa)-.25 G 2.777(lias. This)-2.777 F(beha) |
| 2.777 E .277(vior is also an issue when functions)-.2 F .699(are e)108 |
| 355.2 R -.15(xe)-.15 G 3.199(cuted. Aliases).15 F .699(are e)3.199 F |
| .699(xpanded when a function de\214nition is read, not when the functio\ |
| n is e)-.15 F -.15(xe)-.15 G(cuted,).15 E .494 |
| (because a function de\214nition is itself a compound command.)108 367.2 |
| R .495(As a consequence, aliases de\214ned in a func-)5.494 F .085 |
| (tion are not a)108 379.2 R -.25(va)-.2 G .084 |
| (ilable until after that function is e).25 F -.15(xe)-.15 G 2.584 |
| (cuted. T).15 F 2.584(ob)-.8 G 2.584(es)-2.584 G .084(afe, al)-2.584 F |
| -.1(wa)-.1 G .084(ys put alias de\214nitions on a sepa-).1 F |
| (rate line, and do not use)108 391.2 Q F3(alias)2.5 E F0 |
| (in compound commands.)2.5 E -.15(Fo)108 408 S 2.5(ra).15 G(lmost e)-2.5 |
| E -.15(ve)-.25 G(ry purpose, aliases are superseded by shell functions.) |
| .15 E F1(FUNCTIONS)72 424.8 Q F0 3.467(As)108 436.8 S .967 |
| (hell function, de\214ned as described abo)-3.467 F 1.267 -.15(ve u)-.15 |
| H(nder).15 E F4 .967(SHELL GRAMMAR)3.467 F/F5 9/Times-Roman@0 SF(,)A F0 |
| .968(stores a series of commands for)3.217 F 1.002(later e)108 448.8 R |
| -.15(xe)-.15 G 3.502(cution. When).15 F 1.002(the name of a shell funct\ |
| ion is used as a simple command name, the list of com-)3.502 F .315 |
| (mands associated with that function name is e)108 460.8 R -.15(xe)-.15 |
| G 2.816(cuted. Functions).15 F .316(are e)2.816 F -.15(xe)-.15 G .316 |
| (cuted in the conte).15 F .316(xt of the current)-.15 F .036 |
| (shell; no ne)108 472.8 R 2.536(wp)-.25 G .036 |
| (rocess is created to interpret them \(contrast this with the e)-2.536 F |
| -.15(xe)-.15 G .036(cution of a shell script\).).15 F .035(When a)5.035 |
| F .639(function is e)108 484.8 R -.15(xe)-.15 G .639(cuted, the ar).15 F |
| .639 |
| (guments to the function become the positional parameters during its e) |
| -.18 F -.15(xe)-.15 G(cution.).15 E .533(The special parameter)108 496.8 |
| R F3(#)3.033 E F0 .532(is updated to re\215ect the change.)3.033 F .532 |
| (Special parameter 0 is unchanged.)5.532 F .532(The \214rst ele-)5.532 F |
| (ment of the)108 508.8 Q F4(FUNCN)2.5 E(AME)-.18 E F0 -.25(va)2.25 G |
| (riable is set to the name of the function while the function is e).25 E |
| -.15(xe)-.15 G(cuting.).15 E 1.25(All other aspects of the shell e)108 |
| 525.6 R -.15(xe)-.15 G 1.25(cution en).15 F 1.25 |
| (vironment are identical between a function and its caller with)-.4 F |
| 1.049(these e)108 537.6 R 3.548(xceptions: the)-.15 F F4(DEB)3.548 E(UG) |
| -.09 E F0(and)3.298 E F3(RETURN)3.548 E F0 1.048 |
| (traps \(see the description of the)3.548 F F3(trap)3.548 E F0 -.2(bu) |
| 3.548 G 1.048(iltin under).2 F F4(SHELL)3.548 E -.09(BU)108 549.6 S(IL) |
| .09 E .478(TIN COMMANDS)-.828 F F0(belo)2.728 E .479 |
| (w\) are not inherited unless the function has been gi)-.25 F -.15(ve) |
| -.25 G 2.979(nt).15 G(he)-2.979 E F3(trace)2.979 E F0(attrib)2.979 E |
| .479(ute \(see)-.2 F .421(the description of the)108 561.6 R F4(declar) |
| 2.92 E(e)-.162 E F0 -.2(bu)2.67 G .42(iltin belo).2 F .42(w\) or the) |
| -.25 F F3 .42(\255o functrace)2.92 F F0 .42 |
| (shell option has been enabled with the)2.92 F F3(set)2.92 E F0 -.2(bu) |
| 108 573.6 S .071(iltin \(in which case all functions inherit the).2 F F3 |
| (DEB)2.572 E(UG)-.1 E F0(and)2.572 E F3(RETURN)2.572 E F0 .072 |
| (traps\), and the)2.572 F F4(ERR)2.572 E F0 .072(trap is not inher)2.322 |
| F(-)-.2 E(ited unless the)108 585.6 Q F3(\255o errtrace)2.5 E F0 |
| (shell option has been enabled.)2.5 E -1.11(Va)108 602.4 S .656 |
| (riables local to the function may be declared with the)1.11 F F3(local) |
| 3.155 E F0 -.2(bu)3.155 G .655(iltin command.).2 F(Ordinarily)5.655 E |
| 3.155(,v)-.65 G .655(ariables and)-3.405 F(their v)108 614.4 Q |
| (alues are shared between the function and its caller)-.25 E(.)-.55 E |
| .043(If the b)108 631.2 R .043(uiltin command)-.2 F F3 -.18(re)2.543 G |
| (tur).18 E(n)-.15 E F0 .043(is e)2.543 F -.15(xe)-.15 G .043 |
| (cuted in a function, the function completes and e).15 F -.15(xe)-.15 G |
| .044(cution resumes with).15 F 1.012(the ne)108 643.2 R 1.012 |
| (xt command after the function call.)-.15 F(An)6.011 E 3.511(yc)-.15 G |
| 1.011(ommand associated with the)-3.511 F F3(RETURN)3.511 E F0 1.011 |
| (trap is e)3.511 F -.15(xe)-.15 G(cuted).15 E .213(before e)108 655.2 R |
| -.15(xe)-.15 G .213(cution resumes.).15 F .213 |
| (When a function completes, the v)5.213 F .214 |
| (alues of the positional parameters and the spe-)-.25 F(cial parameter) |
| 108 667.2 Q F3(#)2.5 E F0(are restored to the v)2.5 E(alues the)-.25 E |
| 2.5(yh)-.15 G(ad prior to the function')-2.5 E 2.5(se)-.55 G -.15(xe) |
| -2.65 G(cution.).15 E 1.359 |
| (Function names and de\214nitions may be listed with the)108 684 R F3 |
| <ad66>3.858 E F0 1.358(option to the)3.858 F F3(declar)3.858 E(e)-.18 E |
| F0(or)3.858 E F3(typeset)3.858 E F0 -.2(bu)3.858 G 1.358(iltin com-).2 F |
| 3.39(mands. The)108 696 R F3<ad46>3.39 E F0 .89(option to)3.39 F F3 |
| (declar)3.39 E(e)-.18 E F0(or)3.39 E F3(typeset)3.39 E F0 .89 |
| (will list the function names only \(and optionally the source)3.39 F |
| .327(\214le and line number)108 708 R 2.827(,i)-.4 G 2.827(ft)-2.827 G |
| (he)-2.827 E F3(extdeb)2.827 E(ug)-.2 E F0 .326 |
| (shell option is enabled\).)2.827 F .326(Functions may be e)5.326 F .326 |
| (xported so that subshells)-.15 F 1.297(automatically ha)108 720 R 1.597 |
| -.15(ve t)-.2 H 1.297(hem de\214ned with the).15 F F3<ad66>3.797 E F0 |
| 1.297(option to the)3.797 F F3(export)3.798 E F0 -.2(bu)3.798 G 3.798 |
| (iltin. A).2 F 1.298(function de\214nition may be)3.798 F(GNU Bash-4.1) |
| 72 768 Q(2009 December 29)135.965 E(26)185.955 E 0 Cg EP |
| %%Page: 27 27 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .161(deleted using the)108 84 R/F1 10/Times-Bold@0 SF<ad66>2.661 |
| E F0 .161(option to the)2.661 F F1(unset)2.661 E F0 -.2(bu)2.661 G 2.661 |
| (iltin. Note).2 F .16(that shell functions and v)2.661 F .16 |
| (ariables with the same name)-.25 F 1.325 |
| (may result in multiple identically-named entries in the en)108 96 R |
| 1.325(vironment passed to the shell')-.4 F 3.825(sc)-.55 G 3.825 |
| (hildren. Care)-3.825 F(should be tak)108 108 Q |
| (en in cases where this may cause a problem.)-.1 E |
| (Functions may be recursi)108 124.8 Q -.15(ve)-.25 G 5(.N).15 G 2.5(ol) |
| -5 G(imit is imposed on the number of recursi)-2.5 E .3 -.15(ve c)-.25 H |
| (alls.).15 E/F2 10.95/Times-Bold@0 SF(ARITHMETIC EV)72 141.6 Q(ALU) |
| -1.478 E -1.04(AT)-.657 G(ION)1.04 E F0 2.298(The shell allo)108 153.6 R |
| 2.297(ws arithmetic e)-.25 F 2.297(xpressions to be e)-.15 F -.25(va) |
| -.25 G 2.297(luated, under certain circumstances \(see the).25 F F1(let) |
| 4.797 E F0(and)4.797 E F1(declar)108 165.6 Q(e)-.18 E F0 -.2(bu)2.705 G |
| .205(iltin commands and).2 F F1 .205(Arithmetic Expansion)2.705 F F0 |
| 2.705(\). Ev)B .205(aluation is done in \214x)-.25 F .206(ed-width inte) |
| -.15 F .206(gers with no)-.15 F .429(check for o)108 177.6 R -.15(ve) |
| -.15 G(r\215o).15 E 1.729 -.65(w, t)-.25 H .429(hough di).65 F .428 |
| (vision by 0 is trapped and \215agged as an error)-.25 F 5.428(.T)-.55 G |
| .428(he operators and their prece-)-5.428 F 1.919(dence, associati)108 |
| 189.6 R(vity)-.25 E 4.419(,a)-.65 G 1.919(nd v)-4.419 F 1.919 |
| (alues are the same as in the C language.)-.25 F 1.92(The follo)6.92 F |
| 1.92(wing list of operators is)-.25 F(grouped into le)108 201.6 Q -.15 |
| (ve)-.25 G(ls of equal-precedence operators.).15 E(The le)5 E -.15(ve) |
| -.25 G(ls are listed in order of decreasing precedence.).15 E/F3 10 |
| /Times-Italic@0 SF(id)108 218.4 Q F1(++)A F3(id)2.5 E F1<adad>A F0 -.25 |
| (va)144 230.4 S(riable post-increment and post-decrement).25 E F1(++)108 |
| 242.4 Q F3(id)A F1<adad>2.5 E F3(id)A F0 -.25(va)144 254.4 S |
| (riable pre-increment and pre-decrement).25 E F1 2.5<ad2b>108 266.4 S F0 |
| (unary minus and plus)19.6 E F1 2.5(!~)108 278.4 S F0 |
| (logical and bitwise ne)24.34 E -.05(ga)-.15 G(tion).05 E F1(**)108 |
| 290.4 Q F0 -.15(ex)26 G(ponentiation).15 E F1 2.5(*/%)108 302.4 S F0 |
| (multiplication, di)10.72 E(vision, remainder)-.25 E F1 2.5<2bad>108 |
| 314.4 S F0(addition, subtraction)19.6 E F1(<< >>)108 326.4 Q F0 |
| (left and right bitwise shifts)10.7 E F1(<= >= < >)108 338.4 Q F0 |
| (comparison)144 350.4 Q F1(== !=)108 362.4 Q F0(equality and inequality) |
| 13.07 E F1(&)108 374.4 Q F0(bitwise AND)27.67 E F1(^)108 386.4 Q F0 |
| (bitwise e)32.67 E(xclusi)-.15 E .3 -.15(ve O)-.25 H(R).15 E F1(|)108 |
| 398.4 Q F0(bitwise OR)33.8 E F1(&&)108 410.4 Q F0(logical AND)19.34 E F1 |
| (||)108 422.4 Q F0(logical OR)31.6 E F3 -.2(ex)108 434.4 S(pr).2 E F1(?) |
| A F3 -.2(ex)C(pr).2 E F1(:)A F3 -.2(ex)C(pr).2 E F0 |
| (conditional operator)144 446.4 Q F1 2.5(=*)108 458.4 S 2.5(=/)-2.5 G |
| 2.5(=%)-2.5 G 2.5(=+)-2.5 G 2.5<3dad>-2.5 G 2.5(=<)-2.5 G |
| (<= >>= &= ^= |=)-2.5 E F0(assignment)144 470.4 Q F3 -.2(ex)108 482.4 S |
| (pr1).2 E F1(,)2.5 E F3 -.2(ex)2.5 G(pr2).2 E F0(comma)144 494.4 Q .68 |
| (Shell v)108 511.2 R .68(ariables are allo)-.25 F .68 |
| (wed as operands; parameter e)-.25 F .68 |
| (xpansion is performed before the e)-.15 F .68(xpression is e)-.15 F |
| -.25(va)-.25 G(lu-).25 E 3.507(ated. W)108 523.2 R 1.007(ithin an e)-.4 |
| F 1.007(xpression, shell v)-.15 F 1.007 |
| (ariables may also be referenced by name without using the parameter) |
| -.25 F -.15(ex)108 535.2 S 1.041(pansion syntax.).15 F 3.541(As)6.041 G |
| 1.041(hell v)-3.541 F 1.041(ariable that is null or unset e)-.25 F -.25 |
| (va)-.25 G 1.04(luates to 0 when referenced by name without).25 F 1.466 |
| (using the parameter e)108 547.2 R 1.466(xpansion syntax.)-.15 F 1.467 |
| (The v)6.466 F 1.467(alue of a v)-.25 F 1.467(ariable is e)-.25 F -.25 |
| (va)-.25 G 1.467(luated as an arithmetic e).25 F(xpression)-.15 E 1.39 |
| (when it is referenced, or when a v)108 559.2 R 1.389 |
| (ariable which has been gi)-.25 F -.15(ve)-.25 G 3.889(nt).15 G(he) |
| -3.889 E F3(inte)3.889 E -.1(ge)-.4 G(r).1 E F0(attrib)3.889 E 1.389 |
| (ute using)-.2 F F1(declar)3.889 E 3.889(e-)-.18 G(i)-3.889 E F0(is) |
| 3.889 E .343(assigned a v)108 571.2 R 2.843(alue. A)-.25 F .343(null v) |
| 2.843 F .343(alue e)-.25 F -.25(va)-.25 G .343(luates to 0.).25 F 2.843 |
| (As)5.343 G .343(hell v)-2.843 F .343(ariable need not ha)-.25 F .643 |
| -.15(ve i)-.2 H .343(ts inte).15 F .344(ger attrib)-.15 F .344 |
| (ute turned on)-.2 F(to be used in an e)108 583.2 Q(xpression.)-.15 E |
| 1.406(Constants with a leading 0 are interpreted as octal numbers.)108 |
| 600 R 3.906(Al)6.406 G 1.406(eading 0x or 0X denotes he)-3.906 F |
| (xadecimal.)-.15 E .589(Otherwise, numbers tak)108 612 R 3.089(et)-.1 G |
| .589(he form [)-3.089 F F3(base#)A F0 .589(]n, where)B F3(base)3.089 E |
| F0 .59(is a decimal number between 2 and 64 represent-)3.089 F .093 |
| (ing the arithmetic base, and)108 624 R F3(n)2.593 E F0 .093 |
| (is a number in that base.)2.593 F(If)5.093 E F3(base#)2.593 E F0 .092 |
| (is omitted, then base 10 is used.)2.593 F .092(The digits)5.092 F .064 |
| (greater than 9 are represented by the lo)108 636 R .064 |
| (wercase letters, the uppercase letters, @, and _, in that order)-.25 F |
| 5.065(.I)-.55 G(f)-5.065 E F3(base)2.565 E F0 .433 |
| (is less than or equal to 36, lo)108 648 R .432(wercase and uppercase l\ |
| etters may be used interchangeably to represent num-)-.25 F |
| (bers between 10 and 35.)108 660 Q .234(Operators are e)108 676.8 R -.25 |
| (va)-.25 G .234(luated in order of precedence.).25 F(Sub-e)5.234 E .234 |
| (xpressions in parentheses are e)-.15 F -.25(va)-.25 G .235 |
| (luated \214rst and may).25 F -.15(ove)108 688.8 S |
| (rride the precedence rules abo).15 E -.15(ve)-.15 G(.).15 E F2 |
| (CONDITION)72 705.6 Q(AL EXPRESSIONS)-.219 E F0 .256(Conditional e)108 |
| 717.6 R .256(xpressions are used by the)-.15 F F1([[)2.755 E F0 .255 |
| (compound command and the)2.755 F F1(test)2.755 E F0(and)2.755 E F1([) |
| 2.755 E F0 -.2(bu)2.755 G .255(iltin commands to test).2 F .77 |
| (\214le attrib)108 729.6 R .77 |
| (utes and perform string and arithmetic comparisons.)-.2 F .77 |
| (Expressions are formed from the follo)5.77 F(wing)-.25 E(GNU Bash-4.1) |
| 72 768 Q(2009 December 29)135.965 E(27)185.955 E 0 Cg EP |
| %%Page: 28 28 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 1.041(unary or binary primaries.)108 84 R 1.041(If an)6.041 F(y) |
| -.15 E/F1 10/Times-Italic@0 SF(\214le)3.541 E F0(ar)3.541 E 1.04 |
| (gument to one of the primaries is of the form)-.18 F F1(/de)3.54 E |
| (v/fd/n)-.15 E F0 3.54(,t)C 1.04(hen \214le)-3.54 F(descriptor)108 96 Q |
| F1(n)3.788 E F0 1.289(is check)3.788 F 3.789(ed. If)-.1 F(the)3.789 E F1 |
| (\214le)3.789 E F0(ar)3.789 E 1.289 |
| (gument to one of the primaries is one of)-.18 F F1(/de)3.789 E(v/stdin) |
| -.15 E F0(,)A F1(/de)3.789 E(v/stdout)-.15 E F0 3.789(,o)C(r)-3.789 E F1 |
| (/de)108 108 Q(v/stderr)-.15 E F0 2.5<2c8c>C |
| (le descriptor 0, 1, or 2, respecti)-2.5 E -.15(ve)-.25 G(ly).15 E 2.5 |
| (,i)-.65 G 2.5(sc)-2.5 G(heck)-2.5 E(ed.)-.1 E .722 |
| (Unless otherwise speci\214ed, primaries that operate on \214les follo) |
| 108 124.8 R 3.221(ws)-.25 G .721(ymbolic links and operate on the tar) |
| -3.221 F(get)-.18 E(of the link, rather than the link itself.)108 136.8 |
| Q(When used with)108 154.8 Q/F2 10/Times-Bold@0 SF([[)2.5 E F0 2.5(,T)C |
| (he)-2.5 E F2(<)2.5 E F0(and)2.5 E F2(>)2.5 E F0(operators sort le)2.5 E |
| (xicographically using the current locale.)-.15 E F2<ad61>108 178.8 Q F1 |
| (\214le)2.5 E F0 -.35(Tr)10.58 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex) |
| 2.5 G(ists.).15 E F2<ad62>108 190.8 Q F1(\214le)2.5 E F0 -.35(Tr)10.02 G |
| (ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and is a block special \214le.).15 E F2<ad63>108 202.8 Q F1 |
| (\214le)2.5 E F0 -.35(Tr)11.14 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex) |
| 2.5 G(ists and is a character special \214le.).15 E F2<ad64>108 214.8 Q |
| F1(\214le)2.5 E F0 -.35(Tr)10.02 G(ue if).35 E F1(\214le)2.5 E F0 -.15 |
| (ex)2.5 G(ists and is a directory).15 E(.)-.65 E F2<ad65>108 226.8 Q F1 |
| (\214le)2.5 E F0 -.35(Tr)11.14 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex) |
| 2.5 G(ists.).15 E F2<ad66>108 238.8 Q F1(\214le)2.5 E F0 -.35(Tr)12.25 G |
| (ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G(ists and is a re).15 E |
| (gular \214le.)-.15 E F2<ad67>108 250.8 Q F1(\214le)2.5 E F0 -.35(Tr) |
| 10.58 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and is set-group-id.).15 E F2<ad68>108 262.8 Q F1(\214le)2.5 E F0 |
| -.35(Tr)10.02 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and is a symbolic link.).15 E F2<ad6b>108 274.8 Q F1(\214le)2.5 E |
| F0 -.35(Tr)10.02 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and its `).15 E(`stick)-.74 E(y')-.15 E 2.5('b)-.74 G(it is set.) |
| -2.5 E F2<ad70>108 286.8 Q F1(\214le)2.5 E F0 -.35(Tr)10.02 G(ue if).35 |
| E F1(\214le)2.5 E F0 -.15(ex)2.5 G(ists and is a named pipe \(FIFO\).) |
| .15 E F2<ad72>108 298.8 Q F1(\214le)2.5 E F0 -.35(Tr)11.14 G(ue if).35 E |
| F1(\214le)2.5 E F0 -.15(ex)2.5 G(ists and is readable.).15 E F2<ad73>108 |
| 310.8 Q F1(\214le)2.5 E F0 -.35(Tr)11.69 G(ue if).35 E F1(\214le)2.5 E |
| F0 -.15(ex)2.5 G(ists and has a size greater than zero.).15 E F2<ad74> |
| 108 322.8 Q F1(fd)2.5 E F0 -.35(Tr)16.69 G(ue if \214le descriptor).35 E |
| F1(fd)4.47 E F0(is open and refers to a terminal.)3.27 E F2<ad75>108 |
| 334.8 Q F1(\214le)2.5 E F0 -.35(Tr)10.02 G(ue if).35 E F1(\214le)2.5 E |
| F0 -.15(ex)2.5 G(ists and its set-user).15 E(-id bit is set.)-.2 E F2 |
| <ad77>108 346.8 Q F1(\214le)2.5 E F0 -.35(Tr)8.36 G(ue if).35 E F1 |
| (\214le)2.5 E F0 -.15(ex)2.5 G(ists and is writable.).15 E F2<ad78>108 |
| 358.8 Q F1(\214le)2.5 E F0 -.35(Tr)10.58 G(ue if).35 E F1(\214le)2.5 E |
| F0 -.15(ex)2.5 G(ists and is e).15 E -.15(xe)-.15 G(cutable.).15 E F2 |
| <ad4f>108 370.8 Q F1(\214le)2.5 E F0 -.35(Tr)7.8 G(ue if).35 E F1 |
| (\214le)2.5 E F0 -.15(ex)2.5 G(ists and is o).15 E(wned by the ef)-.25 E |
| (fecti)-.25 E .3 -.15(ve u)-.25 H(ser id.).15 E F2<ad47>108 382.8 Q F1 |
| (\214le)2.5 E F0 -.35(Tr)7.8 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex) |
| 2.5 G(ists and is o).15 E(wned by the ef)-.25 E(fecti)-.25 E .3 -.15 |
| (ve g)-.25 H(roup id.).15 E F2<ad4c>108 394.8 Q F1(\214le)2.5 E F0 -.35 |
| (Tr)8.91 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and is a symbolic link.).15 E F2<ad53>108 406.8 Q F1(\214le)2.5 E |
| F0 -.35(Tr)10.02 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and is a sock).15 E(et.)-.1 E F2<ad4e>108 418.8 Q F1(\214le)2.5 E |
| F0 -.35(Tr)8.36 G(ue if).35 E F1(\214le)2.5 E F0 -.15(ex)2.5 G |
| (ists and has been modi\214ed since it w).15 E(as last read.)-.1 E F1 |
| (\214le1)108 430.8 Q F0<ad>2.5 E F2(nt)A F1(\214le2)2.5 E F0 -.35(Tr)144 |
| 442.8 S .038(ue if).35 F F1(\214le1)2.538 E F0 .039(is ne)2.539 F .039 |
| (wer \(according to modi\214cation date\) than)-.25 F F1(\214le2)2.539 E |
| F0 2.539(,o)C 2.539(ri)-2.539 G(f)-2.539 E F1(\214le1)2.539 E F0 -.15 |
| (ex)2.539 G .039(ists and).15 F F1(\214le2)2.539 E F0 .039(does not.) |
| 2.539 F F1(\214le1)108 454.8 Q F0<ad>2.5 E F2(ot)A F1(\214le2)2.5 E F0 |
| -.35(Tr)144 466.8 S(ue if).35 E F1(\214le1)2.5 E F0(is older than)2.5 E |
| F1(\214le2)2.5 E F0 2.5(,o)C 2.5(ri)-2.5 G(f)-2.5 E F1(\214le2)2.5 E F0 |
| -.15(ex)2.5 G(ists and).15 E F1(\214le1)2.5 E F0(does not.)2.5 E F1 |
| (\214le1)108 478.8 Q F2(\255ef)2.5 E F1(\214le2)2.5 E F0 -.35(Tr)144 |
| 490.8 S(ue if).35 E F1(\214le1)2.5 E F0(and)2.5 E F1(\214le2)2.5 E F0 |
| (refer to the same de)2.5 E(vice and inode numbers.)-.25 E F2<ad6f>108 |
| 502.8 Q F1(optname)2.5 E F0 -.35(Tr)144 514.8 S 1.144 |
| (ue if shell option).35 F F1(optname)3.874 E F0 1.144(is enabled.)3.824 |
| F 1.143(See the list of options under the description of the)6.144 F F2 |
| <ad6f>3.643 E F0(option to the)144 526.8 Q F2(set)2.5 E F0 -.2(bu)2.5 G |
| (iltin belo).2 E -.65(w.)-.25 G F2<ad7a>108 538.8 Q F1(string)2.5 E F0 |
| -.35(Tr)144 550.8 S(ue if the length of).35 E F1(string)2.5 E F0 |
| (is zero.)2.5 E F1(string)108 562.8 Q F2<ad6e>108 574.8 Q F1(string)2.5 |
| E F0 -.35(Tr)144 586.8 S(ue if the length of).35 E F1(string)2.84 E F0 |
| (is non-zero.)2.72 E F1(string1)108 603.6 Q F2(==)2.5 E F1(string2)2.5 E |
| (string1)108 615.6 Q F2(=)2.5 E F1(string2)2.5 E F0 -.35(Tr)144 627.6 S |
| (ue if the strings are equal.).35 E F2(=)5 E F0(should be used with the) |
| 2.5 E F2(test)2.5 E F0(command for POSIX conformance.)2.5 E F1(string1) |
| 108 644.4 Q F2(!=)2.5 E F1(string2)2.5 E F0 -.35(Tr)144 656.4 S |
| (ue if the strings are not equal.).35 E F1(string1)108 673.2 Q F2(<)2.5 |
| E F1(string2)2.5 E F0 -.35(Tr)144 685.2 S(ue if).35 E F1(string1)2.5 E |
| F0(sorts before)2.5 E F1(string2)2.5 E F0(le)2.5 E(xicographically)-.15 |
| E(.)-.65 E F1(string1)108 702 Q F2(>)2.5 E F1(string2)2.5 E F0 -.35(Tr) |
| 144 714 S(ue if).35 E F1(string1)2.5 E F0(sorts after)2.5 E F1(string2) |
| 2.5 E F0(le)2.5 E(xicographically)-.15 E(.)-.65 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(28)185.955 E 0 Cg EP |
| %%Page: 29 29 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Italic@0 SF(ar)108.33 84 Q(g1)-.37 E/F2 10 |
| /Times-Bold@0 SF(OP)2.5 E F1(ar)2.5 E(g2)-.37 E/F3 9/Times-Bold@0 SF(OP) |
| 144 96 Q F0 .385(is one of)2.634 F F2(\255eq)2.885 E F0(,)A F2(\255ne) |
| 2.885 E F0(,)A F2(\255lt)2.885 E F0(,)A F2(\255le)2.885 E F0(,)A F2 |
| (\255gt)2.885 E F0 2.885(,o)C(r)-2.885 E F2(\255ge)2.885 E F0 5.385(.T)C |
| .385(hese arithmetic binary operators return true if)-5.385 F F1(ar) |
| 2.885 E(g1)-.37 E F0 .845(is equal to, not equal to, less than, less th\ |
| an or equal to, greater than, or greater than or equal to)144 108 R F1 |
| (ar)144 120 Q(g2)-.37 E F0 2.5(,r)C(especti)-2.5 E -.15(ve)-.25 G(ly).15 |
| E(.)-.65 E F1(Ar)6.01 E(g1)-.37 E F0(and)2.5 E F1(ar)2.83 E(g2)-.37 E F0 |
| (may be positi)2.52 E .3 -.15(ve o)-.25 H 2.5(rn).15 G -2.25 -.15(eg a) |
| -2.5 H(ti).15 E .3 -.15(ve i)-.25 H(nte).15 E(gers.)-.15 E/F4 10.95 |
| /Times-Bold@0 SF(SIMPLE COMMAND EXP)72 136.8 Q(ANSION)-.81 E F0 .613 |
| (When a simple command is e)108 148.8 R -.15(xe)-.15 G .614 |
| (cuted, the shell performs the follo).15 F .614(wing e)-.25 F .614 |
| (xpansions, assignments, and redi-)-.15 F(rections, from left to right.) |
| 108 160.8 Q 26(1. The)108 177.6 R -.1(wo)4.349 G 1.849 |
| (rds that the parser has mark).1 F 1.848(ed as v)-.1 F 1.848 |
| (ariable assignments \(those preceding the command)-.25 F |
| (name\) and redirections are sa)144 189.6 Q -.15(ve)-.2 G 2.5(df).15 G |
| (or later processing.)-2.5 E 26(2. The)108 206.4 R -.1(wo)3.663 G 1.163 |
| (rds that are not v).1 F 1.164 |
| (ariable assignments or redirections are e)-.25 F 3.664(xpanded. If)-.15 |
| F(an)3.664 E 3.664(yw)-.15 G 1.164(ords remain)-3.764 F .776(after e)144 |
| 218.4 R .776(xpansion, the \214rst w)-.15 F .776(ord is tak)-.1 F .775 |
| (en to be the name of the command and the remaining w)-.1 F(ords)-.1 E |
| (are the ar)144 230.4 Q(guments.)-.18 E 26(3. Redirections)108 247.2 R |
| (are performed as described abo)2.5 E .3 -.15(ve u)-.15 H(nder).15 E F3 |
| (REDIRECTION)2.5 E/F5 9/Times-Roman@0 SF(.)A F0 26(4. The)108 264 R(te) |
| 3.216 E .717(xt after the)-.15 F F2(=)3.217 E F0 .717(in each v)3.217 F |
| .717(ariable assignment under)-.25 F .717(goes tilde e)-.18 F .717 |
| (xpansion, parameter e)-.15 F(xpansion,)-.15 E .34 |
| (command substitution, arithmetic e)144 276 R .339 |
| (xpansion, and quote remo)-.15 F -.25(va)-.15 G 2.839(lb).25 G .339 |
| (efore being assigned to the v)-2.839 F(ari-)-.25 E(able.)144 288 Q .332 |
| (If no command name results, the v)108 304.8 R .332 |
| (ariable assignments af)-.25 F .332(fect the current shell en)-.25 F |
| 2.833(vironment. Otherwise,)-.4 F(the)2.833 E -.25(va)108 316.8 S .757 |
| (riables are added to the en).25 F .757(vironment of the e)-.4 F -.15 |
| (xe)-.15 G .757(cuted command and do not af).15 F .757 |
| (fect the current shell en)-.25 F(vi-)-.4 E 3.176(ronment. If)108 328.8 |
| R(an)3.176 E 3.176(yo)-.15 G 3.176(ft)-3.176 G .677 |
| (he assignments attempts to assign a v)-3.176 F .677 |
| (alue to a readonly v)-.25 F .677(ariable, an error occurs, and)-.25 F |
| (the command e)108 340.8 Q(xits with a non-zero status.)-.15 E .15 |
| (If no command name results, redirections are performed, b)108 357.6 R |
| .149(ut do not af)-.2 F .149(fect the current shell en)-.25 F 2.649 |
| (vironment. A)-.4 F(redirection error causes the command to e)108 369.6 |
| Q(xit with a non-zero status.)-.15 E 1.064 |
| (If there is a command name left after e)108 386.4 R 1.064(xpansion, e) |
| -.15 F -.15(xe)-.15 G 1.064(cution proceeds as described belo).15 F |
| 4.864 -.65(w. O)-.25 H 1.064(therwise, the).65 F .069(command e)108 |
| 398.4 R 2.569(xits. If)-.15 F .069(one of the e)2.569 F .069 |
| (xpansions contained a command substitution, the e)-.15 F .068 |
| (xit status of the command)-.15 F .466(is the e)108 410.4 R .466 |
| (xit status of the last command substitution performed.)-.15 F .467 |
| (If there were no command substitutions, the)5.466 F(command e)108 422.4 |
| Q(xits with a status of zero.)-.15 E F4(COMMAND EXECUTION)72 439.2 Q F0 |
| .547(After a command has been split into w)108 451.2 R .546 |
| (ords, if it results in a simple command and an optional list of ar)-.1 |
| F(gu-)-.18 E(ments, the follo)108 463.2 Q(wing actions are tak)-.25 E |
| (en.)-.1 E .379(If the command name contains no slashes, the shell atte\ |
| mpts to locate it.)108 480 R .379(If there e)5.379 F .379 |
| (xists a shell function by)-.15 F .246(that name, that function is in) |
| 108 492 R -.2(vo)-.4 G -.1(ke).2 G 2.746(da).1 G 2.746(sd)-2.746 G .246 |
| (escribed abo)-2.746 F .546 -.15(ve i)-.15 H(n).15 E F3(FUNCTIONS)2.746 |
| E F5(.)A F0 .246(If the name does not match a func-)4.746 F |
| (tion, the shell searches for it in the list of shell b)108 504 Q 2.5 |
| (uiltins. If)-.2 F 2.5(am)2.5 G(atch is found, that b)-2.5 E |
| (uiltin is in)-.2 E -.2(vo)-.4 G -.1(ke).2 G(d.).1 E .309 |
| (If the name is neither a shell function nor a b)108 520.8 R .31 |
| (uiltin, and contains no slashes,)-.2 F F2(bash)2.81 E F0 .31 |
| (searches each element of)2.81 F(the)108 532.8 Q F3 -.666(PA)3.163 G(TH) |
| -.189 E F0 .662(for a directory containing an e)2.913 F -.15(xe)-.15 G |
| .662(cutable \214le by that name.).15 F F2(Bash)5.662 E F0 .662 |
| (uses a hash table to remember)3.162 F 1.914(the full pathnames of e)108 |
| 544.8 R -.15(xe)-.15 G 1.915(cutable \214les \(see).15 F F2(hash)4.415 E |
| F0(under)4.415 E F3 1.915(SHELL B)4.415 F(UIL)-.09 E 1.915(TIN COMMANDS) |
| -.828 F F0(belo)4.165 E 4.415(w\). A)-.25 F(full)4.415 E .72 |
| (search of the directories in)108 556.8 R F3 -.666(PA)3.22 G(TH)-.189 E |
| F0 .719 |
| (is performed only if the command is not found in the hash table.)2.97 F |
| .719(If the)5.719 F .956(search is unsuccessful, the shell searches for\ |
| a de\214ned shell function named)108 568.8 R F2(command_not_f)3.456 E |
| (ound_han-)-.25 E(dle)108 580.8 Q F0 5.278(.I)C 2.778(ft)-5.278 G .278 |
| (hat function e)-2.778 F .278(xists, it is in)-.15 F -.2(vo)-.4 G -.1 |
| (ke).2 G 2.778(dw).1 G .277 |
| (ith the original command and the original command')-2.778 F 2.777(sa) |
| -.55 G -.18(rg)-2.777 G(uments).18 E .775(as its ar)108 592.8 R .775 |
| (guments, and the function')-.18 F 3.275(se)-.55 G .775 |
| (xit status becomes the e)-3.425 F .775(xit status of the shell.)-.15 F |
| .776(If that function is not)5.776 F |
| (de\214ned, the shell prints an error message and returns an e)108 604.8 |
| Q(xit status of 127.)-.15 E 1.089(If the search is successful, or if th\ |
| e command name contains one or more slashes, the shell e)108 621.6 R |
| -.15(xe)-.15 G 1.089(cutes the).15 F .197(named program in a separate e) |
| 108 633.6 R -.15(xe)-.15 G .197(cution en).15 F 2.698(vironment. Ar)-.4 |
| F .198(gument 0 is set to the name gi)-.18 F -.15(ve)-.25 G .198 |
| (n, and the remain-).15 F(ing ar)108 645.6 Q |
| (guments to the command are set to the ar)-.18 E(guments gi)-.18 E -.15 |
| (ve)-.25 G(n, if an).15 E -.65(y.)-.15 G 1.809(If this e)108 662.4 R |
| -.15(xe)-.15 G 1.809(cution f).15 F 1.809 |
| (ails because the \214le is not in e)-.1 F -.15(xe)-.15 G 1.809 |
| (cutable format, and the \214le is not a directory).15 F 4.309(,i)-.65 G |
| 4.309(ti)-4.309 G(s)-4.309 E .677(assumed to be a)108 674.4 R F1 .678 |
| (shell script)3.177 F F0 3.178(,a\214)C .678 |
| (le containing shell commands.)-3.178 F 3.178(As)5.678 G .678 |
| (ubshell is spa)-3.178 F .678(wned to e)-.15 F -.15(xe)-.15 G .678 |
| (cute it.).15 F(This)5.678 E .33 |
| (subshell reinitializes itself, so that the ef)108 686.4 R .33 |
| (fect is as if a ne)-.25 F 2.829(ws)-.25 G .329(hell had been in)-2.829 |
| F -.2(vo)-.4 G -.1(ke).2 G 2.829(dt).1 G 2.829(oh)-2.829 G .329 |
| (andle the script, with)-2.829 F 1.219(the e)108 698.4 R 1.219 |
| (xception that the locations of commands remembered by the parent \(see) |
| -.15 F F2(hash)3.719 E F0(belo)3.719 E 3.719(wu)-.25 G(nder)-3.719 E F3 |
| (SHELL)3.719 E -.09(BU)108 710.4 S(IL).09 E(TIN COMMANDS)-.828 E F5(\))A |
| F0(are retained by the child.)2.25 E 1.375 |
| (If the program is a \214le be)108 727.2 R 1.374(ginning with)-.15 F F2 |
| (#!)3.874 E F0 3.874(,t)C 1.374 |
| (he remainder of the \214rst line speci\214es an interpreter for the) |
| -3.874 F(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(29)185.955 E 0 |
| Cg EP |
| %%Page: 30 30 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 5.485(program. The)108 84 R 2.985(shell e)5.485 F -.15(xe)-.15 G |
| 2.986(cutes the speci\214ed interpreter on operating systems that do no\ |
| t handle this).15 F -.15(exe)108 96 S .762(cutable format themselv).15 F |
| 3.262(es. The)-.15 F(ar)3.262 E .761 |
| (guments to the interpreter consist of a single optional ar)-.18 F .761 |
| (gument fol-)-.18 F(lo)108 108 Q .156 |
| (wing the interpreter name on the \214rst line of the program, follo) |
| -.25 F .157(wed by the name of the program, follo)-.25 F(wed)-.25 E |
| (by the command ar)108 120 Q(guments, if an)-.18 E -.65(y.)-.15 G/F1 |
| 10.95/Times-Bold@0 SF(COMMAND EXECUTION ENVIR)72 136.8 Q(ONMENT)-.329 E |
| F0(The shell has an)108 148.8 Q/F2 10/Times-Italic@0 SF -.2(ex)2.5 G |
| (ecution en).2 E(vir)-.4 E(onment)-.45 E F0 2.5(,w)C |
| (hich consists of the follo)-2.5 E(wing:)-.25 E 32.5<836f>108 165.6 S |
| 1.406(pen \214les inherited by the shell at in)-32.5 F -.2(vo)-.4 G |
| 1.405(cation, as modi\214ed by redirections supplied to the).2 F/F3 10 |
| /Times-Bold@0 SF(exec)3.905 E F0 -.2(bu)144 177.6 S(iltin).2 E 32.5 |
| <8374>108 194.4 S(he current w)-32.5 E(orking directory as set by)-.1 E |
| F3(cd)2.5 E F0(,)A F3(pushd)2.5 E F0 2.5(,o)C(r)-2.5 E F3(popd)2.5 E F0 |
| 2.5(,o)C 2.5(ri)-2.5 G(nherited by the shell at in)-2.5 E -.2(vo)-.4 G |
| (cation).2 E 32.5<8374>108 211.2 S |
| (he \214le creation mode mask as set by)-32.5 E F3(umask)2.5 E F0 |
| (or inherited from the shell')2.5 E 2.5(sp)-.55 G(arent)-2.5 E 32.5 |
| <8363>108 228 S(urrent traps set by)-32.5 E F3(trap)2.5 E F0 32.5<8373> |
| 108 244.8 S .256(hell parameters that are set by v)-32.5 F .256 |
| (ariable assignment or with)-.25 F F3(set)2.756 E F0 .257 |
| (or inherited from the shell')2.756 F 2.757(sp)-.55 G(arent)-2.757 E |
| (in the en)144 256.8 Q(vironment)-.4 E 32.5<8373>108 273.6 S |
| (hell functions de\214ned during e)-32.5 E -.15(xe)-.15 G |
| (cution or inherited from the shell').15 E 2.5(sp)-.55 G |
| (arent in the en)-2.5 E(vironment)-.4 E 32.5<836f>108 290.4 S |
| (ptions enabled at in)-32.5 E -.2(vo)-.4 G(cation \(either by def).2 E |
| (ault or with command-line ar)-.1 E(guments\) or by)-.18 E F3(set)2.5 E |
| F0 32.5<836f>108 307.2 S(ptions enabled by)-32.5 E F3(shopt)2.5 E F0 |
| 32.5<8373>108 324 S(hell aliases de\214ned with)-32.5 E F3(alias)2.5 E |
| F0 32.5<8376>108 340.8 S |
| (arious process IDs, including those of background jobs, the v)-32.75 E |
| (alue of)-.25 E F3($$)2.5 E F0 2.5(,a)C(nd the v)-2.5 E(alue of)-.25 E |
| /F4 9/Times-Bold@0 SF(PPID)2.5 E F0 .427 |
| (When a simple command other than a b)108 357.6 R .426 |
| (uiltin or shell function is to be e)-.2 F -.15(xe)-.15 G .426 |
| (cuted, it is in).15 F -.2(vo)-.4 G -.1(ke).2 G 2.926(di).1 G 2.926(nas) |
| -2.926 G(eparate)-2.926 E -.15(exe)108 369.6 S .133(cution en).15 F .133 |
| (vironment that consists of the follo)-.4 F 2.634(wing. Unless)-.25 F |
| .134(otherwise noted, the v)2.634 F .134(alues are inherited from)-.25 F |
| (the shell.)108 381.6 Q 32.5<8374>108 398.4 S 1.056(he shell')-32.5 F |
| 3.556(so)-.55 G 1.056(pen \214les, plus an)-3.556 F 3.556(ym)-.15 G |
| 1.056 |
| (odi\214cations and additions speci\214ed by redirections to the com-) |
| -3.556 F(mand)144 410.4 Q 32.5<8374>108 427.2 S(he current w)-32.5 E |
| (orking directory)-.1 E 32.5<8374>108 444 S |
| (he \214le creation mode mask)-32.5 E 32.5<8373>108 460.8 S .856(hell v) |
| -32.5 F .857(ariables and functions mark)-.25 F .857(ed for e)-.1 F .857 |
| (xport, along with v)-.15 F .857(ariables e)-.25 F .857 |
| (xported for the command,)-.15 F(passed in the en)144 472.8 Q(vironment) |
| -.4 E 32.5<8374>108 489.6 S .307 |
| (raps caught by the shell are reset to the v)-32.5 F .306 |
| (alues inherited from the shell')-.25 F 2.806(sp)-.55 G .306 |
| (arent, and traps ignored)-2.806 F(by the shell are ignored)144 501.6 Q |
| 2.5(Ac)108 518.4 S(ommand in)-2.5 E -.2(vo)-.4 G -.1(ke).2 G 2.5(di).1 G |
| 2.5(nt)-2.5 G(his separate en)-2.5 E(vironment cannot af)-.4 E |
| (fect the shell')-.25 E 2.5(se)-.55 G -.15(xe)-2.65 G(cution en).15 E |
| (vironment.)-.4 E .577(Command substitution, commands grouped with pare\ |
| ntheses, and asynchronous commands are in)108 535.2 R -.2(vo)-.4 G -.1 |
| (ke).2 G 3.078(di).1 G(n)-3.078 E 2.745(as)108 547.2 S .245(ubshell en) |
| -2.745 F .245(vironment that is a duplicate of the shell en)-.4 F .244 |
| (vironment, e)-.4 F .244(xcept that traps caught by the shell are)-.15 F |
| .358(reset to the v)108 559.2 R .358 |
| (alues that the shell inherited from its parent at in)-.25 F -.2(vo)-.4 |
| G 2.858(cation. Builtin).2 F .359(commands that are in)2.859 F -.2(vo) |
| -.4 G -.1(ke).2 G(d).1 E .857(as part of a pipeline are also e)108 571.2 |
| R -.15(xe)-.15 G .856(cuted in a subshell en).15 F 3.356 |
| (vironment. Changes)-.4 F .856(made to the subshell en)3.356 F(viron-) |
| -.4 E(ment cannot af)108 583.2 Q(fect the shell')-.25 E 2.5(se)-.55 G |
| -.15(xe)-2.65 G(cution en).15 E(vironment.)-.4 E 1.376(Subshells spa)108 |
| 600 R 1.376(wned to e)-.15 F -.15(xe)-.15 G 1.377 |
| (cute command substitutions inherit the v).15 F 1.377(alue of the)-.25 F |
| F3<ad65>3.877 E F0 1.377(option from the parent)3.877 F 2.5(shell. When) |
| 108 612 R(not in posix mode, Bash clears the)2.5 E F3<ad65>2.5 E F0 |
| (option in such subshells.)2.5 E .405(If a command is follo)108 628.8 R |
| .405(wed by a)-.25 F F3(&)2.905 E F0 .404(and job control is not acti) |
| 2.905 F -.15(ve)-.25 G 2.904(,t).15 G .404(he def)-2.904 F .404 |
| (ault standard input for the command)-.1 F .197(is the empty \214le)108 |
| 640.8 R F2(/de)2.697 E(v/null)-.15 E F0 5.197(.O)C .197 |
| (therwise, the in)-5.197 F -.2(vo)-.4 G -.1(ke).2 G 2.697(dc).1 G .198 |
| (ommand inherits the \214le descriptors of the calling shell)-2.697 F |
| (as modi\214ed by redirections.)108 652.8 Q F1(ENVIR)72 669.6 Q(ONMENT) |
| -.329 E F0 2.354(When a program is in)108 681.6 R -.2(vo)-.4 G -.1(ke).2 |
| G 4.853(di).1 G 4.853(ti)-4.853 G 4.853(sg)-4.853 G -2.15 -.25(iv e) |
| -4.853 H 4.853(na).25 G 4.853(na)-4.853 G 2.353 |
| (rray of strings called the)-4.853 F F2(en)4.853 E(vir)-.4 E(onment)-.45 |
| E F0 7.353(.T).68 G 2.353(his is a list of)-7.353 F F2(name)108 693.6 Q |
| F0<ad>A F2(value)A F0(pairs, of the form)2.5 E F2(name)2.5 E F0(=)A F2 |
| (value)A F0(.).18 E 1.485(The shell pro)108 710.4 R 1.485(vides se)-.15 |
| F -.15(ve)-.25 G 1.485(ral w).15 F 1.485(ays to manipulate the en)-.1 F |
| 3.985(vironment. On)-.4 F(in)3.985 E -.2(vo)-.4 G 1.486 |
| (cation, the shell scans its o).2 F(wn)-.25 E(en)108 722.4 Q 1.431(viro\ |
| nment and creates a parameter for each name found, automatically markin\ |
| g it for)-.4 F F2 -.2(ex)3.93 G(port).2 E F0 1.43(to child)4.61 F |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(30)185.955 E 0 Cg EP |
| %%Page: 31 31 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 4.177(processes. Ex)108 84 R 1.677 |
| (ecuted commands inherit the en)-.15 F 4.177(vironment. The)-.4 F/F1 10 |
| /Times-Bold@0 SF(export)4.178 E F0(and)4.178 E F1(declar)4.178 E 4.178 |
| <65ad>-.18 G(x)-4.178 E F0 1.678(commands allo)4.178 F(w)-.25 E .647 |
| (parameters and functions to be added to and deleted from the en)108 96 |
| R 3.147(vironment. If)-.4 F .646(the v)3.146 F .646 |
| (alue of a parameter in)-.25 F .513(the en)108 108 R .513 |
| (vironment is modi\214ed, the ne)-.4 F 3.013(wv)-.25 G .513 |
| (alue becomes part of the en)-3.263 F .513 |
| (vironment, replacing the old.)-.4 F .514(The en)5.514 F(vi-)-.4 E .523 |
| (ronment inherited by an)108 120 R 3.022(ye)-.15 G -.15(xe)-3.172 G .522 |
| (cuted command consists of the shell').15 F 3.022(si)-.55 G .522 |
| (nitial en)-3.022 F .522(vironment, whose v)-.4 F .522(alues may)-.25 F |
| .578(be modi\214ed in the shell, less an)108 132 R 3.078(yp)-.15 G .578 |
| (airs remo)-3.078 F -.15(ve)-.15 G 3.078(db).15 G 3.078(yt)-3.078 G(he) |
| -3.078 E F1(unset)3.078 E F0 .579(command, plus an)3.078 F 3.079(ya)-.15 |
| G .579(dditions via the)-3.079 F F1(export)3.079 E F0(and)108 144 Q F1 |
| (declar)2.5 E 2.5<65ad>-.18 G(x)-2.5 E F0(commands.)2.5 E .563(The en) |
| 108 160.8 R .563(vironment for an)-.4 F(y)-.15 E/F2 10/Times-Italic@0 SF |
| .563(simple command)3.403 F F0 .562 |
| (or function may be augmented temporarily by pre\214xing it with)3.833 F |
| .202(parameter assignments, as described abo)108 172.8 R .502 -.15(ve i) |
| -.15 H(n).15 E/F3 9/Times-Bold@0 SF -.666(PA)2.702 G(RAMETERS).666 E/F4 |
| 9/Times-Roman@0 SF(.)A F0 .202(These assignment statements af)4.702 F |
| .203(fect only the)-.25 F(en)108 184.8 Q |
| (vironment seen by that command.)-.4 E .81(If the)108 201.6 R F1<ad6b> |
| 3.31 E F0 .81(option is set \(see the)3.31 F F1(set)3.31 E F0 -.2(bu) |
| 3.31 G .81(iltin command belo).2 F .81(w\), then)-.25 F F2(all)3.64 E F0 |
| .81(parameter assignments are placed in)3.82 F(the en)108 213.6 Q |
| (vironment for a command, not just those that precede the command name.) |
| -.4 E(When)108 230.4 Q F1(bash)3.396 E F0(in)3.396 E -.2(vo)-.4 G -.1 |
| (ke).2 G 3.396(sa).1 G 3.397(ne)-3.396 G .897(xternal command, the v) |
| -3.547 F(ariable)-.25 E F1(_)3.397 E F0 .897 |
| (is set to the full \214le name of the command and)3.397 F |
| (passed to that command in its en)108 242.4 Q(vironment.)-.4 E/F5 10.95 |
| /Times-Bold@0 SF(EXIT ST)72 259.2 Q -1.04(AT)-.986 G(US)1.04 E F0 .151 |
| (The e)108 271.2 R .151(xit status of an e)-.15 F -.15(xe)-.15 G .151 |
| (cuted command is the v).15 F .15(alue returned by the)-.25 F F2 |
| (waitpid)2.65 E F0 .15(system call or equi)2.65 F -.25(va)-.25 G .15 |
| (lent func-).25 F 2.847(tion. Exit)108 283.2 R .347(statuses f)2.847 F |
| .347(all between 0 and 255, though, as e)-.1 F .347(xplained belo)-.15 F |
| 1.647 -.65(w, t)-.25 H .347(he shell may use v).65 F .348(alues abo)-.25 |
| F .648 -.15(ve 1)-.15 H(25).15 E(specially)108 295.2 Q 5.674(.E)-.65 G |
| .674(xit statuses from shell b)-5.674 F .673 |
| (uiltins and compound commands are also limited to this range. Under)-.2 |
| F(certain circumstances, the shell will use special v)108 307.2 Q |
| (alues to indicate speci\214c f)-.25 E(ailure modes.)-.1 E -.15(Fo)108 |
| 324 S 3.372(rt).15 G .872(he shell')-3.372 F 3.372(sp)-.55 G .873 |
| (urposes, a command which e)-3.372 F .873(xits with a zero e)-.15 F .873 |
| (xit status has succeeded.)-.15 F .873(An e)5.873 F .873(xit status of) |
| -.15 F .049(zero indicates success.)108 336 R 2.549(An)5.049 G .049 |
| (on-zero e)-2.549 F .049(xit status indicates f)-.15 F 2.549 |
| (ailure. When)-.1 F 2.549(ac)2.549 G .048(ommand terminates on a f) |
| -2.549 F .048(atal sig-)-.1 F(nal)108 348 Q F2(N)2.5 E F0(,)A F1(bash) |
| 2.5 E F0(uses the v)2.5 E(alue of 128+)-.25 E F2(N)A F0(as the e)2.5 E |
| (xit status.)-.15 E .404 |
| (If a command is not found, the child process created to e)108 364.8 R |
| -.15(xe)-.15 G .404(cute it returns a status of 127.).15 F .405 |
| (If a command is)5.405 F(found b)108 376.8 Q(ut is not e)-.2 E -.15(xe) |
| -.15 G(cutable, the return status is 126.).15 E(If a command f)108 393.6 |
| Q(ails because of an error during e)-.1 E |
| (xpansion or redirection, the e)-.15 E(xit status is greater than zero.) |
| -.15 E .081(Shell b)108 410.4 R .081 |
| (uiltin commands return a status of 0 \()-.2 F F2(true)A F0 2.581(\)i)C |
| 2.581(fs)-2.581 G .08(uccessful, and non-zero \()-2.581 F F2(false)A F0 |
| 2.58(\)i)C 2.58(fa)-2.58 G 2.58(ne)-2.58 G .08(rror occurs while)-2.58 F |
| (the)108 422.4 Q 2.5(ye)-.15 G -.15(xe)-2.65 G 2.5(cute. All).15 F -.2 |
| (bu)2.5 G(iltins return an e).2 E |
| (xit status of 2 to indicate incorrect usage.)-.15 E F1(Bash)108 439.2 Q |
| F0 .201(itself returns the e)2.701 F .202 |
| (xit status of the last command e)-.15 F -.15(xe)-.15 G .202 |
| (cuted, unless a syntax error occurs, in which case).15 F(it e)108 451.2 |
| Q(xits with a non-zero v)-.15 E 2.5(alue. See)-.25 F(also the)2.5 E F1 |
| (exit)2.5 E F0 -.2(bu)2.5 G(iltin command belo).2 E -.65(w.)-.25 G F5 |
| (SIGN)72 468 Q(ALS)-.219 E F0(When)108 480 Q F1(bash)3.183 E F0 .683 |
| (is interacti)3.183 F -.15(ve)-.25 G 3.183(,i).15 G 3.183(nt)-3.183 G |
| .683(he absence of an)-3.183 F 3.183(yt)-.15 G .683(raps, it ignores) |
| -3.183 F F3(SIGTERM)3.183 E F0 .682(\(so that)2.933 F F1 .682(kill 0) |
| 3.182 F F0 .682(does not kill an)3.182 F(interacti)108 492 Q .757 -.15 |
| (ve s)-.25 H .457(hell\), and).15 F F3(SIGINT)2.957 E F0 .458 |
| (is caught and handled \(so that the)2.707 F F1(wait)2.958 E F0 -.2(bu) |
| 2.958 G .458(iltin is interruptible\).).2 F .458(In all cases,)5.458 F |
| F1(bash)108 504 Q F0(ignores)2.5 E F3(SIGQ)2.5 E(UIT)-.09 E F4(.)A F0 |
| (If job control is in ef)4.5 E(fect,)-.25 E F1(bash)2.5 E F0(ignores)2.5 |
| E F3(SIGTTIN)2.5 E F4(,)A F3(SIGTT)2.25 E(OU)-.162 E F4(,)A F0(and)2.25 |
| E F3(SIGTSTP)2.5 E F4(.)A F0(Non-b)108 520.8 Q 1.065 |
| (uiltin commands run by)-.2 F F1(bash)3.565 E F0(ha)3.565 E 1.365 -.15 |
| (ve s)-.2 H 1.065(ignal handlers set to the v).15 F 1.064 |
| (alues inherited by the shell from its)-.25 F 3.247(parent. When)108 |
| 532.8 R .747(job control is not in ef)3.247 F .747 |
| (fect, asynchronous commands ignore)-.25 F F3(SIGINT)3.248 E F0(and) |
| 2.998 E F3(SIGQ)3.248 E(UIT)-.09 E F0 .748(in addi-)2.998 F .653 |
| (tion to these inherited handlers.)108 544.8 R .653 |
| (Commands run as a result of command substitution ignore the k)5.653 F |
| -.15(ey)-.1 G(board-).15 E(generated job control signals)108 556.8 Q F3 |
| (SIGTTIN)2.5 E F4(,)A F3(SIGTT)2.25 E(OU)-.162 E F4(,)A F0(and)2.25 E F3 |
| (SIGTSTP)2.5 E F4(.)A F0 2.045(The shell e)108 573.6 R 2.045 |
| (xits by def)-.15 F 2.045(ault upon receipt of a)-.1 F F3(SIGHUP)4.545 E |
| F4(.)A F0 2.045(Before e)6.545 F 2.045(xiting, an interacti)-.15 F 2.346 |
| -.15(ve s)-.25 H 2.046(hell resends the).15 F F3(SIGHUP)108 585.6 Q F0 |
| 1.005(to all jobs, running or stopped.)3.255 F 1.004 |
| (Stopped jobs are sent)6.005 F F3(SIGCONT)3.504 E F0 1.004 |
| (to ensure that the)3.254 F 3.504(yr)-.15 G(ecei)-3.504 E 1.304 -.15 |
| (ve t)-.25 H(he).15 E F3(SIGHUP)108 597.6 Q F4(.)A F0 2.529 -.8(To p) |
| 5.429 H(re).8 E -.15(ve)-.25 G .93(nt the shell from sending the signal\ |
| to a particular job, it should be remo).15 F -.15(ve)-.15 G 3.43(df).15 |
| G .93(rom the)-3.43 F 1.357(jobs table with the)108 609.6 R F1(diso) |
| 3.857 E(wn)-.1 E F0 -.2(bu)3.857 G 1.357(iltin \(see).2 F F3 1.356 |
| (SHELL B)3.856 F(UIL)-.09 E 1.356(TIN COMMANDS)-.828 F F0(belo)3.606 E |
| 1.356(w\) or mark)-.25 F 1.356(ed to not recei)-.1 F -.15(ve)-.25 G F3 |
| (SIGHUP)108 621.6 Q F0(using)2.25 E F1(diso)2.5 E(wn \255h)-.1 E F0(.)A |
| .166(If the)108 638.4 R F1(huponexit)2.666 E F0 .166 |
| (shell option has been set with)2.666 F F1(shopt)2.666 E F0(,)A F1(bash) |
| 2.666 E F0 .166(sends a)2.666 F F3(SIGHUP)2.666 E F0 .166 |
| (to all jobs when an interacti)2.416 F -.15(ve)-.25 G(login shell e)108 |
| 650.4 Q(xits.)-.15 E(If)108 667.2 Q F1(bash)3.047 E F0 .547(is w)3.047 F |
| .546(aiting for a command to complete and recei)-.1 F -.15(ve)-.25 G |
| 3.046(sas).15 G .546(ignal for which a trap has been set, the trap) |
| -3.046 F .662(will not be e)108 679.2 R -.15(xe)-.15 G .662 |
| (cuted until the command completes.).15 F(When)5.663 E F1(bash)3.163 E |
| F0 .663(is w)3.163 F .663(aiting for an asynchronous command)-.1 F .99 |
| (via the)108 691.2 R F1(wait)3.49 E F0 -.2(bu)3.49 G .99(iltin, the rec\ |
| eption of a signal for which a trap has been set will cause the).2 F F1 |
| (wait)3.49 E F0 -.2(bu)3.49 G .99(iltin to).2 F |
| (return immediately with an e)108 703.2 Q |
| (xit status greater than 128, immediately after which the trap is e)-.15 |
| E -.15(xe)-.15 G(cuted.).15 E(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(31)185.955 E 0 Cg EP |
| %%Page: 32 32 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10.95/Times-Bold@0 SF(JOB CONTR)72 84 Q(OL)-.329 E/F2 10 |
| /Times-Italic@0 SF -.25(Jo)108 96 S 4.567(bc).25 G(ontr)-4.567 E(ol)-.45 |
| E F0 2.067(refers to the ability to selecti)5.077 F -.15(ve)-.25 G 2.067 |
| (ly stop \().15 F F2(suspend)A F0 4.567(\)t)C 2.068(he e)-4.567 F -.15 |
| (xe)-.15 G 2.068(cution of processes and continue).15 F(\()108 108 Q F2 |
| -.37(re)C(sume).37 E F0 3.202(\)t)C .702(heir e)-3.202 F -.15(xe)-.15 G |
| .702(cution at a later point.).15 F 3.202(Au)5.702 G .702 |
| (ser typically emplo)-3.202 F .702(ys this f)-.1 F .702 |
| (acility via an interacti)-.1 F 1.001 -.15(ve i)-.25 H(nterf).15 E(ace) |
| -.1 E(supplied jointly by the operating system k)108 120 Q(ernel')-.1 E |
| 2.5(st)-.55 G(erminal dri)-2.5 E -.15(ve)-.25 G 2.5(ra).15 G(nd)-2.5 E |
| /F3 10/Times-Bold@0 SF(bash)2.5 E F0(.)A .784(The shell associates a)108 |
| 136.8 R F2(job)5.024 E F0 .784(with each pipeline.)3.514 F .784(It k) |
| 5.784 F .785(eeps a table of currently e)-.1 F -.15(xe)-.15 G .785 |
| (cuting jobs, which may be).15 F .341(listed with the)108 148.8 R F3 |
| (jobs)2.841 E F0 2.841(command. When)2.841 F F3(bash)2.841 E F0 .341 |
| (starts a job asynchronously \(in the)2.841 F F2(bac)2.84 E(kgr)-.2 E |
| (ound)-.45 E F0 .34(\), it prints a line).77 F(that looks lik)108 160.8 |
| Q(e:)-.1 E([1] 25647)144 177.6 Q .241(indicating that this job is job n\ |
| umber 1 and that the process ID of the last process in the pipeline ass\ |
| ociated)108 194.4 R .733(with this job is 25647.)108 206.4 R .732 |
| (All of the processes in a single pipeline are members of the same job) |
| 5.733 F(.)-.4 E F3(Bash)5.732 E F0(uses)3.232 E(the)108 218.4 Q F2(job) |
| 4.24 E F0(abstraction as the basis for job control.)2.73 E 3.062 -.8 |
| (To f)108 235.2 T 1.462(acilitate the implementation of the user interf) |
| .7 F 1.463(ace to job control, the operating system maintains the)-.1 F |
| .871(notion of a)108 247.2 R F2(curr)3.371 E .871(ent terminal pr)-.37 F |
| .871(ocess gr)-.45 F .871(oup ID)-.45 F F0 5.871(.M)C .87 |
| (embers of this process group \(processes whose process)-5.871 F .023 |
| (group ID is equal to the current terminal process group ID\) recei)108 |
| 259.2 R .323 -.15(ve k)-.25 H -.15(ey).05 G .023 |
| (board-generated signals such as).15 F/F4 9/Times-Bold@0 SF(SIG-)2.523 E |
| (INT)108 271.2 Q/F5 9/Times-Roman@0 SF(.)A F0 1.347 |
| (These processes are said to be in the)5.847 F F2(for)3.846 E -.4(eg) |
| -.37 G -.45(ro).4 G(und).45 E F0(.).77 E F2(Bac)6.926 E(kgr)-.2 E(ound) |
| -.45 E F0 1.346(processes are those whose process)4.616 F .145 |
| (group ID dif)108 283.2 R .145(fers from the terminal')-.25 F .146 |
| (s; such processes are immune to k)-.55 F -.15(ey)-.1 G .146 |
| (board-generated signals.).15 F .146(Only fore-)5.146 F .16 |
| (ground processes are allo)108 295.2 R .16(wed to read from or)-.25 F |
| 2.66(,i)-.4 G 2.66(ft)-2.66 G .16(he user so speci\214es with)-2.66 F/F6 |
| 10/Courier@0 SF .16(stty tostop)2.66 F F0 2.66(,w)C .16(rite to the ter) |
| -2.66 F(-)-.2 E 3.051(minal. Background)108 307.2 R .551 |
| (processes which attempt to read from \(write to when)3.051 F F6 .551 |
| (stty tostop)3.051 F F0 .552(is in ef)3.052 F .552(fect\) the)-.25 F |
| .718(terminal are sent a)108 319.2 R F4 .718(SIGTTIN \(SIGTT)3.218 F |
| (OU\))-.162 E F0 .718(signal by the k)2.968 F(ernel')-.1 E 3.217(st)-.55 |
| G .717(erminal dri)-3.217 F -.15(ve)-.25 G 1.517 -.4(r, w).15 H .717 |
| (hich, unless caught, sus-).4 F(pends the process.)108 331.2 Q 1.087 |
| (If the operating system on which)108 348 R F3(bash)3.587 E F0 1.088 |
| (is running supports job control,)3.588 F F3(bash)3.588 E F0 1.088 |
| (contains f)3.588 F 1.088(acilities to use it.)-.1 F -.8(Ty)108 360 S |
| .302(ping the).8 F F2(suspend)3.142 E F0 .302(character \(typically) |
| 3.572 F F3(^Z)2.801 E F0 2.801(,C)C .301 |
| (ontrol-Z\) while a process is running causes that process to be)-2.801 |
| F 2.142(stopped and returns control to)108 372 R F3(bash)4.642 E F0 |
| 7.142(.T)C 2.142(yping the)-7.942 F F2 2.142(delayed suspend)4.992 F F0 |
| 2.143(character \(typically)5.413 F F3(^Y)4.643 E F0 4.643(,C)C |
| (ontrol-Y\))-4.643 E .021(causes the process to be stopped when it atte\ |
| mpts to read input from the terminal, and control to be returned)108 384 |
| R(to)108 396 Q F3(bash)3.392 E F0 5.892(.T)C .892 |
| (he user may then manipulate the state of this job, using the)-5.892 F |
| F3(bg)3.392 E F0 .892(command to continue it in the)3.392 F .895 |
| (background, the)108 408 R F3(fg)3.395 E F0 .895 |
| (command to continue it in the fore)3.395 F .895(ground, or the)-.15 F |
| F3(kill)3.395 E F0 .894(command to kill it.)3.395 F(A)5.894 E F3(^Z) |
| 3.394 E F0(tak)3.394 E(es)-.1 E(ef)108 420 Q .948(fect immediately)-.25 |
| F 3.448(,a)-.65 G .948(nd has the additional side ef)-3.448 F .948 |
| (fect of causing pending output and typeahead to be dis-)-.25 F(carded.) |
| 108 432 Q .777(There are a number of w)108 448.8 R .777 |
| (ays to refer to a job in the shell.)-.1 F .777(The character)5.777 F F3 |
| (%)3.277 E F0 .777(introduces a job speci\214cation)3.277 F(\()108 460.8 |
| Q F2(jobspec)A F0 3.457(\). Job)B(number)3.457 E F2(n)3.817 E F0 .957 |
| (may be referred to as)3.697 F F3(%n)3.457 E F0 5.957(.A)C .957 |
| (job may also be referred to using a pre\214x of the)-2.5 F .59(name us\ |
| ed to start it, or using a substring that appears in its command line.) |
| 108 472.8 R -.15(Fo)5.59 G 3.09(re).15 G(xample,)-3.24 E F3(%ce)3.09 E |
| F0 .59(refers to a)3.09 F(stopped)108 484.8 Q F3(ce)3.463 E F0(job)3.463 |
| E 5.963(.I)-.4 G 3.463(fap)-5.963 G .963 |
| (re\214x matches more than one job,)-3.463 F F3(bash)3.463 E F0 .963 |
| (reports an error)3.463 F 5.963(.U)-.55 G(sing)-5.963 E F3(%?ce)3.463 E |
| F0 3.464(,o)C 3.464(nt)-3.464 G .964(he other)-3.464 F .087 |
| (hand, refers to an)108 496.8 R 2.587(yj)-.15 G .087 |
| (ob containing the string)-2.587 F F3(ce)2.587 E F0 .087 |
| (in its command line.)2.587 F .087 |
| (If the substring matches more than one)5.087 F(job,)108 508.8 Q F3 |
| (bash)2.518 E F0 .018(reports an error)2.518 F 5.018(.T)-.55 G .018 |
| (he symbols)-5.018 F F3(%%)2.518 E F0(and)2.518 E F3(%+)2.518 E F0 .018 |
| (refer to the shell')2.518 F 2.518(sn)-.55 G .018(otion of the)-2.518 F |
| F2(curr)2.518 E .018(ent job)-.37 F F0 2.518(,w).23 G .018(hich is) |
| -2.518 F .495(the last job stopped while it w)108 520.8 R .495 |
| (as in the fore)-.1 F .495(ground or started in the background.)-.15 F |
| (The)5.494 E F2(pr)4.244 E -.15(ev)-.37 G .494(ious job).15 F F0 .494 |
| (may be)3.224 F .787(referenced using)108 532.8 R F3<25ad>3.287 E F0 |
| 5.787(.I)C 3.287(ft)-5.787 G .787(here is only a single job,)-3.287 F F3 |
| (%+)3.287 E F0(and)3.287 E F3<25ad>3.287 E F0 .788 |
| (can both be used to refer to that job)3.287 F 5.788(.I)-.4 G(n)-5.788 E |
| .257(output pertaining to jobs \(e.g., the output of the)108 544.8 R F3 |
| (jobs)2.756 E F0 .256(command\), the current job is al)2.756 F -.1(wa) |
| -.1 G .256(ys \215agged with a).1 F F3(+)2.756 E F0(,)A .41(and the pre) |
| 108 556.8 R .41(vious job with a)-.25 F F3<ad>2.91 E F0 5.41(.A)C .411 |
| (single % \(with no accompan)-2.5 F .411 |
| (ying job speci\214cation\) also refers to the cur)-.15 F(-)-.2 E |
| (rent job)108 568.8 Q(.)-.4 E .444 |
| (Simply naming a job can be used to bring it into the fore)108 585.6 R |
| (ground:)-.15 E F3(%1)2.943 E F0 .443(is a synon)2.943 F .443(ym for) |
| -.15 F F3 -.63(``)2.943 G .443(fg %1').63 F(')-.63 E F0 2.943(,b)C |
| (ringing)-2.943 E 1.472(job 1 from the background into the fore)108 |
| 597.6 R 3.972(ground. Similarly)-.15 F(,)-.65 E F3 -.63(``)3.973 G 1.473 |
| (%1 &').63 F(')-.63 E F0 1.473(resumes job 1 in the background,)3.973 F |
| (equi)108 609.6 Q -.25(va)-.25 G(lent to).25 E F3 -.63(``)2.5 G(bg %1') |
| .63 E(')-.63 E F0(.)A .131(The shell learns immediately whene)108 626.4 |
| R -.15(ve)-.25 G 2.631(raj).15 G .131(ob changes state.)-2.631 F |
| (Normally)5.131 E(,)-.65 E F3(bash)2.631 E F0 -.1(wa)2.63 G .13 |
| (its until it is about to print a).1 F .157 |
| (prompt before reporting changes in a job')108 638.4 R 2.657(ss)-.55 G |
| .157(tatus so as to not interrupt an)-2.657 F 2.658(yo)-.15 G .158 |
| (ther output.)-2.658 F .158(If the)5.158 F F3<ad62>2.658 E F0 .158 |
| (option to)2.658 F(the)108 650.4 Q F3(set)3.952 E F0 -.2(bu)3.952 G |
| 1.452(iltin command is enabled,).2 F F3(bash)3.952 E F0 1.451 |
| (reports such changes immediately)3.952 F 6.451(.A)-.65 G 1.751 -.15 |
| (ny t)-6.451 H 1.451(rap on).15 F F4(SIGCHLD)3.951 E F0(is)3.701 E -.15 |
| (exe)108 662.4 S(cuted for each child that e).15 E(xits.)-.15 E .032 |
| (If an attempt to e)108 679.2 R(xit)-.15 E F3(bash)2.532 E F0 .032 |
| (is made while jobs are stopped \(or)2.532 F 2.533(,i)-.4 G 2.533(ft) |
| -2.533 G(he)-2.533 E F3(checkjobs)2.533 E F0 .033 |
| (shell option has been enabled)2.533 F 2.02(using the)108 691.2 R F3 |
| (shopt)4.52 E F0 -.2(bu)4.52 G 2.02 |
| (iltin, running\), the shell prints a w).2 F 2.019 |
| (arning message, and, if the)-.1 F F3(checkjobs)4.519 E F0 2.019 |
| (option is)4.519 F .458(enabled, lists the jobs and their statuses.)108 |
| 703.2 R(The)5.458 E F3(jobs)2.958 E F0 .459 |
| (command may then be used to inspect their status.)2.958 F .459(If a) |
| 5.459 F .604(second attempt to e)108 715.2 R .604 |
| (xit is made without an interv)-.15 F .604 |
| (ening command, the shell does not print another w)-.15 F(arning,)-.1 E |
| (and an)108 727.2 Q 2.5(ys)-.15 G(topped jobs are terminated.)-2.5 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(32)185.955 E 0 Cg EP |
| %%Page: 33 33 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10.95/Times-Bold@0 SF(PR)72 84 Q(OMPTING)-.329 E F0 .644 |
| (When e)108 96 R -.15(xe)-.15 G .644(cuting interacti).15 F -.15(ve)-.25 |
| G(ly).15 E(,)-.65 E/F2 10/Times-Bold@0 SF(bash)3.144 E F0 .645 |
| (displays the primary prompt)3.145 F/F3 9/Times-Bold@0 SF(PS1)3.145 E F0 |
| .645(when it is ready to read a command,)2.895 F 1.826 |
| (and the secondary prompt)108 108 R F3(PS2)4.326 E F0 1.825 |
| (when it needs more input to complete a command.)4.076 F F2(Bash)6.825 E |
| F0(allo)4.325 E 1.825(ws these)-.25 F 1.499(prompt strings to be custom\ |
| ized by inserting a number of backslash-escaped special characters that\ |
| are)108 120 R(decoded as follo)108 132 Q(ws:)-.25 E F2(\\a)144 144 Q F0 |
| (an ASCII bell character \(07\))28.22 E F2(\\d)144 156 Q F0 |
| (the date in "W)27.66 E(eekday Month Date" format \(e.g., "T)-.8 E |
| (ue May 26"\))-.45 E F2(\\D{)144 168 Q/F4 10/Times-Italic@0 SF(format)A |
| F2(})A F0(the)180 180 Q F4(format)3.927 E F0 1.427(is passed to)3.927 F |
| F4(strftime)3.927 E F0 1.427 |
| (\(3\) and the result is inserted into the prompt string; an)B(empty)180 |
| 192 Q F4(format)2.5 E F0 |
| (results in a locale-speci\214c time representation.)2.5 E |
| (The braces are required)5 E F2(\\e)144 204 Q F0 |
| (an ASCII escape character \(033\))28.78 E F2(\\h)144 216 Q F0 |
| (the hostname up to the \214rst `.)27.66 E(')-.7 E F2(\\H)144 228 Q F0 |
| (the hostname)25.44 E F2(\\j)144 240 Q F0 |
| (the number of jobs currently managed by the shell)29.89 E F2(\\l)144 |
| 252 Q F0(the basename of the shell')30.44 E 2.5(st)-.55 G(erminal de) |
| -2.5 E(vice name)-.25 E F2(\\n)144 264 Q F0(ne)27.66 E(wline)-.25 E F2 |
| (\\r)144 276 Q F0(carriage return)28.78 E F2(\\s)144 288 Q F0 |
| (the name of the shell, the basename of)29.33 E F2($0)2.5 E F0 |
| (\(the portion follo)2.5 E(wing the \214nal slash\))-.25 E F2(\\t)144 |
| 300 Q F0(the current time in 24-hour HH:MM:SS format)29.89 E F2(\\T)144 |
| 312 Q F0(the current time in 12-hour HH:MM:SS format)26.55 E F2(\\@)144 |
| 324 Q F0(the current time in 12-hour am/pm format)23.92 E F2(\\A)144 336 |
| Q F0(the current time in 24-hour HH:MM format)26 E F2(\\u)144 348 Q F0 |
| (the username of the current user)27.66 E F2(\\v)144 360 Q F0(the v) |
| 28.22 E(ersion of)-.15 E F2(bash)2.5 E F0(\(e.g., 2.00\))2.5 E F2(\\V) |
| 144 372 Q F0(the release of)26 E F2(bash)2.5 E F0 2.5(,v)C |
| (ersion + patch le)-2.65 E -.15(ve)-.25 G 2.5(l\().15 G(e.g., 2.00.0\)) |
| -2.5 E F2(\\w)144 384 Q F0 .115(the current w)26 F .115 |
| (orking directory)-.1 F 2.615(,w)-.65 G(ith)-2.615 E F3($HOME)2.615 E F0 |
| (abbre)2.365 E .116(viated with a tilde \(uses the v)-.25 F .116 |
| (alue of the)-.25 F F3(PR)180 396 Q(OMPT_DIR)-.27 E(TRIM)-.36 E F0 -.25 |
| (va)2.25 G(riable\)).25 E F2(\\W)144 408 Q F0 |
| (the basename of the current w)23.22 E(orking directory)-.1 E 2.5(,w) |
| -.65 G(ith)-2.5 E F3($HOME)2.5 E F0(abbre)2.25 E(viated with a tilde) |
| -.25 E F2(\\!)144 420 Q F0(the history number of this command)29.89 E F2 |
| (\\#)144 432 Q F0(the command number of this command)28.22 E F2(\\$)144 |
| 444 Q F0(if the ef)28.22 E(fecti)-.25 E .3 -.15(ve U)-.25 H(ID is 0, a) |
| .15 E F2(#)2.5 E F0 2.5(,o)C(therwise a)-2.5 E F2($)2.5 E(\\)144 456 Q |
| F4(nnn)A F0(the character corresponding to the octal number)18.22 E F4 |
| (nnn)2.5 E F2(\\\\)144 468 Q F0 2.5(ab)30.44 G(ackslash)-2.5 E F2(\\[) |
| 144 480 Q F0(be)29.89 E 1.257(gin a sequence of non-printing characters\ |
| , which could be used to embed a terminal)-.15 F |
| (control sequence into the prompt)180 492 Q F2(\\])144 504 Q F0 |
| (end a sequence of non-printing characters)29.89 E .119 |
| (The command number and the history number are usually dif)108 520.8 R |
| .12(ferent: the history number of a command is its)-.25 F 1.585(positio\ |
| n in the history list, which may include commands restored from the his\ |
| tory \214le \(see)108 532.8 R F3(HIST)4.084 E(OR)-.162 E(Y)-.315 E F0 |
| (belo)108 544.8 Q .541(w\), while the command number is the position in\ |
| the sequence of commands e)-.25 F -.15(xe)-.15 G .541 |
| (cuted during the cur).15 F(-)-.2 E .546(rent shell session.)108 556.8 R |
| .546(After the string is decoded, it is e)5.546 F .546 |
| (xpanded via parameter e)-.15 F .546(xpansion, command substitu-)-.15 F |
| .351(tion, arithmetic e)108 568.8 R .352(xpansion, and quote remo)-.15 F |
| -.25(va)-.15 G .352(l, subject to the v).25 F .352(alue of the)-.25 F F2 |
| (pr)2.852 E(omptv)-.18 E(ars)-.1 E F0 .352(shell option \(see the)2.852 |
| F(description of the)108 580.8 Q F2(shopt)2.5 E F0(command under)2.5 E |
| F3(SHELL B)2.5 E(UIL)-.09 E(TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).) |
| -.25 E F1(READLINE)72 597.6 Q F0 .151 |
| (This is the library that handles reading input when using an interacti) |
| 108 609.6 R .45 -.15(ve s)-.25 H .15(hell, unless the).15 F F2 |
| (\255\255noediting)2.65 E F0(option)2.65 E 1.208(is gi)108 621.6 R -.15 |
| (ve)-.25 G 3.708(na).15 G 3.708(ts)-3.708 G 1.208(hell in)-3.708 F -.2 |
| (vo)-.4 G 3.708(cation. Line).2 F 1.208 |
| (editing is also used when using the)3.708 F F2<ad65>3.709 E F0 1.209 |
| (option to the)3.709 F F2 -.18(re)3.709 G(ad).18 E F0 -.2(bu)3.709 G |
| 3.709(iltin. By).2 F(def)108 633.6 Q .95 |
| (ault, the line editing commands are similar to those of emacs.)-.1 F |
| 3.449(Av)5.949 G .949(i-style line editing interf)-3.449 F .949 |
| (ace is also)-.1 F -.2(av)108 645.6 S 3.35(ailable. Line)-.05 F .85 |
| (editing can be enabled at an)3.35 F 3.35(yt)-.15 G .85(ime using the) |
| -3.35 F F2 .85(\255o emacs)3.35 F F0(or)3.35 E F2 .85(\255o vi)3.35 F F0 |
| .85(options to the)3.35 F F2(set)3.35 E F0 -.2(bu)3.35 G(iltin).2 E |
| (\(see)108 657.6 Q F3 .763(SHELL B)3.263 F(UIL)-.09 E .763(TIN COMMANDS) |
| -.828 F F0(belo)3.013 E 3.263(w\). T)-.25 F 3.263(ot)-.8 G .763(urn of) |
| -3.263 F 3.263(fl)-.25 G .763 |
| (ine editing after the shell is running, use the)-3.263 F F2(+o)3.262 E |
| (emacs)108 669.6 Q F0(or)2.5 E F2(+o vi)2.5 E F0(options to the)2.5 E F2 |
| (set)2.5 E F0 -.2(bu)2.5 G(iltin.).2 E F2(Readline Notation)87 686.4 Q |
| F0 .567(In this section, the emacs-style notation is used to denote k) |
| 108 698.4 R -.15(ey)-.1 G(strok).15 E 3.068(es. Control)-.1 F -.1(ke) |
| 3.068 G .568(ys are denoted by C\255)-.05 F F4 -.1(ke)C(y)-.2 E F0(,)A |
| 1.153(e.g., C\255n means Control\255N.)108 710.4 R(Similarly)6.153 E(,) |
| -.65 E F4(meta)4.033 E F0 -.1(ke)3.913 G 1.153(ys are denoted by M\255) |
| -.05 F F4 -.1(ke)C(y)-.2 E F0 3.652(,s)C 3.652(oM)-3.652 G 1.152 |
| (\255x means Meta\255X.)-3.652 F(\(On)6.152 E -.1(ke)108 722.4 S .83 |
| (yboards without a)-.05 F F4(meta)3.71 E F0 -.1(ke)3.59 G 2.13 -.65 |
| (y, M)-.05 H<ad>.65 E F4(x)A F0 .83(means ESC)3.33 F F4(x)3.33 E F0 3.33 |
| (,i)C .831(.e., press the Escape k)-3.33 F 1.131 -.15(ey t)-.1 H .831 |
| (hen the).15 F F4(x)4.101 E F0 -.1(ke)3.861 G 4.631 -.65(y. T)-.05 H |
| .831(his mak).65 F(es)-.1 E(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(33)185.955 E 0 Cg EP |
| %%Page: 34 34 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .6(ESC the)108 84 R/F1 10/Times-Italic@0 SF .6(meta pr)3.1 F |
| (e\214x)-.37 E F0 5.6(.T)C .6(he combination M\255C\255)-5.6 F F1(x)A F0 |
| .599(means ESC\255Control\255)3.099 F F1(x)A F0 3.099(,o)C 3.099(rp) |
| -3.099 G .599(ress the Escape k)-3.099 F .899 -.15(ey t)-.1 H .599 |
| (hen hold).15 F(the Control k)108 96 Q .3 -.15(ey w)-.1 H |
| (hile pressing the).15 E F1(x)3.27 E F0 -.1(ke)3.03 G -.65(y.)-.05 G(\)) |
| .65 E .619(Readline commands may be gi)108 112.8 R -.15(ve)-.25 G 3.119 |
| (nn).15 G(umeric)-3.119 E F1(ar)3.119 E(guments)-.37 E F0 3.119(,w).27 G |
| .619(hich normally act as a repeat count.)-3.119 F(Sometimes,)5.62 E(ho) |
| 108 124.8 Q(we)-.25 E -.15(ve)-.25 G 1.419 -.4(r, i).15 H 3.119(ti).4 G |
| 3.119(st)-3.119 G .619(he sign of the ar)-3.119 F .619 |
| (gument that is signi\214cant.)-.18 F -.15(Pa)5.619 G .619(ssing a ne) |
| .15 F -.05(ga)-.15 G(ti).05 E .919 -.15(ve a)-.25 H -.18(rg).15 G .619 |
| (ument to a command that).18 F 1.018(acts in the forw)108 136.8 R 1.018 |
| (ard direction \(e.g.,)-.1 F/F2 10/Times-Bold@0 SF(kill\255line)3.518 E |
| F0 3.518(\)c)C 1.018(auses that command to act in a backw)-3.518 F 1.019 |
| (ard direction.)-.1 F(Com-)6.019 E(mands whose beha)108 148.8 Q |
| (vior with ar)-.2 E(guments de)-.18 E(viates from this are noted belo) |
| -.25 E -.65(w.)-.25 G .812(When a command is described as)108 165.6 R F1 |
| (killing)3.311 E F0(te)3.311 E .811(xt, the te)-.15 F .811 |
| (xt deleted is sa)-.15 F -.15(ve)-.2 G 3.311(df).15 G .811 |
| (or possible future retrie)-3.311 F -.25(va)-.25 G 3.311(l\().25 G F1 |
| (yank-)-3.311 E(ing)108 177.6 Q F0 2.529(\). The)B .029(killed te)2.529 |
| F .029(xt is sa)-.15 F -.15(ve)-.2 G 2.529(di).15 G 2.529(na)-2.529 G F1 |
| .029(kill ring)B F0 5.029(.C)C(onsecuti)-5.029 E .329 -.15(ve k)-.25 H |
| .029(ills cause the te).15 F .029(xt to be accumulated into one unit,) |
| -.15 F .567(which can be yank)108 189.6 R .567(ed all at once.)-.1 F |
| .567(Commands which do not kill te)5.567 F .567 |
| (xt separate the chunks of te)-.15 F .567(xt on the kill)-.15 F(ring.) |
| 108 201.6 Q F2(Readline Initialization)87 218.4 Q F0 .091(Readline is c\ |
| ustomized by putting commands in an initialization \214le \(the)108 |
| 230.4 R F1(inputr)2.591 E(c)-.37 E F0 2.591(\214le\). The)2.591 F .092 |
| (name of this \214le)2.591 F .197(is tak)108 242.4 R .196(en from the v) |
| -.1 F .196(alue of the)-.25 F/F3 9/Times-Bold@0 SF(INPUTRC)2.696 E F0 |
| -.25(va)2.446 G 2.696(riable. If).25 F .196(that v)2.696 F .196 |
| (ariable is unset, the def)-.25 F .196(ault is)-.1 F F1(~/.inputr)2.696 |
| E(c)-.37 E F0 5.196(.W).31 G .196(hen a)-5.196 F 1.034(program which us\ |
| es the readline library starts up, the initialization \214le is read, a\ |
| nd the k)108 254.4 R 1.335 -.15(ey b)-.1 H 1.035(indings and).15 F -.25 |
| (va)108 266.4 S 1.15(riables are set.).25 F 1.15(There are only a fe) |
| 6.15 F 3.649(wb)-.25 G 1.149(asic constructs allo)-3.649 F 1.149 |
| (wed in the readline initialization \214le.)-.25 F(Blank)6.149 E .736 |
| (lines are ignored.)108 278.4 R .737(Lines be)5.737 F .737 |
| (ginning with a)-.15 F F2(#)3.237 E F0 .737(are comments.)3.237 F .737 |
| (Lines be)5.737 F .737(ginning with a)-.15 F F2($)3.237 E F0 .737 |
| (indicate conditional)3.237 F 2.5(constructs. Other)108 290.4 R |
| (lines denote k)2.5 E .3 -.15(ey b)-.1 H(indings and v).15 E |
| (ariable settings.)-.25 E .987(The def)108 307.2 R .987(ault k)-.1 F |
| -.15(ey)-.1 G .987(-bindings may be changed with an).15 F F1(inputr) |
| 3.497 E(c)-.37 E F0 3.487(\214le. Other)3.797 F .987 |
| (programs that use this library may)3.487 F(add their o)108 319.2 Q |
| (wn commands and bindings.)-.25 E -.15(Fo)108 336 S 2.5(re).15 G |
| (xample, placing)-2.65 E(M\255Control\255u: uni)144 352.8 Q -.15(ve)-.25 |
| G(rsal\255ar).15 E(gument)-.18 E(or)108 364.8 Q(C\255Meta\255u: uni)144 |
| 376.8 Q -.15(ve)-.25 G(rsal\255ar).15 E(gument)-.18 E(into the)108 388.8 |
| Q F1(inputr)2.51 E(c)-.37 E F0 -.1(wo)2.81 G(uld mak).1 E 2.5(eM)-.1 G |
| (\255C\255u e)-2.5 E -.15(xe)-.15 G(cute the readline command).15 E F1 |
| (univer)2.5 E(sal\255ar)-.1 E(gument)-.37 E F0(.).68 E 1.26(The follo) |
| 108 405.6 R 1.261(wing symbolic character names are recognized:)-.25 F |
| F1 -.4(RU)3.761 G(BOUT).4 E F0(,)1.27 E F1(DEL)3.761 E F0(,).53 E F1 |
| (ESC)3.761 E F0(,).72 E F1(LFD)3.761 E F0(,).28 E F1(NEWLINE)3.761 E F0 |
| (,).73 E F1(RET)3.761 E F0(,)1.27 E F1(RETURN)108 417.6 Q F0(,)1.1 E F1 |
| (SPC)2.5 E F0(,).72 E F1(SP)2.5 E -.3(AC)-.9 G(E).3 E F0 2.5(,a).73 G |
| (nd)-2.5 E F1 -.5(TA)2.5 G(B).5 E F0(.).27 E .209 |
| (In addition to command names, readline allo)108 434.4 R .209(ws k)-.25 |
| F -.15(ey)-.1 G 2.709(st).15 G 2.709(ob)-2.709 G 2.709(eb)-2.709 G .209 |
| (ound to a string that is inserted when the k)-2.709 F .509 -.15(ey i) |
| -.1 H(s).15 E(pressed \(a)108 446.4 Q F1(macr)2.5 E(o)-.45 E F0(\).)A F2 |
| (Readline K)87 463.2 Q(ey Bindings)-.25 E F0 .366 |
| (The syntax for controlling k)108 475.2 R .666 -.15(ey b)-.1 H .366 |
| (indings in the).15 F F1(inputr)2.876 E(c)-.37 E F0 .366 |
| (\214le is simple.)3.176 F .366(All that is required is the name of the) |
| 5.366 F .383(command or the te)108 487.2 R .383(xt of a macro and a k) |
| -.15 F .683 -.15(ey s)-.1 H .383 |
| (equence to which it should be bound. The name may be speci-).15 F .853 |
| (\214ed in one of tw)108 499.2 R 3.353(ow)-.1 G .853 |
| (ays: as a symbolic k)-3.453 F 1.153 -.15(ey n)-.1 H .853 |
| (ame, possibly with).15 F F1(Meta\255)3.353 E F0(or)3.353 E F1(Contr) |
| 3.353 E(ol\255)-.45 E F0(pre\214x)3.353 E .853(es, or as a k)-.15 F -.15 |
| (ey)-.1 G(sequence.)108 511.2 Q 1.542(When using the form)108 528 R F2 |
| -.1(ke)4.042 G(yname).1 E F0(:)A F1(function\255name).833 E F0(or)4.042 |
| E F1(macr)4.042 E(o)-.45 E F0(,)A F1 -.1(ke)4.042 G(yname)-.2 E F0 1.542 |
| (is the name of a k)4.222 F 1.841 -.15(ey s)-.1 H 1.541(pelled out in) |
| .15 F 2.5(English. F)108 540 R(or e)-.15 E(xample:)-.15 E |
| (Control-u: uni)144 564 Q -.15(ve)-.25 G(rsal\255ar).15 E(gument)-.18 E |
| (Meta-Rubout: backw)144 576 Q(ard-kill-w)-.1 E(ord)-.1 E |
| (Control-o: "> output")144 588 Q .698(In the abo)108 604.8 R .998 -.15 |
| (ve ex)-.15 H(ample,).15 E F1(C\255u)3.038 E F0 .698 |
| (is bound to the function)3.448 F F2(uni)3.198 E -.1(ve)-.1 G |
| (rsal\255ar).1 E(gument)-.1 E F0(,)A F1(M\255DEL)3.878 E F0 .698 |
| (is bound to the func-)3.728 F(tion)108 616.8 Q F2 |
| (backward\255kill\255w)2.759 E(ord)-.1 E F0 2.759(,a)C(nd)-2.759 E F1 |
| (C\255o)2.599 E F0 .258(is bound to run the macro e)2.939 F .258 |
| (xpressed on the right hand side \(that is, to)-.15 F(insert the te)108 |
| 628.8 Q(xt)-.15 E/F4 10/Courier@0 SF 6(>o)2.5 G(utput)-6 E F0 |
| (into the line\).)2.5 E .055(In the second form,)108 645.6 R F2("k)2.555 |
| E(eyseq")-.1 E F0(:)A F1(function\255name).833 E F0(or)2.555 E F1(macr) |
| 2.555 E(o)-.45 E F0(,)A F2 -.1(ke)2.555 G(yseq).1 E F0(dif)2.556 E .056 |
| (fers from)-.25 F F2 -.1(ke)2.556 G(yname).1 E F0(abo)2.556 E .356 -.15 |
| (ve i)-.15 H 2.556(nt).15 G .056(hat strings)-2.556 F 1.284 |
| (denoting an entire k)108 657.6 R 1.584 -.15(ey s)-.1 H 1.284(equence m\ |
| ay be speci\214ed by placing the sequence within double quotes.).15 F |
| (Some)6.284 E .385(GNU Emacs style k)108 669.6 R .685 -.15(ey e)-.1 H |
| .385(scapes can be used, as in the follo).15 F .385(wing e)-.25 F .386 |
| (xample, b)-.15 F .386(ut the symbolic character names)-.2 F |
| (are not recognized.)108 681.6 Q("\\C\255u": uni)144 705.6 Q -.15(ve) |
| -.25 G(rsal\255ar).15 E(gument)-.18 E |
| ("\\C\255x\\C\255r": re\255read\255init\255\214le)144 717.6 Q |
| ("\\e[11~": "Function K)144 729.6 Q .3 -.15(ey 1)-.25 H(").15 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(34)185.955 E 0 Cg EP |
| %%Page: 35 35 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .315(In this e)108 84 R(xample,)-.15 E/F1 10/Times-Italic@0 SF |
| (C\255u)2.655 E F0 .315(is ag)3.065 F .315(ain bound to the function) |
| -.05 F/F2 10/Times-Bold@0 SF(uni)2.815 E -.1(ve)-.1 G(rsal\255ar).1 E |
| (gument)-.1 E F0(.)A F1 .315(C\255x C\255r)5.155 F F0 .314 |
| (is bound to the func-)3.544 F(tion)108 96 Q F2 -.18(re)2.5 G<ad72>.18 E |
| (ead\255init\255\214le)-.18 E F0 2.5(,a)C(nd)-2.5 E F1(ESC [ 1 1 ~)3.01 |
| E F0(is bound to insert the te)3.94 E(xt)-.15 E/F3 10/Courier@0 SF |
| (Function Key 1)2.5 E F0(.)A |
| (The full set of GNU Emacs style escape sequences is)108 112.8 Q F2 |
| <5c43ad>144 124.8 Q F0(control pre\214x)20.3 E F2<5c4dad>144 136.8 Q F0 |
| (meta pre\214x)18.08 E F2(\\e)144 148.8 Q F0(an escape character)28.78 E |
| F2(\\\\)144 160.8 Q F0(backslash)30.44 E F2(\\")144 172.8 Q F0 |
| (literal ")27.67 E F2<5c08>144 184.8 Q F0(literal \010)30.44 E(In addit\ |
| ion to the GNU Emacs style escape sequences, a second set of backslash \ |
| escapes is a)108 201.6 Q -.25(va)-.2 G(ilable:).25 E F2(\\a)144 213.6 Q |
| F0(alert \(bell\))28.22 E F2(\\b)144 225.6 Q F0(backspace)27.66 E F2 |
| (\\d)144 237.6 Q F0(delete)27.66 E F2(\\f)144 249.6 Q F0(form feed)29.89 |
| E F2(\\n)144 261.6 Q F0(ne)27.66 E(wline)-.25 E F2(\\r)144 273.6 Q F0 |
| (carriage return)28.78 E F2(\\t)144 285.6 Q F0(horizontal tab)29.89 E F2 |
| (\\v)144 297.6 Q F0 -.15(ve)28.22 G(rtical tab).15 E F2(\\)144 309.6 Q |
| F1(nnn)A F0(the eight-bit character whose v)18.22 E(alue is the octal v) |
| -.25 E(alue)-.25 E F1(nnn)2.5 E F0(\(one to three digits\))2.5 E F2(\\x) |
| 144 321.6 Q F1(HH)A F0(the eight-bit character whose v)13.78 E |
| (alue is the he)-.25 E(xadecimal v)-.15 E(alue)-.25 E F1(HH)2.5 E F0 |
| (\(one or tw)2.5 E 2.5(oh)-.1 G .3 -.15(ex d)-2.5 H(igits\)).15 E 1.141 |
| (When entering the te)108 338.4 R 1.141(xt of a macro, single or double\ |
| quotes must be used to indicate a macro de\214nition.)-.15 F .09 |
| (Unquoted te)108 350.4 R .09(xt is assumed to be a function name.)-.15 F |
| .089(In the macro body)5.089 F 2.589(,t)-.65 G .089 |
| (he backslash escapes described abo)-2.589 F -.15(ve)-.15 G(are e)108 |
| 362.4 Q 2.5(xpanded. Backslash)-.15 F(will quote an)2.5 E 2.5(yo)-.15 G |
| (ther character in the macro te)-2.5 E(xt, including " and \010.)-.15 E |
| F2(Bash)108 379.2 Q F0(allo)2.929 E .429(ws the current readline k)-.25 |
| F .729 -.15(ey b)-.1 H .429 |
| (indings to be displayed or modi\214ed with the).15 F F2(bind)2.93 E F0 |
| -.2(bu)2.93 G .43(iltin command.).2 F .046 |
| (The editing mode may be switched during interacti)108 391.2 R .346 -.15 |
| (ve u)-.25 H .046(se by using the).15 F F2<ad6f>2.545 E F0 .045 |
| (option to the)2.545 F F2(set)2.545 E F0 -.2(bu)2.545 G .045 |
| (iltin command).2 F(\(see)108 403.2 Q/F4 9/Times-Bold@0 SF(SHELL B)2.5 E |
| (UIL)-.09 E(TIN COMMANDS)-.828 E F0(belo)2.25 E(w\).)-.25 E F2 |
| (Readline V)87 420 Q(ariables)-.92 E F0 .043(Readline has v)108 432 R |
| .043(ariables that can be used to further customize its beha)-.25 F |
| (vior)-.2 E 5.043(.A)-.55 G -.25(va)-2.5 G .043 |
| (riable may be set in the).25 F F1(inpu-)2.554 E(tr)108 444 Q(c)-.37 E |
| F0(\214le with a statement of the form)2.81 E F2(set)144 460.8 Q F1 |
| (variable\255name value)2.5 E F0 .79(Except where noted, readline v)108 |
| 477.6 R .79(ariables can tak)-.25 F 3.29(et)-.1 G .79(he v)-3.29 F |
| (alues)-.25 E F2(On)3.29 E F0(or)3.29 E F2(Off)3.29 E F0 .79 |
| (\(without re)3.29 F -.05(ga)-.15 G .79(rd to case\).).05 F(Unrecog-) |
| 5.79 E .448(nized v)108 489.6 R .448(ariable names are ignored.)-.25 F |
| .448(When a v)5.448 F .448(ariable v)-.25 F .448 |
| (alue is read, empty or null v)-.25 F .449(alues, "on" \(case-insensi-) |
| -.25 F(ti)108 501.6 Q -.15(ve)-.25 G .468(\), and "1" are equi).15 F |
| -.25(va)-.25 G .468(lent to).25 F F2(On)2.968 E F0 5.468(.A)C .468 |
| (ll other v)-5.468 F .468(alues are equi)-.25 F -.25(va)-.25 G .468 |
| (lent to).25 F F2(Off)2.968 E F0 5.468(.T)C .467(he v)-5.468 F .467 |
| (ariables and their def)-.25 F(ault)-.1 E -.25(va)108 513.6 S(lues are:) |
| .25 E F2(bell\255style \(audible\))108 530.4 Q F0 .01 |
| (Controls what happens when readline w)144 542.4 R .011 |
| (ants to ring the terminal bell.)-.1 F .011(If set to)5.011 F F2(none) |
| 2.511 E F0 2.511(,r)C .011(eadline ne)-2.511 F -.15(ve)-.25 G(r).15 E |
| .94(rings the bell.)144 554.4 R .94(If set to)5.94 F F2(visible)3.44 E |
| F0 3.44(,r)C .94(eadline uses a visible bell if one is a)-3.44 F -.25 |
| (va)-.2 G 3.44(ilable. If).25 F .94(set to)3.44 F F2(audible)3.44 E F0 |
| (,)A(readline attempts to ring the terminal')144 566.4 Q 2.5(sb)-.55 G |
| (ell.)-2.5 E F2(bind\255tty\255special\255chars \(On\))108 578.4 Q F0 |
| .055(If set to)144 590.4 R F2(On)2.555 E F0 2.555(,r)C .056(eadline att\ |
| empts to bind the control characters treated specially by the k)-2.555 F |
| (ernel')-.1 E 2.556(st)-.55 G(ermi-)-2.556 E(nal dri)144 602.4 Q -.15 |
| (ve)-.25 G 2.5(rt).15 G 2.5(ot)-2.5 G(heir readline equi)-2.5 E -.25(va) |
| -.25 G(lents.).25 E F2(comment\255begin \(`)108 614.4 Q(`#')-.63 E('\)) |
| -.63 E F0 .885(The string that is inserted when the readline)144 626.4 R |
| F2(insert\255comment)3.385 E F0 .884(command is e)3.384 F -.15(xe)-.15 G |
| 3.384(cuted. This).15 F(com-)3.384 E(mand is bound to)144 638.4 Q F2 |
| (M\255#)2.5 E F0(in emacs mode and to)2.5 E F2(#)2.5 E F0 |
| (in vi command mode.)2.5 E F2(completion\255ignor)108 650.4 Q |
| (e\255case \(Off\))-.18 E F0(If set to)144 662.4 Q F2(On)2.5 E F0 2.5 |
| (,r)C(eadline performs \214lename matching and completion in a case\255\ |
| insensiti)-2.5 E .3 -.15(ve f)-.25 H(ashion.).05 E F2(completion\255pr) |
| 108 674.4 Q(e\214x\255display\255length \(0\))-.18 E F0 .829(The length\ |
| in characters of the common pre\214x of a list of possible completions\ |
| that is displayed)144 686.4 R 1.275(without modi\214cation.)144 698.4 R |
| 1.275(When set to a v)6.275 F 1.274 |
| (alue greater than zero, common pre\214x)-.25 F 1.274 |
| (es longer than this)-.15 F -.25(va)144 710.4 S(lue are replaced with a\ |
| n ellipsis when displaying possible completions.).25 E(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(35)185.955 E 0 Cg EP |
| %%Page: 36 36 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(completion\255query\255items \(100\))108 84 |
| Q F0 .529(This determines when the user is queried about vie)144 96 R |
| .53(wing the number of possible completions gen-)-.25 F .561 |
| (erated by the)144 108 R F1(possible\255completions)3.061 E F0 3.061 |
| (command. It)3.061 F .561(may be set to an)3.061 F 3.06(yi)-.15 G(nte) |
| -3.06 E .56(ger v)-.15 F .56(alue greater than or)-.25 F .782 |
| (equal to zero.)144 120 R .783(If the number of possible completions is\ |
| greater than or equal to the v)5.782 F .783(alue of this)-.25 F -.25 |
| (va)144 132 S .237(riable, the user is ask).25 F .237 |
| (ed whether or not he wishes to vie)-.1 F 2.737(wt)-.25 G .237 |
| (hem; otherwise the)-2.737 F 2.737(ya)-.15 G .237(re simply listed) |
| -2.737 F(on the terminal.)144 144 Q F1(con)108 156 Q -.1(ve)-.4 G |
| (rt\255meta \(On\)).1 E F0 .612(If set to)144 168 R F1(On)3.112 E F0 |
| 3.112(,r)C .613(eadline will con)-3.112 F -.15(ve)-.4 G .613 |
| (rt characters with the eighth bit set to an ASCII k).15 F .913 -.15 |
| (ey s)-.1 H .613(equence by).15 F .541 |
| (stripping the eighth bit and pre\214xing an escape character \(in ef) |
| 144 180 R .541(fect, using escape as the)-.25 F/F2 10/Times-Italic@0 SF |
| .541(meta pr)3.041 F(e-)-.37 E<8c78>144 192 Q F0(\).)A F1 |
| (disable\255completion \(Off\))108 204 Q F0 .038(If set to)144 216 R F1 |
| (On)2.538 E F0 2.538(,r)C .038(eadline will inhibit w)-2.538 F .038 |
| (ord completion.)-.1 F .038 |
| (Completion characters will be inserted into the)5.038 F(line as if the) |
| 144 228 Q 2.5(yh)-.15 G(ad been mapped to)-2.5 E F1(self-insert)2.5 E F0 |
| (.)A F1(editing\255mode \(emacs\))108 240 Q F0 .253 |
| (Controls whether readline be)144 252 R .253(gins with a set of k)-.15 F |
| .553 -.15(ey b)-.1 H .253(indings similar to).15 F F2(emacs)2.752 E F0 |
| (or)2.752 E F2(vi)2.752 E F0(.)A F1(editing\255mode)5.252 E F0 |
| (can be set to either)144 264 Q F1(emacs)2.5 E F0(or)2.5 E F1(vi)2.5 E |
| F0(.)A F1(echo\255contr)108 276 Q(ol\255characters \(On\))-.18 E F0 1.21 |
| (When set to)144 288 R F1(On)3.71 E F0 3.71(,o)C 3.71(no)-3.71 G 1.211 |
| (perating systems that indicate the)-3.71 F 3.711(ys)-.15 G 1.211 |
| (upport it, readline echoes a character)-3.711 F |
| (corresponding to a signal generated from the k)144 300 Q -.15(ey)-.1 G |
| (board.).15 E F1(enable\255k)108 312 Q(eypad \(Off\))-.1 E F0 .893 |
| (When set to)144 324 R F1(On)3.393 E F0 3.393(,r)C .893 |
| (eadline will try to enable the application k)-3.393 F -.15(ey)-.1 G |
| .893(pad when it is called.).15 F .892(Some sys-)5.893 F |
| (tems need this to enable the arro)144 336 Q 2.5(wk)-.25 G -.15(ey)-2.6 |
| G(s.).15 E F1(enable\255meta\255k)108 348 Q(ey \(On\))-.1 E F0 .64 |
| (When set to)144 360 R F1(On)3.14 E F0 3.14(,r)C .64 |
| (eadline will try to enable an)-3.14 F 3.14(ym)-.15 G .64 |
| (eta modi\214er k)-3.14 F .94 -.15(ey t)-.1 H .64 |
| (he terminal claims to support).15 F(when it is called.)144 372 Q |
| (On man)5 E 2.5(yt)-.15 G(erminals, the meta k)-2.5 E .3 -.15(ey i)-.1 H |
| 2.5(su).15 G(sed to send eight-bit characters.)-2.5 E F1 |
| (expand\255tilde \(Off\))108 384 Q F0(If set to)144 396 Q F1(on)2.5 E F0 |
| 2.5(,t)C(ilde e)-2.5 E(xpansion is performed when readline attempts w) |
| -.15 E(ord completion.)-.1 E F1(history\255pr)108 408 Q(eser)-.18 E -.1 |
| (ve)-.1 G(\255point \(Off\)).1 E F0 1.493(If set to)144 420 R F1(on) |
| 3.993 E F0 3.993(,t)C 1.493(he history code attempts to place point at \ |
| the same location on each history line)-3.993 F(retrie)144 432 Q -.15 |
| (ve)-.25 G 2.5(dw).15 G(ith)-2.5 E F1(pr)2.5 E -.15(ev)-.18 G |
| (ious-history).15 E F0(or)2.5 E F1(next-history)2.5 E F0(.)A F1 |
| (history\255size \(0\))108 444 Q F0 .462 |
| (Set the maximum number of history entries sa)144 456 R -.15(ve)-.2 G |
| 2.963(di).15 G 2.963(nt)-2.963 G .463(he history list.)-2.963 F .463 |
| (If set to zero, the number of)5.463 F |
| (entries in the history list is not limited.)144 468 Q F1 |
| (horizontal\255scr)108 480 Q(oll\255mode \(Off\))-.18 E F0 .449 |
| (When set to)144 492 R F1(On)2.949 E F0 2.949(,m)C(ak)-2.949 E .448 |
| (es readline use a single line for display)-.1 F 2.948(,s)-.65 G .448 |
| (crolling the input horizontally on a)-2.948 F 1.194(single screen line\ |
| when it becomes longer than the screen width rather than wrapping to a\ |
| ne)144 504 R(w)-.25 E(line.)144 516 Q F1(input\255meta \(Off\))108 528 |
| Q F0 .228(If set to)144 540 R F1(On)2.728 E F0 2.728(,r)C .227(eadline \ |
| will enable eight-bit input \(that is, it will not strip the high bit f\ |
| rom the char)-2.728 F(-)-.2 E .956(acters it reads\), re)144 552 R -.05 |
| (ga)-.15 G .956(rdless of what the terminal claims it can support.).05 F |
| .957(The name)5.956 F F1(meta\255\215ag)3.457 E F0 .957(is a)3.457 F |
| (synon)144 564 Q(ym for this v)-.15 E(ariable.)-.25 E F1(isear)108 576 Q |
| (ch\255terminators \(`)-.18 E(`C\255[C\255J')-.63 E('\))-.63 E F0 .439(\ |
| The string of characters that should terminate an incremental search wi\ |
| thout subsequently e)144 588 R -.15(xe)-.15 G(cut-).15 E .934 |
| (ing the character as a command.)144 600 R .935(If this v)5.935 F .935 |
| (ariable has not been gi)-.25 F -.15(ve)-.25 G 3.435(nav).15 G .935 |
| (alue, the characters)-3.685 F F2(ESC)3.435 E F0(and)144 612 Q F2 |
| (C\255J)2.5 E F0(will terminate an incremental search.)2.5 E F1 -.1(ke) |
| 108 624 S(ymap \(emacs\)).1 E F0 2.021(Set the current readline k)144 |
| 636 R -.15(ey)-.1 G 4.521(map. The).15 F 2.021(set of v)4.521 F 2.021 |
| (alid k)-.25 F -.15(ey)-.1 G 2.021(map names is).15 F F2 2.02 |
| (emacs, emacs\255standar)4.52 F(d,)-.37 E .068 |
| (emacs\255meta, emacs\255ctlx, vi, vi\255command)144 648 R F0 2.568(,a)C |
| (nd)-2.568 E F2(vi\255insert)2.568 E F0(.).68 E F2(vi)5.068 E F0 .068 |
| (is equi)2.568 F -.25(va)-.25 G .068(lent to).25 F F2(vi\255command) |
| 2.569 E F0(;)A F2(emacs)2.569 E F0 1.544(is equi)144 660 R -.25(va)-.25 |
| G 1.544(lent to).25 F F2(emacs\255standar)4.044 E(d)-.37 E F0 6.544(.T)C |
| 1.544(he def)-6.544 F 1.544(ault v)-.1 F 1.544(alue is)-.25 F F2(emacs) |
| 4.044 E F0 4.044(;t).27 G 1.544(he v)-4.044 F 1.544(alue of)-.25 F F1 |
| (editing\255mode)4.043 E F0(also)4.043 E(af)144 672 Q(fects the def)-.25 |
| E(ault k)-.1 E -.15(ey)-.1 G(map.).15 E F1(mark\255dir)108 684 Q |
| (ectories \(On\))-.18 E F0(If set to)144 696 Q F1(On)2.5 E F0 2.5(,c)C |
| (ompleted directory names ha)-2.5 E .3 -.15(ve a s)-.2 H(lash appended.) |
| .15 E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(36)185.955 E 0 Cg |
| EP |
| %%Page: 37 37 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(mark\255modi\214ed\255lines \(Off\))108 84 |
| Q F0(If set to)144 96 Q F1(On)2.5 E F0 2.5(,h)C(istory lines that ha) |
| -2.5 E .3 -.15(ve b)-.2 H |
| (een modi\214ed are displayed with a preceding asterisk \().15 E F1(*)A |
| F0(\).)A F1(mark\255symlink)108 108 Q(ed\255dir)-.1 E(ectories \(Off\)) |
| -.18 E F0 .175(If set to)144 120 R F1(On)2.675 E F0 2.675(,c)C .175 |
| (ompleted names which are symbolic links to directories ha)-2.675 F .475 |
| -.15(ve a s)-.2 H .175(lash appended \(sub-).15 F(ject to the v)144 132 |
| Q(alue of)-.25 E F1(mark\255dir)2.5 E(ectories)-.18 E F0(\).)A F1 |
| (match\255hidden\255\214les \(On\))108 144 Q F0 .193(This v)144 156 R |
| .193(ariable, when set to)-.25 F F1(On)2.693 E F0 2.693(,c)C .192 |
| (auses readline to match \214les whose names be)-2.693 F .192 |
| (gin with a `.)-.15 F 2.692('\()-.7 G(hidden)-2.692 E 1.023 |
| (\214les\) when performing \214lename completion, unless the leading `.) |
| 144 168 R 3.523('i)-.7 G 3.523(ss)-3.523 G 1.024 |
| (upplied by the user in the)-3.523 F(\214lename to be completed.)144 180 |
| Q F1(output\255meta \(Off\))108 192 Q F0 .507(If set to)144 204 R F1(On) |
| 3.007 E F0 3.007(,r)C .507(eadline will display characters with the eig\ |
| hth bit set directly rather than as a meta-)-3.007 F(pre\214x)144 216 Q |
| (ed escape sequence.)-.15 E F1(page\255completions \(On\))108 228 Q F0 |
| .808(If set to)144 240 R F1(On)3.308 E F0 3.308(,r)C .808 |
| (eadline uses an internal)-3.308 F/F2 10/Times-Italic@0 SF(mor)3.308 E |
| (e)-.37 E F0(-lik)A 3.308(ep)-.1 G .808 |
| (ager to display a screenful of possible comple-)-3.308 F |
| (tions at a time.)144 252 Q F1 |
| (print\255completions\255horizontally \(Off\))108 264 Q F0 1.319 |
| (If set to)144 276 R F1(On)3.819 E F0 3.819(,r)C 1.318(eadline will dis\ |
| play completions with matches sorted horizontally in alphabetical)-3.819 |
| F(order)144 288 Q 2.5(,r)-.4 G(ather than do)-2.5 E(wn the screen.)-.25 |
| E F1 -2.29 -.18(re v)108 300 T(ert\255all\255at\255newline \(Off\)).08 E |
| F0 .872(If set to)144 312 R F1(on)3.372 E F0 3.372(,r)C .873 |
| (eadline will undo all changes to history lines before returning when) |
| -3.372 F F1(accept\255line)3.373 E F0(is)3.373 E -.15(exe)144 324 S |
| 2.686(cuted. By).15 F(def)2.686 E .186 |
| (ault, history lines may be modi\214ed and retain indi)-.1 F .186 |
| (vidual undo lists across calls to)-.25 F F1 -.18(re)144 336 S(adline) |
| .18 E F0(.)A F1(sho)108 348 Q(w\255all\255if\255ambiguous \(Off\))-.1 E |
| F0 .477(This alters the def)144 360 R .477(ault beha)-.1 F .477 |
| (vior of the completion functions.)-.2 F .478(If set to)5.478 F F1(on) |
| 2.978 E F0 2.978(,w)C .478(ords which ha)-3.078 F .778 -.15(ve m)-.2 H |
| (ore).15 E 1.264(than one possible completion cause the matches to be l\ |
| isted immediately instead of ringing the)144 372 R(bell.)144 384 Q F1 |
| (sho)108 396 Q(w\255all\255if\255unmodi\214ed \(Off\))-.1 E F0 5.345 |
| (This alters the def)144 408 R 5.345(ault beha)-.1 F 5.345 |
| (vior of the completion functions in a f)-.2 F 5.346(ashion similar to) |
| -.1 F F1(sho)144 420 Q(w\255all\255if\255ambiguous)-.1 E F0 6.923(.I)C |
| 4.423(fs)-6.923 G 1.923(et to)-4.423 F F1(on)4.423 E F0 4.423(,w)C 1.923 |
| (ords which ha)-4.523 F 2.222 -.15(ve m)-.2 H 1.922 |
| (ore than one possible completion).15 F 1.039(without an)144 432 R 3.539 |
| (yp)-.15 G 1.039 |
| (ossible partial completion \(the possible completions don')-3.539 F |
| 3.539(ts)-.18 G 1.04(hare a common pre\214x\))-3.539 F(cause the matche\ |
| s to be listed immediately instead of ringing the bell.)144 444 Q F1 |
| (skip\255completed\255text \(Off\))108 456 Q F0 .095(If set to)144 468 R |
| F1(On)2.595 E F0 2.595(,t)C .095(his alters the def)-2.595 F .095 |
| (ault completion beha)-.1 F .094 |
| (vior when inserting a single match into the line.)-.2 F(It')144 480 Q |
| 2.545(so)-.55 G .045(nly acti)-2.545 F .345 -.15(ve w)-.25 H .046 |
| (hen performing completion in the middle of a w).15 F 2.546(ord. If)-.1 |
| F .046(enabled, readline does not)2.546 F 1.394(insert characters from \ |
| the completion that match characters after point in the w)144 492 R |
| 1.394(ord being com-)-.1 F(pleted, so portions of the w)144 504 Q |
| (ord follo)-.1 E(wing the cursor are not duplicated.)-.25 E F1 |
| (visible\255stats \(Off\))108 516 Q F0 .846(If set to)144 528 R F1(On) |
| 3.346 E F0 3.346(,ac)C .846(haracter denoting a \214le')-3.346 F 3.346 |
| (st)-.55 G .846(ype as reported by)-3.346 F F2(stat)3.346 E F0 .846 |
| (\(2\) is appended to the \214lename)B |
| (when listing possible completions.)144 540 Q F1 |
| (Readline Conditional Constructs)87 556.8 Q F0 .05 |
| (Readline implements a f)108 568.8 R .05(acility similar in spirit to t\ |
| he conditional compilation features of the C preprocessor)-.1 F .096 |
| (which allo)108 580.8 R .096(ws k)-.25 F .396 -.15(ey b)-.1 H .096 |
| (indings and v).15 F .096 |
| (ariable settings to be performed as the result of tests.)-.25 F .097 |
| (There are four parser)5.096 F(directi)108 592.8 Q -.15(ve)-.25 G 2.5 |
| (su).15 G(sed.)-2.5 E F1($if)108 609.6 Q F0(The)24.89 E F1($if)2.963 E |
| F0 .463(construct allo)2.963 F .462(ws bindings to be made based on the\ |
| editing mode, the terminal being used,)-.25 F .477 |
| (or the application using readline.)144 621.6 R .477(The te)5.477 F .477 |
| (xt of the test e)-.15 F .477 |
| (xtends to the end of the line; no characters)-.15 F |
| (are required to isolate it.)144 633.6 Q F1(mode)144 650.4 Q F0(The) |
| 12.67 E F1(mode=)3.712 E F0 1.212(form of the)3.712 F F1($if)3.711 E F0 |
| (directi)3.711 E 1.511 -.15(ve i)-.25 H 3.711(su).15 G 1.211 |
| (sed to test whether readline is in emacs or vi)-3.711 F 3.065 |
| (mode. This)180 662.4 R .565(may be used in conjunction with the)3.065 F |
| F1 .565(set k)3.065 F(eymap)-.1 E F0 .565(command, for instance, to) |
| 3.065 F .735(set bindings in the)180 674.4 R F2(emacs\255standar)3.235 E |
| (d)-.37 E F0(and)3.235 E F2(emacs\255ctlx)3.235 E F0 -.1(ke)3.235 G .735 |
| (ymaps only if readline is starting)-.05 F(out in emacs mode.)180 686.4 |
| Q F1(term)144 703.2 Q F0(The)15.46 E F1(term=)3.196 E F0 .696 |
| (form may be used to include terminal-speci\214c k)3.196 F .996 -.15 |
| (ey b)-.1 H .697(indings, perhaps to bind).15 F .654(the k)180 715.2 R |
| .954 -.15(ey s)-.1 H .654(equences output by the terminal').15 F 3.154 |
| (sf)-.55 G .654(unction k)-3.154 F -.15(ey)-.1 G 3.154(s. The).15 F -.1 |
| (wo)3.154 G .654(rd on the right side of).1 F(the)180 727.2 Q F1(=)3.231 |
| E F0 .731(is tested ag)3.231 F .732(ainst the both full name of the ter\ |
| minal and the portion of the terminal)-.05 F(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(37)185.955 E 0 Cg EP |
| %%Page: 38 38 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(name before the \214rst)180 84 Q/F1 10/Times-Bold@0 SF<ad>2.5 E |
| F0 5(.T)C(his allo)-5 E(ws)-.25 E/F2 10/Times-Italic@0 SF(sun)2.84 E F0 |
| (to match both)2.74 E F2(sun)2.84 E F0(and)2.74 E F2(sun\255cmd)2.5 E F0 |
| 2.5(,f).77 G(or instance.)-2.5 E F1(application)144 100.8 Q F0(The)180 |
| 112.8 Q F1(application)3.003 E F0 .503 |
| (construct is used to include application-speci\214c settings.)3.003 F |
| .503(Each program)5.503 F .114(using the readline library sets the)180 |
| 124.8 R F2 .114(application name)2.614 F F0 2.614(,a)C .114 |
| (nd an initialization \214le can test for a)-2.614 F .501(particular v) |
| 180 136.8 R 3.001(alue. This)-.25 F .501(could be used to bind k)3.001 F |
| .801 -.15(ey s)-.1 H .5(equences to functions useful for a spe-).15 F |
| .396(ci\214c program.)180 148.8 R -.15(Fo)5.396 G 2.896(ri).15 G .396 |
| (nstance, the follo)-2.896 F .396(wing command adds a k)-.25 F .696 -.15 |
| (ey s)-.1 H .397(equence that quotes the).15 F(current or pre)180 160.8 |
| Q(vious w)-.25 E(ord in Bash:)-.1 E F1($if)180 184.8 Q F0(Bash)2.5 E 2.5 |
| (#Q)180 196.8 S(uote the current or pre)-2.5 E(vious w)-.25 E(ord)-.1 E |
| ("\\C\255xq": "\\eb\\"\\ef\\"")180 208.8 Q F1($endif)180 220.8 Q($endif) |
| 108 237.6 Q F0(This command, as seen in the pre)9.33 E(vious e)-.25 E |
| (xample, terminates an)-.15 E F1($if)2.5 E F0(command.)2.5 E F1($else) |
| 108 254.4 Q F0(Commands in this branch of the)15.45 E F1($if)2.5 E F0 |
| (directi)2.5 E .3 -.15(ve a)-.25 H(re e).15 E -.15(xe)-.15 G |
| (cuted if the test f).15 E(ails.)-.1 E F1($include)108 271.2 Q F0 .357 |
| (This directi)144 283.2 R .657 -.15(ve t)-.25 H(ak).15 E .357 |
| (es a single \214lename as an ar)-.1 F .356 |
| (gument and reads commands and bindings from that)-.18 F 2.5(\214le. F) |
| 144 295.2 R(or e)-.15 E(xample, the follo)-.15 E(wing directi)-.25 E .3 |
| -.15(ve w)-.25 H(ould read).05 E F2(/etc/inputr)2.5 E(c)-.37 E F0(:)A F1 |
| ($include)144 319.2 Q F2(/etc/inputr)5.833 E(c)-.37 E F1(Sear)87 336 Q |
| (ching)-.18 E F0 .834(Readline pro)108 348 R .834 |
| (vides commands for searching through the command history \(see)-.15 F |
| /F3 9/Times-Bold@0 SF(HIST)3.335 E(OR)-.162 E(Y)-.315 E F0(belo)3.085 E |
| .835(w\) for lines)-.25 F(containing a speci\214ed string.)108 360 Q |
| (There are tw)5 E 2.5(os)-.1 G(earch modes:)-2.5 E F2(incr)2.51 E |
| (emental)-.37 E F0(and)3.01 E F2(non-incr)2.5 E(emental)-.37 E F0(.).51 |
| E .698(Incremental searches be)108 376.8 R .698 |
| (gin before the user has \214nished typing the search string.)-.15 F |
| .697(As each character of the)5.697 F .112 |
| (search string is typed, readline displays the ne)108 388.8 R .112 |
| (xt entry from the history matching the string typed so f)-.15 F(ar)-.1 |
| E 5.113(.A)-.55 G(n)-5.113 E .542 |
| (incremental search requires only as man)108 400.8 R 3.042(yc)-.15 G |
| .542(haracters as needed to \214nd the desired history entry)-3.042 F |
| 5.541(.T)-.65 G .541(he char)-5.541 F(-)-.2 E .224 |
| (acters present in the v)108 412.8 R .224(alue of the)-.25 F F1(isear) |
| 2.724 E(ch-terminators)-.18 E F0 -.25(va)2.724 G .224 |
| (riable are used to terminate an incremental search.).25 F .66 |
| (If that v)108 424.8 R .66(ariable has not been assigned a v)-.25 F .66 |
| (alue the Escape and Control-J characters will terminate an incre-)-.25 |
| F .096(mental search.)108 436.8 R .096(Control-G will abort an incremen\ |
| tal search and restore the original line.)5.096 F .097 |
| (When the search is)5.097 F(terminated, the history entry containing th\ |
| e search string becomes the current line.)108 448.8 Q 2.939 -.8(To \214) |
| 108 465.6 T 1.339(nd other matching entries in the history list, type C\ |
| ontrol-S or Control-R as appropriate.).8 F 1.338(This will)6.338 F .674 |
| (search backw)108 477.6 R .674(ard or forw)-.1 F .674 |
| (ard in the history for the ne)-.1 F .675 |
| (xt entry matching the search string typed so f)-.15 F(ar)-.1 E 5.675 |
| (.A)-.55 G -.15(ny)-5.675 G .175(other k)108 489.6 R .475 -.15(ey s)-.1 |
| H .174 |
| (equence bound to a readline command will terminate the search and e).15 |
| F -.15(xe)-.15 G .174(cute that command.).15 F -.15(Fo)5.174 G(r).15 E |
| .54(instance, a)108 501.6 R F2(ne)3.04 E(wline)-.15 E F0 .541 |
| (will terminate the search and accept the line, thereby e)3.04 F -.15 |
| (xe)-.15 G .541(cuting the command from the).15 F(history list.)108 |
| 513.6 Q .653(Readline remembers the last incremental search string.)108 |
| 530.4 R .653(If tw)5.653 F 3.153(oC)-.1 G .653 |
| (ontrol-Rs are typed without an)-3.153 F 3.152(yi)-.15 G(nterv)-3.152 E |
| (en-)-.15 E(ing characters de\214ning a ne)108 542.4 Q 2.5(ws)-.25 G |
| (earch string, an)-2.5 E 2.5(yr)-.15 G(emembered search string is used.) |
| -2.5 E .567(Non-incremental searches read the entire search string befo\ |
| re starting to search for matching history lines.)108 559.2 R(The searc\ |
| h string may be typed by the user or be part of the contents of the cur\ |
| rent line.)108 571.2 Q F1(Readline Command Names)87 588 Q F0 1.392 |
| (The follo)108 600 R 1.391 |
| (wing is a list of the names of the commands and the def)-.25 F 1.391 |
| (ault k)-.1 F 1.691 -.15(ey s)-.1 H 1.391(equences to which the).15 F |
| 3.891(ya)-.15 G(re)-3.891 E 2.621(bound. Command)108 612 R .121 |
| (names without an accompan)2.621 F .121(ying k)-.15 F .421 -.15(ey s)-.1 |
| H .122(equence are unbound by def).15 F 2.622(ault. In)-.1 F .122 |
| (the follo)2.622 F(wing)-.25 E(descriptions,)108 624 Q F2(point)3.411 E |
| F0 .911(refers to the current cursor position, and)3.411 F F2(mark)3.411 |
| E F0 .91(refers to a cursor position sa)3.411 F -.15(ve)-.2 G 3.41(db) |
| .15 G 3.41(yt)-3.41 G(he)-3.41 E F1(set\255mark)108 636 Q F0 2.5 |
| (command. The)2.5 F(te)2.5 E |
| (xt between the point and mark is referred to as the)-.15 E F2 -.37(re) |
| 2.5 G(gion)-.03 E F0(.)A F1(Commands f)87 652.8 Q(or Mo)-.25 E(ving)-.1 |
| E(beginning\255of\255line \(C\255a\))108 664.8 Q F0(Mo)144 676.8 Q .3 |
| -.15(ve t)-.15 H 2.5(ot).15 G(he start of the current line.)-2.5 E F1 |
| (end\255of\255line \(C\255e\))108 688.8 Q F0(Mo)144 700.8 Q .3 -.15 |
| (ve t)-.15 H 2.5(ot).15 G(he end of the line.)-2.5 E(GNU Bash-4.1)72 768 |
| Q(2009 December 29)135.965 E(38)185.955 E 0 Cg EP |
| %%Page: 39 39 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF -.25(fo)108 84 S(rward\255char \(C\255f\)) |
| .25 E F0(Mo)144 96 Q .3 -.15(ve f)-.15 H(orw).15 E(ard a character)-.1 E |
| (.)-.55 E F1(backward\255char \(C\255b\))108 108 Q F0(Mo)144 120 Q .3 |
| -.15(ve b)-.15 H(ack a character).15 E(.)-.55 E F1 -.25(fo)108 132 S |
| (rward\255w).25 E(ord \(M\255f\))-.1 E F0(Mo)144 144 Q .822 -.15(ve f) |
| -.15 H(orw).15 E .522(ard to the end of the ne)-.1 F .523(xt w)-.15 F |
| 3.023(ord. W)-.1 F .523 |
| (ords are composed of alphanumeric characters \(let-)-.8 F |
| (ters and digits\).)144 156 Q F1(backward\255w)108 168 Q(ord \(M\255b\)) |
| -.1 E F0(Mo)144 180 Q 1.71 -.15(ve b)-.15 H 1.41 |
| (ack to the start of the current or pre).15 F 1.41(vious w)-.25 F 3.91 |
| (ord. W)-.1 F 1.41(ords are composed of alphanumeric)-.8 F |
| (characters \(letters and digits\).)144 192 Q F1(shell\255f)108 204 Q |
| (orward\255w)-.25 E(ord)-.1 E F0(Mo)144 216 Q .784 -.15(ve f)-.15 H(orw) |
| .15 E .484(ard to the end of the ne)-.1 F .484(xt w)-.15 F 2.984(ord. W) |
| -.1 F .484(ords are delimited by non-quoted shell metacharac-)-.8 F |
| (ters.)144 228 Q F1(shell\255backward\255w)108 240 Q(ord)-.1 E F0(Mo)144 |
| 252 Q .909 -.15(ve b)-.15 H .609(ack to the start of the current or pre) |
| .15 F .609(vious w)-.25 F 3.109(ord. W)-.1 F .608 |
| (ords are delimited by non-quoted shell)-.8 F(metacharacters.)144 264 Q |
| F1(clear\255scr)108 276 Q(een \(C\255l\))-.18 E F0 .993 |
| (Clear the screen lea)144 288 R .993 |
| (ving the current line at the top of the screen.)-.2 F -.4(Wi)5.993 G |
| .993(th an ar).4 F .993(gument, refresh the)-.18 F |
| (current line without clearing the screen.)144 300 Q F1 -.18(re)108 312 |
| S(draw\255curr).18 E(ent\255line)-.18 E F0(Refresh the current line.)144 |
| 324 Q F1(Commands f)87 340.8 Q(or Manipulating the History)-.25 E |
| (accept\255line \(Newline, Retur)108 352.8 Q(n\))-.15 E F0 .159 |
| (Accept the line re)144 364.8 R -.05(ga)-.15 G .159 |
| (rdless of where the cursor is.).05 F .158(If this line is non-empty) |
| 5.158 F 2.658(,a)-.65 G .158(dd it to the history list)-2.658 F .699 |
| (according to the state of the)144 376.8 R/F2 9/Times-Bold@0 SF |
| (HISTCONTR)3.199 E(OL)-.27 E F0 -.25(va)2.949 G 3.199(riable. If).25 F |
| .699(the line is a modi\214ed history line, then)3.199 F |
| (restore the history line to its original state.)144 388.8 Q F1(pr)108 |
| 400.8 Q -.15(ev)-.18 G(ious\255history \(C\255p\)).15 E F0 |
| (Fetch the pre)144 412.8 Q(vious command from the history list, mo)-.25 |
| E(ving back in the list.)-.15 E F1(next\255history \(C\255n\))108 424.8 |
| Q F0(Fetch the ne)144 436.8 Q(xt command from the history list, mo)-.15 |
| E(ving forw)-.15 E(ard in the list.)-.1 E F1 |
| (beginning\255of\255history \(M\255<\))108 448.8 Q F0(Mo)144 460.8 Q .3 |
| -.15(ve t)-.15 H 2.5(ot).15 G(he \214rst line in the history)-2.5 E(.) |
| -.65 E F1(end\255of\255history \(M\255>\))108 472.8 Q F0(Mo)144 484.8 Q |
| .3 -.15(ve t)-.15 H 2.5(ot).15 G(he end of the input history)-2.5 E 2.5 |
| (,i)-.65 G(.e., the line currently being entered.)-2.5 E F1 -2.29 -.18 |
| (re v)108 496.8 T(erse\255sear).08 E(ch\255history \(C\255r\))-.18 E F0 |
| 1.471(Search backw)144 508.8 R 1.471 |
| (ard starting at the current line and mo)-.1 F 1.47 |
| (ving `up' through the history as necessary)-.15 F(.)-.65 E |
| (This is an incremental search.)144 520.8 Q F1 -.25(fo)108 532.8 S |
| (rward\255sear).25 E(ch\255history \(C\255s\))-.18 E F0 1.131 |
| (Search forw)144 544.8 R 1.131(ard starting at the current line and mo) |
| -.1 F 1.132(ving `do)-.15 F 1.132(wn' through the history as necessary) |
| -.25 F(.)-.65 E(This is an incremental search.)144 556.8 Q F1 |
| (non\255incr)108 568.8 Q(emental\255r)-.18 E -2.3 -.15(ev e)-.18 H |
| (rse\255sear).15 E(ch\255history \(M\255p\))-.18 E F0 .165(Search backw) |
| 144 580.8 R .164(ard through the history starting at the current line u\ |
| sing a non-incremental search for)-.1 F 2.5(as)144 592.8 S |
| (tring supplied by the user)-2.5 E(.)-.55 E F1(non\255incr)108 604.8 Q |
| (emental\255f)-.18 E(orward\255sear)-.25 E(ch\255history \(M\255n\))-.18 |
| E F0 1.353(Search forw)144 616.8 R 1.354(ard through the history using \ |
| a non-incremental search for a string supplied by the)-.1 F(user)144 |
| 628.8 Q(.)-.55 E F1(history\255sear)108 640.8 Q(ch\255f)-.18 E(orward) |
| -.25 E F0 .249(Search forw)144 652.8 R .249(ard through the history for\ |
| the string of characters between the start of the current line)-.1 F |
| (and the point.)144 664.8 Q(This is a non-incremental search.)5 E F1 |
| (history\255sear)108 676.8 Q(ch\255backward)-.18 E F0 .95(Search backw) |
| 144 688.8 R .951(ard through the history for the string of characters b\ |
| etween the start of the current)-.1 F(line and the point.)144 700.8 Q |
| (This is a non-incremental search.)5 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(39)185.955 E 0 Cg EP |
| %%Page: 40 40 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(yank\255nth\255ar)108 84 Q 2.5(g\()-.1 G |
| <4dad43ad7929>-2.5 E F0 .622(Insert the \214rst ar)144 96 R .622 |
| (gument to the pre)-.18 F .622(vious command \(usually the second w)-.25 |
| F .622(ord on the pre)-.1 F .622(vious line\))-.25 F .794(at point.)144 |
| 108 R -.4(Wi)5.794 G .794(th an ar).4 F(gument)-.18 E/F2 10 |
| /Times-Italic@0 SF(n)3.294 E F0 3.294(,i).24 G .794(nsert the)-3.294 F |
| F2(n)3.294 E F0 .794(th w)B .794(ord from the pre)-.1 F .794 |
| (vious command \(the w)-.25 F .795(ords in the)-.1 F(pre)144 120 Q .292 |
| (vious command be)-.25 F .292(gin with w)-.15 F .291(ord 0\).)-.1 F |
| 2.791(An)5.291 G -2.25 -.15(eg a)-2.791 H(ti).15 E .591 -.15(ve a)-.25 H |
| -.18(rg).15 G .291(ument inserts the).18 F F2(n)2.791 E F0 .291(th w)B |
| .291(ord from the end of)-.1 F .281(the pre)144 132 R .281 |
| (vious command.)-.25 F .281(Once the ar)5.281 F(gument)-.18 E F2(n)2.781 |
| E F0 .281(is computed, the ar)2.781 F .281(gument is e)-.18 F .282 |
| (xtracted as if the "!)-.15 F F2(n)A F0(")A(history e)144 144 Q |
| (xpansion had been speci\214ed.)-.15 E F1(yank\255last\255ar)108 156 Q |
| 2.5(g\()-.1 G -1.667(M\255. ,)-2.5 F -1.667(M\255_ \))2.5 F F0 1.308 |
| (Insert the last ar)144 168 R 1.308(gument to the pre)-.18 F 1.307 |
| (vious command \(the last w)-.25 F 1.307(ord of the pre)-.1 F 1.307 |
| (vious history entry\).)-.25 F -.4(Wi)144 180 S .735(th an ar).4 F .735 |
| (gument, beha)-.18 F 1.035 -.15(ve ex)-.2 H .735(actly lik).15 F(e)-.1 E |
| F1(yank\255nth\255ar)3.235 E(g)-.1 E F0 5.736(.S)C(uccessi)-5.736 E |
| 1.036 -.15(ve c)-.25 H .736(alls to).15 F F1(yank\255last\255ar)3.236 E |
| (g)-.1 E F0(mo)3.236 E -.15(ve)-.15 G .728 |
| (back through the history list, inserting the last ar)144 192 R .728 |
| (gument of each line in turn.)-.18 F .728(The history e)5.728 F(xpan-) |
| -.15 E .14(sion f)144 204 R .14(acilities are used to e)-.1 F .14 |
| (xtract the last ar)-.15 F .14(gument, as if the "!$" history e)-.18 F |
| .14(xpansion had been speci-)-.15 F(\214ed.)144 216 Q F1 |
| (shell\255expand\255line \(M\255C\255e\))108 228 Q F0 .623 |
| (Expand the line as the shell does.)144 240 R .622 |
| (This performs alias and history e)5.622 F .622 |
| (xpansion as well as all of the)-.15 F(shell w)144 252 Q(ord e)-.1 E 2.5 |
| (xpansions. See)-.15 F/F3 9/Times-Bold@0 SF(HIST)2.5 E(OR)-.162 E 2.25 |
| (YE)-.315 G(XP)-2.25 E(ANSION)-.666 E F0(belo)2.25 E 2.5(wf)-.25 G |
| (or a description of history e)-2.5 E(xpansion.)-.15 E F1 |
| (history\255expand\255line \(M\255^\))108 264 Q F0 .938 |
| (Perform history e)144 276 R .939(xpansion on the current line.)-.15 F |
| (See)5.939 E F3(HIST)3.439 E(OR)-.162 E 3.189(YE)-.315 G(XP)-3.189 E |
| (ANSION)-.666 E F0(belo)3.189 E 3.439(wf)-.25 G .939(or a descrip-) |
| -3.439 F(tion of history e)144 288 Q(xpansion.)-.15 E F1(magic\255space) |
| 108 300 Q F0 1.627(Perform history e)144 312 R 1.627 |
| (xpansion on the current line and insert a space.)-.15 F(See)6.626 E F3 |
| (HIST)4.126 E(OR)-.162 E 3.876(YE)-.315 G(XP)-3.876 E(ANSION)-.666 E F0 |
| (belo)144 324 Q 2.5(wf)-.25 G(or a description of history e)-2.5 E |
| (xpansion.)-.15 E F1(alias\255expand\255line)108 336 Q F0 .394 |
| (Perform alias e)144 348 R .394(xpansion on the current line.)-.15 F |
| (See)5.395 E F3(ALIASES)2.895 E F0(abo)2.645 E .695 -.15(ve f)-.15 H |
| .395(or a description of alias e).15 F(xpan-)-.15 E(sion.)144 360 Q F1 |
| (history\255and\255alias\255expand\255line)108 372 Q F0 |
| (Perform history and alias e)144 384 Q(xpansion on the current line.) |
| -.15 E F1(insert\255last\255ar)108 396 Q(gument \(M\255.)-.1 E 2.5(,M) |
| .833 G -1.667(\255_ \))-2.5 F F0 2.5(As)144 408 S(ynon)-2.5 E(ym for) |
| -.15 E F1(yank\255last\255ar)2.5 E(g)-.1 E F0(.)A F1 |
| (operate\255and\255get\255next \(C\255o\))108 420 Q F0 .948 |
| (Accept the current line for e)144 432 R -.15(xe)-.15 G .948 |
| (cution and fetch the ne).15 F .948(xt line relati)-.15 F 1.247 -.15 |
| (ve t)-.25 H 3.447(ot).15 G .947(he current line from the)-3.447 F |
| (history for editing.)144 444 Q(An)5 E 2.5(ya)-.15 G -.18(rg)-2.5 G |
| (ument is ignored.).18 E F1 |
| (edit\255and\255execute\255command \(C\255xC\255e\))108 456 Q F0(In)144 |
| 468 Q -.2(vo)-.4 G 1.226 -.1(ke a).2 H 3.526(ne).1 G 1.026 |
| (ditor on the current command line, and e)-3.526 F -.15(xe)-.15 G 1.026 |
| (cute the result as shell commands.).15 F F1(Bash)6.026 E F0 |
| (attempts to in)144 480 Q -.2(vo)-.4 G -.1(ke).2 G F3($VISU)2.6 E(AL) |
| -.54 E/F4 9/Times-Roman@0 SF(,)A F3($EDIT)2.25 E(OR)-.162 E F4(,)A F0 |
| (and)2.25 E F2(emacs)2.5 E F0(as the editor)2.5 E 2.5(,i)-.4 G 2.5(nt) |
| -2.5 G(hat order)-2.5 E(.)-.55 E F1(Commands f)87 496.8 Q(or Changing T) |
| -.25 E(ext)-.92 E(delete\255char \(C\255d\))108 508.8 Q F0 .358 |
| (Delete the character at point.)144 520.8 R .358(If point is at the be) |
| 5.358 F .358(ginning of the line, there are no characters in the)-.15 F |
| (line, and the last character typed w)144 532.8 Q(as not bound to)-.1 E |
| F1(delete\255char)2.5 E F0 2.5(,t)C(hen return)-2.5 E F3(EOF)2.5 E F4(.) |
| A F1(backward\255delete\255char \(Rubout\))108 544.8 Q F0 .552 |
| (Delete the character behind the cursor)144 556.8 R 5.553(.W)-.55 G .553 |
| (hen gi)-5.553 F -.15(ve)-.25 G 3.053(nan).15 G .553(umeric ar)-3.053 F |
| .553(gument, sa)-.18 F .853 -.15(ve t)-.2 H .553(he deleted te).15 F |
| .553(xt on)-.15 F(the kill ring.)144 568.8 Q F1 -.25(fo)108 580.8 S |
| (rward\255backward\255delete\255char).25 E F0 .474 |
| (Delete the character under the cursor)144 592.8 R 2.974(,u)-.4 G .474 |
| (nless the cursor is at the end of the line, in which case the)-2.974 F |
| (character behind the cursor is deleted.)144 604.8 Q F1 |
| (quoted\255insert \(C\255q, C\255v\))108 616.8 Q F0 .778(Add the ne)144 |
| 628.8 R .779(xt character typed to the line v)-.15 F 3.279 |
| (erbatim. This)-.15 F .779(is ho)3.279 F 3.279(wt)-.25 G 3.279(oi)-3.279 |
| G .779(nsert characters lik)-3.279 F(e)-.1 E F1(C\255q)3.279 E F0 3.279 |
| (,f)C(or)-3.279 E -.15(ex)144 640.8 S(ample.).15 E F1 |
| (tab\255insert \(C\255v T)108 652.8 Q(AB\))-.9 E F0 |
| (Insert a tab character)144 664.8 Q(.)-.55 E F1 |
| (self\255insert \(a, b, A, 1, !, ...\))108 676.8 Q F0 |
| (Insert the character typed.)144 688.8 Q F1 |
| (transpose\255chars \(C\255t\))108 700.8 Q F0 .322 |
| (Drag the character before point forw)144 712.8 R .321(ard o)-.1 F -.15 |
| (ve)-.15 G 2.821(rt).15 G .321(he character at point, mo)-2.821 F .321 |
| (ving point forw)-.15 F .321(ard as well.)-.1 F 1.182 |
| (If point is at the end of the line, then this transposes the tw)144 |
| 724.8 R 3.683(oc)-.1 G 1.183(haracters before point.)-3.683 F(Ne)6.183 E |
| -.05(ga)-.15 G(ti).05 E -.15(ve)-.25 G(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(40)185.955 E 0 Cg EP |
| %%Page: 41 41 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(ar)144 84 Q(guments ha)-.18 E .3 -.15(ve n)-.2 H 2.5(oe).15 G |
| -.25(ff)-2.5 G(ect.).25 E/F1 10/Times-Bold@0 SF(transpose\255w)108 96 Q |
| (ords \(M\255t\))-.1 E F0 .024(Drag the w)144 108 R .024 |
| (ord before point past the w)-.1 F .023(ord after point, mo)-.1 F .023 |
| (ving point o)-.15 F -.15(ve)-.15 G 2.523(rt).15 G .023(hat w)-2.523 F |
| .023(ord as well.)-.1 F .023(If point)5.023 F |
| (is at the end of the line, this transposes the last tw)144 120 Q 2.5 |
| (ow)-.1 G(ords on the line.)-2.6 E F1(upcase\255w)108 132 Q |
| (ord \(M\255u\))-.1 E F0 1.698(Uppercase the current \(or follo)144 144 |
| R 1.698(wing\) w)-.25 F 4.198(ord. W)-.1 F 1.698(ith a ne)-.4 F -.05(ga) |
| -.15 G(ti).05 E 1.999 -.15(ve a)-.25 H -.18(rg).15 G 1.699 |
| (ument, uppercase the pre).18 F(vious)-.25 E -.1(wo)144 156 S(rd, b).1 E |
| (ut do not mo)-.2 E .3 -.15(ve p)-.15 H(oint.).15 E F1(do)108 168 Q |
| (wncase\255w)-.1 E(ord \(M\255l\))-.1 E F0(Lo)144 180 Q 1.648 |
| (wercase the current \(or follo)-.25 F 1.648(wing\) w)-.25 F 4.148 |
| (ord. W)-.1 F 1.647(ith a ne)-.4 F -.05(ga)-.15 G(ti).05 E 1.947 -.15 |
| (ve a)-.25 H -.18(rg).15 G 1.647(ument, lo).18 F 1.647(wercase the pre) |
| -.25 F(vious)-.25 E -.1(wo)144 192 S(rd, b).1 E(ut do not mo)-.2 E .3 |
| -.15(ve p)-.15 H(oint.).15 E F1(capitalize\255w)108 204 Q |
| (ord \(M\255c\))-.1 E F0 1.974(Capitalize the current \(or follo)144 216 |
| R 1.974(wing\) w)-.25 F 4.474(ord. W)-.1 F 1.974(ith a ne)-.4 F -.05(ga) |
| -.15 G(ti).05 E 2.274 -.15(ve a)-.25 H -.18(rg).15 G 1.975 |
| (ument, capitalize the pre).18 F(vious)-.25 E -.1(wo)144 228 S(rd, b).1 |
| E(ut do not mo)-.2 E .3 -.15(ve p)-.15 H(oint.).15 E F1 -.1(ove)108 240 |
| S(rwrite\255mode).1 E F0 -.8(To)144 252 S .438(ggle o).8 F -.15(ve)-.15 |
| G .438(rwrite mode.).15 F -.4(Wi)5.438 G .438(th an e).4 F .438 |
| (xplicit positi)-.15 F .737 -.15(ve n)-.25 H .437(umeric ar).15 F .437 |
| (gument, switches to o)-.18 F -.15(ve)-.15 G .437(rwrite mode.).15 F -.4 |
| (Wi)144 264 S .78(th an e).4 F .781(xplicit non-positi)-.15 F 1.081 -.15 |
| (ve n)-.25 H .781(umeric ar).15 F .781(gument, switches to insert mode.) |
| -.18 F .781(This command af)5.781 F(fects)-.25 E(only)144 276 Q F1 |
| (emacs)4.395 E F0(mode;)4.395 E F1(vi)4.395 E F0 1.894(mode does o)4.395 |
| F -.15(ve)-.15 G 1.894(rwrite dif).15 F(ferently)-.25 E 6.894(.E)-.65 G |
| 1.894(ach call to)-6.894 F/F2 10/Times-Italic@0 SF -.37(re)4.394 G |
| (adline\(\)).37 E F0 1.894(starts in insert)4.394 F 3.968(mode. In)144 |
| 288 R -.15(ove)3.968 G 1.468(rwrite mode, characters bound to).15 F F1 |
| (self\255insert)3.969 E F0 1.469(replace the te)3.969 F 1.469 |
| (xt at point rather than)-.15 F .958(pushing the te)144 300 R .958 |
| (xt to the right.)-.15 F .957(Characters bound to)5.958 F F1 |
| (backward\255delete\255char)3.457 E F0 .957(replace the character)3.457 |
| F(before point with a space.)144 312 Q(By def)5 E |
| (ault, this command is unbound.)-.1 E F1(Killing and Y)87 328.8 Q |
| (anking)-.85 E(kill\255line \(C\255k\))108 340.8 Q F0(Kill the te)144 |
| 352.8 Q(xt from point to the end of the line.)-.15 E F1 |
| (backward\255kill\255line \(C\255x Rubout\))108 364.8 Q F0(Kill backw) |
| 144 376.8 Q(ard to the be)-.1 E(ginning of the line.)-.15 E F1 |
| (unix\255line\255discard \(C\255u\))108 388.8 Q F0(Kill backw)144 400.8 |
| Q(ard from point to the be)-.1 E(ginning of the line.)-.15 E |
| (The killed te)5 E(xt is sa)-.15 E -.15(ve)-.2 G 2.5(do).15 G 2.5(nt) |
| -2.5 G(he kill-ring.)-2.5 E F1(kill\255whole\255line)108 412.8 Q F0 |
| (Kill all characters on the current line, no matter where point is.)144 |
| 424.8 Q F1(kill\255w)108 436.8 Q(ord \(M\255d\))-.1 E F0 .728 |
| (Kill from point to the end of the current w)144 448.8 R .729 |
| (ord, or if between w)-.1 F .729(ords, to the end of the ne)-.1 F .729 |
| (xt w)-.15 F(ord.)-.1 E -.8(Wo)144 460.8 S |
| (rd boundaries are the same as those used by).8 E F1 -.25(fo)2.5 G |
| (rward\255w).25 E(ord)-.1 E F0(.)A F1(backward\255kill\255w)108 472.8 Q |
| (ord \(M\255Rubout\))-.1 E F0(Kill the w)144 484.8 Q(ord behind point.) |
| -.1 E -.8(Wo)5 G(rd boundaries are the same as those used by).8 E F1 |
| (backward\255w)2.5 E(ord)-.1 E F0(.)A F1(shell\255kill\255w)108 496.8 Q |
| (ord \(M\255d\))-.1 E F0 .729 |
| (Kill from point to the end of the current w)144 508.8 R .728 |
| (ord, or if between w)-.1 F .728(ords, to the end of the ne)-.1 F .728 |
| (xt w)-.15 F(ord.)-.1 E -.8(Wo)144 520.8 S |
| (rd boundaries are the same as those used by).8 E F1(shell\255f)2.5 E |
| (orward\255w)-.25 E(ord)-.1 E F0(.)A F1(shell\255backward\255kill\255w) |
| 108 532.8 Q(ord \(M\255Rubout\))-.1 E F0 3.025(Kill the w)144 544.8 R |
| 3.025(ord behind point.)-.1 F -.8(Wo)8.025 G 3.025 |
| (rd boundaries are the same as those used by).8 F F1(shell\255back-) |
| 5.525 E(ward\255w)144 556.8 Q(ord)-.1 E F0(.)A F1(unix\255w)108 568.8 Q |
| (ord\255rubout \(C\255w\))-.1 E F0 .365(Kill the w)144 580.8 R .365 |
| (ord behind point, using white space as a w)-.1 F .364(ord boundary)-.1 |
| F 5.364(.T)-.65 G .364(he killed te)-5.364 F .364(xt is sa)-.15 F -.15 |
| (ve)-.2 G 2.864(do).15 G 2.864(nt)-2.864 G(he)-2.864 E(kill-ring.)144 |
| 592.8 Q F1(unix\255\214lename\255rubout)108 604.8 Q F0 .166(Kill the w) |
| 144 616.8 R .166 |
| (ord behind point, using white space and the slash character as the w) |
| -.1 F .167(ord boundaries.)-.1 F(The)5.167 E(killed te)144 628.8 Q |
| (xt is sa)-.15 E -.15(ve)-.2 G 2.5(do).15 G 2.5(nt)-2.5 G(he kill-ring.) |
| -2.5 E F1(delete\255horizontal\255space \(M\255\\\))108 640.8 Q F0 |
| (Delete all spaces and tabs around point.)144 652.8 Q F1(kill\255r)108 |
| 664.8 Q(egion)-.18 E F0(Kill the te)144 676.8 Q(xt in the current re) |
| -.15 E(gion.)-.15 E F1(copy\255r)108 688.8 Q(egion\255as\255kill)-.18 E |
| F0(Cop)144 700.8 Q 2.5(yt)-.1 G(he te)-2.5 E(xt in the re)-.15 E |
| (gion to the kill b)-.15 E(uf)-.2 E(fer)-.25 E(.)-.55 E(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(41)185.955 E 0 Cg EP |
| %%Page: 42 42 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(copy\255backward\255w)108 84 Q(ord)-.1 E F0 |
| (Cop)144 96 Q 4.801(yt)-.1 G 2.301(he w)-4.801 F 2.301 |
| (ord before point to the kill b)-.1 F(uf)-.2 E(fer)-.25 E 7.301(.T)-.55 |
| G 2.301(he w)-7.301 F 2.3(ord boundaries are the same as)-.1 F F1(back-) |
| 4.8 E(ward\255w)144 108 Q(ord)-.1 E F0(.)A F1(copy\255f)108 120 Q |
| (orward\255w)-.25 E(ord)-.1 E F0(Cop)144 132 Q 4.507(yt)-.1 G 2.007 |
| (he w)-4.507 F 2.007(ord follo)-.1 F 2.007(wing point to the kill b)-.25 |
| F(uf)-.2 E(fer)-.25 E 7.008(.T)-.55 G 2.008(he w)-7.008 F 2.008 |
| (ord boundaries are the same as)-.1 F F1 -.25(fo)4.508 G -.37(r-).25 G |
| (ward\255w)144 144 Q(ord)-.1 E F0(.)A F1(yank \(C\255y\))108 156 Q F0 -1 |
| (Ya)144 168 S(nk the top of the kill ring into the b)1 E(uf)-.2 E |
| (fer at point.)-.25 E F1(yank\255pop \(M\255y\))108 180 Q F0 |
| (Rotate the kill ring, and yank the ne)144 192 Q 2.5(wt)-.25 G 2.5 |
| (op. Only)-2.5 F -.1(wo)2.5 G(rks follo).1 E(wing)-.25 E F1(yank)2.5 E |
| F0(or)2.5 E F1(yank\255pop)2.5 E F0(.)A F1(Numeric Ar)87 208.8 Q |
| (guments)-.1 E(digit\255ar)108 220.8 Q |
| (gument \(M\2550, M\2551, ..., M\255\255\))-.1 E F0 .642 |
| (Add this digit to the ar)144 232.8 R .641 |
| (gument already accumulating, or start a ne)-.18 F 3.141(wa)-.25 G -.18 |
| (rg)-3.141 G 3.141(ument. M\255\255).18 F .641(starts a ne)3.141 F(g-) |
| -.15 E(ati)144 244.8 Q .3 -.15(ve a)-.25 H -.18(rg).15 G(ument.).18 E F1 |
| (uni)108 256.8 Q -.1(ve)-.1 G(rsal\255ar).1 E(gument)-.1 E F0 .778 |
| (This is another w)144 268.8 R .779(ay to specify an ar)-.1 F 3.279 |
| (gument. If)-.18 F .779(this command is follo)3.279 F .779 |
| (wed by one or more digits,)-.25 F 1.376 |
| (optionally with a leading minus sign, those digits de\214ne the ar)144 |
| 280.8 R 3.876(gument. If)-.18 F 1.376(the command is fol-)3.876 F(lo)144 |
| 292.8 Q 1.17(wed by digits, e)-.25 F -.15(xe)-.15 G(cuting).15 E F1(uni) |
| 3.67 E -.1(ve)-.1 G(rsal\255ar).1 E(gument)-.1 E F0(ag)3.67 E 1.17 |
| (ain ends the numeric ar)-.05 F 1.17(gument, b)-.18 F 1.17(ut is other) |
| -.2 F(-)-.2 E .899(wise ignored.)144 304.8 R .898 |
| (As a special case, if this command is immediately follo)5.899 F .898 |
| (wed by a character that is)-.25 F .243 |
| (neither a digit or minus sign, the ar)144 316.8 R .243 |
| (gument count for the ne)-.18 F .243(xt command is multiplied by four) |
| -.15 F 5.243(.T)-.55 G(he)-5.243 E(ar)144 328.8 Q .378 |
| (gument count is initially one, so e)-.18 F -.15(xe)-.15 G .378 |
| (cuting this function the \214rst time mak).15 F .378(es the ar)-.1 F |
| .378(gument count)-.18 F(four)144 340.8 Q 2.5(,as)-.4 G(econd time mak) |
| -2.5 E(es the ar)-.1 E(gument count sixteen, and so on.)-.18 E F1 |
| (Completing)87 357.6 Q(complete \(T)108 369.6 Q(AB\))-.9 E F0 1.137 |
| (Attempt to perform completion on the te)144 381.6 R 1.137 |
| (xt before point.)-.15 F F1(Bash)6.137 E F0 1.137 |
| (attempts completion treating the)3.637 F(te)144 393.6 Q .533(xt as a v) |
| -.15 F .533(ariable \(if the te)-.25 F .533(xt be)-.15 F .533(gins with) |
| -.15 F F1($)3.033 E F0 .533(\), username \(if the te)B .532(xt be)-.15 F |
| .532(gins with)-.15 F F1(~)3.032 E F0 .532(\), hostname \(if the)B(te) |
| 144 405.6 Q .701(xt be)-.15 F .701(gins with)-.15 F F1(@)3.201 E F0 .701 |
| (\), or command \(including aliases and functions\) in turn.)B .702 |
| (If none of these pro-)5.701 F |
| (duces a match, \214lename completion is attempted.)144 417.6 Q F1 |
| (possible\255completions \(M\255?\))108 429.6 Q F0 |
| (List the possible completions of the te)144 441.6 Q(xt before point.) |
| -.15 E F1(insert\255completions \(M\255*\))108 453.6 Q F0 .783 |
| (Insert all completions of the te)144 465.6 R .783 |
| (xt before point that w)-.15 F .783(ould ha)-.1 F 1.083 -.15(ve b)-.2 H |
| .783(een generated by).15 F F1(possible\255com-)3.282 E(pletions)144 |
| 477.6 Q F0(.)A F1(menu\255complete)108 489.6 Q F0 .928(Similar to)144 |
| 501.6 R F1(complete)3.428 E F0 3.428(,b)C .929(ut replaces the w)-3.628 |
| F .929(ord to be completed with a single match from the list of)-.1 F |
| 1.194(possible completions.)144 513.6 R 1.194(Repeated e)6.194 F -.15 |
| (xe)-.15 G 1.194(cution of).15 F F1(menu\255complete)3.694 E F0 1.193 |
| (steps through the list of possible)3.694 F .828 |
| (completions, inserting each match in turn.)144 525.6 R .828 |
| (At the end of the list of completions, the bell is rung)5.828 F .727 |
| (\(subject to the setting of)144 537.6 R F1(bell\255style)3.227 E F0 |
| 3.227(\)a)C .727(nd the original te)-3.227 F .727(xt is restored.)-.15 F |
| .727(An ar)5.727 F .727(gument of)-.18 F/F2 10/Times-Italic@0 SF(n)3.227 |
| E F0(mo)3.227 E -.15(ve)-.15 G(s).15 E F2(n)3.227 E F0 1.73 |
| (positions forw)144 549.6 R 1.73(ard in the list of matches; a ne)-.1 F |
| -.05(ga)-.15 G(ti).05 E 2.03 -.15(ve a)-.25 H -.18(rg).15 G 1.73 |
| (ument may be used to mo).18 F 2.03 -.15(ve b)-.15 H(ackw).15 E(ard)-.1 |
| E(through the list.)144 561.6 Q(This command is intended to be bound to) |
| 5 E F1 -.9(TA)2.5 G(B).9 E F0 2.5(,b)C(ut is unbound by def)-2.7 E |
| (ault.)-.1 E F1(menu\255complete-)108 573.6 Q(w)10 I(k)-7.22 -10 M(c) |
| -5.56 -10 M(rd)2.78 10 M F0 .82(Identical to)144 585.6 R F1 |
| (menu\255complete)3.32 E F0 3.32(,b)C .82(ut mo)-3.52 F -.15(ve)-.15 G |
| 3.32(sb).15 G(ackw)-3.32 E .82 |
| (ard through the list of possible completions, as if)-.1 F F1 |
| (menu\255complete)144 597.6 Q F0(had been gi)2.5 E -.15(ve)-.25 G 2.5 |
| (nan).15 G -2.25 -.15(eg a)-2.5 H(ti).15 E .3 -.15(ve a)-.25 H -.18(rg) |
| .15 G 2.5(ument. This).18 F(command is unbound by def)2.5 E(ault.)-.1 E |
| F1(delete\255char\255or\255list)108 609.6 Q F0 .234 |
| (Deletes the character under the cursor if not at the be)144 621.6 R |
| .234(ginning or end of the line \(lik)-.15 F(e)-.1 E F1(delete\255char) |
| 2.735 E F0(\).)A .425(If at the end of the line, beha)144 633.6 R -.15 |
| (ve)-.2 G 2.925(si).15 G .425(dentically to)-2.925 F F1 |
| (possible\255completions)2.925 E F0 5.425(.T)C .425 |
| (his command is unbound)-5.425 F(by def)144 645.6 Q(ault.)-.1 E F1 |
| (complete\255\214lename \(M\255/\))108 657.6 Q F0 |
| (Attempt \214lename completion on the te)144 669.6 Q(xt before point.) |
| -.15 E F1(possible\255\214lename\255completions \(C\255x /\))108 681.6 Q |
| F0(List the possible completions of the te)144 693.6 Q |
| (xt before point, treating it as a \214lename.)-.15 E F1 |
| (complete\255user)108 705.6 Q(name \(M\255~\))-.15 E F0 |
| (Attempt completion on the te)144 717.6 Q |
| (xt before point, treating it as a username.)-.15 E(GNU Bash-4.1)72 768 |
| Q(2009 December 29)135.965 E(42)185.955 E 0 Cg EP |
| %%Page: 43 43 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(possible\255user)108 84 Q |
| (name\255completions \(C\255x ~\))-.15 E F0 |
| (List the possible completions of the te)144 96 Q |
| (xt before point, treating it as a username.)-.15 E F1(complete\255v)108 |
| 108 Q(ariable \(M\255$\))-.1 E F0(Attempt completion on the te)144 120 Q |
| (xt before point, treating it as a shell v)-.15 E(ariable.)-.25 E F1 |
| (possible\255v)108 132 Q(ariable\255completions \(C\255x $\))-.1 E F0 |
| (List the possible completions of the te)144 144 Q |
| (xt before point, treating it as a shell v)-.15 E(ariable.)-.25 E F1 |
| (complete\255hostname \(M\255@\))108 156 Q F0 |
| (Attempt completion on the te)144 168 Q |
| (xt before point, treating it as a hostname.)-.15 E F1 |
| (possible\255hostname\255completions \(C\255x @\))108 180 Q F0 |
| (List the possible completions of the te)144 192 Q |
| (xt before point, treating it as a hostname.)-.15 E F1 |
| (complete\255command \(M\255!\))108 204 Q F0 .58 |
| (Attempt completion on the te)144 216 R .581 |
| (xt before point, treating it as a command name.)-.15 F .581 |
| (Command comple-)5.581 F .715(tion attempts to match the te)144 228 R |
| .715(xt ag)-.15 F .715(ainst aliases, reserv)-.05 F .715(ed w)-.15 F |
| .715(ords, shell functions, shell b)-.1 F .715(uiltins, and)-.2 F |
| (\214nally e)144 240 Q -.15(xe)-.15 G |
| (cutable \214lenames, in that order).15 E(.)-.55 E F1 |
| (possible\255command\255completions \(C\255x !\))108 252 Q F0 |
| (List the possible completions of the te)144 264 Q |
| (xt before point, treating it as a command name.)-.15 E F1 |
| (dynamic\255complete\255history \(M\255T)108 276 Q(AB\))-.9 E F0 .424 |
| (Attempt completion on the te)144 288 R .425 |
| (xt before point, comparing the te)-.15 F .425(xt ag)-.15 F .425 |
| (ainst lines from the history list)-.05 F |
| (for possible completion matches.)144 300 Q F1(dab)108 312 Q(br)-.1 E |
| -.15(ev)-.18 G(\255expand).15 E F0 .611 |
| (Attempt menu completion on the te)144 324 R .611 |
| (xt before point, comparing the te)-.15 F .61(xt ag)-.15 F .61 |
| (ainst lines from the his-)-.05 F |
| (tory list for possible completion matches.)144 336 Q F1 |
| (complete\255into\255braces \(M\255{\))108 348 Q F0 .4(Perform \214lena\ |
| me completion and insert the list of possible completions enclosed with\ |
| in braces so)144 360 R(the list is a)144 372 Q -.25(va)-.2 G |
| (ilable to the shell \(see).25 E F1(Brace Expansion)2.5 E F0(abo)2.5 E |
| -.15(ve)-.15 G(\).).15 E F1 -.25(Ke)87 388.8 S(yboard Macr).25 E(os)-.18 |
| E(start\255kbd\255macr)108 400.8 Q 2.5(o\()-.18 G(C\255x \()-2.5 E(\)) |
| .833 E F0(Be)144 412.8 Q(gin sa)-.15 E |
| (ving the characters typed into the current k)-.2 E -.15(ey)-.1 G |
| (board macro.).15 E F1(end\255kbd\255macr)108 424.8 Q 2.5(o\()-.18 G |
| (C\255x \))-2.5 E(\)).833 E F0(Stop sa)144 436.8 Q |
| (ving the characters typed into the current k)-.2 E -.15(ey)-.1 G |
| (board macro and store the de\214nition.).15 E F1 |
| (call\255last\255kbd\255macr)108 448.8 Q 2.5(o\()-.18 G(C\255x e\))-2.5 |
| E F0(Re-e)144 460.8 Q -.15(xe)-.15 G 1(cute the last k).15 F -.15(ey)-.1 |
| G .999(board macro de\214ned, by making the characters in the macro app\ |
| ear as if).15 F(typed at the k)144 472.8 Q -.15(ey)-.1 G(board.).15 E F1 |
| (Miscellaneous)87 489.6 Q -.18(re)108 501.6 S<ad72>.18 E |
| (ead\255init\255\214le \(C\255x C\255r\))-.18 E F0 1.776 |
| (Read in the contents of the)144 513.6 R/F2 10/Times-Italic@0 SF(inputr) |
| 4.276 E(c)-.37 E F0 1.777(\214le, and incorporate an)4.276 F 4.277(yb) |
| -.15 G 1.777(indings or v)-4.277 F 1.777(ariable assignments)-.25 F |
| (found there.)144 525.6 Q F1(abort \(C\255g\))108 537.6 Q F0 3.249 |
| (Abort the current editing command and ring the terminal')144 549.6 R |
| 5.748(sb)-.55 G 3.248(ell \(subject to the setting of)-5.748 F F1 |
| (bell\255style)144 561.6 Q F0(\).)A F1(do\255upper)108 573.6 Q |
| (case\255v)-.18 E(ersion \(M\255a, M\255b, M\255)-.1 E F2(x)A F1 2.5(,.) |
| C(..\))-2.5 E F0 1.755(If the meta\214ed character)144 585.6 R F2(x) |
| 4.255 E F0 1.755(is lo)4.255 F 1.756 |
| (wercase, run the command that is bound to the corresponding)-.25 F |
| (uppercase character)144 597.6 Q(.)-.55 E F1(pr)108 609.6 Q |
| (e\214x\255meta \(ESC\))-.18 E F0(Metafy the ne)144 621.6 Q |
| (xt character typed.)-.15 E/F3 9/Times-Bold@0 SF(ESC)5 E F1(f)2.25 E F0 |
| (is equi)2.5 E -.25(va)-.25 G(lent to).25 E F1(Meta\255f)2.5 E F0(.)A F1 |
| (undo \(C\255_, C\255x C\255u\))108 633.6 Q F0 |
| (Incremental undo, separately remembered for each line.)144 645.6 Q F1 |
| -2.29 -.18(re v)108 657.6 T(ert\255line \(M\255r\)).08 E F0 1.095 |
| (Undo all changes made to this line.)144 669.6 R 1.095(This is lik)6.095 |
| F 3.595(ee)-.1 G -.15(xe)-3.745 G 1.095(cuting the).15 F F1(undo)3.595 E |
| F0 1.095(command enough times to)3.595 F |
| (return the line to its initial state.)144 681.6 Q F1 |
| (tilde\255expand \(M\255&\))108 693.6 Q F0(Perform tilde e)144 705.6 Q |
| (xpansion on the current w)-.15 E(ord.)-.1 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(43)185.955 E 0 Cg EP |
| %%Page: 44 44 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(set\255mark \(C\255@, M\255<space>\))108 84 |
| Q F0(Set the mark to the point.)144 96 Q(If a numeric ar)5 E |
| (gument is supplied, the mark is set to that position.)-.18 E F1 |
| (exchange\255point\255and\255mark \(C\255x C\255x\))108 108 Q F0(Sw)144 |
| 120 Q .282(ap the point with the mark.)-.1 F .283 |
| (The current cursor position is set to the sa)5.283 F -.15(ve)-.2 G |
| 2.783(dp).15 G .283(osition, and the old)-2.783 F(cursor position is sa) |
| 144 132 Q -.15(ve)-.2 G 2.5(da).15 G 2.5(st)-2.5 G(he mark.)-2.5 E F1 |
| (character\255sear)108 144 Q(ch \(C\255]\))-.18 E F0 3.036(Ac)144 156 S |
| .536(haracter is read and point is mo)-3.036 F -.15(ve)-.15 G 3.035(dt) |
| .15 G 3.035(ot)-3.035 G .535(he ne)-3.035 F .535 |
| (xt occurrence of that character)-.15 F 5.535(.A)-.55 G(ne)-2.5 E -.05 |
| (ga)-.15 G(ti).05 E .835 -.15(ve c)-.25 H(ount).15 E(searches for pre) |
| 144 168 Q(vious occurrences.)-.25 E F1(character\255sear)108 180 Q |
| (ch\255backward \(M\255C\255]\))-.18 E F0 3.543(Ac)144 192 S 1.043 |
| (haracter is read and point is mo)-3.543 F -.15(ve)-.15 G 3.544(dt).15 G |
| 3.544(ot)-3.544 G 1.044(he pre)-3.544 F 1.044 |
| (vious occurrence of that character)-.25 F 6.044(.A)-.55 G(ne)-2.5 E |
| -.05(ga)-.15 G(ti).05 E -.15(ve)-.25 G |
| (count searches for subsequent occurrences.)144 204 Q F1 |
| (skip\255csi\255sequence \(\))108 216 Q F0 1.827 |
| (Read enough characters to consume a multi-k)144 228 R 2.126 -.15(ey s) |
| -.1 H 1.826(equence such as those de\214ned for k).15 F -.15(ey)-.1 G |
| 4.326(sl).15 G(ik)-4.326 E(e)-.1 E .79(Home and End.)144 240 R .791 |
| (Such sequences be)5.79 F .791 |
| (gin with a Control Sequence Indicator \(CSI\), usually ESC\255[.)-.15 F |
| .332(If this sequence is bound to "\\[", k)144 252 R -.15(ey)-.1 G 2.831 |
| (sp).15 G .331(roducing such sequences will ha)-2.831 F .631 -.15(ve n) |
| -.2 H 2.831(oe).15 G -.25(ff)-2.831 G .331(ect unless e).25 F(xplic-) |
| -.15 E .026(itly bound to a readline command, instead of inserting stra\ |
| y characters into the editing b)144 264 R(uf)-.2 E(fer)-.25 E 5.026(.T) |
| -.55 G(his)-5.026 E(is unbound by def)144 276 Q(ault, b)-.1 E |
| (ut usually bound to ESC\255[.)-.2 E F1(insert\255comment \(M\255#\))108 |
| 288 Q F0 -.4(Wi)144 300 S .481(thout a numeric ar).4 F .481 |
| (gument, the v)-.18 F .481(alue of the readline)-.25 F F1 |
| (comment\255begin)2.981 E F0 -.25(va)2.981 G .48 |
| (riable is inserted at the).25 F(be)144 312 Q .097 |
| (ginning of the current line.)-.15 F .098(If a numeric ar)5.097 F .098 |
| (gument is supplied, this command acts as a toggle:)-.18 F(if)5.098 E |
| .322(the characters at the be)144 324 R .321 |
| (ginning of the line do not match the v)-.15 F .321(alue of)-.25 F F1 |
| (comment\255begin)2.821 E F0 2.821(,t)C .321(he v)-2.821 F .321(alue is) |
| -.25 F .831(inserted, otherwise the characters in)144 336 R F1 |
| (comment\255begin)3.331 E F0 .832(are deleted from the be)3.331 F .832 |
| (ginning of the line.)-.15 F 1.469 |
| (In either case, the line is accepted as if a ne)144 348 R 1.468 |
| (wline had been typed.)-.25 F 1.468(The def)6.468 F 1.468(ault v)-.1 F |
| 1.468(alue of)-.25 F F1(com-)3.968 E(ment\255begin)144 360 Q F0 .839 |
| (causes this command to mak)3.339 F 3.339(et)-.1 G .839 |
| (he current line a shell comment.)-3.339 F .84(If a numeric ar)5.84 F |
| (gu-)-.18 E(ment causes the comment character to be remo)144 372 Q -.15 |
| (ve)-.15 G(d, the line will be e).15 E -.15(xe)-.15 G |
| (cuted by the shell.).15 E F1(glob\255complete\255w)108 384 Q |
| (ord \(M\255g\))-.1 E F0 .792(The w)144 396 R .791 |
| (ord before point is treated as a pattern for pathname e)-.1 F .791 |
| (xpansion, with an asterisk implicitly)-.15 F 2.5(appended. This)144 408 |
| R(pattern is used to generate a list of matching \214le names for possi\ |
| ble completions.)2.5 E F1(glob\255expand\255w)108 420 Q |
| (ord \(C\255x *\))-.1 E F0 .371(The w)144 432 R .372 |
| (ord before point is treated as a pattern for pathname e)-.1 F .372 |
| (xpansion, and the list of matching \214le)-.15 F .516 |
| (names is inserted, replacing the w)144 444 R 3.016(ord. If)-.1 F 3.016 |
| (an)3.016 G .516(umeric ar)-3.016 F .516 |
| (gument is supplied, an asterisk is appended)-.18 F(before pathname e) |
| 144 456 Q(xpansion.)-.15 E F1(glob\255list\255expansions \(C\255x g\)) |
| 108 468 Q F0 .923(The list of e)144 480 R .923(xpansions that w)-.15 F |
| .923(ould ha)-.1 F 1.223 -.15(ve b)-.2 H .923(een generated by).15 F F1 |
| (glob\255expand\255w)3.423 E(ord)-.1 E F0 .923(is displayed, and)3.423 F |
| .872(the line is redra)144 492 R 3.372(wn. If)-.15 F 3.372(an)3.372 G |
| .872(umeric ar)-3.372 F .872 |
| (gument is supplied, an asterisk is appended before pathname)-.18 F -.15 |
| (ex)144 504 S(pansion.).15 E F1(dump\255functions)108 516 Q F0 .626 |
| (Print all of the functions and their k)144 528 R .926 -.15(ey b)-.1 H |
| .627(indings to the readline output stream.).15 F .627(If a numeric ar) |
| 5.627 F(gu-)-.18 E |
| (ment is supplied, the output is formatted in such a w)144 540 Q |
| (ay that it can be made part of an)-.1 E/F2 10/Times-Italic@0 SF(inputr) |
| 2.5 E(c)-.37 E F0(\214le.)2.5 E F1(dump\255v)108 552 Q(ariables)-.1 E F0 |
| 1.8(Print all of the settable readline v)144 564 R 1.799 |
| (ariables and their v)-.25 F 1.799(alues to the readline output stream.) |
| -.25 F 1.799(If a)6.799 F .304(numeric ar)144 576 R .304 |
| (gument is supplied, the output is formatted in such a w)-.18 F .304 |
| (ay that it can be made part of an)-.1 F F2(inputr)144 588 Q(c)-.37 E F0 |
| (\214le.)2.5 E F1(dump\255macr)108 600 Q(os)-.18 E F0 .593 |
| (Print all of the readline k)144 612 R .893 -.15(ey s)-.1 H .592 |
| (equences bound to macros and the strings the).15 F 3.092(yo)-.15 G |
| 3.092(utput. If)-3.092 F 3.092(an)3.092 G(umeric)-3.092 E(ar)144 624 Q |
| .528(gument is supplied, the output is formatted in such a w)-.18 F .528 |
| (ay that it can be made part of an)-.1 F F2(inputr)3.028 E(c)-.37 E F0 |
| (\214le.)144 636 Q F1(display\255shell\255v)108 648 Q |
| (ersion \(C\255x C\255v\))-.1 E F0(Display v)144 660 Q |
| (ersion information about the current instance of)-.15 E F1(bash)2.5 E |
| F0(.)A F1(Pr)87 676.8 Q(ogrammable Completion)-.18 E F0 .147(When w)108 |
| 688.8 R .147(ord completion is attempted for an ar)-.1 F .147 |
| (gument to a command for which a completion speci\214cation \(a)-.18 F |
| F2(compspec)108 700.8 Q F0 3.828(\)h)C 1.329 |
| (as been de\214ned using the)-3.828 F F1(complete)3.829 E F0 -.2(bu) |
| 3.829 G 1.329(iltin \(see).2 F/F3 9/Times-Bold@0 SF 1.329(SHELL B)3.829 |
| F(UIL)-.09 E 1.329(TIN COMMANDS)-.828 F F0(belo)3.579 E 1.329(w\), the) |
| -.25 F(programmable completion f)108 712.8 Q(acilities are in)-.1 E -.2 |
| (vo)-.4 G -.1(ke).2 G(d.).1 E .498 |
| (First, the command name is identi\214ed.)108 729.6 R .498 |
| (If the command w)5.498 F .497 |
| (ord is the empty string \(completion attempted at)-.1 F(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(44)185.955 E 0 Cg EP |
| %%Page: 45 45 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .233(the be)108 84 R .233(ginning of an empty line\), an)-.15 F |
| 2.733(yc)-.15 G .233(ompspec de\214ned with the)-2.733 F/F1 10 |
| /Times-Bold@0 SF<ad45>2.733 E F0 .233(option to)2.733 F F1(complete) |
| 2.733 E F0 .233(is used.)2.733 F .234(If a comp-)5.234 F .481(spec has \ |
| been de\214ned for that command, the compspec is used to generate the l\ |
| ist of possible completions)108 96 R .822(for the w)108 108 R 3.322 |
| (ord. If)-.1 F .822(the command w)3.322 F .823(ord is a full pathname, \ |
| a compspec for the full pathname is searched for)-.1 F 2.867 |
| (\214rst. If)108 120 R .366(no compspec is found for the full pathname,\ |
| an attempt is made to \214nd a compspec for the portion)2.867 F(follo) |
| 108 132 Q .421(wing the \214nal slash.)-.25 F .422 |
| (If those searches to not result in a compspec, an)5.421 F 2.922(yc)-.15 |
| G .422(ompspec de\214ned with the)-2.922 F F1<ad44>2.922 E F0(option to) |
| 108 144 Q F1(complete)2.5 E F0(is used as the def)2.5 E(ault.)-.1 E .817 |
| (Once a compspec has been found, it is used to generate the list of mat\ |
| ching w)108 160.8 R 3.317(ords. If)-.1 F 3.317(ac)3.317 G .817 |
| (ompspec is not)-3.317 F(found, the def)108 172.8 Q(ault)-.1 E F1(bash) |
| 2.5 E F0(completion as described abo)2.5 E .3 -.15(ve u)-.15 H(nder).15 |
| E F1(Completing)2.5 E F0(is performed.)2.5 E .463 |
| (First, the actions speci\214ed by the compspec are used.)108 189.6 R |
| .464(Only matches which are pre\214x)5.464 F .464(ed by the w)-.15 F |
| .464(ord being)-.1 F .596(completed are returned.)108 201.6 R .596 |
| (When the)5.596 F F1<ad66>3.096 E F0(or)3.095 E F1<ad64>3.095 E F0 .595 |
| (option is used for \214lename or directory name completion, the)3.095 F |
| (shell v)108 213.6 Q(ariable)-.25 E/F2 9/Times-Bold@0 SF(FIGNORE)2.5 E |
| F0(is used to \214lter the matches.)2.25 E(An)108 230.4 Q 4.084(yc)-.15 |
| G 1.584(ompletions speci\214ed by a pathname e)-4.084 F 1.584 |
| (xpansion pattern to the)-.15 F F1<ad47>4.084 E F0 1.584 |
| (option are generated ne)4.084 F 4.084(xt. The)-.15 F -.1(wo)108 242.4 S |
| .555(rds generated by the pattern need not match the w).1 F .554 |
| (ord being completed.)-.1 F(The)5.554 E F2(GLOBIGNORE)3.054 E F0 .554 |
| (shell v)2.804 F(ari-)-.25 E |
| (able is not used to \214lter the matches, b)108 254.4 Q(ut the)-.2 E F2 |
| (FIGNORE)2.5 E F0 -.25(va)2.25 G(riable is used.).25 E(Ne)108 271.2 Q |
| .32(xt, the string speci\214ed as the ar)-.15 F .32(gument to the)-.18 F |
| F1<ad57>2.82 E F0 .321(option is considered.)2.821 F .321 |
| (The string is \214rst split using the)5.321 F .413(characters in the) |
| 108 283.2 R F2(IFS)2.913 E F0 .412(special v)2.663 F .412 |
| (ariable as delimiters.)-.25 F .412(Shell quoting is honored.)5.412 F |
| .412(Each w)5.412 F .412(ord is then e)-.1 F(xpanded)-.15 E .091 |
| (using brace e)108 295.2 R .091(xpansion, tilde e)-.15 F .092 |
| (xpansion, parameter and v)-.15 F .092(ariable e)-.25 F .092 |
| (xpansion, command substitution, and arith-)-.15 F 1.397(metic e)108 |
| 307.2 R 1.396(xpansion, as described abo)-.15 F 1.696 -.15(ve u)-.15 H |
| (nder).15 E F2(EXP)3.896 E(ANSION)-.666 E/F3 9/Times-Roman@0 SF(.)A F0 |
| 1.396(The results are split using the rules described)5.896 F(abo)108 |
| 319.2 Q .509 -.15(ve u)-.15 H(nder).15 E F1 -.75(Wo)2.709 G .209 |
| (rd Splitting).75 F F0 5.209(.T)C .209(he results of the e)-5.209 F .209 |
| (xpansion are pre\214x-matched ag)-.15 F .21(ainst the w)-.05 F .21 |
| (ord being com-)-.1 F(pleted, and the matching w)108 331.2 Q |
| (ords become the possible completions.)-.1 E 1.238 |
| (After these matches ha)108 348 R 1.538 -.15(ve b)-.2 H 1.238 |
| (een generated, an).15 F 3.738(ys)-.15 G 1.237 |
| (hell function or command speci\214ed with the)-3.738 F F1<ad46>3.737 E |
| F0(and)3.737 E F1<ad43>3.737 E F0 3.375(options is in)108 360 R -.2(vo) |
| -.4 G -.1(ke).2 G 5.875(d. When).1 F 3.375 |
| (the command or function is in)5.875 F -.2(vo)-.4 G -.1(ke).2 G 3.375 |
| (d, the).1 F F2(COMP_LINE)5.876 E F3(,)A F2(COMP_POINT)5.626 E F3(,)A F2 |
| (COMP_KEY)108 372 Q F3(,)A F0(and)2.408 E F2(COMP_TYPE)2.658 E F0 -.25 |
| (va)2.408 G .157(riables are assigned v).25 F .157 |
| (alues as described abo)-.25 F .457 -.15(ve u)-.15 H(nder).15 E F1 .157 |
| (Shell V)2.657 F(ariables)-.92 E F0 5.157(.I)C(f)-5.157 E 3.485(as)108 |
| 384 S .986(hell function is being in)-3.485 F -.2(vo)-.4 G -.1(ke).2 G |
| .986(d, the).1 F F2(COMP_W)3.486 E(ORDS)-.09 E F0(and)3.236 E F2 |
| (COMP_CW)3.486 E(ORD)-.09 E F0 -.25(va)3.236 G .986 |
| (riables are also set.).25 F(When)5.986 E .609 |
| (the function or command is in)108 396 R -.2(vo)-.4 G -.1(ke).2 G .608 |
| (d, the \214rst ar).1 F .608(gument is the name of the command whose ar) |
| -.18 F .608(guments are)-.18 F .073(being completed, the second ar)108 |
| 408 R .073(gument is the w)-.18 F .073 |
| (ord being completed, and the third ar)-.1 F .073(gument is the w)-.18 F |
| .073(ord pre-)-.1 F .608(ceding the w)108 420 R .607 |
| (ord being completed on the current command line.)-.1 F .607 |
| (No \214ltering of the generated completions)5.607 F(ag)108 432 Q .093 |
| (ainst the w)-.05 F .093(ord being completed is performed; the function\ |
| or command has complete freedom in generat-)-.1 F(ing the matches.)108 |
| 444 Q(An)108 460.8 Q 2.938(yf)-.15 G .437(unction speci\214ed with) |
| -2.938 F F1<ad46>2.937 E F0 .437(is in)2.937 F -.2(vo)-.4 G -.1(ke).2 G |
| 2.937<648c>.1 G 2.937(rst. The)-2.937 F .437(function may use an)2.937 F |
| 2.937(yo)-.15 G 2.937(ft)-2.937 G .437(he shell f)-2.937 F .437 |
| (acilities, including)-.1 F(the)108 472.8 Q F1(compgen)2.956 E F0 -.2 |
| (bu)2.956 G .456(iltin described belo).2 F 1.756 -.65(w, t)-.25 H 2.956 |
| (og).65 G .456(enerate the matches.)-2.956 F .457 |
| (It must put the possible completions in the)5.456 F F2(COMPREPL)108 |
| 484.8 Q(Y)-.828 E F0(array v)2.25 E(ariable.)-.25 E(Ne)108 501.6 Q .081 |
| (xt, an)-.15 F 2.581(yc)-.15 G .081(ommand speci\214ed with the)-2.581 F |
| F1<ad43>2.581 E F0 .081(option is in)2.581 F -.2(vo)-.4 G -.1(ke).2 G |
| 2.581(di).1 G 2.58(na)-2.581 G 2.58(ne)-2.58 G -.4(nv)-2.58 G .08 |
| (ironment equi).4 F -.25(va)-.25 G .08(lent to command sub-).25 F 2.858 |
| (stitution. It)108 513.6 R .359(should print a list of completions, one\ |
| per line, to the standard output.)2.858 F .359(Backslash may be used) |
| 5.359 F(to escape a ne)108 525.6 Q(wline, if necessary)-.25 E(.)-.65 E |
| .377(After all of the possible completions are generated, an)108 542.4 R |
| 2.877<798c>-.15 G .377(lter speci\214ed with the)-2.877 F F1<ad58>2.876 |
| E F0 .376(option is applied to the)2.876 F 3.181(list. The)108 554.4 R |
| .681(\214lter is a pattern as used for pathname e)3.181 F .681 |
| (xpansion; a)-.15 F F1(&)3.181 E F0 .682 |
| (in the pattern is replaced with the te)3.182 F .682(xt of)-.15 F .523 |
| (the w)108 566.4 R .523(ord being completed.)-.1 F 3.023(Al)5.523 G |
| (iteral)-3.023 E F1(&)3.023 E F0 .522 |
| (may be escaped with a backslash; the backslash is remo)3.022 F -.15(ve) |
| -.15 G 3.022(db).15 G(efore)-3.022 E .849(attempting a match.)108 578.4 |
| R(An)5.849 E 3.349(yc)-.15 G .849 |
| (ompletion that matches the pattern will be remo)-3.349 F -.15(ve)-.15 G |
| 3.35(df).15 G .85(rom the list.)-3.35 F 3.35(Al)5.85 G(eading)-3.35 E F1 |
| (!)3.35 E F0(ne)108 590.4 Q -.05(ga)-.15 G |
| (tes the pattern; in this case an).05 E 2.5(yc)-.15 G |
| (ompletion not matching the pattern will be remo)-2.5 E -.15(ve)-.15 G |
| (d.).15 E(Finally)108 607.2 Q 3.087(,a)-.65 G .887 -.15(ny p)-3.087 H |
| .587(re\214x and suf).15 F .587(\214x speci\214ed with the)-.25 F F1 |
| <ad50>3.087 E F0(and)3.087 E F1<ad53>3.087 E F0 .587 |
| (options are added to each member of the com-)3.087 F(pletion list, and\ |
| the result is returned to the readline completion code as the list of \ |
| possible completions.)108 619.2 Q .246(If the pre)108 636 R .247 |
| (viously-applied actions do not generate an)-.25 F 2.747(ym)-.15 G .247 |
| (atches, and the)-2.747 F F1 .247(\255o dir)2.747 F(names)-.15 E F0 .247 |
| (option w)2.747 F .247(as supplied to)-.1 F F1(complete)108 648 Q F0 |
| (when the compspec w)2.5 E |
| (as de\214ned, directory name completion is attempted.)-.1 E .462 |
| (If the)108 664.8 R F1 .462(\255o plusdirs)2.962 F F0 .462(option w) |
| 2.962 F .462(as supplied to)-.1 F F1(complete)2.962 E F0 .462 |
| (when the compspec w)2.962 F .462(as de\214ned, directory name com-)-.1 |
| F(pletion is attempted and an)108 676.8 Q 2.5(ym)-.15 G |
| (atches are added to the results of the other actions.)-2.5 E .559 |
| (By def)108 693.6 R .559(ault, if a compspec is found, whate)-.1 F -.15 |
| (ve)-.25 G 3.059(ri).15 G 3.059(tg)-3.059 G .56 |
| (enerates is returned to the completion code as the full set)-3.059 F |
| .632(of possible completions.)108 705.6 R .632(The def)5.632 F(ault)-.1 |
| E F1(bash)3.132 E F0 .631 |
| (completions are not attempted, and the readline def)3.131 F .631 |
| (ault of \214le-)-.1 F .558(name completion is disabled.)108 717.6 R |
| .558(If the)5.558 F F1 .559(\255o bashdefault)3.059 F F0 .559(option w) |
| 3.059 F .559(as supplied to)-.1 F F1(complete)3.059 E F0 .559 |
| (when the compspec)3.059 F -.1(wa)108 729.6 S 3.172(sd).1 G .672 |
| (e\214ned, the)-3.172 F F1(bash)3.172 E F0(def)3.172 E .671 |
| (ault completions are attempted if the compspec generates no matches.) |
| -.1 F .671(If the)5.671 F F1<ad6f>3.171 E F0(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(45)185.955 E 0 Cg EP |
| %%Page: 46 46 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(default)108 84 Q F0 1.207(option w)3.706 F |
| 1.207(as supplied to)-.1 F F1(complete)3.707 E F0 1.207 |
| (when the compspec w)3.707 F 1.207(as de\214ned, readline')-.1 F 3.707 |
| (sd)-.55 G(ef)-3.707 E 1.207(ault completion)-.1 F |
| (will be performed if the compspec \(and, if attempted, the def)108 96 Q |
| (ault)-.1 E F1(bash)2.5 E F0(completions\) generate no matches.)2.5 E |
| .245(When a compspec indicates that directory name completion is desire\ |
| d, the programmable completion func-)108 112.8 R .632(tions force readl\ |
| ine to append a slash to completed names which are symbolic links to di\ |
| rectories, subject)108 124.8 R 2.762(to the v)108 136.8 R 2.762 |
| (alue of the)-.25 F F1(mark\255dir)5.262 E(ectories)-.18 E F0 2.761 |
| (readline v)5.262 F 2.761(ariable, re)-.25 F -.05(ga)-.15 G 2.761 |
| (rdless of the setting of the).05 F F1(mark-sym-)5.261 E(link)108 148.8 |
| Q(ed\255dir)-.1 E(ectories)-.18 E F0(readline v)2.5 E(ariable.)-.25 E |
| .19(There is some support for dynamically modifying completions.)108 |
| 165.6 R .191(This is most useful when used in combina-)5.191 F 1.33 |
| (tion with a def)108 177.6 R 1.33(ault completion speci\214ed with)-.1 F |
| F1 1.33(complete -D)3.83 F F0 6.33(.I)C(t')-6.33 E 3.83(sp)-.55 G 1.33 |
| (ossible for shell functions e)-3.83 F -.15(xe)-.15 G 1.33(cuted as).15 |
| F .93(completion handlers to indicate that completion should be retried\ |
| by returning an e)108 189.6 R .93(xit status of 124.)-.15 F .93(If a) |
| 5.93 F .1(shell function returns 124, and changes the compspec associat\ |
| ed with the command on which completion is)108 201.6 R .665 |
| (being attempted \(supplied as the \214rst ar)108 213.6 R .666 |
| (gument when the function is e)-.18 F -.15(xe)-.15 G .666 |
| (cuted\), programmable completion).15 F 1.139(restarts from the be)108 |
| 225.6 R 1.139 |
| (ginning, with an attempt to \214nd a compspec for that command.)-.15 F |
| 1.139(This allo)6.139 F 1.138(ws a set of)-.25 F(completions to be b)108 |
| 237.6 Q(uilt dynamically as completion is attempted, rather than being \ |
| loaded all at once.)-.2 E -.15(Fo)108 254.4 S 2.636(ri).15 G .137 |
| (nstance, assuming that there is a library of compspecs, each k)-2.636 F |
| .137(ept in a \214le corresponding to the name of)-.1 F |
| (the command, the follo)108 266.4 Q(wing def)-.25 E |
| (ault completion function w)-.1 E(ould load completions dynamically:)-.1 |
| E/F2 10/Courier@0 SF(_completion_loader\(\))108 283.2 Q({)108 295.2 Q 6 |
| (.")144 307.2 S |
| (/etc/bash_completion.d/$1.sh" >/dev/null 2>&1 && return 124)-6 E(})108 |
| 319.2 Q(complete -D -F _completion_loader)108 331.2 Q/F3 10.95 |
| /Times-Bold@0 SF(HIST)72 360 Q(OR)-.197 E(Y)-.383 E F0 .372(When the)108 |
| 372 R F1 .372(\255o history)2.872 F F0 .372(option to the)2.872 F F1 |
| (set)2.872 E F0 -.2(bu)2.872 G .372(iltin is enabled, the shell pro).2 F |
| .371(vides access to the)-.15 F/F4 10/Times-Italic@0 SF .371 |
| (command history)2.871 F F0(,)A .304(the list of commands pre)108 384 R |
| .304(viously typed.)-.25 F .304(The v)5.304 F .304(alue of the)-.25 F/F5 |
| 9/Times-Bold@0 SF(HISTSIZE)2.804 E F0 -.25(va)2.554 G .305 |
| (riable is used as the number of com-).25 F .43(mands to sa)108 396 R |
| .73 -.15(ve i)-.2 H 2.93(nah).15 G .43(istory list.)-2.93 F .43(The te) |
| 5.43 F .429(xt of the last)-.15 F F5(HISTSIZE)2.929 E F0 .429 |
| (commands \(def)2.679 F .429(ault 500\) is sa)-.1 F -.15(ve)-.2 G 2.929 |
| (d. The).15 F(shell)2.929 E .287 |
| (stores each command in the history list prior to parameter and v)108 |
| 408 R .287(ariable e)-.25 F .287(xpansion \(see)-.15 F F5(EXP)2.787 E |
| (ANSION)-.666 E F0(abo)2.537 E -.15(ve)-.15 G(\)).15 E -.2(bu)108 420 S |
| 4.066(ta).2 G 1.565(fter history e)-4.066 F 1.565 |
| (xpansion is performed, subject to the v)-.15 F 1.565 |
| (alues of the shell v)-.25 F(ariables)-.25 E F5(HISTIGNORE)4.065 E F0 |
| (and)3.815 E F5(HISTCONTR)108 432 Q(OL)-.27 E/F6 9/Times-Roman@0 SF(.)A |
| F0 .082 |
| (On startup, the history is initialized from the \214le named by the v) |
| 108 448.8 R(ariable)-.25 E F5(HISTFILE)2.583 E F0(\(def)2.333 E(ault)-.1 |
| E F4(~/.bash_history)2.583 E F0(\).)A .315(The \214le named by the v)108 |
| 460.8 R .315(alue of)-.25 F F5(HISTFILE)2.815 E F0 .315 |
| (is truncated, if necessary)2.565 F 2.815(,t)-.65 G 2.815(oc)-2.815 G |
| .315(ontain no more than the number of)-2.815 F .532 |
| (lines speci\214ed by the v)108 472.8 R .532(alue of)-.25 F F5 |
| (HISTFILESIZE)3.032 E F6(.)A F0 .532 |
| (When the history \214le is read, lines be)5.032 F .532 |
| (ginning with the his-)-.15 F 1.159(tory comment character follo)108 |
| 484.8 R 1.158(wed immediately by a digit are interpreted as timestamps \ |
| for the preceding)-.25 F .052(history line.)108 496.8 R .053 |
| (These timestamps are optionally displayed depending on the v)5.052 F |
| .053(alue of the)-.25 F F5(HISTTIMEFORMA)2.553 E(T)-.855 E F0 -.25(va) |
| 108 508.8 S 4.387(riable. When).25 F 1.887(an interacti)4.387 F 2.187 |
| -.15(ve s)-.25 H 1.887(hell e).15 F 1.887(xits, the last)-.15 F F5 |
| ($HISTSIZE)4.387 E F0 1.887(lines are copied from the history list to) |
| 4.137 F F5($HISTFILE)108 520.8 Q F6(.)A F0 .056(If the)4.556 F F1 |
| (histappend)2.556 E F0 .056 |
| (shell option is enabled \(see the description of)2.556 F F1(shopt)2.556 |
| E F0(under)2.556 E F5 .056(SHELL B)2.556 F(UIL)-.09 E(TIN)-.828 E |
| (COMMANDS)108 532.8 Q F0(belo)2.672 E .422(w\), the lines are appended \ |
| to the history \214le, otherwise the history \214le is o)-.25 F -.15(ve) |
| -.15 G 2.921(rwritten. If).15 F F5(HISTFILE)108 544.8 Q F0 .435(is unse\ |
| t, or if the history \214le is unwritable, the history is not sa)2.684 F |
| -.15(ve)-.2 G 2.935(d. If).15 F(the)2.935 E F5(HISTTIMEFORMA)2.935 E(T) |
| -.855 E F0 -.25(va)108 556.8 S .917 |
| (riable is set, time stamps are written to the history \214le, mark).25 |
| F .916(ed with the history comment character)-.1 F 3.416(,s)-.4 G(o) |
| -3.416 E(the)108 568.8 Q 3.082(ym)-.15 G .582(ay be preserv)-3.082 F |
| .582(ed across shell sessions.)-.15 F .583 |
| (This uses the history comment character to distinguish time-)5.583 F |
| .987(stamps from other history lines.)108 580.8 R .987(After sa)5.987 F |
| .987(ving the history)-.2 F 3.486(,t)-.65 G .986 |
| (he history \214le is truncated to contain no more)-3.486 F(than)108 |
| 592.8 Q F5(HISTFILESIZE)2.5 E F0 2.5(lines. If)2.25 F F5(HISTFILESIZE) |
| 2.5 E F0(is not set, no truncation is performed.)2.25 E 1.293(The b)108 |
| 609.6 R 1.293(uiltin command)-.2 F F1(fc)3.793 E F0(\(see)3.793 E F5 |
| 1.293(SHELL B)3.793 F(UIL)-.09 E 1.293(TIN COMMANDS)-.828 F F0(belo) |
| 3.543 E 1.294(w\) may be used to list or edit and re-)-.25 F -.15(exe) |
| 108 621.6 S .674(cute a portion of the history list.).15 F(The)5.673 E |
| F1(history)3.173 E F0 -.2(bu)3.173 G .673 |
| (iltin may be used to display or modify the history list).2 F .279 |
| (and manipulate the history \214le.)108 633.6 R .279 |
| (When using command-line editing, search commands are a)5.279 F -.25(va) |
| -.2 G .28(ilable in each).25 F(editing mode that pro)108 645.6 Q |
| (vide access to the history list.)-.15 E 1.486(The shell allo)108 662.4 |
| R 1.486(ws control o)-.25 F -.15(ve)-.15 G 3.986(rw).15 G 1.486 |
| (hich commands are sa)-3.986 F -.15(ve)-.2 G 3.986(do).15 G 3.986(nt) |
| -3.986 G 1.486(he history list.)-3.986 F(The)6.485 E F5(HISTCONTR)3.985 |
| E(OL)-.27 E F0(and)3.735 E F5(HISTIGNORE)108 674.4 Q F0 -.25(va)2.707 G |
| .457(riables may be set to cause the shell to sa).25 F .758 -.15(ve o) |
| -.2 H .458(nly a subset of the commands entered.).15 F(The)5.458 E F1 |
| (cmdhist)108 686.4 Q F0 .75 |
| (shell option, if enabled, causes the shell to attempt to sa)3.25 F 1.05 |
| -.15(ve e)-.2 H .75(ach line of a multi-line command in).15 F 1.077 |
| (the same history entry)108 698.4 R 3.577(,a)-.65 G 1.077 |
| (dding semicolons where necessary to preserv)-3.577 F 3.577(es)-.15 G |
| 1.077(yntactic correctness.)-3.577 F(The)6.077 E F1(lithist)3.577 E F0 |
| .374(shell option causes the shell to sa)108 710.4 R .674 -.15(ve t)-.2 |
| H .374(he command with embedded ne).15 F .373 |
| (wlines instead of semicolons.)-.25 F .373(See the)5.373 F .318 |
| (description of the)108 722.4 R F1(shopt)2.818 E F0 -.2(bu)2.818 G .318 |
| (iltin belo).2 F 2.818(wu)-.25 G(nder)-2.818 E F5 .318(SHELL B)2.818 F |
| (UIL)-.09 E .318(TIN COMMANDS)-.828 F F0 .319 |
| (for information on setting and)2.568 F(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(46)185.955 E 0 Cg EP |
| %%Page: 47 47 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(unsetting shell options.)108 84 Q/F1 10.95/Times-Bold@0 SF(HIST) |
| 72 100.8 Q(OR)-.197 E 2.738(YE)-.383 G(XP)-2.738 E(ANSION)-.81 E F0 .611 |
| (The shell supports a history e)108 112.8 R .611 |
| (xpansion feature that is similar to the history e)-.15 F .61 |
| (xpansion in)-.15 F/F2 10/Times-Bold@0 SF(csh.)3.11 E F0 .61 |
| (This section)5.61 F .87(describes what syntax features are a)108 124.8 |
| R -.25(va)-.2 G 3.371(ilable. This).25 F .871(feature is enabled by def) |
| 3.371 F .871(ault for interacti)-.1 F 1.171 -.15(ve s)-.25 H .871 |
| (hells, and).15 F 2.014(can be disabled using the)108 136.8 R F2(+H) |
| 4.514 E F0 2.014(option to the)4.514 F F2(set)4.514 E F0 -.2(bu)4.514 G |
| 2.014(iltin command \(see).2 F/F3 9/Times-Bold@0 SF 2.013(SHELL B)4.513 |
| F(UIL)-.09 E 2.013(TIN COMMANDS)-.828 F F0(belo)108 148.8 Q 2.5 |
| (w\). Non-interacti)-.25 F .3 -.15(ve s)-.25 H |
| (hells do not perform history e).15 E(xpansion by def)-.15 E(ault.)-.1 E |
| 1.305(History e)108 165.6 R 1.305(xpansions introduce w)-.15 F 1.306(or\ |
| ds from the history list into the input stream, making it easy to repea\ |
| t)-.1 F .21(commands, insert the ar)108 177.6 R .21(guments to a pre) |
| -.18 F .209 |
| (vious command into the current input line, or \214x errors in pre)-.25 |
| F(vious)-.25 E(commands quickly)108 189.6 Q(.)-.65 E 1.163(History e)108 |
| 206.4 R 1.163(xpansion is performed immediately after a complete line i\ |
| s read, before the shell breaks it into)-.15 F -.1(wo)108 218.4 S 3.2 |
| (rds. It).1 F(tak)3.2 E .7(es place in tw)-.1 F 3.2(op)-.1 G 3.2 |
| (arts. The)-3.2 F .7 |
| (\214rst is to determine which line from the history list to use during) |
| 3.2 F 4.367(substitution. The)108 230.4 R 1.868(second is to select por\ |
| tions of that line for inclusion into the current one.)4.367 F 1.868 |
| (The line)6.868 F .663(selected from the history is the)108 242.4 R/F4 |
| 10/Times-Italic@0 SF -.15(ev)3.163 G(ent).15 E F0 3.163(,a)C .663 |
| (nd the portions of that line that are acted upon are)-3.163 F F4(wor) |
| 3.162 E(ds)-.37 E F0 5.662(.V)C(arious)-6.772 E F4(modi\214er)108 254.4 |
| Q(s)-.1 E F0 .226(are a)2.726 F -.25(va)-.2 G .226 |
| (ilable to manipulate the selected w).25 F 2.726(ords. The)-.1 F .227 |
| (line is brok)2.726 F .227(en into w)-.1 F .227(ords in the same f)-.1 F |
| (ashion)-.1 E .352(as when reading input, so that se)108 266.4 R -.15 |
| (ve)-.25 G(ral).15 E F4(metac)2.852 E(har)-.15 E(acter)-.15 E F0 .351 |
| (-separated w)B .351(ords surrounded by quotes are considered)-.1 F .624 |
| (one w)108 278.4 R 3.124(ord. History)-.1 F -.15(ex)3.124 G .624 |
| (pansions are introduced by the appearance of the history e).15 F .625 |
| (xpansion character)-.15 F 3.125(,w)-.4 G(hich)-3.125 E(is)108 290.4 Q |
| F2(!)3.333 E F0(by def)3.333 E 2.5(ault. Only)-.1 F(backslash \()2.5 E |
| F2(\\).833 E F0 2.5(\)a).833 G(nd single quotes can quote the history e) |
| -2.5 E(xpansion character)-.15 E(.)-.55 E(Se)108 307.2 Q -.15(ve)-.25 G |
| .03(ral characters inhibit history e).15 F .03 |
| (xpansion if found immediately follo)-.15 F .03(wing the history e)-.25 |
| F .03(xpansion character)-.15 F(,)-.4 E -2.15 -.25(ev e)108 319.2 T |
| 3.162(ni).25 G 3.162(fi)-3.162 G 3.162(ti)-3.162 G 3.162(su)-3.162 G |
| .662(nquoted: space, tab, ne)-3.162 F .662(wline, carriage return, and) |
| -.25 F F2(=)3.162 E F0 5.662(.I)C 3.162(ft)-5.662 G(he)-3.162 E F2 |
| (extglob)3.162 E F0 .662(shell option is enabled,)3.162 F F2(\()3.163 E |
| F0(will also inhibit e)108 331.2 Q(xpansion.)-.15 E(Se)108 348 Q -.15 |
| (ve)-.25 G .11(ral shell options settable with the).15 F F2(shopt)2.61 E |
| F0 -.2(bu)2.61 G .109(iltin may be used to tailor the beha).2 F .109 |
| (vior of history e)-.2 F(xpansion.)-.15 E 1.142(If the)108 360 R F2 |
| (histv)3.643 E(erify)-.1 E F0 1.143 |
| (shell option is enabled \(see the description of the)3.643 F F2(shopt) |
| 3.643 E F0 -.2(bu)3.643 G 1.143(iltin belo).2 F 1.143(w\), and)-.25 F F2 |
| -.18(re)3.643 G(adline).18 E F0(is)3.643 E .461(being used, history sub\ |
| stitutions are not immediately passed to the shell parser)108 372 R 5.46 |
| (.I)-.55 G .46(nstead, the e)-5.46 F .46(xpanded line)-.15 F 1.515 |
| (is reloaded into the)108 384 R F2 -.18(re)4.015 G(adline).18 E F0 1.515 |
| (editing b)4.015 F(uf)-.2 E 1.516(fer for further modi\214cation.)-.25 F |
| (If)6.516 E F2 -.18(re)4.016 G(adline).18 E F0 1.516 |
| (is being used, and the)4.016 F F2(histr)108 396 Q(eedit)-.18 E F0 1.202 |
| (shell option is enabled, a f)3.702 F 1.202 |
| (ailed history substitution will be reloaded into the)-.1 F F2 -.18(re) |
| 3.702 G(adline).18 E F0(editing)3.702 E -.2(bu)108 408 S -.25(ff).2 G |
| 1.16(er for correction.).25 F(The)6.16 E F2<ad70>3.66 E F0 1.16 |
| (option to the)3.66 F F2(history)3.66 E F0 -.2(bu)3.661 G 1.161 |
| (iltin command may be used to see what a history).2 F -.15(ex)108 420 S |
| .056(pansion will do before using it.).15 F(The)5.056 E F2<ad73>2.556 E |
| F0 .056(option to the)2.556 F F2(history)2.555 E F0 -.2(bu)2.555 G .055 |
| (iltin may be used to add commands to the).2 F |
| (end of the history list without actually e)108 432 Q -.15(xe)-.15 G |
| (cuting them, so that the).15 E 2.5(ya)-.15 G(re a)-2.5 E -.25(va)-.2 G |
| (ilable for subsequent recall.).25 E 2.2(The shell allo)108 448.8 R 2.2 |
| (ws control of the v)-.25 F 2.2(arious characters used by the history e) |
| -.25 F 2.2(xpansion mechanism \(see the)-.15 F 1.147(description of)108 |
| 460.8 R F2(histchars)3.647 E F0(abo)3.647 E 1.447 -.15(ve u)-.15 H(nder) |
| .15 E F2 1.147(Shell V)3.647 F(ariables)-.92 E F0 3.646(\). The)B 1.146 |
| (shell uses the history comment character to)3.646 F |
| (mark history timestamps when writing the history \214le.)108 472.8 Q F2 |
| (Ev)87 489.6 Q(ent Designators)-.1 E F0(An e)108 501.6 Q -.15(ve)-.25 G |
| (nt designator is a reference to a command line entry in the history li\ |
| st.).15 E F2(!)108 518.4 Q F0 1.607(Start a history substitution, e) |
| 32.67 F 1.607(xcept when follo)-.15 F 1.607(wed by a)-.25 F F2(blank) |
| 4.107 E F0 4.107(,n)C -.25(ew)-4.107 G 1.608 |
| (line, carriage return, = or \().25 F(\(when the)144 530.4 Q F2(extglob) |
| 2.5 E F0(shell option is enabled using the)2.5 E F2(shopt)2.5 E F0 -.2 |
| (bu)2.5 G(iltin\).).2 E F2(!)108 542.4 Q F4(n)A F0 |
| (Refer to command line)27.67 E F4(n)2.5 E F0(.).24 E F2<21ad>108 554.4 Q |
| F4(n)A F0(Refer to the current command line minus)21.97 E F4(n)2.5 E F0 |
| (.).24 E F2(!!)108 566.4 Q F0(Refer to the pre)29.34 E(vious command.) |
| -.25 E(This is a synon)5 E(ym for `!\2551'.)-.15 E F2(!)108 578.4 Q F4 |
| (string)A F0(Refer to the most recent command starting with)9.33 E F4 |
| (string)2.5 E F0(.).22 E F2(!?)108 590.4 Q F4(string)A F2([?])A F0 1.022 |
| (Refer to the most recent command containing)144 602.4 R F4(string)3.522 |
| E F0 6.022(.T).22 G 1.022(he trailing)-6.022 F F2(?)3.522 E F0 1.022 |
| (may be omitted if)3.522 F F4(string)3.861 E F0(is)3.741 E(follo)144 |
| 614.4 Q(wed immediately by a ne)-.25 E(wline.)-.25 E/F5 12/Times-Bold@0 |
| SF(^)108 631.4 Q F4(string1)-5 I F5(^)5 I F4(string2)-5 I F5(^)5 I F0 |
| 2.629(Quick substitution.)144 638.4 R 2.629 |
| (Repeat the last command, replacing)7.629 F F4(string1)5.469 E F0(with) |
| 5.129 E F4(string2)5.129 E F0 7.629(.E).02 G(qui)-7.629 E -.25(va)-.25 G |
| 2.63(lent to).25 F -.74(``)144 650.4 S(!!:s/).74 E F4(string1)A F0(/)A |
| F4(string2)A F0(/')A 2.5('\()-.74 G(see)-2.5 E F2(Modi\214ers)2.5 E F0 |
| (belo)2.5 E(w\).)-.25 E F2(!#)108 662.4 Q F0 |
| (The entire command line typed so f)27.67 E(ar)-.1 E(.)-.55 E F2 -.75 |
| (Wo)87 679.2 S(rd Designators).75 E F0 -.8(Wo)108 691.2 S 1.314 |
| (rd designators are used to select desired w).8 F 1.314(ords from the e) |
| -.1 F -.15(ve)-.25 G 3.814(nt. A).15 F F2(:)3.814 E F0 1.313 |
| (separates the e)3.813 F -.15(ve)-.25 G 1.313(nt speci\214cation).15 F |
| .529(from the w)108 703.2 R .529(ord designator)-.1 F 5.529(.I)-.55 G |
| 3.029(tm)-5.529 G .529(ay be omitted if the w)-3.029 F .529 |
| (ord designator be)-.1 F .529(gins with a)-.15 F F2(^)3.029 E F0(,)A F2 |
| ($)3.029 E F0(,)A F2(*)3.029 E F0(,)A F2<ad>3.029 E F0 3.029(,o)C(r) |
| -3.029 E F2(%)3.029 E F0 5.53(.W)C(ords)-6.33 E 1.301 |
| (are numbered from the be)108 715.2 R 1.301 |
| (ginning of the line, with the \214rst w)-.15 F 1.3 |
| (ord being denoted by 0 \(zero\).)-.1 F -.8(Wo)6.3 G 1.3(rds are).8 F |
| (inserted into the current line separated by single spaces.)108 727.2 Q |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(47)185.955 E 0 Cg EP |
| %%Page: 48 48 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF 2.5(0\()108 84 S(zer)-2.5 E(o\))-.18 E F0 |
| (The zeroth w)144 96 Q 2.5(ord. F)-.1 F |
| (or the shell, this is the command w)-.15 E(ord.)-.1 E/F2 10 |
| /Times-Italic@0 SF(n)108.36 108 Q F0(The)30.64 E F2(n)2.5 E F0(th w)A |
| (ord.)-.1 E F1(^)108 120 Q F0(The \214rst ar)32.67 E 2.5(gument. That) |
| -.18 F(is, w)2.5 E(ord 1.)-.1 E F1($)108 132 Q F0(The last ar)31 E |
| (gument.)-.18 E F1(%)108 144 Q F0(The w)26 E |
| (ord matched by the most recent `?)-.1 E F2(string)A F0(?' search.)A F2 |
| (x)108.77 156 Q F1<ad>A F2(y)A F0 2.5(Ar)20.65 G(ange of w)-2.5 E |
| (ords; `\255)-.1 E F2(y)A F0 2.5('a)C(bbre)-2.5 E(viates `0\255)-.25 E |
| F2(y)A F0('.)A F1(*)108 168 Q F0 .315(All of the w)31 F .315(ords b)-.1 |
| F .315(ut the zeroth.)-.2 F .315(This is a synon)5.315 F .315(ym for `) |
| -.15 F F2(1\255$)A F0 2.815('. It)B .315(is not an error to use)2.815 F |
| F1(*)2.816 E F0 .316(if there is)2.816 F(just one w)144 180 Q |
| (ord in the e)-.1 E -.15(ve)-.25 G |
| (nt; the empty string is returned in that case.).15 E F1(x*)108 192 Q F0 |
| (Abbre)26 E(viates)-.25 E F2(x\255$)2.5 E F0(.)A F1<78ad>108 204 Q F0 |
| (Abbre)25.3 E(viates)-.25 E F2(x\255$)2.5 E F0(lik)2.5 E(e)-.1 E F1(x*) |
| 2.5 E F0 2.5(,b)C(ut omits the last w)-2.7 E(ord.)-.1 E(If a w)108 220.8 |
| Q(ord designator is supplied without an e)-.1 E -.15(ve)-.25 G |
| (nt speci\214cation, the pre).15 E(vious command is used as the e)-.25 E |
| -.15(ve)-.25 G(nt.).15 E F1(Modi\214ers)87 237.6 Q F0 .184 |
| (After the optional w)108 249.6 R .184(ord designator)-.1 F 2.684(,t)-.4 |
| G .183(here may appear a sequence of one or more of the follo)-2.684 F |
| .183(wing modi\214ers,)-.25 F(each preceded by a `:'.)108 261.6 Q F1(h) |
| 108 278.4 Q F0(Remo)30.44 E .3 -.15(ve a t)-.15 H |
| (railing \214le name component, lea).15 E(ving only the head.)-.2 E F1 |
| (t)108 290.4 Q F0(Remo)32.67 E .3 -.15(ve a)-.15 H |
| (ll leading \214le name components, lea).15 E(ving the tail.)-.2 E F1(r) |
| 108 302.4 Q F0(Remo)31.56 E .3 -.15(ve a t)-.15 H(railing suf).15 E |
| (\214x of the form)-.25 E F2(.xxx)2.5 E F0 2.5(,l)C(ea)-2.5 E |
| (ving the basename.)-.2 E F1(e)108 314.4 Q F0(Remo)31.56 E .3 -.15(ve a) |
| -.15 H(ll b).15 E(ut the trailing suf)-.2 E(\214x.)-.25 E F1(p)108 326.4 |
| Q F0(Print the ne)30.44 E 2.5(wc)-.25 G(ommand b)-2.5 E(ut do not e)-.2 |
| E -.15(xe)-.15 G(cute it.).15 E F1(q)108 338.4 Q F0 |
| (Quote the substituted w)30.44 E(ords, escaping further substitutions.) |
| -.1 E F1(x)108 350.4 Q F0(Quote the substituted w)31 E(ords as with)-.1 |
| E F1(q)2.5 E F0 2.5(,b)C(ut break into w)-2.7 E(ords at)-.1 E F1(blanks) |
| 2.5 E F0(and ne)2.5 E(wlines.)-.25 E F1(s/)108 362.4 Q F2(old)A F1(/)A |
| F2(ne)A(w)-.15 E F1(/)A F0(Substitute)144 374.4 Q F2(ne)3.081 E(w)-.15 E |
| F0 .221(for the \214rst occurrence of)3.031 F F2(old)2.951 E F0 .221 |
| (in the e)3.491 F -.15(ve)-.25 G .221(nt line.).15 F(An)5.221 E 2.721 |
| (yd)-.15 G .221(elimiter can be used in place)-2.721 F .617(of /.)144 |
| 386.4 R .617 |
| (The \214nal delimiter is optional if it is the last character of the e) |
| 5.617 F -.15(ve)-.25 G .617(nt line.).15 F .616(The delimiter may)5.616 |
| F .666(be quoted in)144 398.4 R F2(old)3.396 E F0(and)3.936 E F2(ne) |
| 3.526 E(w)-.15 E F0 .666(with a single backslash.)3.476 F .666 |
| (If & appears in)5.666 F F2(ne)3.166 E(w)-.15 E F0 3.166(,i).31 G 3.166 |
| (ti)-3.166 G 3.166(sr)-3.166 G .666(eplaced by)-3.166 F F2(old)3.166 E |
| F0 5.666(.A).77 G .275(single backslash will quote the &.)144 410.4 R |
| (If)5.275 E F2(old)3.004 E F0 .274(is null, it is set to the last)3.544 |
| F F2(old)3.004 E F0 .274(substituted, or)3.544 F 2.774(,i)-.4 G 2.774 |
| (fn)-2.774 G 2.774(op)-2.774 G(re)-2.774 E(vi-)-.25 E |
| (ous history substitutions took place, the last)144 422.4 Q F2(string) |
| 2.84 E F0(in a)2.72 E F1(!?)2.5 E F2(string)A F1([?])A F0(search.)5 E F1 |
| (&)108 434.4 Q F0(Repeat the pre)27.67 E(vious substitution.)-.25 E F1 |
| (g)108 446.4 Q F0 .397(Cause changes to be applied o)31 F -.15(ve)-.15 G |
| 2.897(rt).15 G .398(he entire e)-2.897 F -.15(ve)-.25 G .398(nt line.) |
| .15 F .398(This is used in conjunction with `)5.398 F F1(:s)A F0 2.898 |
| ('\()C(e.g.,)-2.898 E(`)144 458.4 Q F1(:gs/)A F2(old)A F1(/)A F2(ne)A(w) |
| -.15 E F1(/)A F0 1.219('\) or `)B F1(:&)A F0 3.719('. If)B 1.219 |
| (used with `)3.719 F F1(:s)A F0 1.218(', an)B 3.718(yd)-.15 G 1.218 |
| (elimiter can be used in place of /, and the \214nal)-3.718 F .089 |
| (delimiter is optional if it is the last character of the e)144 470.4 R |
| -.15(ve)-.25 G .09(nt line.).15 F(An)5.09 E F1(a)2.59 E F0 .09 |
| (may be used as a synon)2.59 F .09(ym for)-.15 F F1(g)144 482.4 Q F0(.)A |
| F1(G)108 494.4 Q F0(Apply the follo)28.22 E(wing `)-.25 E F1(s)A F0 2.5 |
| ('m)C(odi\214er once to each w)-2.5 E(ord in the e)-.1 E -.15(ve)-.25 G |
| (nt line.).15 E/F3 10.95/Times-Bold@0 SF(SHELL B)72 511.2 Q(UIL)-.11 E |
| (TIN COMMANDS)-1.007 E F0 .063(Unless otherwise noted, each b)108 523.2 |
| R .062(uiltin command documented in this section as accepting options p\ |
| receded by)-.2 F F1<ad>108 535.2 Q F0(accepts)2.533 E F1<adad>2.533 E F0 |
| .034(to signify the end of the options.)2.533 F(The)5.034 E F1(:)2.534 E |
| F0(,)A F1(true)2.534 E F0(,)A F1(false)2.534 E F0 2.534(,a)C(nd)-2.534 E |
| F1(test)2.534 E F0 -.2(bu)2.534 G .034(iltins do not accept options and) |
| .2 F .078(do not treat)108 547.2 R F1<adad>2.577 E F0(specially)2.577 E |
| 5.077(.T)-.65 G(he)-5.077 E F1(exit)2.577 E F0(,)A F1(logout)2.577 E F0 |
| (,)A F1(br)2.577 E(eak)-.18 E F0(,)A F1(continue)2.577 E F0(,)A F1(let) |
| 2.577 E F0 2.577(,a)C(nd)-2.577 E F1(shift)2.577 E F0 -.2(bu)2.577 G |
| .077(iltins accept and process ar).2 F(gu-)-.18 E .319(ments be)108 |
| 559.2 R .319(ginning with)-.15 F F1<ad>2.819 E F0 .319 |
| (without requiring)2.819 F F1<adad>2.819 E F0 5.319(.O)C .319(ther b) |
| -5.319 F .319(uiltins that accept ar)-.2 F .32(guments b)-.18 F .32 |
| (ut are not speci\214ed as)-.2 F 1.144(accepting options interpret ar) |
| 108 571.2 R 1.144(guments be)-.18 F 1.144(ginning with)-.15 F F1<ad> |
| 3.643 E F0 1.143(as in)3.643 F -.25(va)-.4 G 1.143 |
| (lid options and require).25 F F1<adad>3.643 E F0 1.143(to pre)3.643 F |
| -.15(ve)-.25 G 1.143(nt this).15 F(interpretation.)108 583.2 Q F1(:)108 |
| 601.2 Q F0([)2.5 E F2(ar)A(guments)-.37 E F0(])A .451(No ef)144 613.2 R |
| .451(fect; the command does nothing be)-.25 F .452(yond e)-.15 F |
| (xpanding)-.15 E F2(ar)3.282 E(guments)-.37 E F0 .452(and performing an) |
| 3.222 F 2.952(ys)-.15 G(peci\214ed)-2.952 E 2.5(redirections. A)144 |
| 625.2 R(zero e)2.5 E(xit code is returned.)-.15 E F1(.)110.5 642 Q F2 |
| (\214lename)6.666 E F0([)2.5 E F2(ar)A(guments)-.37 E F0(])A F1(sour)108 |
| 654 Q(ce)-.18 E F2(\214lename)2.5 E F0([)2.5 E F2(ar)A(guments)-.37 E F0 |
| (])A 1.02(Read and e)144 666 R -.15(xe)-.15 G 1.02(cute commands from) |
| .15 F F2(\214lename)5.43 E F0 1.02(in the current shell en)3.7 F 1.02 |
| (vironment and return the e)-.4 F(xit)-.15 E 1.68 |
| (status of the last command e)144 678 R -.15(xe)-.15 G 1.68(cuted from) |
| .15 F F2(\214lename)4.18 E F0 6.68(.I).18 G(f)-6.68 E F2(\214lename)6.09 |
| E F0 1.68(does not contain a slash, \214le)4.36 F .608(names in)144 690 |
| R/F4 9/Times-Bold@0 SF -.666(PA)3.108 G(TH)-.189 E F0 .608 |
| (are used to \214nd the directory containing)2.858 F F2(\214lename)3.108 |
| E F0 5.608(.T).18 G .608(he \214le searched for in)-5.608 F F4 -.666(PA) |
| 3.108 G(TH)-.189 E F0 .832(need not be e)144 702 R -.15(xe)-.15 G 3.332 |
| (cutable. When).15 F F1(bash)3.332 E F0 .832(is not in)3.332 F F2 .832 |
| (posix mode)3.332 F F0 3.332(,t)C .833 |
| (he current directory is searched if no)-3.332 F .982 |
| (\214le is found in)144 714 R F4 -.666(PA)3.481 G(TH)-.189 E/F5 9 |
| /Times-Roman@0 SF(.)A F0 .981(If the)5.481 F F1(sour)3.481 E(cepath)-.18 |
| E F0 .981(option to the)3.481 F F1(shopt)3.481 E F0 -.2(bu)3.481 G .981 |
| (iltin command is turned of).2 F .981(f, the)-.25 F F4 -.666(PA)144 726 |
| S(TH)-.189 E F0 .112(is not searched.)2.362 F .112(If an)5.112 F(y)-.15 |
| E F2(ar)2.612 E(guments)-.37 E F0 .112(are supplied, the)2.612 F 2.612 |
| (yb)-.15 G .112(ecome the positional parameters when)-2.612 F |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(48)185.955 E 0 Cg EP |
| %%Page: 49 49 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Italic@0 SF(\214lename)144 84 Q F0 .342(is e)2.842 F |
| -.15(xe)-.15 G 2.842(cuted. Otherwise).15 F .342 |
| (the positional parameters are unchanged.)2.842 F .341 |
| (The return status is the)5.341 F .716(status of the last command e)144 |
| 96 R .716(xited within the script \(0 if no commands are e)-.15 F -.15 |
| (xe)-.15 G .716(cuted\), and f).15 F .716(alse if)-.1 F F1(\214lename) |
| 145.91 108 Q F0(is not found or cannot be read.)2.68 E/F2 10 |
| /Times-Bold@0 SF(alias)108 124.8 Q F0([)2.5 E F2<ad70>A F0 2.5(][)C F1 |
| (name)-2.5 E F0([=)A F1(value)A F0 2.5(].)C(..])-2.5 E F2(Alias)144 |
| 136.8 Q F0 2.725(with no ar)5.225 F 2.724(guments or with the)-.18 F F2 |
| <ad70>5.224 E F0 2.724(option prints the list of aliases in the form) |
| 5.224 F F2(alias)5.224 E F1(name)144 148.8 Q F0(=)A F1(value)A F0 .58 |
| (on standard output.)3.08 F .58(When ar)5.58 F .58 |
| (guments are supplied, an alias is de\214ned for each)-.18 F F1(name) |
| 3.08 E F0(whose)144 160.8 Q F1(value)2.895 E F0 .395(is gi)2.895 F -.15 |
| (ve)-.25 G 2.895(n. A).15 F .395(trailing space in)2.895 F F1(value) |
| 5.395 E F0 .395(causes the ne)2.895 F .395(xt w)-.15 F .395 |
| (ord to be check)-.1 F .395(ed for alias sub-)-.1 F .054 |
| (stitution when the alias is e)144 172.8 R 2.554(xpanded. F)-.15 F .054 |
| (or each)-.15 F F1(name)2.554 E F0 .054(in the ar)2.554 F .054 |
| (gument list for which no)-.18 F F1(value)2.554 E F0 .054(is sup-)2.554 |
| F 1.314(plied, the name and v)144 184.8 R 1.314 |
| (alue of the alias is printed.)-.25 F F2(Alias)6.314 E F0 1.314 |
| (returns true unless a)3.814 F F1(name)3.814 E F0 1.313(is gi)3.814 F |
| -.15(ve)-.25 G 3.813(nf).15 G(or)-3.813 E |
| (which no alias has been de\214ned.)144 196.8 Q F2(bg)108 213.6 Q F0([) |
| 2.5 E F1(jobspec)A F0(...])2.5 E .744(Resume each suspended job)144 |
| 225.6 R F1(jobspec)3.244 E F0 .745 |
| (in the background, as if it had been started with)3.244 F F2(&)3.245 E |
| F0 5.745(.I)C(f)-5.745 E F1(job-)4.985 E(spec)144 237.6 Q F0 .672 |
| (is not present, the shell')3.482 F 3.172(sn)-.55 G .672(otion of the) |
| -3.172 F F1(curr)3.172 E .672(ent job)-.37 F F0 .672(is used.)3.172 F F2 |
| (bg)5.671 E F1(jobspec)4.911 E F0 .671(returns 0 unless run)3.481 F .418 |
| (when job control is disabled or)144 249.6 R 2.919(,w)-.4 G .419 |
| (hen run with job control enabled, an)-2.919 F 2.919(ys)-.15 G |
| (peci\214ed)-2.919 E F1(jobspec)2.919 E F0 -.1(wa)2.919 G 2.919(sn).1 G |
| (ot)-2.919 E(found or w)144 261.6 Q(as started without job control.)-.1 |
| E F2(bind)108 278.4 Q F0([)2.5 E F2<ad6d>A F1 -.1(ke)2.5 G(ymap)-.2 E F0 |
| 2.5(][)C F2(\255lpsvPSV)-2.5 E F0(])A F2(bind)108 290.4 Q F0([)2.5 E F2 |
| <ad6d>A F1 -.1(ke)2.5 G(ymap)-.2 E F0 2.5(][)C F2<ad71>-2.5 E F1 |
| (function)2.5 E F0 2.5(][)C F2<ad75>-2.5 E F1(function)2.5 E F0 2.5(][)C |
| F2<ad72>-2.5 E F1 -.1(ke)2.5 G(yseq)-.2 E F0(])A F2(bind)108 302.4 Q F0 |
| ([)2.5 E F2<ad6d>A F1 -.1(ke)2.5 G(ymap)-.2 E F0(])A F2<ad66>2.5 E F1 |
| (\214lename)2.5 E F2(bind)108 314.4 Q F0([)2.5 E F2<ad6d>A F1 -.1(ke)2.5 |
| G(ymap)-.2 E F0(])A F2<ad78>2.5 E F1 -.1(ke)2.5 G(yseq)-.2 E F0(:)A F1 |
| (shell\255command)A F2(bind)108 326.4 Q F0([)2.5 E F2<ad6d>A F1 -.1(ke) |
| 2.5 G(ymap)-.2 E F0(])A F1 -.1(ke)2.5 G(yseq)-.2 E F0(:)A F1 |
| (function\255name)A F2(bind)108 338.4 Q F1 -.37(re)2.5 G |
| (adline\255command).37 E F0 .239(Display current)144 350.4 R F2 -.18(re) |
| 2.739 G(adline).18 E F0 -.1(ke)2.739 G 2.739(ya)-.05 G .239 |
| (nd function bindings, bind a k)-2.739 F .539 -.15(ey s)-.1 H .238 |
| (equence to a).15 F F2 -.18(re)2.738 G(adline).18 E F0 .238(function or) |
| 2.738 F .475(macro, or set a)144 362.4 R F2 -.18(re)2.975 G(adline).18 E |
| F0 -.25(va)2.975 G 2.975(riable. Each).25 F .476(non-option ar)2.976 F |
| .476(gument is a command as it w)-.18 F .476(ould appear in)-.1 F F1 |
| (.inputr)144 374.4 Q(c)-.37 E F0 2.984(,b).31 G .484 |
| (ut each binding or command must be passed as a separate ar)-3.184 F |
| .483(gument; e.g., '"\\C\255x\\C\255r":)-.18 F 2.5 |
| (re\255read\255init\255\214le'. Options,)144 386.4 R(if supplied, ha)2.5 |
| E .3 -.15(ve t)-.2 H(he follo).15 E(wing meanings:)-.25 E F2<ad6d>144 |
| 398.4 Q F1 -.1(ke)2.5 G(ymap)-.2 E F0(Use)180 410.4 Q F1 -.1(ke)5.158 G |
| (ymap)-.2 E F0 2.658(as the k)5.348 F -.15(ey)-.1 G 2.658(map to be af) |
| .15 F 2.659(fected by the subsequent bindings.)-.25 F(Acceptable)7.659 E |
| F1 -.1(ke)180 422.4 S(ymap)-.2 E F0 3.193(names are)5.883 F F1 3.193 |
| (emacs, emacs\255standar)5.693 F 3.192 |
| (d, emacs\255meta, emacs\255ctlx, vi, vi\255mo)-.37 F(ve)-.1 E(,)-.1 E |
| (vi\255command)180 434.4 Q F0 4.429(,a)C(nd)-4.429 E F1(vi\255insert) |
| 4.429 E F0(.).68 E F1(vi)6.929 E F0 1.929(is equi)4.429 F -.25(va)-.25 G |
| 1.929(lent to).25 F F1(vi\255command)4.429 E F0(;)A F1(emacs)4.429 E F0 |
| 1.929(is equi)4.429 F -.25(va)-.25 G 1.93(lent to).25 F F1 |
| (emacs\255standar)180 446.4 Q(d)-.37 E F0(.)A F2<ad6c>144 458.4 Q F0 |
| (List the names of all)27.52 E F2 -.18(re)2.5 G(adline).18 E F0 |
| (functions.)2.5 E F2<ad70>144 470.4 Q F0(Display)24.74 E F2 -.18(re)2.5 |
| G(adline).18 E F0(function names and bindings in such a w)2.5 E |
| (ay that the)-.1 E 2.5(yc)-.15 G(an be re-read.)-2.5 E F2<ad50>144 482.4 |
| Q F0(List current)24.19 E F2 -.18(re)2.5 G(adline).18 E F0 |
| (function names and bindings.)2.5 E F2<ad73>144 494.4 Q F0(Display)26.41 |
| E F2 -.18(re)3.655 G(adline).18 E F0 -.1(ke)3.655 G 3.655(ys)-.05 G |
| 1.155(equences bound to macros and the strings the)-3.655 F 3.655(yo) |
| -.15 G 1.155(utput in such a)-3.655 F -.1(wa)180 506.4 S 2.5(yt).1 G |
| (hat the)-2.5 E 2.5(yc)-.15 G(an be re-read.)-2.5 E F2<ad53>144 518.4 Q |
| F0(Display)24.74 E F2 -.18(re)2.5 G(adline).18 E F0 -.1(ke)2.5 G 2.5(ys) |
| -.05 G(equences bound to macros and the strings the)-2.5 E 2.5(yo)-.15 G |
| (utput.)-2.5 E F2<ad76>144 530.4 Q F0(Display)25.3 E F2 -.18(re)2.5 G |
| (adline).18 E F0 -.25(va)2.5 G(riable names and v).25 E |
| (alues in such a w)-.25 E(ay that the)-.1 E 2.5(yc)-.15 G |
| (an be re-read.)-2.5 E F2<ad56>144 542.4 Q F0(List current)23.08 E F2 |
| -.18(re)2.5 G(adline).18 E F0 -.25(va)2.5 G(riable names and v).25 E |
| (alues.)-.25 E F2<ad66>144 554.4 Q F1(\214lename)2.5 E F0(Read k)180 |
| 566.4 Q .3 -.15(ey b)-.1 H(indings from).15 E F1(\214lename)2.5 E F0(.)A |
| F2<ad71>144 578.4 Q F1(function)2.5 E F0(Query about which k)180 590.4 Q |
| -.15(ey)-.1 G 2.5(si).15 G -1.9 -.4(nv o)-2.5 H .2 -.1(ke t).4 H |
| (he named).1 E F1(function)2.5 E F0(.)A F2<ad75>144 602.4 Q F1(function) |
| 2.5 E F0(Unbind all k)180 614.4 Q -.15(ey)-.1 G 2.5(sb).15 G |
| (ound to the named)-2.5 E F1(function)2.5 E F0(.)A F2<ad72>144 626.4 Q |
| F1 -.1(ke)2.5 G(yseq)-.2 E F0(Remo)180 638.4 Q .3 -.15(ve a)-.15 H .3 |
| -.15(ny c).15 H(urrent binding for).15 E F1 -.1(ke)2.5 G(yseq)-.2 E F0 |
| (.)A F2<ad78>144 650.4 Q F1 -.1(ke)2.5 G(yseq)-.2 E F2(:)A F1 |
| (shell\255command)A F0(Cause)180 662.4 Q F1(shell\255command)4.325 E F0 |
| 1.825(to be e)4.325 F -.15(xe)-.15 G 1.825(cuted whene).15 F -.15(ve) |
| -.25 G(r).15 E F1 -.1(ke)4.325 G(yseq)-.2 E F0 1.825(is entered.)4.325 F |
| (When)6.825 E F1(shell\255com-)4.325 E(mand)180 674.4 Q F0 1.765(is e) |
| 4.265 F -.15(xe)-.15 G 1.765(cuted, the shell sets the).15 F/F3 9 |
| /Times-Bold@0 SF(READLINE_LINE)4.265 E F0 -.25(va)4.015 G 1.765 |
| (riable to the contents of the).25 F F2 -.18(re)180 686.4 S(adline).18 E |
| F0 1.353(line b)3.852 F(uf)-.2 E 1.353(fer and the)-.25 F F3 |
| (READLINE_POINT)3.853 E F0 -.25(va)3.603 G 1.353 |
| (riable to the current location of the).25 F 2.012(insertion point.)180 |
| 698.4 R 2.011(If the e)7.012 F -.15(xe)-.15 G 2.011 |
| (cuted command changes the v).15 F 2.011(alue of)-.25 F F3 |
| (READLINE_LINE)4.511 E F0(or)4.261 E F3(READLINE_POINT)180 710.4 Q/F4 9 |
| /Times-Roman@0 SF(,)A F0(those ne)2.25 E 2.5(wv)-.25 G |
| (alues will be re\215ected in the editing state.)-2.75 E(The return v) |
| 144 727.2 Q(alue is 0 unless an unrecognized option is gi)-.25 E -.15 |
| (ve)-.25 G 2.5(no).15 G 2.5(ra)-2.5 G 2.5(ne)-2.5 G(rror occurred.)-2.5 |
| E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(49)185.955 E 0 Cg EP |
| %%Page: 50 50 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(br)108 84 Q(eak)-.18 E F0([)2.5 E/F2 10 |
| /Times-Italic@0 SF(n)A F0(])A .054(Exit from within a)144 96 R F1 -.25 |
| (fo)2.554 G(r).25 E F0(,)A F1(while)2.554 E F0(,)A F1(until)2.555 E F0 |
| 2.555(,o)C(r)-2.555 E F1(select)2.555 E F0 2.555(loop. If)2.555 F F2(n) |
| 2.555 E F0 .055(is speci\214ed, break)2.555 F F2(n)2.555 E F0(le)2.555 E |
| -.15(ve)-.25 G(ls.).15 E F2(n)5.415 E F0 .055(must be)2.795 F/F3 10 |
| /Symbol SF<b3>2.555 E F0(1.)2.555 E(If)144 108 Q F2(n)3.075 E F0 .215(i\ |
| s greater than the number of enclosing loops, all enclosing loops are e) |
| 2.955 F 2.714(xited. The)-.15 F .214(return v)2.714 F(alue)-.25 E |
| (is 0 unless)144 120 Q F2(n)2.5 E F0(is not greater than or equal to 1.) |
| 2.5 E F1 -.2(bu)108 136.8 S(iltin).2 E F2(shell\255b)2.5 E(uiltin)-.2 E |
| F0([)2.5 E F2(ar)A(guments)-.37 E F0(])A(Ex)144 148.8 Q .792 |
| (ecute the speci\214ed shell b)-.15 F .792(uiltin, passing it)-.2 F F2 |
| (ar)3.293 E(guments)-.37 E F0 3.293(,a).27 G .793(nd return its e)-3.293 |
| F .793(xit status.)-.15 F .793(This is useful)5.793 F .616 |
| (when de\214ning a function whose name is the same as a shell b)144 |
| 160.8 R .615(uiltin, retaining the functionality of)-.2 F .57(the b)144 |
| 172.8 R .57(uiltin within the function.)-.2 F(The)5.57 E F1(cd)3.07 E F0 |
| -.2(bu)3.07 G .57(iltin is commonly rede\214ned this w).2 F(ay)-.1 E |
| 5.57(.T)-.65 G .57(he return status)-5.57 F(is f)144 184.8 Q(alse if)-.1 |
| E F2(shell\255b)2.84 E(uiltin)-.2 E F0(is not a shell b)2.74 E |
| (uiltin command.)-.2 E F1(caller)108 201.6 Q F0([)2.5 E F2 -.2(ex)C(pr) |
| .2 E F0(])A .254(Returns the conte)144 213.6 R .254(xt of an)-.15 F |
| 2.754(ya)-.15 G(cti)-2.754 E .554 -.15(ve s)-.25 H .254 |
| (ubroutine call \(a shell function or a script e).15 F -.15(xe)-.15 G |
| .254(cuted with the).15 F F1(.)2.753 E F0(or)2.753 E F1(sour)144 225.6 Q |
| (ce)-.18 E F0 -.2(bu)3.062 G 3.062(iltins. W).2 F(ithout)-.4 E F2 -.2 |
| (ex)3.062 G(pr).2 E F0(,)A F1(caller)3.062 E F0 .562 |
| (displays the line number and source \214lename of the current)3.062 F |
| .254(subroutine call.)144 237.6 R .254(If a non-ne)5.254 F -.05(ga)-.15 |
| G(ti).05 E .554 -.15(ve i)-.25 H(nte).15 E .253(ger is supplied as)-.15 |
| F F2 -.2(ex)2.753 G(pr).2 E F0(,)A F1(caller)2.753 E F0 .253 |
| (displays the line number)2.753 F 2.753(,s)-.4 G(ub-)-2.753 E 1.327(rou\ |
| tine name, and source \214le corresponding to that position in the curr\ |
| ent e)144 249.6 R -.15(xe)-.15 G 1.328(cution call stack.).15 F .001 |
| (This e)144 261.6 R .001(xtra information may be used, for e)-.15 F .001 |
| (xample, to print a stack trace.)-.15 F(The current frame is frame)5 E |
| 3.019(0. The)144 273.6 R .519(return v)3.019 F .519 |
| (alue is 0 unless the shell is not e)-.25 F -.15(xe)-.15 G .52 |
| (cuting a subroutine call or).15 F F2 -.2(ex)3.02 G(pr).2 E F0 .52 |
| (does not corre-)3.02 F(spond to a v)144 285.6 Q |
| (alid position in the call stack.)-.25 E F1(cd)108 302.4 Q F0([)2.5 E F1 |
| (\255L|-P)A F0 2.5(][)C F2(dir)-2.5 E F0(])A .21 |
| (Change the current directory to)144 314.4 R F2(dir)2.71 E F0 5.21(.T)C |
| .21(he v)-5.21 F(ariable)-.25 E/F4 9/Times-Bold@0 SF(HOME)2.71 E F0 .21 |
| (is the def)2.46 F(ault)-.1 E F2(dir)2.71 E F0 5.21(.T).73 G .21(he v) |
| -5.21 F(ariable)-.25 E F4(CDP)2.71 E -.855(AT)-.666 G(H).855 E F0 .776 |
| (de\214nes the search path for the directory containing)144 326.4 R F2 |
| (dir)3.276 E F0 5.777(.A).73 G(lternati)-5.777 E 1.077 -.15(ve d)-.25 H |
| .777(irectory names in).15 F F4(CDP)3.277 E -.855(AT)-.666 G(H).855 E F0 |
| .764(are separated by a colon \(:\).)144 338.4 R 3.264(An)5.764 G .764 |
| (ull directory name in)-3.264 F F4(CDP)3.264 E -.855(AT)-.666 G(H).855 E |
| F0 .764(is the same as the current direc-)3.014 F(tory)144 350.4 Q 2.973 |
| (,i)-.65 G .473(.e., `)-2.973 F(`)-.74 E F1(.)A F0 -.74('')C 5.473(.I) |
| .74 G(f)-5.473 E F2(dir)3.323 E F0(be)3.703 E .474 |
| (gins with a slash \(/\), then)-.15 F F4(CDP)2.974 E -.855(AT)-.666 G(H) |
| .855 E F0 .474(is not used. The)2.724 F F1<ad50>2.974 E F0 .474 |
| (option says to use)2.974 F .58(the ph)144 362.4 R .58 |
| (ysical directory structure instead of follo)-.05 F .579 |
| (wing symbolic links \(see also the)-.25 F F1<ad50>3.079 E F0 .579 |
| (option to the)3.079 F F1(set)144 374.4 Q F0 -.2(bu)3.383 G .883 |
| (iltin command\); the).2 F F1<ad4c>3.383 E F0 .884 |
| (option forces symbolic links to be follo)3.384 F 3.384(wed. An)-.25 F |
| (ar)3.384 E .884(gument of)-.18 F F1<ad>3.384 E F0(is)3.384 E(equi)144 |
| 386.4 Q -.25(va)-.25 G .316(lent to).25 F F4($OLDPWD)2.816 E/F5 9 |
| /Times-Roman@0 SF(.)A F0 .316(If a non-empty directory name from)4.816 F |
| F4(CDP)2.815 E -.855(AT)-.666 G(H).855 E F0 .315(is used, or if)2.565 F |
| F1<ad>2.815 E F0 .315(is the \214rst)2.815 F(ar)144 398.4 Q .116(gument\ |
| , and the directory change is successful, the absolute pathname of the \ |
| ne)-.18 F 2.616(ww)-.25 G .116(orking direc-)-2.716 F 1.165 |
| (tory is written to the standard output.)144 410.4 R 1.164(The return v) |
| 6.164 F 1.164(alue is true if the directory w)-.25 F 1.164 |
| (as successfully)-.1 F(changed; f)144 422.4 Q(alse otherwise.)-.1 E F1 |
| (command)108 439.2 Q F0([)2.5 E F1(\255pVv)A F0(])A F2(command)2.5 E F0 |
| ([)2.5 E F2(ar)A(g)-.37 E F0(...])2.5 E(Run)144 451.2 Q F2(command)2.956 |
| E F0(with)3.527 E F2(ar)3.087 E(gs)-.37 E F0 .257 |
| (suppressing the normal shell function lookup. Only b)3.027 F .257 |
| (uiltin commands or)-.2 F .502(commands found in the)144 463.2 R F4 |
| -.666(PA)3.002 G(TH)-.189 E F0 .502(are e)2.752 F -.15(xe)-.15 G 3.002 |
| (cuted. If).15 F(the)3.002 E F1<ad70>3.002 E F0 .502(option is gi)3.002 |
| F -.15(ve)-.25 G .501(n, the search for).15 F F2(command)3.201 E F0(is) |
| 3.771 E .399(performed using a def)144 475.2 R .399(ault v)-.1 F .399 |
| (alue for)-.25 F F4 -.666(PA)2.899 G(TH)-.189 E F0 .4 |
| (that is guaranteed to \214nd all of the standard utilities.)2.649 F(If) |
| 5.4 E .175(either the)144 487.2 R F1<ad56>2.675 E F0(or)2.675 E F1<ad76> |
| 2.675 E F0 .175(option is supplied, a description of)2.675 F F2(command) |
| 2.875 E F0 .174(is printed.)3.445 F(The)5.174 E F1<ad76>2.674 E F0 .174 |
| (option causes)2.674 F 3.11(as)144 499.2 S .61(ingle w)-3.11 F .61 |
| (ord indicating the command or \214le name used to in)-.1 F -.2(vo)-.4 G |
| -.1(ke).2 G F2(command)3.41 E F0 .61(to be displayed; the)3.88 F F1 |
| <ad56>144 511.2 Q F0 .25(option produces a more v)2.75 F .25 |
| (erbose description.)-.15 F .249(If the)5.25 F F1<ad56>2.749 E F0(or) |
| 2.749 E F1<ad76>2.749 E F0 .249(option is supplied, the e)2.749 F .249 |
| (xit status)-.15 F 1.004(is 0 if)144 523.2 R F2(command)3.704 E F0 -.1 |
| (wa)4.274 G 3.504(sf).1 G 1.005(ound, and 1 if not.)-3.504 F 1.005 |
| (If neither option is supplied and an error occurred or)6.005 F F2 |
| (command)144.2 535.2 Q F0 1.599(cannot be found, the e)4.869 F 1.599 |
| (xit status is 127.)-.15 F 1.599(Otherwise, the e)6.599 F 1.598 |
| (xit status of the)-.15 F F1(command)4.098 E F0 -.2(bu)144 547.2 S |
| (iltin is the e).2 E(xit status of)-.15 E F2(command)2.5 E F0(.).77 E F1 |
| (compgen)108 564 Q F0([)2.5 E F2(option)A F0 2.5(][)C F2(wor)-2.5 E(d) |
| -.37 E F0(])A .012(Generate possible completion matches for)144 576 R F2 |
| (wor)2.513 E(d)-.37 E F0 .013(according to the)2.513 F F2(option)2.513 E |
| F0 .013(s, which may be an)B 2.513(yo)-.15 G(ption)-2.513 E .982 |
| (accepted by the)144 588 R F1(complete)3.482 E F0 -.2(bu)3.481 G .981 |
| (iltin with the e).2 F .981(xception of)-.15 F F1<ad70>3.481 E F0(and) |
| 3.481 E F1<ad72>3.481 E F0 3.481(,a)C .981(nd write the matches to the) |
| -3.481 F 1.415(standard output.)144 600 R 1.415(When using the)6.415 F |
| F1<ad46>3.915 E F0(or)3.915 E F1<ad43>3.915 E F0 1.415(options, the v) |
| 3.915 F 1.415(arious shell v)-.25 F 1.415(ariables set by the pro-)-.25 |
| F(grammable completion f)144 612 Q(acilities, while a)-.1 E -.25(va)-.2 |
| G(ilable, will not ha).25 E .3 -.15(ve u)-.2 H(seful v).15 E(alues.)-.25 |
| E .352(The matches will be generated in the same w)144 636 R .352 |
| (ay as if the programmable completion code had gen-)-.1 F .02(erated th\ |
| em directly from a completion speci\214cation with the same \215ags.)144 |
| 648 R(If)5.02 E F2(wor)2.52 E(d)-.37 E F0 .02(is speci\214ed, only)2.52 |
| F(those completions matching)144 660 Q F2(wor)2.5 E(d)-.37 E F0 |
| (will be displayed.)2.5 E(The return v)144 684 Q |
| (alue is true unless an in)-.25 E -.25(va)-.4 G |
| (lid option is supplied, or no matches were generated.).25 E F1 |
| (complete)108 700.8 Q F0([)3.729 E F1(\255abcdefgjksuv)A F0 3.729(][)C |
| F1<ad6f>-3.729 E F2(comp-option)3.729 E F0 3.729(][)C F1(\255DE)-3.729 E |
| F0 3.728(][)C F1<ad41>-3.728 E F2(action)3.728 E F0 3.728(][)C F1<ad47> |
| -3.728 E F2(globpat)3.728 E F0 3.728(][)C F1<ad57>-3.728 E F2(wor)3.728 |
| E(dlist)-.37 E F0 3.728(][)C F1<ad46>-3.728 E F2(func-)3.728 E(tion)108 |
| 712.8 Q F0 2.5(][)C F1<ad43>-2.5 E F2(command)2.5 E F0(])A([)144 724.8 Q |
| F1<ad58>A F2(\214lterpat)2.5 E F0 2.5(][)C F1<ad50>-2.5 E F2(pr)2.5 E |
| (e\214x)-.37 E F0 2.5(][)C F1<ad53>-2.5 E F2(suf)2.5 E<8c78>-.18 E F0(]) |
| A F2(name)2.5 E F0([)2.5 E F2(name ...)A F0(])A(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(50)185.955 E 0 Cg EP |
| %%Page: 51 51 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(complete \255pr)108 84 Q F0([)2.5 E F1 |
| (\255DE)A F0 2.5(][)C/F2 10/Times-Italic@0 SF(name)-2.5 E F0(...])2.5 E |
| .634(Specify ho)144 96 R 3.134(wa)-.25 G -.18(rg)-3.134 G .634 |
| (uments to each).18 F F2(name)3.134 E F0 .634(should be completed.)3.134 |
| F .633(If the)5.634 F F1<ad70>3.133 E F0 .633 |
| (option is supplied, or if no)3.133 F .139(options are supplied, e)144 |
| 108 R .139(xisting completion speci\214cations are printed in a w)-.15 F |
| .14(ay that allo)-.1 F .14(ws them to be)-.25 F .31(reused as input.)144 |
| 120 R(The)5.31 E F1<ad72>2.81 E F0 .31(option remo)2.81 F -.15(ve)-.15 G |
| 2.81(sac).15 G .31(ompletion speci\214cation for each)-2.81 F F2(name) |
| 2.81 E F0 2.81(,o)C 1.11 -.4(r, i)-2.81 H 2.81(fn).4 G(o)-2.81 E F2 |
| (name)2.81 E F0(s)A 1.346 |
| (are supplied, all completion speci\214cations.)144 132 R(The)6.347 E F1 |
| <ad44>3.847 E F0 1.347(option indicates that the remaining options)3.847 |
| F .5(and actions should apply to the `)144 144 R(`def)-.74 E(ault')-.1 E |
| 3('c)-.74 G .5(ommand completion; that is, completion attempted on)-3 F |
| 3.455(ac)144 156 S .955(ommand for which no completion has pre)-3.455 F |
| .955(viously been de\214ned.)-.25 F(The)5.955 E F1<ad45>3.455 E F0 .955 |
| (option indicates that)3.455 F .065 |
| (the remaining options and actions should apply to `)144 168 R(`empty') |
| -.74 E 2.564('c)-.74 G .064(ommand completion; that is, comple-)-2.564 F |
| (tion attempted on a blank line.)144 180 Q 1.437 |
| (The process of applying these completion speci\214cations when w)144 |
| 204 R 1.438(ord completion is attempted is)-.1 F(described abo)144 216 Q |
| .3 -.15(ve u)-.15 H(nder).15 E F1(Pr)2.5 E(ogrammable Completion)-.18 E |
| F0(.)A .556(Other options, if speci\214ed, ha)144 240 R .856 -.15(ve t) |
| -.2 H .555(he follo).15 F .555(wing meanings.)-.25 F .555(The ar)5.555 F |
| .555(guments to the)-.18 F F1<ad47>3.055 E F0(,)A F1<ad57>3.055 E F0 |
| 3.055(,a)C(nd)-3.055 E F1<ad58>3.055 E F0 .722 |
| (options \(and, if necessary)144 252 R 3.222(,t)-.65 G(he)-3.222 E F1 |
| <ad50>3.222 E F0(and)3.222 E F1<ad53>3.222 E F0 .723 |
| (options\) should be quoted to protect them from e)3.222 F(xpan-)-.15 E |
| (sion before the)144 264 Q F1(complete)2.5 E F0 -.2(bu)2.5 G |
| (iltin is in).2 E -.2(vo)-.4 G -.1(ke).2 G(d.).1 E F1<ad6f>144 276 Q F2 |
| (comp-option)2.5 E F0(The)184 288 Q F2(comp-option)2.791 E F0 .291 |
| (controls se)2.791 F -.15(ve)-.25 G .291(ral aspects of the compspec') |
| .15 F 2.791(sb)-.55 G(eha)-2.791 E .291(vior be)-.2 F .291 |
| (yond the simple)-.15 F(generation of completions.)184 300 Q F2 |
| (comp-option)5 E F0(may be one of:)2.5 E F1(bashdefault)184 312 Q F0 |
| .281(Perform the rest of the def)224 324 R(ault)-.1 E F1(bash)2.781 E F0 |
| .281(completions if the compspec generates no)2.781 F(matches.)224 336 Q |
| F1(default)184 348 Q F0 2.876(Use readline')10 F 5.376(sd)-.55 G(ef) |
| -5.376 E 2.875(ault \214lename completion if the compspec generates no) |
| -.1 F(matches.)224 360 Q F1(dir)184 372 Q(names)-.15 E F0(Perform direc\ |
| tory name completion if the compspec generates no matches.)224 384 Q F1 |
| (\214lenames)184 396 Q F0 -.7(Te)224 408 S .137(ll readline that the co\ |
| mpspec generates \214lenames, so it can perform an).7 F 2.637<798c>-.15 |
| G(le-)-2.637 E .134(name\255speci\214c processing \(lik)224 420 R 2.634 |
| (ea)-.1 G .134(dding a slash to directory names, quoting spe-)-2.634 F |
| .45(cial characters, or suppressing trailing spaces\).)224 432 R .45 |
| (Intended to be used with shell)5.45 F(functions.)224 444 Q F1(nospace) |
| 184 456 Q F0 -.7(Te)6.11 G .22 |
| (ll readline not to append a space \(the def).7 F .22(ault\) to w)-.1 F |
| .22(ords completed at the end)-.1 F(of the line.)224 468 Q F1(plusdirs) |
| 184 480 Q F0 1.985(After an)5.54 F 4.485(ym)-.15 G 1.985 |
| (atches de\214ned by the compspec are generated, directory name)-4.485 F |
| .584(completion is attempted and an)224 492 R 3.084(ym)-.15 G .584 |
| (atches are added to the results of the other)-3.084 F(actions.)224 504 |
| Q F1<ad41>144 516 Q F2(action)2.5 E F0(The)184 528 Q F2(action)2.5 E F0 |
| (may be one of the follo)2.5 E |
| (wing to generate a list of possible completions:)-.25 E F1(alias)184 |
| 540 Q F0(Alias names.)20.55 E(May also be speci\214ed as)5 E F1<ad61>2.5 |
| E F0(.)A F1(arrayv)184 552 Q(ar)-.1 E F0(Array v)224 564 Q |
| (ariable names.)-.25 E F1 4.7(binding Readline)184 576 R F0 -.1(ke)2.5 G |
| 2.5(yb)-.05 G(inding names.)-2.5 E F1 -.2(bu)184 588 S(iltin).2 E F0 |
| (Names of shell b)11.85 E(uiltin commands.)-.2 E |
| (May also be speci\214ed as)5 E F1<ad62>2.5 E F0(.)A F1(command)184 600 |
| Q F0(Command names.)224 612 Q(May also be speci\214ed as)5 E F1<ad63>2.5 |
| E F0(.)A F1(dir)184 624 Q(ectory)-.18 E F0(Directory names.)224 636 Q |
| (May also be speci\214ed as)5 E F1<ad64>2.5 E F0(.)A F1(disabled)184 648 |
| Q F0(Names of disabled shell b)224 660 Q(uiltins.)-.2 E F1(enabled)184 |
| 672 Q F0(Names of enabled shell b)6.66 E(uiltins.)-.2 E F1(export)184 |
| 684 Q F0(Names of e)12.23 E(xported shell v)-.15 E 2.5(ariables. May) |
| -.25 F(also be speci\214ed as)2.5 E F1<ad65>2.5 E F0(.)A F1(\214le)184 |
| 696 Q F0(File names.)27.22 E(May also be speci\214ed as)5 E F1<ad66>2.5 |
| E F0(.)A(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(51)185.955 E 0 |
| Cg EP |
| %%Page: 52 52 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(function)184 84 Q F0 |
| (Names of shell functions.)224 96 Q F1(gr)184 108 Q(oup)-.18 E F0 |
| (Group names.)14.62 E(May also be speci\214ed as)5 E F1<ad67>2.5 E F0(.) |
| A F1(helptopic)184 120 Q F0(Help topics as accepted by the)224 132 Q F1 |
| (help)2.5 E F0 -.2(bu)2.5 G(iltin.).2 E F1(hostname)184 144 Q F0 |
| (Hostnames, as tak)224 156 Q(en from the \214le speci\214ed by the)-.1 E |
| /F2 9/Times-Bold@0 SF(HOSTFILE)2.5 E F0(shell v)2.25 E(ariable.)-.25 E |
| F1(job)184 168 Q F0(Job names, if job control is acti)26.11 E -.15(ve) |
| -.25 G 5(.M).15 G(ay also be speci\214ed as)-5 E F1<ad6a>2.5 E F0(.)A F1 |
| -.1(ke)184 180 S(yw).1 E(ord)-.1 E F0(Shell reserv)224 192 Q(ed w)-.15 E |
| 2.5(ords. May)-.1 F(also be speci\214ed as)2.5 E F1<ad6b>2.5 E F0(.)A F1 |
| (running)184 204 Q F0(Names of running jobs, if job control is acti)5.54 |
| E -.15(ve)-.25 G(.).15 E F1(ser)184 216 Q(vice)-.1 E F0(Service names.) |
| 10.67 E(May also be speci\214ed as)5 E F1<ad73>2.5 E F0(.)A F1(setopt) |
| 184 228 Q F0 -1.11(Va)14.45 G(lid ar)1.11 E(guments for the)-.18 E F1 |
| <ad6f>2.5 E F0(option to the)2.5 E F1(set)2.5 E F0 -.2(bu)2.5 G(iltin.) |
| .2 E F1(shopt)184 240 Q F0(Shell option names as accepted by the)16.66 E |
| F1(shopt)2.5 E F0 -.2(bu)2.5 G(iltin.).2 E F1(signal)184 252 Q F0 |
| (Signal names.)14.99 E F1(stopped)184 264 Q F0 |
| (Names of stopped jobs, if job control is acti)6.66 E -.15(ve)-.25 G(.) |
| .15 E F1(user)184 276 Q F0(User names.)21.67 E |
| (May also be speci\214ed as)5 E F1<ad75>2.5 E F0(.)A F1 -.1(va)184 288 S |
| (riable).1 E F0(Names of all shell v)5.1 E 2.5(ariables. May)-.25 F |
| (also be speci\214ed as)2.5 E F1<ad76>2.5 E F0(.)A F1<ad47>144 300 Q/F3 |
| 10/Times-Italic@0 SF(globpat)2.5 E F0 1.007(The pathname e)184 312 R |
| 1.007(xpansion pattern)-.15 F F3(globpat)3.507 E F0 1.007(is e)3.507 F |
| 1.008(xpanded to generate the possible comple-)-.15 F(tions.)184 324 Q |
| F1<ad57>144 336 Q F3(wor)2.5 E(dlist)-.37 E F0(The)184 348 Q F3(wor)3.64 |
| E(dlist)-.37 E F0 1.14(is split using the characters in the)3.64 F F2 |
| (IFS)3.64 E F0 1.139(special v)3.39 F 1.139(ariable as delimiters, and) |
| -.25 F 2.007(each resultant w)184 360 R 2.007(ord is e)-.1 F 4.507 |
| (xpanded. The)-.15 F 2.008(possible completions are the members of the) |
| 4.507 F(resultant list which match the w)184 372 Q(ord being completed.) |
| -.1 E F1<ad43>144 384 Q F3(command)2.5 E(command)184 396 Q F0 1.056 |
| (is e)3.556 F -.15(xe)-.15 G 1.056(cuted in a subshell en).15 F 1.056 |
| (vironment, and its output is used as the possible)-.4 F(completions.) |
| 184 408 Q F1<ad46>144 420 Q F3(function)2.5 E F0 1.18 |
| (The shell function)184 432 R F3(function)3.68 E F0 1.181(is e)3.681 F |
| -.15(xe)-.15 G 1.181(cuted in the current shell en).15 F 3.681 |
| (vironment. When)-.4 F 1.181(it \214n-)3.681 F .932 |
| (ishes, the possible completions are retrie)184 444 R -.15(ve)-.25 G |
| 3.432(df).15 G .932(rom the v)-3.432 F .932(alue of the)-.25 F F2 |
| (COMPREPL)3.431 E(Y)-.828 E F0(array)3.181 E -.25(va)184 456 S(riable.) |
| .25 E F1<ad58>144 468 Q F3(\214lterpat)2.5 E(\214lterpat)184 480 Q F0 |
| .455(is a pattern as used for pathname e)2.955 F 2.956(xpansion. It)-.15 |
| F .456(is applied to the list of possible)2.956 F 1.596 |
| (completions generated by the preceding options and ar)184 492 R 1.596 |
| (guments, and each completion)-.18 F(matching)184 504 Q F3(\214lterpat) |
| 3.204 E F0 .704(is remo)3.204 F -.15(ve)-.15 G 3.204(df).15 G .704 |
| (rom the list.)-3.204 F 3.204(Al)5.704 G(eading)-3.204 E F1(!)3.204 E F0 |
| (in)3.204 E F3(\214lterpat)3.205 E F0(ne)3.205 E -.05(ga)-.15 G .705 |
| (tes the pattern;).05 F(in this case, an)184 516 Q 2.5(yc)-.15 G |
| (ompletion not matching)-2.5 E F3(\214lterpat)2.5 E F0(is remo)2.5 E |
| -.15(ve)-.15 G(d.).15 E F1<ad50>144 528 Q F3(pr)2.5 E(e\214x)-.37 E(pr) |
| 184 540 Q(e\214x)-.37 E F0 .535(is added at the be)3.035 F .534 |
| (ginning of each possible completion after all other options ha)-.15 F |
| -.15(ve)-.2 G(been applied.)184 552 Q F1<ad53>144 564 Q F3(suf)2.5 E |
| 2.81(\214x suf)-.18 F<8c78>-.18 E F0 |
| (is appended to each possible completion after all other options ha)2.5 |
| E .3 -.15(ve b)-.2 H(een applied.).15 E .466(The return v)144 580.8 R |
| .466(alue is true unless an in)-.25 F -.25(va)-.4 G .466 |
| (lid option is supplied, an option other than).25 F F1<ad70>2.967 E F0 |
| (or)2.967 E F1<ad72>2.967 E F0 .467(is sup-)2.967 F 1.362 |
| (plied without a)144 592.8 R F3(name)3.862 E F0(ar)3.862 E 1.361 |
| (gument, an attempt is made to remo)-.18 F 1.661 -.15(ve a c)-.15 H |
| 1.361(ompletion speci\214cation for a).15 F F3(name)144 604.8 Q F0 |
| (for which no speci\214cation e)2.5 E |
| (xists, or an error occurs adding a completion speci\214cation.)-.15 E |
| F1(compopt)108 621.6 Q F0([)2.5 E F1<ad6f>A F3(option)2.5 E F0 2.5(][)C |
| F1(\255DE)-2.5 E F0 2.5(][)C F1(+o)-2.5 E F3(option)2.5 E F0 2.5(][)C F3 |
| (name)-2.5 E F0(])A .447(Modify completion options for each)144 633.6 R |
| F3(name)2.947 E F0 .447(according to the)2.947 F F3(option)2.947 E F0 |
| .447(s, or for the currently-e)B -.15(xe)-.15 G(cution).15 E .726 |
| (completion if no)144 645.6 R F3(name)3.226 E F0 3.226(sa)C .726 |
| (re supplied.)-3.226 F .725(If no)5.725 F F3(option)3.225 E F0 3.225(sa) |
| C .725(re gi)-3.225 F -.15(ve)-.25 G .725 |
| (n, display the completion options for).15 F(each)144 657.6 Q F3(name) |
| 3.223 E F0 .723(or the current completion.)3.223 F .724(The possible v) |
| 5.724 F .724(alues of)-.25 F F3(option)3.224 E F0 .724(are those v)3.224 |
| F .724(alid for the)-.25 F F1(com-)3.224 E(plete)144 669.6 Q F0 -.2(bu) |
| 2.798 G .298(iltin described abo).2 F -.15(ve)-.15 G 5.297(.T).15 G(he) |
| -5.297 E F1<ad44>2.797 E F0 .297 |
| (option indicates that the remaining options should apply to)2.797 F |
| 1.227(the `)144 681.6 R(`def)-.74 E(ault')-.1 E 3.727('c)-.74 G 1.228(o\ |
| mmand completion; that is, completion attempted on a command for which \ |
| no)-3.727 F 2.178(completion has pre)144 693.6 R 2.178 |
| (viously been de\214ned.)-.25 F(The)7.178 E F1<ad45>4.678 E F0 2.177 |
| (option indicates that the remaining options)4.677 F(should apply to `) |
| 144 705.6 Q(`empty')-.74 E 2.5('c)-.74 G |
| (ommand completion; that is, completion attempted on a blank line.)-2.5 |
| E .327(The return v)108 722.4 R .327(alue is true unless an in)-.25 F |
| -.25(va)-.4 G .327 |
| (lid option is supplied, an attempt is made to modify the options for a) |
| .25 F(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(52)185.955 E 0 Cg |
| EP |
| %%Page: 53 53 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Italic@0 SF(name)108 84 Q F0 |
| (for which no completion speci\214cation e)2.5 E |
| (xists, or an output error occurs.)-.15 E/F2 10/Times-Bold@0 SF |
| (continue)108 100.8 Q F0([)2.5 E F1(n)A F0(])A 1.754(Resume the ne)144 |
| 112.8 R 1.754(xt iteration of the enclosing)-.15 F F2 -.25(fo)4.254 G(r) |
| .25 E F0(,)A F2(while)4.254 E F0(,)A F2(until)4.254 E F0 4.254(,o)C(r) |
| -4.254 E F2(select)4.254 E F0 4.253(loop. If)4.254 F F1(n)4.613 E F0 |
| 1.753(is speci\214ed,)4.493 F 1.208(resume at the)144 124.8 R F1(n)3.709 |
| E F0 1.209(th enclosing loop.)B F1(n)6.569 E F0 1.209(must be)3.949 F/F3 |
| 10/Symbol SF<b3>3.709 E F0 3.709(1. If)3.709 F F1(n)4.069 E F0 1.209 |
| (is greater than the number of enclosing)3.949 F .514 |
| (loops, the last enclosing loop \(the `)144 136.8 R(`top-le)-.74 E -.15 |
| (ve)-.25 G(l').15 E 3.014('l)-.74 G .514(oop\) is resumed.)-3.014 F .513 |
| (The return v)5.513 F .513(alue is 0 unless)-.25 F F1(n)3.013 E F0(is) |
| 3.013 E(not greater than or equal to 1.)144 148.8 Q F2(declar)108 165.6 |
| Q(e)-.18 E F0([)2.5 E F2(\255aAfFilrtux)A F0 2.5(][)C F2<ad70>-2.5 E F0 |
| 2.5(][)C F1(name)-2.5 E F0([=)A F1(value)A F0 2.5(].)C(..])-2.5 E F2 |
| (typeset)108 177.6 Q F0([)2.5 E F2(\255aAfFilrtux)A F0 2.5(][)C F2<ad70> |
| -2.5 E F0 2.5(][)C F1(name)-2.5 E F0([=)A F1(value)A F0 2.5(].)C(..]) |
| -2.5 E 1.264(Declare v)144 189.6 R 1.264(ariables and/or gi)-.25 F 1.564 |
| -.15(ve t)-.25 H 1.264(hem attrib).15 F 3.765(utes. If)-.2 F(no)3.765 E |
| F1(name)3.765 E F0 3.765(sa)C 1.265(re gi)-3.765 F -.15(ve)-.25 G 3.765 |
| (nt).15 G 1.265(hen display the v)-3.765 F 1.265(alues of)-.25 F -.25 |
| (va)144 201.6 S 3.483(riables. The).25 F F2<ad70>3.483 E F0 .983 |
| (option will display the attrib)3.483 F .983(utes and v)-.2 F .982 |
| (alues of each)-.25 F F1(name)3.482 E F0 5.982(.W).18 G(hen)-5.982 E F2 |
| <ad70>3.482 E F0 .982(is used)3.482 F(with)144 213.6 Q F1(name)3.579 E |
| F0(ar)3.579 E 1.079(guments, additional options are ignored.)-.18 F |
| (When)6.079 E F2<ad70>3.579 E F0 1.079(is supplied without)3.579 F F1 |
| (name)3.58 E F0(ar)3.58 E(gu-)-.18 E .151 |
| (ments, it will display the attrib)144 225.6 R .151(utes and v)-.2 F |
| .151(alues of all v)-.25 F .15(ariables ha)-.25 F .15(ving the attrib) |
| -.2 F .15(utes speci\214ed by the)-.2 F .046(additional options.)144 |
| 237.6 R .046(If no other options are supplied with)5.046 F F2<ad70>2.547 |
| E F0(,)A F2(declar)2.547 E(e)-.18 E F0 .047(will display the attrib) |
| 2.547 F .047(utes and)-.2 F -.25(va)144 249.6 S 1.363 |
| (lues of all shell v).25 F 3.863(ariables. The)-.25 F F2<ad66>3.863 E F0 |
| 1.362(option will restrict the display to shell functions.)3.863 F(The) |
| 6.362 E F2<ad46>3.862 E F0 2.422(option inhibits the display of functio\ |
| n de\214nitions; only the function name and attrib)144 261.6 R 2.423 |
| (utes are)-.2 F 2.664(printed. If)144 273.6 R(the)2.664 E F2(extdeb) |
| 2.664 E(ug)-.2 E F0 .164(shell option is enabled using)2.664 F F2(shopt) |
| 2.664 E F0 2.664(,t)C .163(he source \214le name and line number)-2.664 |
| F 1.382(where the function is de\214ned are displayed as well.)144 285.6 |
| R(The)6.382 E F2<ad46>3.882 E F0 1.382(option implies)3.882 F F2<ad66> |
| 3.882 E F0 6.382(.T)C 1.382(he follo)-6.382 F(wing)-.25 E .794 |
| (options can be used to restrict output to v)144 297.6 R .794 |
| (ariables with the speci\214ed attrib)-.25 F .793(ute or to gi)-.2 F |
| 1.093 -.15(ve v)-.25 H(ariables)-.1 E(attrib)144 309.6 Q(utes:)-.2 E F2 |
| <ad61>144 321.6 Q F0(Each)25.3 E F1(name)2.5 E F0(is an inde)2.5 E -.15 |
| (xe)-.15 G 2.5(da).15 G(rray v)-2.5 E(ariable \(see)-.25 E F2(Arrays)2.5 |
| E F0(abo)2.5 E -.15(ve)-.15 G(\).).15 E F2<ad41>144 333.6 Q F0(Each) |
| 23.08 E F1(name)2.5 E F0(is an associati)2.5 E .3 -.15(ve a)-.25 H |
| (rray v).15 E(ariable \(see)-.25 E F2(Arrays)2.5 E F0(abo)2.5 E -.15(ve) |
| -.15 G(\).).15 E F2<ad66>144 345.6 Q F0(Use function names only)26.97 E |
| (.)-.65 E F2<ad69>144 357.6 Q F0 .557(The v)27.52 F .558 |
| (ariable is treated as an inte)-.25 F .558(ger; arithmetic e)-.15 F -.25 |
| (va)-.25 G .558(luation \(see).25 F/F4 9/Times-Bold@0 SF .558 |
| (ARITHMETIC EV)3.058 F(ALU)-1.215 E(A-)-.54 E(TION)180 369.6 Q F0(abo) |
| 2.25 E -.15(ve)-.15 G 2.5(\)i).15 G 2.5(sp)-2.5 G(erformed when the v) |
| -2.5 E(ariable is assigned a v)-.25 E(alue.)-.25 E F2<ad6c>144 381.6 Q |
| F0 .91(When the v)27.52 F .909(ariable is assigned a v)-.25 F .909 |
| (alue, all upper)-.25 F .909(-case characters are con)-.2 F -.15(ve)-.4 |
| G .909(rted to lo).15 F(wer)-.25 E(-)-.2 E 2.5(case. The)180 393.6 R |
| (upper)2.5 E(-case attrib)-.2 E(ute is disabled.)-.2 E F2<ad72>144 405.6 |
| Q F0(Mak)25.86 E(e)-.1 E F1(name)5.046 E F0 5.046(sr)C(eadonly)-5.046 E |
| 7.546(.T)-.65 G 2.546(hese names cannot then be assigned v)-7.546 F |
| 2.547(alues by subsequent)-.25 F(assignment statements or unset.)180 |
| 417.6 Q F2<ad74>144 429.6 Q F0(Gi)26.97 E .73 -.15(ve e)-.25 H(ach).15 E |
| F1(name)2.93 E F0(the)2.929 E F1(tr)2.929 E(ace)-.15 E F0(attrib)2.929 E |
| 2.929(ute. T)-.2 F .429(raced functions inherit the)-.35 F F2(DEB)2.929 |
| E(UG)-.1 E F0(and)2.929 E F2(RETURN)2.929 E F0 |
| (traps from the calling shell.)180 441.6 Q(The trace attrib)5 E |
| (ute has no special meaning for v)-.2 E(ariables.)-.25 E F2<ad75>144 |
| 453.6 Q F0 .909(When the v)24.74 F .909(ariable is assigned a v)-.25 F |
| .909(alue, all lo)-.25 F(wer)-.25 E .909(-case characters are con)-.2 F |
| -.15(ve)-.4 G .91(rted to upper).15 F(-)-.2 E 2.5(case. The)180 465.6 R |
| (lo)2.5 E(wer)-.25 E(-case attrib)-.2 E(ute is disabled.)-.2 E F2<ad78> |
| 144 477.6 Q F0(Mark)25.3 E F1(name)2.5 E F0 2.5(sf)C(or e)-2.5 E |
| (xport to subsequent commands via the en)-.15 E(vironment.)-.4 E .121 |
| (Using `+' instead of `\255' turns of)144 494.4 R 2.621(ft)-.25 G .121 |
| (he attrib)-2.621 F .121(ute instead, with the e)-.2 F .12 |
| (xceptions that)-.15 F F2(+a)2.62 E F0 .12(may not be used)2.62 F .644 |
| (to destro)144 506.4 R 3.144(ya)-.1 G 3.144(na)-3.144 G .644(rray v) |
| -3.144 F .644(ariable and)-.25 F F2(+r)3.145 E F0 .645(will not remo) |
| 3.145 F .945 -.15(ve t)-.15 H .645(he readonly attrib).15 F 3.145 |
| (ute. When)-.2 F .645(used in a func-)3.145 F 1.945(tion, mak)144 518.4 |
| R 1.945(es each)-.1 F F1(name)4.445 E F0 1.945(local, as with the)4.445 |
| F F2(local)4.444 E F0 4.444(command. If)4.444 F 4.444(av)4.444 G 1.944 |
| (ariable name is follo)-4.694 F 1.944(wed by)-.25 F(=)144 530.4 Q F1 |
| (value)A F0 3.238(,t)C .738(he v)-3.238 F .738(alue of the v)-.25 F .738 |
| (ariable is set to)-.25 F F1(value)3.238 E F0 5.738(.T)C .738 |
| (he return v)-5.738 F .739(alue is 0 unless an in)-.25 F -.25(va)-.4 G |
| .739(lid option is).25 F .603 |
| (encountered, an attempt is made to de\214ne a function using)144 542.4 |
| R/F5 10/Courier@0 SF .603(\255f foo=bar)3.103 F F0 3.103(,a)C 3.103(na) |
| -3.103 G .603(ttempt is made to)-3.103 F 1.242(assign a v)144 554.4 R |
| 1.242(alue to a readonly v)-.25 F 1.242 |
| (ariable, an attempt is made to assign a v)-.25 F 1.243 |
| (alue to an array v)-.25 F(ariable)-.25 E 1.386 |
| (without using the compound assignment syntax \(see)144 566.4 R F2 |
| (Arrays)3.886 E F0(abo)3.886 E -.15(ve)-.15 G 1.386(\), one of the).15 F |
| F1(names)3.886 E F0 1.386(is not a)3.886 F -.25(va)144 578.4 S .171 |
| (lid shell v).25 F .171(ariable name, an attempt is made to turn of)-.25 |
| F 2.671(fr)-.25 G .171(eadonly status for a readonly v)-2.671 F .172 |
| (ariable, an)-.25 F .96(attempt is made to turn of)144 590.4 R 3.46(fa) |
| -.25 G .96(rray status for an array v)-3.46 F .96 |
| (ariable, or an attempt is made to display a)-.25 F(non-e)144 602.4 Q |
| (xistent function with)-.15 E F2<ad66>2.5 E F0(.)A F2(dirs [+)108 619.2 |
| Q F1(n)A F2 2.5(][)C<ad>-2.5 E F1(n)A F2 2.5(][)C(\255cplv])-2.5 E F0 |
| -.4(Wi)144 631.2 S .328 |
| (thout options, displays the list of currently remembered directories.) |
| .4 F .329(The def)5.329 F .329(ault display is on a)-.1 F 1.238 |
| (single line with directory names separated by spaces.)144 643.2 R 1.238 |
| (Directories are added to the list with the)6.238 F F2(pushd)144 655.2 Q |
| F0(command; the)2.5 E F2(popd)2.5 E F0(command remo)2.5 E -.15(ve)-.15 G |
| 2.5(se).15 G(ntries from the list.)-2.5 E F2(+)144 667.2 Q F1(n)A F0 |
| 1.564(Displays the)25.3 F F1(n)4.064 E F0 1.565 |
| (th entry counting from the left of the list sho)B 1.565(wn by)-.25 F F2 |
| (dirs)4.065 E F0 1.565(when in)4.065 F -.2(vo)-.4 G -.1(ke).2 G(d).1 E |
| (without options, starting with zero.)180 679.2 Q F2<ad>144 691.2 Q F1 |
| (n)A F0 1.194(Displays the)25.3 F F1(n)3.694 E F0 1.194 |
| (th entry counting from the right of the list sho)B 1.194(wn by)-.25 F |
| F2(dirs)3.694 E F0 1.194(when in)3.694 F -.2(vo)-.4 G -.1(ke).2 G(d).1 E |
| (without options, starting with zero.)180 703.2 Q F2<ad63>144 715.2 Q F0 |
| (Clears the directory stack by deleting all of the entries.)25.86 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(53)185.955 E 0 Cg EP |
| %%Page: 54 54 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF<ad6c>144 84 Q F0 .324 |
| (Produces a longer listing; the def)27.52 F .324 |
| (ault listing format uses a tilde to denote the home direc-)-.1 F(tory) |
| 180 96 Q(.)-.65 E F1<ad70>144 108 Q F0 |
| (Print the directory stack with one entry per line.)24.74 E F1<ad76>144 |
| 120 Q F0 .273(Print the directory stack with one entry per line, pre\ |
| \214xing each entry with its inde)25.3 F 2.772(xi)-.15 G 2.772(nt)-2.772 |
| G(he)-2.772 E(stack.)180 132 Q .257(The return v)144 148.8 R .258 |
| (alue is 0 unless an in)-.25 F -.25(va)-.4 G .258 |
| (lid option is supplied or).25 F/F2 10/Times-Italic@0 SF(n)2.758 E F0 |
| (inde)2.758 E -.15(xe)-.15 G 2.758(sb).15 G -.15(ey)-2.758 G .258 |
| (ond the end of the direc-).15 F(tory stack.)144 160.8 Q F1(diso)108 |
| 177.6 Q(wn)-.1 E F0([)2.5 E F1(\255ar)A F0 2.5(][)C F1<ad68>-2.5 E F0 |
| 2.5(][)C F2(jobspec)-2.5 E F0(...])2.5 E -.4(Wi)144 189.6 S .295 |
| (thout options, each).4 F F2(jobspec)4.535 E F0 .295(is remo)3.105 F |
| -.15(ve)-.15 G 2.795(df).15 G .295(rom the table of acti)-2.795 F .595 |
| -.15(ve j)-.25 H 2.795(obs. If).15 F F2(jobspec)4.535 E F0 .295 |
| (is not present,)3.105 F .422(and neither)144 201.6 R F1<ad61>2.922 E F0 |
| (nor)2.922 E F1<ad72>2.922 E F0 .422(is supplied, the shell')2.922 F |
| 2.922(sn)-.55 G .422(otion of the)-2.922 F F2(curr)2.923 E .423(ent job) |
| -.37 F F0 .423(is used.)2.923 F .423(If the)5.423 F F1<ad68>2.923 E F0 |
| .423(option is)2.923 F(gi)144 213.6 Q -.15(ve)-.25 G .141(n, each).15 F |
| F2(jobspec)4.381 E F0 .141(is not remo)2.951 F -.15(ve)-.15 G 2.641(df) |
| .15 G .141(rom the table, b)-2.641 F .141(ut is mark)-.2 F .141 |
| (ed so that)-.1 F/F3 9/Times-Bold@0 SF(SIGHUP)2.641 E F0 .14 |
| (is not sent to the)2.39 F .004(job if the shell recei)144 225.6 R -.15 |
| (ve)-.25 G 2.504(sa).15 G F3(SIGHUP)A/F4 9/Times-Roman@0 SF(.)A F0 .004 |
| (If no)4.504 F F2(jobspec)4.244 E F0 .004(is present, and neither the) |
| 2.814 F F1<ad61>2.504 E F0 .005(nor the)2.504 F F1<ad72>2.505 E F0 .005 |
| (option is)2.505 F 1.229(supplied, the)144 237.6 R F2(curr)3.729 E 1.229 |
| (ent job)-.37 F F0 1.229(is used.)3.729 F 1.229(If no)6.229 F F2 |
| (jobspec)5.469 E F0 1.229(is supplied, the)4.039 F F1<ad61>3.729 E F0 |
| 1.228(option means to remo)3.729 F 1.528 -.15(ve o)-.15 H(r).15 E .656 |
| (mark all jobs; the)144 249.6 R F1<ad72>3.156 E F0 .657 |
| (option without a)3.156 F F2(jobspec)4.897 E F0(ar)3.467 E .657 |
| (gument restricts operation to running jobs.)-.18 F(The)5.657 E |
| (return v)144 261.6 Q(alue is 0 unless a)-.25 E F2(jobspec)4.24 E F0 |
| (does not specify a v)2.81 E(alid job)-.25 E(.)-.4 E F1(echo)108 278.4 Q |
| F0([)2.5 E F1(\255neE)A F0 2.5(][)C F2(ar)-2.5 E(g)-.37 E F0(...])2.5 E |
| .395(Output the)144 290.4 R F2(ar)2.895 E(g)-.37 E F0 .395 |
| (s, separated by spaces, follo)B .395(wed by a ne)-.25 F 2.895 |
| (wline. The)-.25 F .394(return status is al)2.895 F -.1(wa)-.1 G .394 |
| (ys 0.).1 F(If)5.394 E F1<ad6e>2.894 E F0 .548 |
| (is speci\214ed, the trailing ne)144 302.4 R .548(wline is suppressed.) |
| -.25 F .548(If the)5.548 F F1<ad65>3.048 E F0 .548(option is gi)3.048 F |
| -.15(ve)-.25 G .548(n, interpretation of the fol-).15 F(lo)144 314.4 Q |
| .053(wing backslash-escaped characters is enabled.)-.25 F(The)5.053 E F1 |
| <ad45>2.553 E F0 .052(option disables the interpretation of these)2.552 |
| F 1.502(escape characters, e)144 326.4 R -.15(ve)-.25 G 4.002(no).15 G |
| 4.002(ns)-4.002 G 1.502(ystems where the)-4.002 F 4.002(ya)-.15 G 1.502 |
| (re interpreted by def)-4.002 F 4.003(ault. The)-.1 F F1(xpg_echo)4.003 |
| E F0(shell)4.003 E .009 |
| (option may be used to dynamically determine whether or not)144 338.4 R |
| F1(echo)2.509 E F0 -.15(ex)2.509 G .009(pands these escape characters) |
| .15 F .659(by def)144 350.4 R(ault.)-.1 E F1(echo)5.659 E F0 .659 |
| (does not interpret)3.159 F F1<adad>3.159 E F0 .659 |
| (to mean the end of options.)3.159 F F1(echo)5.66 E F0 .66 |
| (interprets the follo)3.16 F(wing)-.25 E(escape sequences:)144 362.4 Q |
| F1(\\a)144 374.4 Q F0(alert \(bell\))28.22 E F1(\\b)144 386.4 Q F0 |
| (backspace)27.66 E F1(\\c)144 398.4 Q F0(suppress further output)28.78 E |
| F1(\\e)144 410.4 Q F0(an escape character)28.78 E F1(\\f)144 422.4 Q F0 |
| (form feed)29.89 E F1(\\n)144 434.4 Q F0(ne)27.66 E 2.5(wl)-.25 G(ine) |
| -2.5 E F1(\\r)144 446.4 Q F0(carriage return)28.78 E F1(\\t)144 458.4 Q |
| F0(horizontal tab)29.89 E F1(\\v)144 470.4 Q F0 -.15(ve)28.22 G |
| (rtical tab).15 E F1(\\\\)144 482.4 Q F0(backslash)30.44 E F1(\\0)144 |
| 494.4 Q F2(nnn)A F0(the eight-bit character whose v)13.22 E |
| (alue is the octal v)-.25 E(alue)-.25 E F2(nnn)2.5 E F0 |
| (\(zero to three octal digits\))2.5 E F1(\\x)144 506.4 Q F2(HH)A F0 |
| (the eight-bit character whose v)13.78 E(alue is the he)-.25 E |
| (xadecimal v)-.15 E(alue)-.25 E F2(HH)2.5 E F0(\(one or tw)2.5 E 2.5(oh) |
| -.1 G .3 -.15(ex d)-2.5 H(igits\)).15 E F1(enable)108 523.2 Q F0([)2.5 E |
| F1<ad61>A F0 2.5(][)C F1(\255dnps)-2.5 E F0 2.5(][)C F1<ad66>-2.5 E F2 |
| (\214lename)2.5 E F0 2.5(][)C F2(name)-2.5 E F0(...])2.5 E .278 |
| (Enable and disable b)144 535.2 R .278(uiltin shell commands.)-.2 F .278 |
| (Disabling a b)5.278 F .278(uiltin allo)-.2 F .278 |
| (ws a disk command which has)-.25 F .833(the same name as a shell b)144 |
| 547.2 R .834(uiltin to be e)-.2 F -.15(xe)-.15 G .834 |
| (cuted without specifying a full pathname, e).15 F -.15(ve)-.25 G 3.334 |
| (nt).15 G(hough)-3.334 E .99(the shell normally searches for b)144 559.2 |
| R .989(uiltins before disk commands.)-.2 F(If)5.989 E F1<ad6e>3.489 E F0 |
| .989(is used, each)3.489 F F2(name)3.489 E F0 .989(is dis-)3.489 F 1.581 |
| (abled; otherwise,)144 571.2 R F2(names)4.082 E F0 1.582(are enabled.) |
| 4.082 F -.15(Fo)6.582 G 4.082(re).15 G 1.582(xample, to use the)-4.232 F |
| F1(test)4.082 E F0 1.582(binary found via the)4.082 F F3 -.666(PA)4.082 |
| G(TH)-.189 E F0 .081(instead of the shell b)144 583.2 R .081(uiltin v) |
| -.2 F .081(ersion, run)-.15 F/F5 10/Courier@0 SF .081(enable -n test) |
| 2.581 F F0 5.081(.T)C(he)-5.081 E F1<ad66>2.58 E F0 .08 |
| (option means to load the ne)2.58 F(w)-.25 E -.2(bu)144 595.2 S 1.524 |
| (iltin command).2 F F2(name)4.384 E F0 1.524(from shared object)4.204 F |
| F2(\214lename)4.024 E F0 4.024(,o).18 G 4.024(ns)-4.024 G 1.524 |
| (ystems that support dynamic loading.)-4.024 F(The)144 607.2 Q F1<ad64> |
| 2.867 E F0 .367(option will delete a b)2.867 F .367(uiltin pre)-.2 F |
| .367(viously loaded with)-.25 F F1<ad66>2.866 E F0 5.366(.I)C 2.866(fn) |
| -5.366 G(o)-2.866 E F2(name)2.866 E F0(ar)2.866 E .366(guments are gi) |
| -.18 F -.15(ve)-.25 G .366(n, or).15 F .398(if the)144 619.2 R F1<ad70> |
| 2.898 E F0 .399(option is supplied, a list of shell b)2.899 F .399 |
| (uiltins is printed.)-.2 F -.4(Wi)5.399 G .399(th no other option ar).4 |
| F .399(guments, the)-.18 F .099(list consists of all enabled shell b)144 |
| 631.2 R 2.598(uiltins. If)-.2 F F1<ad6e>2.598 E F0 .098 |
| (is supplied, only disabled b)2.598 F .098(uiltins are printed.)-.2 F |
| (If)5.098 E F1<ad61>2.598 E F0 1.916 |
| (is supplied, the list printed includes all b)144 643.2 R 1.916 |
| (uiltins, with an indication of whether or not each is)-.2 F 2.879 |
| (enabled. If)144 655.2 R F1<ad73>2.879 E F0 .379 |
| (is supplied, the output is restricted to the POSIX)2.879 F F2(special) |
| 2.879 E F0 -.2(bu)2.878 G 2.878(iltins. The).2 F .378(return v)2.878 F |
| (alue)-.25 E .994(is 0 unless a)144 667.2 R F2(name)3.854 E F0 .994 |
| (is not a shell b)3.674 F .994(uiltin or there is an error loading a ne) |
| -.2 F 3.495(wb)-.25 G .995(uiltin from a shared)-3.695 F(object.)144 |
| 679.2 Q F1 -2.3 -.15(ev a)108 696 T(l).15 E F0([)2.5 E F2(ar)A(g)-.37 E |
| F0(...])2.5 E(The)144 708 Q F2(ar)3.171 E(g)-.37 E F0 3.171(sa)C .671 |
| (re read and concatenated together into a single command.)-3.171 F .67 |
| (This command is then read)5.67 F .495(and e)144 720 R -.15(xe)-.15 G |
| .495(cuted by the shell, and its e).15 F .495 |
| (xit status is returned as the v)-.15 F .495(alue of)-.25 F F1 -2.3 -.15 |
| (ev a)2.995 H(l).15 E F0 5.495(.I)C 2.995(ft)-5.495 G .495(here are no) |
| -2.995 F F2(ar)2.995 E(gs)-.37 E F0(,).27 E(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(54)185.955 E 0 Cg EP |
| %%Page: 55 55 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E(or only null ar)144 84 Q(guments,)-.18 E/F1 10/Times-Bold@0 SF |
| -2.3 -.15(ev a)2.5 H(l).15 E F0(returns 0.)2.5 E F1(exec)108 100.8 Q F0 |
| ([)2.5 E F1(\255cl)A F0 2.5(][)C F1<ad61>-2.5 E/F2 10/Times-Italic@0 SF |
| (name)2.5 E F0 2.5(][)C F2(command)-2.5 E F0([)2.5 E F2(ar)A(guments) |
| -.37 E F0(]])A(If)144 112.8 Q F2(command)3.006 E F0 .306 |
| (is speci\214ed, it replaces the shell.)3.576 F .305(No ne)5.305 F 2.805 |
| (wp)-.25 G .305(rocess is created.)-2.805 F(The)5.305 E F2(ar)3.135 E |
| (guments)-.37 E F0(become)3.075 E .176(the ar)144 124.8 R .176 |
| (guments to)-.18 F F2(command)2.676 E F0 5.176(.I)C 2.676(ft)-5.176 G |
| (he)-2.676 E F1<ad6c>2.676 E F0 .176 |
| (option is supplied, the shell places a dash at the be)2.676 F .177 |
| (ginning of)-.15 F .5(the zeroth ar)144 136.8 R .5(gument passed to)-.18 |
| F F2(command)3 E F0 5.499(.T).77 G .499(his is what)-5.499 F F2(lo)2.999 |
| E(gin)-.1 E F0 .499(\(1\) does.).24 F(The)5.499 E F1<ad63>2.999 E F0 |
| .499(option causes)2.999 F F2(com-)3.199 E(mand)144 148.8 Q F0 .638 |
| (to be e)3.908 F -.15(xe)-.15 G .638(cuted with an empty en).15 F 3.138 |
| (vironment. If)-.4 F F1<ad61>3.138 E F0 .638 |
| (is supplied, the shell passes)3.138 F F2(name)3.499 E F0 .639(as the) |
| 3.319 F 1.078(zeroth ar)144 160.8 R 1.077(gument to the e)-.18 F -.15 |
| (xe)-.15 G 1.077(cuted command.).15 F(If)6.077 E F2(command)3.777 E F0 |
| 1.077(cannot be e)4.347 F -.15(xe)-.15 G 1.077(cuted for some reason, a) |
| .15 F(non-interacti)144 172.8 Q .617 -.15(ve s)-.25 H .317(hell e).15 F |
| .317(xits, unless the shell option)-.15 F F1(execfail)2.817 E F0 .318 |
| (is enabled, in which case it returns f)2.817 F(ail-)-.1 E 2.505 |
| (ure. An)144 184.8 R(interacti)2.505 E .305 -.15(ve s)-.25 H .005 |
| (hell returns f).15 F .005(ailure if the \214le cannot be e)-.1 F -.15 |
| (xe)-.15 G 2.505(cuted. If).15 F F2(command)2.705 E F0 .005 |
| (is not speci\214ed,)3.275 F(an)144 196.8 Q 3.036(yr)-.15 G .536 |
| (edirections tak)-3.036 F 3.036(ee)-.1 G -.25(ff)-3.036 G .536 |
| (ect in the current shell, and the return status is 0.).25 F .536 |
| (If there is a redirection)5.536 F(error)144 208.8 Q 2.5(,t)-.4 G |
| (he return status is 1.)-2.5 E F1(exit)108 225.6 Q F0([)2.5 E F2(n)A F0 |
| 6.29(]C)C .096(ause the shell to e)-6.29 F .096(xit with a status of) |
| -.15 F F2(n)2.596 E F0 5.096(.I)C(f)-5.096 E F2(n)2.955 E F0 .095 |
| (is omitted, the e)2.835 F .095(xit status is that of the last command) |
| -.15 F -.15(exe)144 237.6 S 2.5(cuted. A).15 F(trap on)2.5 E/F3 9 |
| /Times-Bold@0 SF(EXIT)2.5 E F0(is e)2.25 E -.15(xe)-.15 G |
| (cuted before the shell terminates.).15 E F1(export)108 254.4 Q F0([)2.5 |
| E F1(\255fn)A F0 2.5(][).833 G F2(name)-2.5 E F0([=)A F2(wor)A(d)-.37 E |
| F0(]] ...)A F1(export \255p)108 266.4 Q F0 .256(The supplied)144 278.4 R |
| F2(names)3.117 E F0 .257(are mark)3.027 F .257(ed for automatic e)-.1 F |
| .257(xport to the en)-.15 F .257(vironment of subsequently e)-.4 F -.15 |
| (xe)-.15 G(cuted).15 E 2.627(commands. If)144 290.4 R(the)2.627 E F1 |
| <ad66>2.627 E F0 .127(option is gi)2.627 F -.15(ve)-.25 G .127(n, the) |
| .15 F F2(names)2.987 E F0 .127(refer to functions.)2.897 F .127(If no) |
| 5.127 F F2(names)2.987 E F0 .127(are gi)2.897 F -.15(ve)-.25 G .126 |
| (n, or if the).15 F F1<ad70>144 302.4 Q F0 .659 |
| (option is supplied, a list of all names that are e)3.159 F .66 |
| (xported in this shell is printed.)-.15 F(The)5.66 E F1<ad6e>3.16 E F0 |
| (option)3.16 E 1.587(causes the e)144 314.4 R 1.587 |
| (xport property to be remo)-.15 F -.15(ve)-.15 G 4.086(df).15 G 1.586 |
| (rom each)-4.086 F F2(name)4.086 E F0 6.586(.I)C 4.086(fav)-6.586 G |
| 1.586(ariable name is follo)-4.336 F 1.586(wed by)-.25 F(=)144 326.4 Q |
| F2(wor)A(d)-.37 E F0 2.803(,t)C .303(he v)-2.803 F .303(alue of the v) |
| -.25 F .304(ariable is set to)-.25 F F2(wor)2.804 E(d)-.37 E F0(.)A F1 |
| (export)5.304 E F0 .304(returns an e)2.804 F .304 |
| (xit status of 0 unless an in)-.15 F -.25(va)-.4 G(lid).25 E .294 |
| (option is encountered, one of the)144 338.4 R F2(names)2.793 E F0 .293 |
| (is not a v)2.793 F .293(alid shell v)-.25 F .293(ariable name, or)-.25 |
| F F1<ad66>2.793 E F0 .293(is supplied with a)2.793 F F2(name)144.36 |
| 350.4 Q F0(that is not a function.)2.68 E F1(fc)108 367.2 Q F0([)2.5 E |
| F1<ad65>A F2(ename)2.5 E F0 2.5(][)C F1(\255lnr)-2.5 E F0 2.5(][)C F2 |
| <8c72>-2.5 E(st)-.1 E F0 2.5(][)C F2(last)-2.5 E F0(])A F1(fc \255s)108 |
| 379.2 Q F0([)2.5 E F2(pat)A F0(=)A F2 -.37(re)C(p).37 E F0 2.5(][)C F2 |
| (cmd)-2.5 E F0(])A .477(Fix Command.)144 391.2 R .478 |
| (In the \214rst form, a range of commands from)5.477 F F2<8c72>4.888 E |
| (st)-.1 E F0(to)3.658 E F2(last)3.068 E F0 .478 |
| (is selected from the his-)3.658 F .882(tory list.)144 403.2 R F2 -.45 |
| (Fi)5.882 G -.1(rs).45 G(t).1 E F0(and)4.062 E F2(last)3.472 E F0 .882 |
| (may be speci\214ed as a string \(to locate the last command be)4.062 F |
| .881(ginning with)-.15 F .797(that string\) or as a number \(an inde)144 |
| 415.2 R 3.297(xi)-.15 G .797(nto the history list, where a ne)-3.297 F |
| -.05(ga)-.15 G(ti).05 E 1.097 -.15(ve n)-.25 H .797(umber is used as an) |
| .15 F(of)144 427.2 Q .277(fset from the current command number\).)-.25 F |
| (If)5.277 E F2(last)2.867 E F0 .276 |
| (is not speci\214ed it is set to the current command)3.457 F .092 |
| (for listing \(so that)144 439.2 R/F4 10/Courier@0 SF .092 |
| (fc \255l \25510)2.592 F F0 .092(prints the last 10 commands\) and to) |
| 2.592 F F2<8c72>4.502 E(st)-.1 E F0 2.592(otherwise. If)3.272 F F2<8c72> |
| 4.502 E(st)-.1 E F0 .093(is not)3.273 F |
| (speci\214ed it is set to the pre)144 451.2 Q |
| (vious command for editing and \25516 for listing.)-.25 E(The)144 475.2 |
| Q F1<ad6e>2.522 E F0 .022 |
| (option suppresses the command numbers when listing.)2.522 F(The)5.022 E |
| F1<ad72>2.522 E F0 .022(option re)2.522 F -.15(ve)-.25 G .022 |
| (rses the order of).15 F .438(the commands.)144 487.2 R .438(If the) |
| 5.438 F F1<ad6c>2.938 E F0 .438(option is gi)2.938 F -.15(ve)-.25 G .438 |
| (n, the commands are listed on standard output.).15 F(Otherwise,)5.438 E |
| .335(the editor gi)144 499.2 R -.15(ve)-.25 G 2.835(nb).15 G(y)-2.835 E |
| F2(ename)3.025 E F0 .335(is in)3.015 F -.2(vo)-.4 G -.1(ke).2 G 2.835 |
| (do).1 G 2.835(na\214)-2.835 G .335(le containing those commands.)-2.835 |
| F(If)5.334 E F2(ename)3.024 E F0 .334(is not gi)3.014 F -.15(ve)-.25 G |
| (n,).15 E .63(the v)144 511.2 R .63(alue of the)-.25 F F3(FCEDIT)3.13 E |
| F0 -.25(va)2.88 G .631(riable is used, and the v).25 F .631(alue of)-.25 |
| F F3(EDIT)3.131 E(OR)-.162 E F0(if)2.881 E F3(FCEDIT)3.131 E F0 .631 |
| (is not set.)2.881 F .631(If nei-)5.631 F .951(ther v)144 523.2 R .951 |
| (ariable is set,)-.25 F F2(vi)5.117 E F0 .951(is used.)5.117 F .95 |
| (When editing is complete, the edited commands are echoed and)5.951 F |
| -.15(exe)144 535.2 S(cuted.).15 E .039(In the second form,)144 559.2 R |
| F2(command)2.539 E F0 .039(is re-e)2.539 F -.15(xe)-.15 G .039 |
| (cuted after each instance of).15 F F2(pat)2.54 E F0 .04(is replaced by) |
| 2.54 F F2 -.37(re)2.54 G(p).37 E F0 5.04(.A)C(useful)-2.5 E .406 |
| (alias to use with this is)144 571.2 R F4 .406(r='fc \255s')2.906 F F0 |
| 2.906(,s)C 2.906(ot)-2.906 G .406(hat typing)-2.906 F F4 6.406(rc)2.906 |
| G(c)-6.406 E F0 .406(runs the last command be)2.906 F .406(ginning with) |
| -.15 F F4(cc)144 583.2 Q F0(and typing)2.5 E F4(r)2.5 E F0(re-e)2.5 E |
| -.15(xe)-.15 G(cutes the last command.).15 E .142 |
| (If the \214rst form is used, the return v)144 607.2 R .142 |
| (alue is 0 unless an in)-.25 F -.25(va)-.4 G .142 |
| (lid option is encountered or).25 F F2<8c72>4.552 E(st)-.1 E F0(or)3.322 |
| E F2(last)2.732 E F0 .455(specify history lines out of range.)144 619.2 |
| R .454(If the)5.454 F F1<ad65>2.954 E F0 .454 |
| (option is supplied, the return v)2.954 F .454(alue is the v)-.25 F .454 |
| (alue of the)-.25 F .787(last command e)144 631.2 R -.15(xe)-.15 G .787 |
| (cuted or f).15 F .788 |
| (ailure if an error occurs with the temporary \214le of commands.)-.1 F |
| .788(If the)5.788 F 1.136 |
| (second form is used, the return status is that of the command re-e)144 |
| 643.2 R -.15(xe)-.15 G 1.135(cuted, unless).15 F F2(cmd)3.835 E F0 1.135 |
| (does not)4.405 F(specify a v)144 655.2 Q |
| (alid history line, in which case)-.25 E F1(fc)2.5 E F0(returns f)2.5 E |
| (ailure.)-.1 E F1(fg)108 672 Q F0([)2.5 E F2(jobspec)A F0(])A(Resume)144 |
| 684 Q F2(jobspec)5.653 E F0 1.413(in the fore)4.223 F 1.413 |
| (ground, and mak)-.15 F 3.913(ei)-.1 G 3.913(tt)-3.913 G 1.413 |
| (he current job)-3.913 F 6.413(.I)-.4 G(f)-6.413 E F2(jobspec)5.653 E F0 |
| 1.414(is not present, the)4.223 F(shell')144 696 Q 3.117(sn)-.55 G .617 |
| (otion of the)-3.117 F F2(curr)3.117 E .617(ent job)-.37 F F0 .617 |
| (is used.)3.117 F .617(The return v)5.617 F .616 |
| (alue is that of the command placed into the)-.25 F(fore)144 708 Q .362 |
| (ground, or f)-.15 F .362(ailure if run when job control is disabled or) |
| -.1 F 2.862(,w)-.4 G .363(hen run with job control enabled, if)-2.862 F |
| F2(jobspec)145.74 720 Q F0 .004(does not specify a v)2.815 F .004 |
| (alid job or)-.25 F F2(jobspec)4.244 E F0 .004(speci\214es a job that w) |
| 2.814 F .004(as started without job control.)-.1 F(GNU Bash-4.1)72 768 Q |
| (2009 December 29)135.965 E(55)185.955 E 0 Cg EP |
| %%Page: 56 56 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(getopts)108 84 Q/F2 10/Times-Italic@0 SF |
| (optstring name)2.5 E F0([)2.5 E F2(ar)A(gs)-.37 E F0(])A F1(getopts)144 |
| 96 Q F0 .793 |
| (is used by shell procedures to parse positional parameters.)3.293 F F2 |
| (optstring)6.023 E F0 .793(contains the option)3.513 F .15 |
| (characters to be recognized; if a character is follo)144 108 R .149 |
| (wed by a colon, the option is e)-.25 F .149(xpected to ha)-.15 F .449 |
| -.15(ve a)-.2 H(n).15 E(ar)144 120 Q .578 |
| (gument, which should be separated from it by white space.)-.18 F .579 |
| (The colon and question mark char)5.579 F(-)-.2 E 1.665 |
| (acters may not be used as option characters.)144 132 R 1.665 |
| (Each time it is in)6.665 F -.2(vo)-.4 G -.1(ke).2 G(d,).1 E F1(getopts) |
| 4.165 E F0 1.665(places the ne)4.165 F(xt)-.15 E .796 |
| (option in the shell v)144 144 R(ariable)-.25 E F2(name)3.296 E F0 3.296 |
| (,i).18 G(nitializing)-3.296 E F2(name)3.657 E F0 .797(if it does not e) |
| 3.477 F .797(xist, and the inde)-.15 F 3.297(xo)-.15 G 3.297(ft)-3.297 G |
| .797(he ne)-3.297 F(xt)-.15 E(ar)144 156 Q .085 |
| (gument to be processed into the v)-.18 F(ariable)-.25 E/F3 9 |
| /Times-Bold@0 SF(OPTIND)2.585 E/F4 9/Times-Roman@0 SF(.)A F3(OPTIND) |
| 4.585 E F0 .085(is initialized to 1 each time the shell)2.335 F .845 |
| (or a shell script is in)144 168 R -.2(vo)-.4 G -.1(ke).2 G 3.345 |
| (d. When).1 F .845(an option requires an ar)3.345 F(gument,)-.18 E F1 |
| (getopts)3.346 E F0 .846(places that ar)3.346 F(gument)-.18 E .804 |
| (into the v)144 180 R(ariable)-.25 E F3(OPT)3.304 E(ARG)-.81 E F4(.)A F0 |
| .803(The shell does not reset)5.304 F F3(OPTIND)3.303 E F0 .803 |
| (automatically; it must be manually)3.053 F .293 |
| (reset between multiple calls to)144 192 R F1(getopts)2.793 E F0 .293 |
| (within the same shell in)2.793 F -.2(vo)-.4 G .293(cation if a ne).2 F |
| 2.793(ws)-.25 G .294(et of parameters)-2.793 F(is to be used.)144 204 Q |
| 2.044(When the end of options is encountered,)144 228 R F1(getopts)4.543 |
| E F0 -.15(ex)4.543 G 2.043(its with a return v).15 F 2.043 |
| (alue greater than zero.)-.25 F F3(OPTIND)144 240 Q F0 |
| (is set to the inde)2.25 E 2.5(xo)-.15 G 2.5(ft)-2.5 G |
| (he \214rst non-option ar)-2.5 E(gument, and)-.18 E F1(name)2.5 E F0 |
| (is set to ?.)2.5 E F1(getopts)144 264 Q F0 2.392 |
| (normally parses the positional parameters, b)4.892 F 2.392 |
| (ut if more ar)-.2 F 2.393(guments are gi)-.18 F -.15(ve)-.25 G 4.893 |
| (ni).15 G(n)-4.893 E F2(ar)4.893 E(gs)-.37 E F0(,).27 E F1(getopts)144 |
| 276 Q F0(parses those instead.)2.5 E F1(getopts)144 300 Q F0 1.166 |
| (can report errors in tw)3.666 F 3.665(ow)-.1 G 3.665(ays. If)-3.765 F |
| 1.165(the \214rst character of)3.665 F F2(optstring)3.895 E F0 1.165 |
| (is a colon,)3.885 F F2(silent)4.005 E F0(error)4.345 E 1.263 |
| (reporting is used.)144 312 R 1.263 |
| (In normal operation diagnostic messages are printed when in)6.263 F |
| -.25(va)-.4 G 1.263(lid options or).25 F .394(missing option ar)144 324 |
| R .394(guments are encountered.)-.18 F .394(If the v)5.394 F(ariable) |
| -.25 E F3(OPTERR)2.894 E F0 .394(is set to 0, no error messages)2.644 F |
| (will be displayed, e)144 336 Q -.15(ve)-.25 G 2.5(ni).15 G 2.5(ft)-2.5 |
| G(he \214rst character of)-2.5 E F2(optstring)2.73 E F0(is not a colon.) |
| 2.72 E .666(If an in)144 360 R -.25(va)-.4 G .666(lid option is seen,) |
| .25 F F1(getopts)3.166 E F0 .667(places ? into)3.167 F F2(name)3.527 E |
| F0 .667(and, if not silent, prints an error message)3.347 F .4 |
| (and unsets)144 372 R F3(OPT)2.9 E(ARG)-.81 E F4(.)A F0(If)4.899 E F1 |
| (getopts)2.899 E F0 .399 |
| (is silent, the option character found is placed in)2.899 F F3(OPT)2.899 |
| E(ARG)-.81 E F0 .399(and no)2.649 F(diagnostic message is printed.)144 |
| 384 Q 1.241(If a required ar)144 408 R 1.241(gument is not found, and) |
| -.18 F F1(getopts)3.741 E F0 1.241(is not silent, a question mark \() |
| 3.741 F F1(?).833 E F0 3.742(\)i).833 G 3.742(sp)-3.742 G 1.242 |
| (laced in)-3.742 F F2(name)144 420 Q F0(,).18 E F3(OPT)2.735 E(ARG)-.81 |
| E F0 .234(is unset, and a diagnostic message is printed.)2.485 F(If) |
| 5.234 E F1(getopts)2.734 E F0 .234(is silent, then a colon \()2.734 F F1 |
| (:).833 E F0(\)).833 E(is placed in)144 432 Q F2(name)2.86 E F0(and)2.68 |
| E F3(OPT)2.5 E(ARG)-.81 E F0(is set to the option character found.)2.25 |
| E F1(getopts)144 456 Q F0 .902 |
| (returns true if an option, speci\214ed or unspeci\214ed, is found.) |
| 3.401 F .902(It returns f)5.902 F .902(alse if the end of)-.1 F |
| (options is encountered or an error occurs.)144 468 Q F1(hash)108 484.8 |
| Q F0([)2.5 E F1(\255lr)A F0 2.5(][)C F1<ad70>-2.5 E F2(\214lename)2.5 E |
| F0 2.5(][)C F1(\255dt)-2.5 E F0 2.5(][)C F2(name)-2.5 E F0(])A -.15(Fo) |
| 144 496.8 S 3.555(re).15 G(ach)-3.555 E F2(name)3.555 E F0 3.555(,t).18 |
| G 1.054(he full \214le name of the command is determined by searching t\ |
| he directories in)-3.555 F F1($P)144 508.8 Q -.95(AT)-.74 G(H).95 E F0 |
| .349(and remembered.)2.849 F .349(If the)5.349 F F1<ad70>2.849 E F0 .349 |
| (option is supplied, no path search is performed, and)2.849 F F2 |
| (\214lename)4.76 E F0 .452 |
| (is used as the full \214le name of the command.)144 520.8 R(The)5.452 E |
| F1<ad72>2.952 E F0 .452(option causes the shell to for)2.952 F .452 |
| (get all remem-)-.18 F .592(bered locations.)144 532.8 R(The)5.592 E F1 |
| <ad64>3.092 E F0 .593(option causes the shell to for)3.092 F .593 |
| (get the remembered location of each)-.18 F F2(name)3.093 E F0(.)A .021 |
| (If the)144 544.8 R F1<ad74>2.521 E F0 .021 |
| (option is supplied, the full pathname to which each)2.521 F F2(name) |
| 2.52 E F0 .02(corresponds is printed.)2.52 F .02(If multi-)5.02 F(ple) |
| 144 556.8 Q F2(name)3.703 E F0(ar)3.703 E 1.203 |
| (guments are supplied with)-.18 F F1<ad74>3.703 E F0 3.703(,t)C(he) |
| -3.703 E F2(name)3.703 E F0 1.204 |
| (is printed before the hashed full pathname.)3.703 F(The)144 568.8 Q F1 |
| <ad6c>3.216 E F0 .715(option causes output to be displayed in a format \ |
| that may be reused as input.)3.216 F .715(If no ar)5.715 F(gu-)-.18 E |
| 1.183(ments are gi)144 580.8 R -.15(ve)-.25 G 1.183(n, or if only).15 F |
| F1<ad6c>3.683 E F0 1.184 |
| (is supplied, information about remembered commands is printed.)3.684 F |
| (The return status is true unless a)144 592.8 Q F2(name)2.86 E F0 |
| (is not found or an in)2.68 E -.25(va)-.4 G(lid option is supplied.).25 |
| E F1(help)108 609.6 Q F0([)2.5 E F1(\255dms)A F0 2.5(][)C F2(pattern) |
| -2.5 E F0(])A .867(Display helpful information about b)144 621.6 R .867 |
| (uiltin commands.)-.2 F(If)5.867 E F2(pattern)4.617 E F0 .866 |
| (is speci\214ed,)3.607 F F1(help)3.366 E F0(gi)3.366 E -.15(ve)-.25 G |
| 3.366(sd).15 G(etailed)-3.366 E .306(help on all commands matching)144 |
| 633.6 R F2(pattern)2.806 E F0 2.807(;o).24 G .307 |
| (therwise help for all the b)-2.807 F .307 |
| (uiltins and shell control struc-)-.2 F(tures is printed.)144 645.6 Q F1 |
| <ad64>144 657.6 Q F0(Display a short description of each)24.74 E F2 |
| (pattern)2.5 E F1<ad6d>144 669.6 Q F0(Display the description of each) |
| 21.97 E F2(pattern)2.5 E F0(in a manpage-lik)2.5 E 2.5(ef)-.1 G(ormat) |
| -2.5 E F1<ad73>144 681.6 Q F0 |
| (Display only a short usage synopsis for each)26.41 E F2(pattern)2.5 E |
| F0(The return status is 0 unless no command matches)108 693.6 Q F2 |
| (pattern)2.5 E F0(.).24 E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 |
| E(56)185.955 E 0 Cg EP |
| %%Page: 57 57 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(history [)108 84 Q/F2 10/Times-Italic@0 SF |
| (n)A F1(])A(history \255c)108 96 Q(history \255d)108 108 Q F2(of)2.5 E |
| (fset)-.18 E F1(history \255anrw)108 120 Q F0([)2.5 E F2(\214lename)A F0 |
| (])A F1(history \255p)108 132 Q F2(ar)2.5 E(g)-.37 E F0([)2.5 E F2(ar)A |
| 2.5(g.)-.37 G(..)-2.5 E F0(])A F1(history \255s)108 144 Q F2(ar)2.5 E(g) |
| -.37 E F0([)2.5 E F2(ar)A 2.5(g.)-.37 G(..)-2.5 E F0(])A -.4(Wi)144 156 |
| S .752 |
| (th no options, display the command history list with line numbers.).4 F |
| .752(Lines listed with a)5.752 F F1(*)3.251 E F0(ha)3.251 E -.15(ve)-.2 |
| G .38(been modi\214ed.)144 168 R .38(An ar)5.38 F .38(gument of)-.18 F |
| F2(n)3.24 E F0 .38(lists only the last)3.12 F F2(n)3.24 E F0 2.88 |
| (lines. If)3.12 F .38(the shell v)2.88 F(ariable)-.25 E/F3 9 |
| /Times-Bold@0 SF(HISTTIMEFOR-)2.881 E(MA)144 180 Q(T)-.855 E F0 .265 |
| (is set and not null, it is used as a format string for)2.515 F F2 |
| (strftime)2.764 E F0 .264(\(3\) to display the time stamp asso-)B 1.019 |
| (ciated with each displayed history entry)144 192 R 6.019(.N)-.65 G |
| 3.519(oi)-6.019 G(nterv)-3.519 E 1.019 |
| (ening blank is printed between the formatted)-.15 F .176 |
| (time stamp and the history line.)144 204 R(If)5.176 E F2(\214lename) |
| 2.676 E F0 .176 |
| (is supplied, it is used as the name of the history \214le; if)2.676 F |
| (not, the v)144 216 Q(alue of)-.25 E F3(HISTFILE)2.5 E F0(is used.)2.25 |
| E(Options, if supplied, ha)5 E .3 -.15(ve t)-.2 H(he follo).15 E |
| (wing meanings:)-.25 E F1<ad63>144 228 Q F0 |
| (Clear the history list by deleting all the entries.)25.86 E F1<ad64>144 |
| 240 Q F2(of)2.5 E(fset)-.18 E F0(Delete the history entry at position) |
| 180 252 Q F2(of)2.5 E(fset)-.18 E F0(.)A F1<ad61>144 264 Q F0 .598 |
| (Append the `)25.3 F(`ne)-.74 E(w')-.25 E 3.098('h)-.74 G .598 |
| (istory lines \(history lines entered since the be)-3.098 F .599 |
| (ginning of the current)-.15 F F1(bash)180 276 Q F0 |
| (session\) to the history \214le.)2.5 E F1<ad6e>144 288 Q F0 .854(Read \ |
| the history lines not already read from the history \214le into the cur\ |
| rent history list.)24.74 F .772 |
| (These are lines appended to the history \214le since the be)180 300 R |
| .773(ginning of the current)-.15 F F1(bash)3.273 E F0(ses-)3.273 E |
| (sion.)180 312 Q F1<ad72>144 324 Q F0(Read the contents of the history \ |
| \214le and use them as the current history)25.86 E(.)-.65 E F1<ad77>144 |
| 336 Q F0(Write the current history to the history \214le, o)23.08 E -.15 |
| (ve)-.15 G(rwriting the history \214le').15 E 2.5(sc)-.55 G(ontents.) |
| -2.5 E F1<ad70>144 348 Q F0 .626 |
| (Perform history substitution on the follo)24.74 F(wing)-.25 E F2(ar) |
| 3.125 E(gs)-.37 E F0 .625(and display the result on the standard)3.125 F |
| 2.975(output. Does)180 360 R .475 |
| (not store the results in the history list.)2.975 F(Each)5.475 E F2(ar) |
| 2.975 E(g)-.37 E F0 .475(must be quoted to disable)2.975 F |
| (normal history e)180 372 Q(xpansion.)-.15 E F1<ad73>144 384 Q F0 .363 |
| (Store the)26.41 F F2(ar)3.193 E(gs)-.37 E F0 .363 |
| (in the history list as a single entry)3.133 F 5.363(.T)-.65 G .362 |
| (he last command in the history list is)-5.363 F(remo)180 396 Q -.15(ve) |
| -.15 G 2.5(db).15 G(efore the)-2.5 E F2(ar)2.83 E(gs)-.37 E F0 |
| (are added.)2.77 E .145(If the)144 412.8 R F3(HISTTIMEFORMA)2.645 E(T) |
| -.855 E F0 -.25(va)2.395 G .145 |
| (riable is set, the time stamp information associated with each history) |
| .25 F .669(entry is written to the history \214le, mark)144 424.8 R .669 |
| (ed with the history comment character)-.1 F 5.668(.W)-.55 G .668 |
| (hen the history)-5.668 F .955(\214le is read, lines be)144 436.8 R .956 |
| (ginning with the history comment character follo)-.15 F .956 |
| (wed immediately by a digit)-.25 F .416 |
| (are interpreted as timestamps for the pre)144 448.8 R .416 |
| (vious history line.)-.25 F .416(The return v)5.416 F .415 |
| (alue is 0 unless an in)-.25 F -.25(va)-.4 G(lid).25 E .499(option is e\ |
| ncountered, an error occurs while reading or writing the history \214le\ |
| , an in)144 460.8 R -.25(va)-.4 G(lid).25 E F2(of)3 E(fset)-.18 E F0(is) |
| 3 E(supplied as an ar)144 472.8 Q(gument to)-.18 E F1<ad64>2.5 E F0 2.5 |
| (,o)C 2.5(rt)-2.5 G(he history e)-2.5 E(xpansion supplied as an ar)-.15 |
| E(gument to)-.18 E F1<ad70>2.5 E F0 -.1(fa)2.5 G(ils.).1 E F1(jobs)108 |
| 489.6 Q F0([)2.5 E F1(\255lnprs)A F0 2.5(][)C F2(jobspec)A F0(... ])2.5 |
| E F1(jobs \255x)108 501.6 Q F2(command)2.5 E F0([)2.5 E F2(ar)2.5 E(gs) |
| -.37 E F0(... ])2.5 E(The \214rst form lists the acti)144 513.6 Q .3 |
| -.15(ve j)-.25 H 2.5(obs. The).15 F(options ha)2.5 E .3 -.15(ve t)-.2 H |
| (he follo).15 E(wing meanings:)-.25 E F1<ad6c>144 525.6 Q F0 |
| (List process IDs in addition to the normal information.)27.52 E F1 |
| <ad70>144 537.6 Q F0(List only the process ID of the job')24.74 E 2.5 |
| (sp)-.55 G(rocess group leader)-2.5 E(.)-.55 E F1<ad6e>144 549.6 Q F0 |
| .194(Display information only about jobs that ha)24.74 F .494 -.15(ve c) |
| -.2 H .193(hanged status since the user w).15 F .193(as last noti-)-.1 F |
| (\214ed of their status.)180 561.6 Q F1<ad72>144 573.6 Q F0 |
| (Restrict output to running jobs.)25.86 E F1<ad73>144 585.6 Q F0 |
| (Restrict output to stopped jobs.)26.41 E(If)144 602.4 Q F2(jobspec) |
| 4.553 E F0 .313(is gi)3.123 F -.15(ve)-.25 G .313 |
| (n, output is restricted to information about that job).15 F 5.314(.T) |
| -.4 G .314(he return status is 0 unless)-5.314 F(an in)144 614.4 Q -.25 |
| (va)-.4 G(lid option is encountered or an in).25 E -.25(va)-.4 G(lid).25 |
| E F2(jobspec)4.24 E F0(is supplied.)2.81 E .395(If the)144 631.2 R F1 |
| <ad78>2.895 E F0 .394(option is supplied,)2.894 F F1(jobs)2.894 E F0 |
| .394(replaces an)2.894 F(y)-.15 E F2(jobspec)4.634 E F0 .394(found in) |
| 3.204 F F2(command)3.094 E F0(or)3.664 E F2(ar)3.224 E(gs)-.37 E F0 .394 |
| (with the corre-)3.164 F(sponding process group ID, and e)144 643.2 Q |
| -.15(xe)-.15 G(cutes).15 E F2(command)2.7 E F0(passing it)3.27 E F2(ar) |
| 2.5 E(gs)-.37 E F0 2.5(,r).27 G(eturning its e)-2.5 E(xit status.)-.15 E |
| F1(kill)108 660 Q F0([)2.5 E F1<ad73>A F2(sigspec)2.5 E F0(|)2.5 E F1 |
| <ad6e>2.5 E F2(signum)2.5 E F0(|)2.5 E F1<ad>2.5 E F2(sigspec)A F0 2.5 |
| (][)C F2(pid)-2.5 E F0(|)2.5 E F2(jobspec)2.5 E F0 2.5(].)C(..)-2.5 E F1 |
| (kill \255l)108 672 Q F0([)2.5 E F2(sigspec)A F0(|)2.5 E F2 -.2(ex)2.5 G |
| (it_status).2 E F0(])A .119(Send the signal named by)144 684 R F2 |
| (sigspec)2.959 E F0(or)2.929 E F2(signum)2.959 E F0 .119 |
| (to the processes named by)2.939 F F2(pid)3.87 E F0(or)3.39 E F2 |
| (jobspec)2.62 E F0(.).31 E F2(sigspec)5.46 E F0(is)2.93 E .319 |
| (either a case-insensiti)144 696 R .619 -.15(ve s)-.25 H .319 |
| (ignal name such as).15 F F3(SIGKILL)2.819 E F0 .318 |
| (\(with or without the)2.569 F F3(SIG)2.818 E F0 .318 |
| (pre\214x\) or a signal)2.568 F(number;)144 708 Q F2(signum)4.188 E F0 |
| 1.349(is a signal number)4.168 F 6.349(.I)-.55 G(f)-6.349 E F2(sigspec) |
| 4.189 E F0 1.349(is not present, then)4.159 F F3(SIGTERM)3.849 E F0 |
| 1.349(is assumed.)3.599 F(An)6.349 E(ar)144 720 Q .523(gument of)-.18 F |
| F1<ad6c>3.023 E F0 .523(lists the signal names.)3.023 F .523(If an)5.523 |
| F 3.023(ya)-.15 G -.18(rg)-3.023 G .523(uments are supplied when).18 F |
| F1<ad6c>3.023 E F0 .523(is gi)3.023 F -.15(ve)-.25 G .523(n, the names) |
| .15 F(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(57)185.955 E 0 Cg |
| EP |
| %%Page: 58 58 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .28(of the signals corresponding to the ar)144 84 R .28 |
| (guments are listed, and the return status is 0.)-.18 F(The)5.28 E/F1 10 |
| /Times-Italic@0 SF -.2(ex)2.78 G(it_status).2 E F0(ar)144 96 Q .378 |
| (gument to)-.18 F/F2 10/Times-Bold@0 SF<ad6c>2.878 E F0 .378 |
| (is a number specifying either a signal number or the e)2.878 F .377 |
| (xit status of a process termi-)-.15 F .593(nated by a signal.)144 108 R |
| F2(kill)5.593 E F0 .593(returns true if at least one signal w)3.093 F |
| .593(as successfully sent, or f)-.1 F .594(alse if an error)-.1 F |
| (occurs or an in)144 120 Q -.25(va)-.4 G(lid option is encountered.).25 |
| E F2(let)108 136.8 Q F1(ar)2.5 E(g)-.37 E F0([)2.5 E F1(ar)A(g)-.37 E F0 |
| (...])2.5 E(Each)144 148.8 Q F1(ar)3.027 E(g)-.37 E F0 .197 |
| (is an arithmetic e)2.917 F .197(xpression to be e)-.15 F -.25(va)-.25 G |
| .196(luated \(see).25 F/F3 9/Times-Bold@0 SF .196(ARITHMETIC EV)2.696 F |
| (ALU)-1.215 E -.855(AT)-.54 G(ION).855 E F0(abo)2.446 E -.15(ve)-.15 G |
| 2.696(\). If).15 F(the last)144 160.8 Q F1(ar)2.83 E(g)-.37 E F0 -.25 |
| (eva)2.72 G(luates to 0,).25 E F2(let)2.5 E F0 |
| (returns 1; 0 is returned otherwise.)2.5 E F2(local)108 177.6 Q F0([)2.5 |
| E F1(option)A F0 2.5(][)C F1(name)-2.5 E F0([=)A F1(value)A F0 2.5(].)C |
| (..])-2.5 E -.15(Fo)144 189.6 S 2.56(re).15 G .06(ach ar)-2.56 F .06 |
| (gument, a local v)-.18 F .06(ariable named)-.25 F F1(name)2.92 E F0 .06 |
| (is created, and assigned)2.74 F F1(value)2.56 E F0 5.06(.T).18 G(he) |
| -5.06 E F1(option)2.56 E F0 .06(can be)2.56 F(an)144 201.6 Q 3.153(yo) |
| -.15 G 3.153(ft)-3.153 G .653(he options accepted by)-3.153 F F2(declar) |
| 3.153 E(e)-.18 E F0 5.652(.W)C(hen)-5.652 E F2(local)3.152 E F0 .652 |
| (is used within a function, it causes the v)3.152 F(ari-)-.25 E(able)144 |
| 213.6 Q F1(name)3.72 E F0 .86(to ha)3.54 F 1.16 -.15(ve a v)-.2 H .861 |
| (isible scope restricted to that function and its children.).15 F -.4 |
| (Wi)5.861 G .861(th no operands,).4 F F2(local)144 225.6 Q F0 1.165 |
| (writes a list of local v)3.665 F 1.165 |
| (ariables to the standard output.)-.25 F 1.165(It is an error to use) |
| 6.165 F F2(local)3.664 E F0 1.164(when not)3.664 F .232 |
| (within a function.)144 237.6 R .233(The return status is 0 unless)5.232 |
| F F2(local)2.733 E F0 .233(is used outside a function, an in)2.733 F |
| -.25(va)-.4 G(lid).25 E F1(name)3.093 E F0(is)2.913 E(supplied, or)144 |
| 249.6 Q F1(name)2.5 E F0(is a readonly v)2.5 E(ariable.)-.25 E F2 |
| (logout)108 266.4 Q F0(Exit a login shell.)9.33 E F2(map\214le)108 283.2 |
| Q F0([)2.5 E F2<ad6e>A F1(count)2.5 E F0 2.5(][)C F2<ad4f>-2.5 E F1 |
| (origin)2.5 E F0 2.5(][)C F2<ad73>-2.5 E F1(count)2.5 E F0 2.5(][)C F2 |
| <ad74>-2.5 E F0 2.5(][)C F2<ad75>-2.5 E F1(fd)2.5 E F0 2.5(][)C F2<ad43> |
| -2.5 E F1(callbac)2.5 E(k)-.2 E F0 2.5(][)C F2<ad63>-2.5 E F1(quantum) |
| 2.5 E F0 2.5(][)C F1(arr)-2.5 E(ay)-.15 E F0(])A F2 -.18(re)108 295.2 S |
| (adarray).18 E F0([)2.5 E F2<ad6e>A F1(count)2.5 E F0 2.5(][)C F2<ad4f> |
| -2.5 E F1(origin)2.5 E F0 2.5(][)C F2<ad73>-2.5 E F1(count)2.5 E F0 2.5 |
| (][)C F2<ad74>-2.5 E F0 2.5(][)C F2<ad75>-2.5 E F1(fd)2.5 E F0 2.5(][)C |
| F2<ad43>-2.5 E F1(callbac)2.5 E(k)-.2 E F0 2.5(][)C F2<ad63>-2.5 E F1 |
| (quantum)2.5 E F0 2.5(][)C F1(arr)-2.5 E(ay)-.15 E F0(])A .351 |
| (Read lines from the standard input into the inde)144 307.2 R -.15(xe) |
| -.15 G 2.851(da).15 G .351(rray v)-2.851 F(ariable)-.25 E F1(arr)2.85 E |
| (ay)-.15 E F0 2.85(,o).32 G 2.85(rf)-2.85 G .35(rom \214le descriptor) |
| -2.85 F F1(fd)2.85 E F0 1.248(if the)144 319.2 R F2<ad75>3.748 E F0 |
| 1.248(option is supplied.)3.748 F 1.249(The v)6.249 F(ariable)-.25 E F3 |
| (MAPFILE)3.749 E F0 1.249(is the def)3.499 F(ault)-.1 E F1(arr)3.749 E |
| (ay)-.15 E F0 6.249(.O)C 1.249(ptions, if supplied,)-6.249 F(ha)144 |
| 331.2 Q .3 -.15(ve t)-.2 H(he follo).15 E(wing meanings:)-.25 E F2<ad6e> |
| 144 343.2 Q F0(Cop)24.74 E 2.5(ya)-.1 G 2.5(tm)-2.5 G(ost)-2.5 E F1 |
| (count)2.7 E F0 2.5(lines. If)3.18 F F1(count)2.5 E F0 |
| (is 0, all lines are copied.)2.5 E F2<ad4f>144 355.2 Q F0(Be)22.52 E |
| (gin assigning to)-.15 E F1(arr)2.83 E(ay)-.15 E F0(at inde)2.82 E(x) |
| -.15 E F1(origin)2.5 E F0 5(.T).24 G(he def)-5 E(ault inde)-.1 E 2.5(xi) |
| -.15 G 2.5(s0)-2.5 G(.)-2.5 E F2<ad73>144 367.2 Q F0 |
| (Discard the \214rst)26.41 E F1(count)2.5 E F0(lines read.)2.5 E F2 |
| <ad74>144 379.2 Q F0(Remo)26.97 E .3 -.15(ve a t)-.15 H(railing ne).15 E |
| (wline from each line read.)-.25 E F2<ad75>144 391.2 Q F0 |
| (Read lines from \214le descriptor)24.74 E F1(fd)2.5 E F0 |
| (instead of the standard input.)2.5 E F2<ad43>144 403.2 Q F0(Ev)23.08 E |
| (aluate)-.25 E F1(callbac)2.7 E(k)-.2 E F0(each time)3.17 E F1(quantum) |
| 2.5 E F0(lines are read.)2.5 E(The)5 E F2<ad63>2.5 E F0 |
| (option speci\214es)2.5 E F1(quantum)2.5 E F0(.).32 E F2<ad63>144 415.2 |
| Q F0(Specify the number of lines read between each call to)25.86 E F1 |
| (callbac)2.5 E(k)-.2 E F0(.).67 E(If)144 432 Q F2<ad43>2.968 E F0 .467 |
| (is speci\214ed without)2.967 F F2<ad63>2.967 E F0 2.967(,t)C .467 |
| (he def)-2.967 F .467(ault quantum is 5000.)-.1 F(When)5.467 E F1 |
| (callbac)2.967 E(k)-.2 E F0 .467(is e)2.967 F -.25(va)-.25 G .467 |
| (luated, it is sup-).25 F 1.22(plied the inde)144 444 R 3.72(xo)-.15 G |
| 3.72(ft)-3.72 G 1.22(he ne)-3.72 F 1.22 |
| (xt array element to be assigned as an additional ar)-.15 F(gument.)-.18 |
| E F1(callbac)6.22 E(k)-.2 E F0(is)3.72 E -.25(eva)144 456 S |
| (luated after the line is read b).25 E |
| (ut before the array element is assigned.)-.2 E |
| (If not supplied with an e)144 472.8 Q(xplicit origin,)-.15 E F2 |
| (map\214le)2.5 E F0(will clear)2.5 E F1(arr)2.5 E(ay)-.15 E F0 |
| (before assigning to it.)2.5 E F2(map\214le)144 489.6 Q F0 1.906 |
| (returns successfully unless an in)4.406 F -.25(va)-.4 G 1.905 |
| (lid option or option ar).25 F 1.905(gument is supplied,)-.18 F F1(arr) |
| 4.405 E(ay)-.15 E F0(is)4.405 E(in)144 501.6 Q -.25(va)-.4 G |
| (lid or unassignable, or if).25 E F1(arr)2.5 E(ay)-.15 E F0 |
| (is not an inde)2.5 E -.15(xe)-.15 G 2.5(da).15 G(rray)-2.5 E(.)-.65 E |
| F2(popd)108 518.4 Q F0<5bad>2.5 E F2(n)A F0 2.5(][)C(+)-2.5 E F1(n)A F0 |
| 2.5(][)C<ad>-2.5 E F1(n)A F0(])A(Remo)144 530.4 Q -.15(ve)-.15 G 2.799 |
| (se).15 G .299(ntries from the directory stack.)-2.799 F -.4(Wi)5.299 G |
| .299(th no ar).4 F .299(guments, remo)-.18 F -.15(ve)-.15 G 2.799(st).15 |
| G .3(he top directory from the)-2.799 F 1.479(stack, and performs a)144 |
| 542.4 R F2(cd)3.979 E F0 1.479(to the ne)3.979 F 3.979(wt)-.25 G 1.479 |
| (op directory)-3.979 F 6.479(.A)-.65 G -.18(rg)-6.479 G 1.478 |
| (uments, if supplied, ha).18 F 1.778 -.15(ve t)-.2 H 1.478(he follo).15 |
| F(wing)-.25 E(meanings:)144 554.4 Q F2<ad6e>144 566.4 Q F0 .551 |
| (Suppresses the normal change of directory when remo)24.74 F .551 |
| (ving directories from the stack, so)-.15 F |
| (that only the stack is manipulated.)180 578.4 Q F2(+)144 590.4 Q F1(n)A |
| F0(Remo)25.3 E -.15(ve)-.15 G 2.64(st).15 G(he)-2.64 E F1(n)2.64 E F0 |
| .14(th entry counting from the left of the list sho)B .14(wn by)-.25 F |
| F2(dirs)2.64 E F0 2.64(,s)C .14(tarting with zero.)-2.64 F -.15(Fo)180 |
| 602.4 S 2.5(re).15 G(xample:)-2.65 E/F4 10/Courier@0 SF(popd +0)2.5 E F0 |
| (remo)2.5 E -.15(ve)-.15 G 2.5(st).15 G(he \214rst directory)-2.5 E(,) |
| -.65 E F4(popd +1)2.5 E F0(the second.)2.5 E F2<ad>144 614.4 Q F1(n)A F0 |
| (Remo)25.3 E -.15(ve)-.15 G 3.759(st).15 G(he)-3.759 E F1(n)3.759 E F0 |
| 1.259(th entry counting from the right of the list sho)B 1.26(wn by)-.25 |
| F F2(dirs)3.76 E F0 3.76(,s)C 1.26(tarting with)-3.76 F 2.5(zero. F)180 |
| 626.4 R(or e)-.15 E(xample:)-.15 E F4(popd -0)2.5 E F0(remo)2.5 E -.15 |
| (ve)-.15 G 2.5(st).15 G(he last directory)-2.5 E(,)-.65 E F4(popd -1)2.5 |
| E F0(the ne)2.5 E(xt to last.)-.15 E .644(If the)144 643.2 R F2(popd) |
| 3.144 E F0 .644(command is successful, a)3.144 F F2(dirs)3.143 E F0 .643 |
| (is performed as well, and the return status is 0.)3.143 F F2(popd)5.643 |
| E F0 .415(returns f)144 655.2 R .415(alse if an in)-.1 F -.25(va)-.4 G |
| .415(lid option is encountered, the directory stack is empty).25 F 2.916 |
| (,an)-.65 G(on-e)-2.916 E .416(xistent direc-)-.15 F |
| (tory stack entry is speci\214ed, or the directory change f)144 667.2 Q |
| (ails.)-.1 E F2(printf)108 684 Q F0([)2.5 E F2<ad76>A F1(var)2.5 E F0(]) |
| A F1(format)2.5 E F0([)2.5 E F1(ar)A(guments)-.37 E F0(])A .372 |
| (Write the formatted)144 696 R F1(ar)2.872 E(guments)-.37 E F0 .372 |
| (to the standard output under the control of the)2.872 F F1(format)2.872 |
| E F0 5.372(.T)C(he)-5.372 E F1(format)2.872 E F0 1.804(is a character s\ |
| tring which contains three types of objects: plain characters, which ar\ |
| e simply)144 708 R 1.859 |
| (copied to standard output, character escape sequences, which are con) |
| 144 720 R -.15(ve)-.4 G 1.858(rted and copied to the).15 F(GNU Bash-4.1) |
| 72 768 Q(2009 December 29)135.965 E(58)185.955 E 0 Cg EP |
| %%Page: 59 59 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 1.171(standard output, and format speci\214cations, each of whic\ |
| h causes printing of the ne)144 84 R 1.172(xt successi)-.15 F -.15(ve) |
| -.25 G/F1 10/Times-Italic@0 SF(ar)144 96 Q(gument)-.37 E F0 6.274(.I)C |
| 3.774(na)-6.274 G 1.274(ddition to the standard)-3.774 F F1(printf)3.774 |
| E F0 1.274(\(1\) formats,)B/F2 10/Times-Bold@0 SF(%b)3.774 E F0(causes) |
| 3.774 E F2(printf)3.774 E F0 1.273(to e)3.774 F 1.273(xpand backslash) |
| -.15 F .619(escape sequences in the corresponding)144 108 R F1(ar)3.119 |
| E(gument)-.37 E F0(\(e)3.119 E .619(xcept that)-.15 F F2(\\c)3.119 E F0 |
| .62(terminates output, backslashes in)3.119 F F2<5c08>144 120 Q F0(,)A |
| F2(\\")2.985 E F0 2.985(,a)C(nd)-2.985 E F2(\\?)2.985 E F0 .485 |
| (are not remo)2.985 F -.15(ve)-.15 G .485(d, and octal escapes be).15 F |
| .484(ginning with)-.15 F F2(\\0)2.984 E F0 .484 |
| (may contain up to four digits\),)2.984 F(and)144 132 Q F2(%q)2.567 E F0 |
| (causes)2.567 E F2(printf)2.567 E F0 .067(to output the corresponding) |
| 2.567 F F1(ar)2.568 E(gument)-.37 E F0 .068 |
| (in a format that can be reused as shell)2.568 F(input.)144 144 Q(The) |
| 144 168 Q F2<ad76>2.904 E F0 .404 |
| (option causes the output to be assigned to the v)2.904 F(ariable)-.25 E |
| F1(var)2.904 E F0 .404(rather than being printed to the)2.904 F |
| (standard output.)144 180 Q(The)144 204 Q F1(format)3.423 E F0 .923 |
| (is reused as necessary to consume all of the)3.423 F F1(ar)3.423 E |
| (guments)-.37 E F0 5.923(.I)C 3.423(ft)-5.923 G(he)-3.423 E F1(format) |
| 3.423 E F0 .924(requires more)3.424 F F1(ar)144 216 Q(guments)-.37 E F0 |
| .033(than are supplied, the e)2.534 F .033 |
| (xtra format speci\214cations beha)-.15 F .333 -.15(ve a)-.2 H 2.533(si) |
| .15 G 2.533(faz)-2.533 G .033(ero v)-2.533 F .033(alue or null string,) |
| -.25 F(as appropriate, had been supplied.)144 228 Q(The return v)5 E |
| (alue is zero on success, non-zero on f)-.25 E(ailure.)-.1 E F2(pushd) |
| 108 244.8 Q F0([)2.5 E F2<ad6e>A F0 2.5(][)C(+)-2.5 E F1(n)A F0 2.5(][)C |
| <ad>-2.5 E F1(n)A F0(])A F2(pushd)108 256.8 Q F0([)2.5 E F2<ad6e>A F0 |
| 2.5(][)C F1(dir)-2.5 E F0(])A .639(Adds a directory to the top of the d\ |
| irectory stack, or rotates the stack, making the ne)144 268.8 R 3.14(wt) |
| -.25 G .64(op of the)-3.14 F 1.316(stack the current w)144 280.8 R 1.316 |
| (orking directory)-.1 F 6.316(.W)-.65 G 1.315(ith no ar)-6.716 F 1.315 |
| (guments, e)-.18 F 1.315(xchanges the top tw)-.15 F 3.815(od)-.1 G 1.315 |
| (irectories and)-3.815 F .871 |
| (returns 0, unless the directory stack is empty)144 292.8 R 5.871(.A) |
| -.65 G -.18(rg)-5.871 G .872(uments, if supplied, ha).18 F 1.172 -.15 |
| (ve t)-.2 H .872(he follo).15 F .872(wing mean-)-.25 F(ings:)144 304.8 Q |
| F2<ad6e>144 316.8 Q F0 .902(Suppresses the normal change of directory w\ |
| hen adding directories to the stack, so that)24.74 F |
| (only the stack is manipulated.)180 328.8 Q F2(+)144 340.8 Q F1(n)A F0 |
| 1.267(Rotates the stack so that the)25.3 F F1(n)3.767 E F0 1.268 |
| (th directory \(counting from the left of the list sho)B 1.268(wn by) |
| -.25 F F2(dirs)180 352.8 Q F0 2.5(,s)C |
| (tarting with zero\) is at the top.)-2.5 E F2<ad>144 364.8 Q F1(n)A F0 |
| .92(Rotates the stack so that the)25.3 F F1(n)3.42 E F0 .92 |
| (th directory \(counting from the right of the list sho)B .92(wn by)-.25 |
| F F2(dirs)180 376.8 Q F0 2.5(,s)C(tarting with zero\) is at the top.) |
| -2.5 E F1(dir)144.35 388.8 Q F0(Adds)23.98 E F1(dir)2.85 E F0 |
| (to the directory stack at the top, making it the ne)3.23 E 2.5(wc)-.25 |
| G(urrent w)-2.5 E(orking directory)-.1 E(.)-.65 E .488(If the)144 405.6 |
| R F2(pushd)2.988 E F0 .488(command is successful, a)2.988 F F2(dirs) |
| 2.988 E F0 .488(is performed as well.)2.988 F .489 |
| (If the \214rst form is used,)5.488 F F2(pushd)2.989 E F0 1.04 |
| (returns 0 unless the cd to)144 417.6 R F1(dir)3.89 E F0 -.1(fa)4.27 G |
| 3.539(ils. W).1 F 1.039(ith the second form,)-.4 F F2(pushd)3.539 E F0 |
| 1.039(returns 0 unless the directory)3.539 F .846(stack is empty)144 |
| 429.6 R 3.346(,an)-.65 G(on-e)-3.346 E .847(xistent directory stack ele\ |
| ment is speci\214ed, or the directory change to the)-.15 F |
| (speci\214ed ne)144 441.6 Q 2.5(wc)-.25 G(urrent directory f)-2.5 E |
| (ails.)-.1 E F2(pwd)108 458.4 Q F0([)2.5 E F2(\255LP)A F0(])A .845 |
| (Print the absolute pathname of the current w)144 470.4 R .845 |
| (orking directory)-.1 F 5.844(.T)-.65 G .844 |
| (he pathname printed contains no)-5.844 F .181(symbolic links if the)144 |
| 482.4 R F2<ad50>2.681 E F0 .181(option is supplied or the)2.681 F F2 |
| .181(\255o ph)2.681 F(ysical)-.15 E F0 .181(option to the)2.681 F F2 |
| (set)2.681 E F0 -.2(bu)2.681 G .182(iltin command is).2 F 3.264 |
| (enabled. If)144 494.4 R(the)3.264 E F2<ad4c>3.264 E F0 .763 |
| (option is used, the pathname printed may contain symbolic links.)3.264 |
| F .763(The return)5.763 F 1.36(status is 0 unless an error occurs while\ |
| reading the name of the current directory or an in)144 506.4 R -.25(va) |
| -.4 G(lid).25 E(option is supplied.)144 518.4 Q F2 -.18(re)108 535.2 S |
| (ad).18 E F0([)3.817 E F2(\255ers)A F0 3.817(][)C F2<ad61>-3.817 E F1 |
| (aname)3.817 E F0 3.817(][)C F2<ad64>-3.817 E F1(delim)3.817 E F0 3.817 |
| (][)C F2<ad69>-3.817 E F1(te)3.817 E(xt)-.2 E F0 3.817(][)C F2<ad6e> |
| -3.817 E F1(nc)3.816 E(har)-.15 E(s)-.1 E F0 3.816(][)C F2<ad4e>-3.816 E |
| F1(nc)3.816 E(har)-.15 E(s)-.1 E F0 3.816(][)C F2<ad70>-3.816 E F1(pr) |
| 3.816 E(ompt)-.45 E F0 3.816(][)C F2<ad74>-3.816 E F1(timeout)3.816 E F0 |
| 3.816(][)C F2<ad75>-3.816 E F1(fd)3.816 E F0(])A([)108 547.2 Q F1(name)A |
| F0(...])2.5 E .516(One line is read from the standard input, or from th\ |
| e \214le descriptor)144 559.2 R F1(fd)3.016 E F0 .516(supplied as an ar) |
| 3.016 F .516(gument to)-.18 F(the)144 571.2 Q F2<ad75>2.538 E F0 .038 |
| (option, and the \214rst w)2.538 F .038(ord is assigned to the \214rst) |
| -.1 F F1(name)2.539 E F0 2.539(,t).18 G .039(he second w)-2.539 F .039 |
| (ord to the second)-.1 F F1(name)2.539 E F0(,).18 E .42 |
| (and so on, with lefto)144 583.2 R -.15(ve)-.15 G 2.92(rw).15 G .42 |
| (ords and their interv)-3.02 F .42 |
| (ening separators assigned to the last)-.15 F F1(name)2.92 E F0 5.42(.I) |
| .18 G 2.92(ft)-5.42 G(here)-2.92 E .54(are fe)144 595.2 R .54(wer w)-.25 |
| F .541(ords read from the input stream than names, the remaining names \ |
| are assigned empty)-.1 F -.25(va)144 607.2 S 2.511(lues. The).25 F .011 |
| (characters in)2.511 F/F3 9/Times-Bold@0 SF(IFS)2.511 E F0 .011 |
| (are used to split the line into w)2.261 F 2.511(ords. The)-.1 F .011 |
| (backslash character \()2.511 F F2(\\)A F0 2.51(\)m)C(ay)-2.51 E 1.89 |
| (be used to remo)144 619.2 R 2.19 -.15(ve a)-.15 H 2.19 -.15(ny s).15 H |
| 1.891(pecial meaning for the ne).15 F 1.891 |
| (xt character read and for line continuation.)-.15 F |
| (Options, if supplied, ha)144 631.2 Q .3 -.15(ve t)-.2 H(he follo).15 E |
| (wing meanings:)-.25 E F2<ad61>144 643.2 Q F1(aname)2.5 E F0 1.05(The w) |
| 180 655.2 R 1.049 |
| (ords are assigned to sequential indices of the array v)-.1 F(ariable) |
| -.25 E F1(aname)3.549 E F0 3.549(,s).18 G 1.049(tarting at 0.)-3.549 F |
| F1(aname)180.33 667.2 Q F0(is unset before an)2.68 E 2.5(yn)-.15 G .5 |
| -.25(ew va)-2.5 H(lues are assigned.).25 E(Other)5 E F1(name)2.5 E F0 |
| (ar)2.5 E(guments are ignored.)-.18 E F2<ad64>144 679.2 Q F1(delim)2.5 E |
| F0(The \214rst character of)180 691.2 Q F1(delim)2.5 E F0 |
| (is used to terminate the input line, rather than ne)2.5 E(wline.)-.25 E |
| F2<ad65>144 703.2 Q F0 .372 |
| (If the standard input is coming from a terminal,)25.86 F F2 -.18(re) |
| 2.873 G(adline).18 E F0(\(see)2.873 E F3(READLINE)2.873 E F0(abo)2.623 E |
| -.15(ve)-.15 G 2.873(\)i).15 G 2.873(su)-2.873 G(sed)-2.873 E .218 |
| (to obtain the line.)180 715.2 R .218 |
| (Readline uses the current \(or def)5.218 F .218 |
| (ault, if line editing w)-.1 F .218(as not pre)-.1 F(viously)-.25 E |
| (acti)180 727.2 Q -.15(ve)-.25 G 2.5(\)e).15 G(diting settings.)-2.5 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(59)185.955 E 0 Cg EP |
| %%Page: 60 60 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF<ad69>144 84 Q/F2 10/Times-Italic@0 SF(te) |
| 2.5 E(xt)-.2 E F0(If)10.78 E F1 -.18(re)2.715 G(adline).18 E F0 .216 |
| (is being used to read the line,)2.715 F F2(te)2.716 E(xt)-.2 E F0 .216 |
| (is placed into the editing b)2.716 F(uf)-.2 E .216(fer before edit-) |
| -.25 F(ing be)180 96 Q(gins.)-.15 E F1<ad6e>144 108 Q F2(nc)2.5 E(har) |
| -.15 E(s)-.1 E F1 -.18(re)180 120 S(ad).18 E F0 1.395 |
| (returns after reading)3.895 F F2(nc)3.895 E(har)-.15 E(s)-.1 E F0 1.395 |
| (characters rather than w)3.895 F 1.394(aiting for a complete line of) |
| -.1 F(input, b)180 132 Q(ut honor a delimiter if fe)-.2 E(wer than)-.25 |
| E F2(nc)2.5 E(har)-.15 E(s)-.1 E F0 |
| (characters are read before the delimiter)2.5 E(.)-.55 E F1<ad4e>144 144 |
| Q F2(nc)2.5 E(har)-.15 E(s)-.1 E F1 -.18(re)180 156 S(ad).18 E F0 1.269 |
| (returns after reading e)3.769 F(xactly)-.15 E F2(nc)3.769 E(har)-.15 E |
| (s)-.1 E F0 1.269(characters rather than w)3.769 F 1.27 |
| (aiting for a complete)-.1 F .275 |
| (line of input, unless EOF is encountered or)180 168 R F1 -.18(re)2.775 |
| G(ad).18 E F0 .274(times out.)2.774 F .274(Delimiter characters encoun-) |
| 5.274 F 1.002 |
| (tered in the input are not treated specially and do not cause)180 180 R |
| F1 -.18(re)3.503 G(ad).18 E F0 1.003(to return until)3.503 F F2(nc)3.503 |
| E(har)-.15 E(s)-.1 E F0(characters are read.)180 192 Q F1<ad70>144 204 Q |
| F2(pr)2.5 E(ompt)-.45 E F0(Display)180 216 Q F2(pr)3.661 E(ompt)-.45 E |
| F0 1.161(on standard error)3.661 F 3.661(,w)-.4 G 1.161 |
| (ithout a trailing ne)-3.661 F 1.161(wline, before attempting to read) |
| -.25 F(an)180 228 Q 2.5(yi)-.15 G 2.5(nput. The)-2.5 F |
| (prompt is displayed only if input is coming from a terminal.)2.5 E F1 |
| <ad72>144 240 Q F0 .543(Backslash does not act as an escape character) |
| 25.86 F 5.543(.T)-.55 G .544(he backslash is considered to be part of) |
| -5.543 F(the line.)180 252 Q(In particular)5 E 2.5(,ab)-.4 G |
| (ackslash-ne)-2.5 E(wline pair may not be used as a line continuation.) |
| -.25 E F1<ad73>144 264 Q F0(Silent mode.)26.41 E |
| (If input is coming from a terminal, characters are not echoed.)5 E F1 |
| <ad74>144 276 Q F2(timeout)2.5 E F0(Cause)180 288 Q F1 -.18(re)3.549 G |
| (ad).18 E F0 1.048(to time out and return f)3.549 F 1.048 |
| (ailure if a complete line of input is not read within)-.1 F F2(timeout) |
| 180 300 Q F0(seconds.)3.496 E F2(timeout)5.996 E F0 .997 |
| (may be a decimal number with a fractional portion follo)3.496 F(wing) |
| -.25 E .576(the decimal point.)180 312 R .576(This option is only ef) |
| 5.576 F(fecti)-.25 E .876 -.15(ve i)-.25 H(f).15 E F1 -.18(re)3.076 G |
| (ad).18 E F0 .576(is reading input from a terminal,)3.076 F .141 |
| (pipe, or other special \214le; it has no ef)180 324 R .142 |
| (fect when reading from re)-.25 F .142(gular \214les.)-.15 F(If)5.142 E |
| F2(timeout)2.642 E F0 .142(is 0,)2.642 F F1 -.18(re)180 336 S(ad).18 E |
| F0 .113(returns success if input is a)2.614 F -.25(va)-.2 G .113 |
| (ilable on the speci\214ed \214le descriptor).25 F 2.613(,f)-.4 G .113 |
| (ailure otherwise.)-2.713 F(The e)180 348 Q |
| (xit status is greater than 128 if the timeout is e)-.15 E(xceeded.)-.15 |
| E F1<ad75>144 360 Q F2(fd)2.5 E F0(Read input from \214le descriptor) |
| 14.46 E F2(fd)2.5 E F0(.)A .191(If no)144 376.8 R F2(names)3.051 E F0 |
| .191(are supplied, the line read is assigned to the v)2.961 F(ariable) |
| -.25 E/F3 9/Times-Bold@0 SF(REPL)2.692 E(Y)-.828 E/F4 9/Times-Roman@0 SF |
| (.)A F0 .192(The return code is zero,)4.692 F 1.344 |
| (unless end-of-\214le is encountered,)144 388.8 R F1 -.18(re)3.844 G(ad) |
| .18 E F0 1.343 |
| (times out \(in which case the return code is greater than)3.844 F |
| (128\), or an in)144 400.8 Q -.25(va)-.4 G |
| (lid \214le descriptor is supplied as the ar).25 E(gument to)-.18 E F1 |
| <ad75>2.5 E F0(.)A F1 -.18(re)108 417.6 S(adonly).18 E F0([)2.5 E F1 |
| (\255aA)A(pf)-.25 E F0 2.5(][)C F2(name)-2.5 E F0([=)A F2(wor)A(d)-.37 E |
| F0 2.5(].)C(..])-2.5 E .77(The gi)144 429.6 R -.15(ve)-.25 G(n).15 E F2 |
| (names)3.27 E F0 .77(are mark)3.27 F .77(ed readonly; the v)-.1 F .77 |
| (alues of these)-.25 F F2(names)3.63 E F0 .77 |
| (may not be changed by subse-)3.54 F 1.097(quent assignment.)144 441.6 R |
| 1.097(If the)6.097 F F1<ad66>3.597 E F0 1.097 |
| (option is supplied, the functions corresponding to the)3.597 F F2 |
| (names)3.596 E F0 1.096(are so)3.596 F(mark)144 453.6 Q 3.334(ed. The) |
| -.1 F F1<ad61>3.334 E F0 .834(option restricts the v)3.334 F .834 |
| (ariables to inde)-.25 F -.15(xe)-.15 G 3.334(da).15 G .834(rrays; the) |
| -3.334 F F1<ad41>3.334 E F0 .834(option restricts the v)3.334 F(ari-) |
| -.25 E .538(ables to associati)144 465.6 R .838 -.15(ve a)-.25 H 3.038 |
| (rrays. If).15 F(no)3.038 E F2(name)3.398 E F0(ar)3.218 E .538 |
| (guments are gi)-.18 F -.15(ve)-.25 G .538(n, or if the).15 F F1<ad70> |
| 3.038 E F0 .537(option is supplied, a list)3.038 F .08 |
| (of all readonly names is printed.)144 477.6 R(The)5.08 E F1<ad70>2.58 E |
| F0 .081(option causes output to be displayed in a format that may)2.58 F |
| 1.177(be reused as input.)144 489.6 R 1.177(If a v)6.177 F 1.176 |
| (ariable name is follo)-.25 F 1.176(wed by =)-.25 F F2(wor)A(d)-.37 E F0 |
| 3.676(,t)C 1.176(he v)-3.676 F 1.176(alue of the v)-.25 F 1.176 |
| (ariable is set to)-.25 F F2(wor)144 501.6 Q(d)-.37 E F0 6.205(.T)C |
| 1.205(he return status is 0 unless an in)-6.205 F -.25(va)-.4 G 1.206 |
| (lid option is encountered, one of the).25 F F2(names)4.066 E F0 1.206 |
| (is not a)3.976 F -.25(va)144 513.6 S(lid shell v).25 E |
| (ariable name, or)-.25 E F1<ad66>2.5 E F0(is supplied with a)2.5 E F2 |
| (name)2.86 E F0(that is not a function.)2.68 E F1 -.18(re)108 530.4 S |
| (tur).18 E(n)-.15 E F0([)2.5 E F2(n)A F0(])A .587 |
| (Causes a function to e)144 542.4 R .587(xit with the return v)-.15 F |
| .587(alue speci\214ed by)-.25 F F2(n)3.087 E F0 5.587(.I).24 G(f)-5.587 |
| E F2(n)3.447 E F0 .586(is omitted, the return status is)3.327 F 1.335 |
| (that of the last command e)144 554.4 R -.15(xe)-.15 G 1.335 |
| (cuted in the function body).15 F 6.335(.I)-.65 G 3.835(fu)-6.335 G |
| 1.335(sed outside a function, b)-3.835 F 1.335(ut during)-.2 F -.15(exe) |
| 144 566.4 S .794(cution of a script by the).15 F F1(.)3.294 E F0(\() |
| 5.794 E F1(sour)A(ce)-.18 E F0 3.294(\)c)C .794 |
| (ommand, it causes the shell to stop e)-3.294 F -.15(xe)-.15 G .794 |
| (cuting that script).15 F .245(and return either)144 578.4 R F2(n)3.105 |
| E F0 .246(or the e)2.985 F .246(xit status of the last command e)-.15 F |
| -.15(xe)-.15 G .246(cuted within the script as the e).15 F .246 |
| (xit sta-)-.15 F .082(tus of the script.)144 590.4 R .082 |
| (If used outside a function and not during e)5.082 F -.15(xe)-.15 G .082 |
| (cution of a script by).15 F F1(.)2.582 E F0 2.581(,t).833 G .081 |
| (he return sta-)-2.581 F 2.305(tus is f)144 602.4 R 4.805(alse. An)-.1 F |
| 4.805(yc)-.15 G 2.305(ommand associated with the)-4.805 F F1(RETURN) |
| 4.805 E F0 2.306(trap is e)4.806 F -.15(xe)-.15 G 2.306(cuted before e) |
| .15 F -.15(xe)-.15 G(cution).15 E(resumes after the function or script.) |
| 144 614.4 Q F1(set)108 631.2 Q F0([)2.5 E F1 |
| (\255\255abefhkmnptuvxBCEHPT)A F0 2.5(][)C F1<ad6f>-2.5 E F2(option)2.5 |
| E F0 2.5(][)C F2(ar)-2.5 E(g)-.37 E F0(...])2.5 E F1(set)108 643.2 Q F0 |
| ([)2.5 E F1(+abefhkmnptuvxBCEHPT)A F0 2.5(][)C F1(+o)-2.5 E F2(option) |
| 2.5 E F0 2.5(][)C F2(ar)-2.5 E(g)-.37 E F0(...])2.5 E -.4(Wi)144 655.2 S |
| .836(thout options, the name and v).4 F .835(alue of each shell v)-.25 F |
| .835(ariable are displayed in a format that can be)-.25 F .784 |
| (reused as input for setting or resetting the currently-set v)144 667.2 |
| R 3.284(ariables. Read-only)-.25 F -.25(va)3.284 G .784 |
| (riables cannot be).25 F 2.947(reset. In)144 679.2 R F2 .447(posix mode) |
| 2.947 F F0 2.947(,o)C .447(nly shell v)-2.947 F .447 |
| (ariables are listed.)-.25 F .447 |
| (The output is sorted according to the current)5.447 F 3.53 |
| (locale. When)144 691.2 R 1.031(options are speci\214ed, the)3.53 F |
| 3.531(ys)-.15 G 1.031(et or unset shell attrib)-3.531 F 3.531(utes. An) |
| -.2 F 3.531(ya)-.15 G -.18(rg)-3.531 G 1.031(uments remaining).18 F |
| 1.624(after option processing are treated as v)144 703.2 R 1.623 |
| (alues for the positional parameters and are assigned, in)-.25 F(order) |
| 144 715.2 Q 2.5(,t)-.4 G(o)-2.5 E F1($1)2.5 E F0(,)A F1($2)2.5 E F0(,)A |
| F1 2.5(... $)2.5 F F2(n)A F0 5(.O)C(ptions, if speci\214ed, ha)-5 E .3 |
| -.15(ve t)-.2 H(he follo).15 E(wing meanings:)-.25 E(GNU Bash-4.1)72 768 |
| Q(2009 December 29)135.965 E(60)185.955 E 0 Cg EP |
| %%Page: 61 61 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF<ad61>144 84 Q F0 .539(Automatically mark v) |
| 29.3 F .539 |
| (ariables and functions which are modi\214ed or created for e)-.25 F .54 |
| (xport to)-.15 F(the en)184 96 Q(vironment of subsequent commands.)-.4 E |
| F1<ad62>144 108 Q F0 .132 |
| (Report the status of terminated background jobs immediately)28.74 F |
| 2.632(,r)-.65 G .131(ather than before the ne)-2.632 F(xt)-.15 E |
| (primary prompt.)184 120 Q(This is ef)5 E(fecti)-.25 E .3 -.15(ve o)-.25 |
| H(nly when job control is enabled.).15 E F1<ad65>144 132 Q F0 .51 |
| (Exit immediately if a)29.86 F/F2 10/Times-Italic@0 SF(pipeline)3.01 E |
| F0 .511(\(which may consist of a single)3.011 F F2 .511(simple command) |
| 3.011 F F0 3.011(\), a)B F2(sub-)3.011 E(shell)184 144 Q F0 .872 |
| (command enclosed in parentheses, or one of the commands e)3.373 F -.15 |
| (xe)-.15 G .872(cuted as part of a).15 F .399 |
| (command list enclosed by braces \(see)184 156 R/F3 9/Times-Bold@0 SF |
| .399(SHELL GRAMMAR)2.899 F F0(abo)2.649 E -.15(ve)-.15 G 2.899(\)e).15 G |
| .399(xits with a non-zero)-3.049 F 3.969(status. The)184 168 R 1.468 |
| (shell does not e)3.969 F 1.468(xit if the command that f)-.15 F 1.468 |
| (ails is part of the command list)-.1 F .569(immediately follo)184 180 R |
| .569(wing a)-.25 F F1(while)3.069 E F0(or)3.069 E F1(until)3.069 E F0 |
| -.1(ke)3.069 G(yw)-.05 E .569(ord, part of the test follo)-.1 F .57 |
| (wing the)-.25 F F1(if)3.07 E F0(or)3.07 E F1(elif)3.07 E F0(reserv)184 |
| 192 Q .544(ed w)-.15 F .544(ords, part of an)-.1 F 3.044(yc)-.15 G .544 |
| (ommand e)-3.044 F -.15(xe)-.15 G .544(cuted in a).15 F F1(&&)3.044 E F0 |
| (or)3.044 E/F4 10/Symbol SF<efef>3.044 E F0 .544(list e)3.044 F .544 |
| (xcept the command)-.15 F(follo)184 204 Q 1.23(wing the \214nal)-.25 F |
| F1(&&)3.73 E F0(or)3.73 E F4<efef>3.73 E F0 3.73(,a)C 1.53 -.15(ny c) |
| -3.73 H 1.231(ommand in a pipeline b).15 F 1.231 |
| (ut the last, or if the com-)-.2 F(mand')184 216 Q 3.191(sr)-.55 G .691 |
| (eturn v)-3.191 F .691(alue is being in)-.25 F -.15(ve)-.4 G .691 |
| (rted with).15 F F1(!)3.191 E F0 5.691(.A)C .691(trap on)-2.5 F F1(ERR) |
| 3.19 E F0 3.19(,i)C 3.19(fs)-3.19 G .69(et, is e)-3.19 F -.15(xe)-.15 G |
| .69(cuted before).15 F .686(the shell e)184 228 R 3.186(xits. This)-.15 |
| F .686(option applies to the shell en)3.186 F .686 |
| (vironment and each subshell en)-.4 F(viron-)-.4 E .068 |
| (ment separately \(see)184 240 R F3 .068(COMMAND EXECUTION ENVIR)2.568 F |
| (ONMENT)-.27 E F0(abo)2.318 E -.15(ve)-.15 G .068(\), and may cause).15 |
| F(subshells to e)184 252 Q(xit before e)-.15 E -.15(xe)-.15 G |
| (cuting all the commands in the subshell.).15 E F1<ad66>144 264 Q F0 |
| (Disable pathname e)30.97 E(xpansion.)-.15 E F1<ad68>144 276 Q F0 2.238 |
| (Remember the location of commands as the)28.74 F 4.738(ya)-.15 G 2.239 |
| (re look)-4.738 F 2.239(ed up for e)-.1 F -.15(xe)-.15 G 4.739 |
| (cution. This).15 F(is)4.739 E(enabled by def)184 288 Q(ault.)-.1 E F1 |
| <ad6b>144 300 Q F0 .514(All ar)28.74 F .514 |
| (guments in the form of assignment statements are placed in the en)-.18 |
| F .513(vironment for a)-.4 F |
| (command, not just those that precede the command name.)184 312 Q F1 |
| <ad6d>144 324 Q F0 .148(Monitor mode.)25.97 F .148 |
| (Job control is enabled.)5.148 F .149(This option is on by def)5.148 F |
| .149(ault for interacti)-.1 F .449 -.15(ve s)-.25 H(hells).15 E .637 |
| (on systems that support it \(see)184 336 R F3 .636(JOB CONTR)3.136 F |
| (OL)-.27 E F0(abo)2.886 E -.15(ve)-.15 G 3.136(\). Background).15 F .636 |
| (processes run in a)3.136 F .641 |
| (separate process group and a line containing their e)184 348 R .642 |
| (xit status is printed upon their com-)-.15 F(pletion.)184 360 Q F1 |
| <ad6e>144 372 Q F0 .653(Read commands b)28.74 F .653(ut do not e)-.2 F |
| -.15(xe)-.15 G .653(cute them.).15 F .652 |
| (This may be used to check a shell script for)5.653 F(syntax errors.)184 |
| 384 Q(This is ignored by interacti)5 E .3 -.15(ve s)-.25 H(hells.).15 E |
| F1<ad6f>144 396 Q F2(option\255name)2.5 E F0(The)184 408 Q F2 |
| (option\255name)2.5 E F0(can be one of the follo)2.5 E(wing:)-.25 E F1 |
| (allexport)184 420 Q F0(Same as)224 432 Q F1<ad61>2.5 E F0(.)A F1 |
| (braceexpand)184 444 Q F0(Same as)224 456 Q F1<ad42>2.5 E F0(.)A F1 |
| (emacs)184 468 Q F0 .089(Use an emacs-style command line editing interf) |
| 13.9 F 2.589(ace. This)-.1 F .089(is enabled by def)2.589 F(ault)-.1 E |
| .95(when the shell is interacti)224 480 R -.15(ve)-.25 G 3.45(,u).15 G |
| .95(nless the shell is started with the)-3.45 F F1(\255\255noediting) |
| 3.45 E F0 2.5(option. This)224 492 R(also af)2.5 E |
| (fects the editing interf)-.25 E(ace used for)-.1 E F1 -.18(re)2.5 G |
| (ad \255e).18 E F0(.)A F1(err)184 504 Q(exit)-.18 E F0(Same as)11.31 E |
| F1<ad65>2.5 E F0(.)A F1(errtrace)184 516 Q F0(Same as)5.03 E F1<ad45>2.5 |
| E F0(.)A F1(functrace)184 528 Q F0(Same as)224 540 Q F1<ad54>2.5 E F0(.) |
| A F1(hashall)184 552 Q F0(Same as)9.43 E F1<ad68>2.5 E F0(.)A F1 |
| (histexpand)184 564 Q F0(Same as)224 576 Q F1<ad48>2.5 E F0(.)A F1 |
| (history)184 588 Q F0 .586(Enable command history)10 F 3.087(,a)-.65 G |
| 3.087(sd)-3.087 G .587(escribed abo)-3.087 F .887 -.15(ve u)-.15 H(nder) |
| .15 E F3(HIST)3.087 E(OR)-.162 E(Y)-.315 E/F5 9/Times-Roman@0 SF(.)A F0 |
| .587(This option is)5.087 F(on by def)224 600 Q(ault in interacti)-.1 E |
| .3 -.15(ve s)-.25 H(hells.).15 E F1(ignor)184 612 Q(eeof)-.18 E F0 1.657 |
| (The ef)224 624 R 1.657(fect is as if the shell command)-.25 F/F6 10 |
| /Courier@0 SF(IGNOREEOF=10)4.156 E F0 1.656(had been e)4.156 F -.15(xe) |
| -.15 G(cuted).15 E(\(see)224 636 Q F1(Shell V)2.5 E(ariables)-.92 E F0 |
| (abo)2.5 E -.15(ve)-.15 G(\).).15 E F1 -.1(ke)184 648 S(yw).1 E(ord)-.1 |
| E F0(Same as)224 660 Q F1<ad6b>2.5 E F0(.)A F1(monitor)184 672 Q F0 |
| (Same as)5.56 E F1<ad6d>2.5 E F0(.)A F1(noclob)184 684 Q(ber)-.1 E F0 |
| (Same as)224 696 Q F1<ad43>2.5 E F0(.)A F1(noexec)184 708 Q F0(Same as) |
| 11.12 E F1<ad6e>2.5 E F0(.)A(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(61)185.955 E 0 Cg EP |
| %%Page: 62 62 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(noglob)184 84 Q F0(Same as)11.1 E F1<ad66> |
| 2.5 E F0(.)A F1(nolog)184 96 Q F0(Currently ignored.)16.66 E F1(notify) |
| 184 108 Q F0(Same as)15 E F1<ad62>2.5 E F0(.)A F1(nounset)184 120 Q F0 |
| (Same as)6.66 E F1<ad75>2.5 E F0(.)A F1(onecmd)184 132 Q F0(Same as)6.67 |
| E F1<ad74>2.5 E F0(.)A F1(ph)184 144 Q(ysical)-.15 E F0(Same as)5.14 E |
| F1<ad50>2.5 E F0(.)A F1(pipefail)184 156 Q F0 1.029 |
| (If set, the return v)7.77 F 1.029(alue of a pipeline is the v)-.25 F |
| 1.03(alue of the last \(rightmost\) com-)-.25 F 1.137(mand to e)224 168 |
| R 1.136 |
| (xit with a non-zero status, or zero if all commands in the pipeline) |
| -.15 F -.15(ex)224 180 S(it successfully).15 E 5(.T)-.65 G |
| (his option is disabled by def)-5 E(ault.)-.1 E F1(posix)184 192 Q F0 |
| 2.09(Change the beha)17.77 F 2.091(vior of)-.2 F F1(bash)4.591 E F0 |
| 2.091(where the def)4.591 F 2.091(ault operation dif)-.1 F 2.091 |
| (fers from the)-.25 F(POSIX standard to match the standard \()224 204 Q |
| /F2 10/Times-Italic@0 SF(posix mode)A F0(\).)A F1(pri)184 216 Q(vileged) |
| -.1 E F0(Same as)224 228 Q F1<ad70>2.5 E F0(.)A F1 -.1(ve)184 240 S |
| (rbose).1 E F0(Same as)7.33 E F1<ad76>2.5 E F0(.)A F1(vi)184 252 Q F0 |
| 1.466(Use a vi-style command line editing interf)32.22 F 3.965 |
| (ace. This)-.1 F 1.465(also af)3.965 F 1.465(fects the editing)-.25 F |
| (interf)224 264 Q(ace used for)-.1 E F1 -.18(re)2.5 G(ad \255e).18 E F0 |
| (.)A F1(xtrace)184 276 Q F0(Same as)13.35 E F1<ad78>2.5 E F0(.)A(If)184 |
| 294 Q F1<ad6f>3.052 E F0 .552(is supplied with no)3.052 F F2 |
| (option\255name)3.053 E F0 3.053(,t)C .553(he v)-3.053 F .553 |
| (alues of the current options are printed.)-.25 F(If)5.553 E F1(+o)184 |
| 306 Q F0 1.072(is supplied with no)3.572 F F2(option\255name)3.572 E F0 |
| 3.572(,a)C 1.071(series of)-.001 F F1(set)3.571 E F0 1.071 |
| (commands to recreate the current)3.571 F |
| (option settings is displayed on the standard output.)184 318 Q F1<ad70> |
| 144 330 Q F0 -.45(Tu)28.74 G 1.071(rn on).45 F F2(privile)4.821 E -.1 |
| (ge)-.4 G(d).1 E F0 3.572(mode. In)4.341 F 1.072(this mode, the)3.572 F |
| /F3 9/Times-Bold@0 SF($ENV)3.572 E F0(and)3.322 E F3($B)3.572 E(ASH_ENV) |
| -.27 E F0 1.072(\214les are not pro-)3.322 F 1.501 |
| (cessed, shell functions are not inherited from the en)184 342 R 1.5 |
| (vironment, and the)-.4 F F3(SHELLOPTS)4 E/F4 9/Times-Roman@0 SF(,)A F3 |
| -.27(BA)184 354 S(SHOPTS).27 E F4(,)A F3(CDP)2.774 E -.855(AT)-.666 G(H) |
| .855 E F4(,)A F0(and)2.774 E F3(GLOBIGNORE)3.024 E F0 -.25(va)2.774 G |
| .524(riables, if the).25 F 3.025(ya)-.15 G .525(ppear in the en)-3.025 F |
| (vironment,)-.4 E .38(are ignored.)184 366 R .38 |
| (If the shell is started with the ef)5.38 F(fecti)-.25 E .679 -.15(ve u) |
| -.25 H .379(ser \(group\) id not equal to the real).15 F .461 |
| (user \(group\) id, and the)184 378 R F1<ad70>2.961 E F0 .461 |
| (option is not supplied, these actions are tak)2.961 F .462 |
| (en and the ef)-.1 F(fec-)-.25 E(ti)184 390 Q .695 -.15(ve u)-.25 H .395 |
| (ser id is set to the real user id.).15 F .395(If the)5.395 F F1<ad70> |
| 2.895 E F0 .394(option is supplied at startup, the ef)2.895 F(fecti)-.25 |
| E -.15(ve)-.25 G .386(user id is not reset.)184 402 R -.45(Tu)5.386 G |
| .386(rning this option of).45 F 2.886(fc)-.25 G .387(auses the ef)-2.886 |
| F(fecti)-.25 E .687 -.15(ve u)-.25 H .387(ser and group ids to be).15 F |
| (set to the real user and group ids.)184 414 Q F1<ad74>144 426 Q F0 |
| (Exit after reading and e)30.97 E -.15(xe)-.15 G(cuting one command.).15 |
| E F1<ad75>144 438 Q F0 -.35(Tr)28.74 G .044(eat unset v).35 F .044(aria\ |
| bles and parameters other than the special parameters "@" and "*" as an) |
| -.25 F .182(error when performing parameter e)184 450 R 2.682 |
| (xpansion. If)-.15 F -.15(ex)2.682 G .183 |
| (pansion is attempted on an unset v).15 F(ari-)-.25 E .746 |
| (able or parameter)184 462 R 3.246(,t)-.4 G .746 |
| (he shell prints an error message, and, if not interacti)-3.246 F -.15 |
| (ve)-.25 G 3.246(,e).15 G .746(xits with a)-3.396 F(non-zero status.)184 |
| 474 Q F1<ad76>144 486 Q F0(Print shell input lines as the)29.3 E 2.5(ya) |
| -.15 G(re read.)-2.5 E F1<ad78>144 498 Q F0 .315(After e)29.3 F .315 |
| (xpanding each)-.15 F F2 .315(simple command)2.815 F F0(,)A F1 -.25(fo) |
| 2.815 G(r).25 E F0(command,)2.815 E F1(case)2.815 E F0(command,)2.815 E |
| F1(select)2.815 E F0(command,)2.815 E 1.236(or arithmetic)184 510 R F1 |
| -.25(fo)3.736 G(r).25 E F0 1.236(command, display the e)3.736 F 1.236 |
| (xpanded v)-.15 F 1.236(alue of)-.25 F F3(PS4)3.736 E F4(,)A F0(follo) |
| 3.486 E 1.236(wed by the com-)-.25 F(mand and its e)184 522 Q |
| (xpanded ar)-.15 E(guments or associated w)-.18 E(ord list.)-.1 E F1 |
| <ad42>144 534 Q F0 2.578(The shell performs brace e)27.63 F 2.578 |
| (xpansion \(see)-.15 F F1 2.578(Brace Expansion)5.078 F F0(abo)5.078 E |
| -.15(ve)-.15 G 5.079(\). This).15 F 2.579(is on by)5.079 F(def)184 546 Q |
| (ault.)-.1 E F1<ad43>144 558 Q F0 .214(If set,)27.08 F F1(bash)2.714 E |
| F0 .214(does not o)2.714 F -.15(ve)-.15 G .214(rwrite an e).15 F .214 |
| (xisting \214le with the)-.15 F F1(>)2.714 E F0(,)A F1(>&)2.714 E F0 |
| 2.713(,a)C(nd)-2.713 E F1(<>)2.713 E F0 .213(redirection opera-)2.713 F |
| 3.053(tors. This)184 570 R .553(may be o)3.053 F -.15(ve)-.15 G .553 |
| (rridden when creating output \214les by using the redirection opera-) |
| .15 F(tor)184 582 Q F1(>|)2.5 E F0(instead of)2.5 E F1(>)2.5 E F0(.)A F1 |
| <ad45>144 594 Q F0 .104(If set, an)27.63 F 2.604(yt)-.15 G .104(rap on) |
| -2.604 F F1(ERR)2.604 E F0 .103 |
| (is inherited by shell functions, command substitutions, and com-)2.604 |
| F .838(mands e)184 606 R -.15(xe)-.15 G .838(cuted in a subshell en).15 |
| F 3.338(vironment. The)-.4 F F1(ERR)3.338 E F0 .839 |
| (trap is normally not inherited in)3.339 F(such cases.)184 618 Q F1 |
| <ad48>144 630 Q F0(Enable)26.52 E F1(!)3.032 E F0 .532 |
| (style history substitution.)5.532 F .531(This option is on by def)5.532 |
| F .531(ault when the shell is inter)-.1 F(-)-.2 E(acti)184 642 Q -.15 |
| (ve)-.25 G(.).15 E F1<ad50>144 654 Q F0 1.164 |
| (If set, the shell does not follo)28.19 F 3.664(ws)-.25 G 1.164 |
| (ymbolic links when e)-3.664 F -.15(xe)-.15 G 1.165 |
| (cuting commands such as).15 F F1(cd)3.665 E F0 2.822 |
| (that change the current w)184 666 R 2.822(orking directory)-.1 F 7.822 |
| (.I)-.65 G 5.322(tu)-7.822 G 2.822(ses the ph)-5.322 F 2.821 |
| (ysical directory structure)-.05 F 2.685(instead. By)184 678 R(def)2.685 |
| E(ault,)-.1 E F1(bash)2.686 E F0(follo)2.686 E .186 |
| (ws the logical chain of directories when performing com-)-.25 F |
| (mands which change the current directory)184 690 Q(.)-.65 E F1<ad54>144 |
| 702 Q F0 .89(If set, an)27.63 F 3.39(yt)-.15 G .89(raps on)-3.39 F F1 |
| (DEB)3.39 E(UG)-.1 E F0(and)3.39 E F1(RETURN)3.39 E F0 .89 |
| (are inherited by shell functions, command)3.39 F 1.932 |
| (substitutions, and commands e)184 714 R -.15(xe)-.15 G 1.932 |
| (cuted in a subshell en).15 F 4.432(vironment. The)-.4 F F1(DEB)4.432 E |
| (UG)-.1 E F0(and)4.432 E F1(RETURN)184 726 Q F0 |
| (traps are normally not inherited in such cases.)2.5 E(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(62)185.955 E 0 Cg EP |
| %%Page: 63 63 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF<adad>144 84 Q F0 .401(If no ar)28.6 F .401 |
| (guments follo)-.18 F 2.901(wt)-.25 G .401 |
| (his option, then the positional parameters are unset.)-2.901 F |
| (Otherwise,)5.4 E(the positional parameters are set to the)184 96 Q/F2 |
| 10/Times-Italic@0 SF(ar)2.5 E(g)-.37 E F0(s, e)A -.15(ve)-.25 G 2.5(ni) |
| .15 G 2.5(fs)-2.5 G(ome of them be)-2.5 E(gin with a)-.15 E F1<ad>2.5 E |
| F0(.)A F1<ad>144 108 Q F0 1.944 |
| (Signal the end of options, cause all remaining)34.3 F F2(ar)4.444 E(g) |
| -.37 E F0 4.444(st)C 4.444(ob)-4.444 G 4.445(ea)-4.444 G 1.945 |
| (ssigned to the positional)-4.445 F 3.446(parameters. The)184 120 R F1 |
| <ad78>3.446 E F0(and)3.446 E F1<ad76>3.446 E F0 .945 |
| (options are turned of)3.446 F 3.445(f. If)-.25 F .945(there are no) |
| 3.445 F F2(ar)3.445 E(g)-.37 E F0 .945(s, the positional)B |
| (parameters remain unchanged.)184 132 Q .425(The options are of)144 |
| 148.8 R 2.925(fb)-.25 G 2.925(yd)-2.925 G(ef)-2.925 E .425 |
| (ault unless otherwise noted.)-.1 F .425 |
| (Using + rather than \255 causes these options)5.425 F .178 |
| (to be turned of)144 160.8 R 2.678(f. The)-.25 F .178 |
| (options can also be speci\214ed as ar)2.678 F .178(guments to an in) |
| -.18 F -.2(vo)-.4 G .177(cation of the shell.).2 F(The)5.177 E .066 |
| (current set of options may be found in)144 172.8 R F1<24ad>2.566 E F0 |
| 5.066(.T)C .066(he return status is al)-5.066 F -.1(wa)-.1 G .066 |
| (ys true unless an in).1 F -.25(va)-.4 G .067(lid option).25 F |
| (is encountered.)144 184.8 Q F1(shift)108 201.6 Q F0([)2.5 E F2(n)A F0 |
| (])A .429(The positional parameters from)144 213.6 R F2(n)2.929 E F0 |
| .429(+1 ... are renamed to)B F1 .429($1 ....)2.929 F F0 -.15(Pa)5.428 G |
| .428(rameters represented by the num-).15 F(bers)144 225.6 Q F1($#)2.582 |
| E F0(do)2.582 E .082(wn to)-.25 F F1($#)2.582 E F0<ad>A F2(n)A F0 .082 |
| (+1 are unset.)B F2(n)5.442 E F0 .082(must be a non-ne)2.822 F -.05(ga) |
| -.15 G(ti).05 E .383 -.15(ve n)-.25 H .083(umber less than or equal to) |
| .15 F F1($#)2.583 E F0 5.083(.I)C(f)-5.083 E F2(n)2.943 E F0 .06 |
| (is 0, no parameters are changed.)144 237.6 R(If)5.06 E F2(n)2.92 E F0 |
| .06(is not gi)2.8 F -.15(ve)-.25 G .06(n, it is assumed to be 1.).15 F |
| (If)5.06 E F2(n)2.92 E F0 .06(is greater than)2.8 F F1($#)2.56 E F0 2.56 |
| (,t)C(he)-2.56 E .143(positional parameters are not changed.)144 249.6 R |
| .144(The return status is greater than zero if)5.143 F F2(n)3.004 E F0 |
| .144(is greater than)2.884 F F1($#)2.644 E F0 |
| (or less than zero; otherwise 0.)144 261.6 Q F1(shopt)108 278.4 Q F0([) |
| 2.5 E F1(\255pqsu)A F0 2.5(][)C F1<ad6f>-2.5 E F0 2.5(][)C F2(optname) |
| -2.5 E F0(...])2.5 E -.8(To)144 290.4 S .222(ggle the v).8 F .222 |
| (alues of v)-.25 F .222(ariables controlling optional shell beha)-.25 F |
| (vior)-.2 E 5.222(.W)-.55 G .222(ith no options, or with the)-5.622 F F1 |
| <ad70>2.722 E F0 .721(option, a list of all settable options is display\ |
| ed, with an indication of whether or not each is set.)144 302.4 R(The) |
| 144 314.4 Q F1<ad70>2.828 E F0 .327(option causes output to be displaye\ |
| d in a form that may be reused as input.)2.828 F .327(Other options) |
| 5.327 F(ha)144 326.4 Q .3 -.15(ve t)-.2 H(he follo).15 E(wing meanings:) |
| -.25 E F1<ad73>144 338.4 Q F0(Enable \(set\) each)26.41 E F2(optname)2.5 |
| E F0(.)A F1<ad75>144 350.4 Q F0(Disable \(unset\) each)24.74 E F2 |
| (optname)2.5 E F0(.)A F1<ad71>144 362.4 Q F0 .003(Suppresses normal out\ |
| put \(quiet mode\); the return status indicates whether the)24.74 F F2 |
| (optname)2.504 E F0(is)2.504 E .256(set or unset.)180 374.4 R .256 |
| (If multiple)5.256 F F2(optname)2.756 E F0(ar)2.756 E .256 |
| (guments are gi)-.18 F -.15(ve)-.25 G 2.756(nw).15 G(ith)-2.756 E F1 |
| <ad71>2.756 E F0 2.755(,t)C .255(he return status is zero if)-2.755 F |
| (all)180 386.4 Q F2(optnames)2.5 E F0(are enabled; non-zero otherwise.) |
| 2.5 E F1<ad6f>144 398.4 Q F0(Restricts the v)25.3 E(alues of)-.25 E F2 |
| (optname)2.5 E F0(to be those de\214ned for the)2.5 E F1<ad6f>2.5 E F0 |
| (option to the)2.5 E F1(set)2.5 E F0 -.2(bu)2.5 G(iltin.).2 E .127 |
| (If either)144 415.2 R F1<ad73>2.627 E F0(or)2.627 E F1<ad75>2.627 E F0 |
| .127(is used with no)2.627 F F2(optname)2.627 E F0(ar)2.627 E .127 |
| (guments, the display is limited to those options which)-.18 F 1.024 |
| (are set or unset, respecti)144 427.2 R -.15(ve)-.25 G(ly).15 E 6.024 |
| (.U)-.65 G 1.024(nless otherwise noted, the)-6.024 F F1(shopt)3.523 E F0 |
| 1.023(options are disabled \(unset\) by)3.523 F(def)144 439.2 Q(ault.) |
| -.1 E 1.544(The return status when listing options is zero if all)144 |
| 456 R F2(optnames)4.044 E F0 1.545(are enabled, non-zero otherwise.) |
| 4.045 F .696 |
| (When setting or unsetting options, the return status is zero unless an) |
| 144 468 R F2(optname)3.196 E F0 .696(is not a v)3.196 F .695(alid shell) |
| -.25 F(option.)144 480 Q(The list of)144 496.8 Q F1(shopt)2.5 E F0 |
| (options is:)2.5 E F1(autocd)144 514.8 Q F0 .199 |
| (If set, a command name that is the name of a directory is e)11.11 F |
| -.15(xe)-.15 G .2(cuted as if it were the ar).15 F(gu-)-.18 E |
| (ment to the)184 526.8 Q F1(cd)2.5 E F0 2.5(command. This)2.5 F |
| (option is only used by interacti)2.5 E .3 -.15(ve s)-.25 H(hells.).15 E |
| F1(cdable_v)144 538.8 Q(ars)-.1 E F0 .156(If set, an ar)184 550.8 R .156 |
| (gument to the)-.18 F F1(cd)2.656 E F0 -.2(bu)2.656 G .155 |
| (iltin command that is not a directory is assumed to be the).2 F |
| (name of a v)184 562.8 Q(ariable whose v)-.25 E |
| (alue is the directory to change to.)-.25 E F1(cdspell)144 574.8 Q F0 |
| 1.055 |
| (If set, minor errors in the spelling of a directory component in a) |
| 10.55 F F1(cd)3.555 E F0 1.055(command will be)3.555 F 3.988 |
| (corrected. The)184 586.8 R 1.488(errors check)3.988 F 1.487 |
| (ed for are transposed characters, a missing character)-.1 F 3.987(,a) |
| -.4 G(nd)-3.987 E .552(one character too man)184 598.8 R 4.352 -.65 |
| (y. I)-.15 H 3.052(fac).65 G .552 |
| (orrection is found, the corrected \214le name is printed, and)-3.052 F |
| (the command proceeds.)184 610.8 Q |
| (This option is only used by interacti)5 E .3 -.15(ve s)-.25 H(hells.) |
| .15 E F1(checkhash)144 622.8 Q F0 2.08(If set,)184 634.8 R F1(bash)4.58 |
| E F0 2.079(checks that a command found in the hash table e)4.58 F 2.079 |
| (xists before trying to)-.15 F -.15(exe)184 646.8 S(cute it.).15 E |
| (If a hashed command no longer e)5 E |
| (xists, a normal path search is performed.)-.15 E F1(checkjobs)144 658.8 |
| Q F0 .448(If set,)184 670.8 R F1(bash)2.948 E F0 .448 |
| (lists the status of an)2.948 F 2.949(ys)-.15 G .449 |
| (topped and running jobs before e)-2.949 F .449(xiting an interacti)-.15 |
| F -.15(ve)-.25 G 3.439(shell. If)184 682.8 R(an)3.439 E 3.439(yj)-.15 G |
| .938(obs are running, this causes the e)-3.439 F .938 |
| (xit to be deferred until a second e)-.15 F .938(xit is)-.15 F 2.203 |
| (attempted without an interv)184 694.8 R 2.203(ening command \(see)-.15 |
| F/F3 9/Times-Bold@0 SF 2.203(JOB CONTR)4.703 F(OL)-.27 E F0(abo)4.453 E |
| -.15(ve)-.15 G 4.703(\). The).15 F(shell)4.704 E(al)184 706.8 Q -.1(wa) |
| -.1 G(ys postpones e).1 E(xiting if an)-.15 E 2.5(yj)-.15 G |
| (obs are stopped.)-2.5 E(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 |
| E(63)185.955 E 0 Cg EP |
| %%Page: 64 64 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(checkwinsize)144 84 Q F0 .797(If set,)184 |
| 96 R F1(bash)3.297 E F0 .797(checks the windo)3.297 F 3.297(ws)-.25 G |
| .796(ize after each command and, if necessary)-3.297 F 3.296(,u)-.65 G |
| .796(pdates the)-3.296 F -.25(va)184 108 S(lues of).25 E/F2 9 |
| /Times-Bold@0 SF(LINES)2.5 E F0(and)2.25 E F2(COLUMNS)2.5 E/F3 9 |
| /Times-Roman@0 SF(.)A F1(cmdhist)144 120 Q F0 1.202(If set,)6.11 F F1 |
| (bash)3.702 E F0 1.202(attempts to sa)3.702 F 1.502 -.15(ve a)-.2 H |
| 1.202(ll lines of a multiple-line command in the same history).15 F |
| (entry)184 132 Q 5(.T)-.65 G(his allo)-5 E |
| (ws easy re-editing of multi-line commands.)-.25 E F1(compat31)144 144 Q |
| F0 .42(If set,)184 156 R F1(bash)2.92 E F0 .42(changes its beha)2.92 F |
| .419(vior to that of v)-.2 F .419(ersion 3.1 with respect to quoted ar) |
| -.15 F(guments)-.18 E(to the conditional command')184 168 Q 2.5(s=)-.55 |
| G 2.5(~o)-2.5 G(perator)-2.5 E(.)-.55 E F1(compat32)144 180 Q F0 1.409 |
| (If set,)184 192 R F1(bash)3.909 E F0 1.409(changes its beha)3.909 F |
| 1.409(vior to that of v)-.2 F 1.41 |
| (ersion 3.2 with respect to locale-speci\214c)-.15 F |
| (string comparison when using the conditional command')184 204 Q 2.5 |
| (s<a)-.55 G(nd > operators.)-2.5 E F1(compat40)144 216 Q F0 1.41 |
| (If set,)184 228 R F1(bash)3.91 E F0 1.41(changes its beha)3.91 F 1.409 |
| (vior to that of v)-.2 F 1.409 |
| (ersion 4.0 with respect to locale-speci\214c)-.15 F 1.692 |
| (string comparison when using the conditional command')184 240 R 4.193 |
| (s<a)-.55 G 1.693(nd > operators and the)-4.193 F(ef)184 252 Q |
| (fect of interrupting a command list.)-.25 E F1(dirspell)144 264 Q F0 |
| .859(If set,)7.77 F F1(bash)3.359 E F0 .858 |
| (attempts spelling correction on directory names during w)3.359 F .858 |
| (ord completion if)-.1 F |
| (the directory name initially supplied does not e)184 276 Q(xist.)-.15 E |
| F1(dotglob)144 288 Q F0 .165(If set,)7.77 F F1(bash)2.665 E F0 .165 |
| (includes \214lenames be)2.665 F .165(ginning with a `.)-.15 F 2.665('i) |
| -.7 G 2.665(nt)-2.665 G .165(he results of pathname e)-2.665 F |
| (xpansion.)-.15 E F1(execfail)144 300 Q F0 1.387 |
| (If set, a non-interacti)7.79 F 1.687 -.15(ve s)-.25 H 1.386 |
| (hell will not e).15 F 1.386(xit if it cannot e)-.15 F -.15(xe)-.15 G |
| 1.386(cute the \214le speci\214ed as an).15 F(ar)184 312 Q |
| (gument to the)-.18 E F1(exec)2.5 E F0 -.2(bu)2.5 G(iltin command.).2 E |
| (An interacti)5 E .3 -.15(ve s)-.25 H(hell does not e).15 E(xit if)-.15 |
| E F1(exec)2.5 E F0 -.1(fa)2.5 G(ils.).1 E F1(expand_aliases)144 324 Q F0 |
| .716(If set, aliases are e)184 336 R .717(xpanded as described abo)-.15 |
| F 1.017 -.15(ve u)-.15 H(nder).15 E F2(ALIASES)3.217 E F3(.)A F0 .717 |
| (This option is enabled)5.217 F(by def)184 348 Q(ault for interacti)-.1 |
| E .3 -.15(ve s)-.25 H(hells.).15 E F1(extdeb)144 360 Q(ug)-.2 E F0 |
| (If set, beha)184 372 Q(vior intended for use by deb)-.2 E |
| (uggers is enabled:)-.2 E F1(1.)184 384 Q F0(The)28.5 E F1<ad46>4.251 E |
| F0 1.751(option to the)4.251 F F1(declar)4.251 E(e)-.18 E F0 -.2(bu) |
| 4.251 G 1.751(iltin displays the source \214le name and line).2 F |
| (number corresponding to each function name supplied as an ar)220 396 Q |
| (gument.)-.18 E F1(2.)184 408 Q F0 1.667(If the command run by the)28.5 |
| F F1(DEB)4.167 E(UG)-.1 E F0 1.667(trap returns a non-zero v)4.167 F |
| 1.667(alue, the ne)-.25 F(xt)-.15 E(command is skipped and not e)220 420 |
| Q -.15(xe)-.15 G(cuted.).15 E F1(3.)184 432 Q F0 .841 |
| (If the command run by the)28.5 F F1(DEB)3.341 E(UG)-.1 E F0 .841 |
| (trap returns a v)3.341 F .84(alue of 2, and the shell is)-.25 F -.15 |
| (exe)220 444 S .488 |
| (cuting in a subroutine \(a shell function or a shell script e).15 F |
| -.15(xe)-.15 G .488(cuted by the).15 F F1(.)2.988 E F0(or)2.988 E F1 |
| (sour)220 456 Q(ce)-.18 E F0 -.2(bu)2.5 G(iltins\), a call to).2 E F1 |
| -.18(re)2.5 G(tur).18 E(n)-.15 E F0(is simulated.)2.5 E F1(4.)184 468 Q |
| F2 -.27(BA)28.5 G(SH_ARGC).27 E F0(and)3.154 E F2 -.27(BA)3.404 G |
| (SH_ARGV).27 E F0 .904(are updated as described in their descriptions) |
| 3.154 F(abo)220 480 Q -.15(ve)-.15 G(.).15 E F1(5.)184 492 Q F0 1.359 |
| (Function tracing is enabled:)28.5 F 1.359 |
| (command substitution, shell functions, and sub-)6.359 F(shells in)220 |
| 504 Q -.2(vo)-.4 G -.1(ke).2 G 2.5(dw).1 G(ith)-2.5 E F1(\()2.5 E/F4 10 |
| /Times-Italic@0 SF(command)2.5 E F1(\))2.5 E F0(inherit the)2.5 E F1 |
| (DEB)2.5 E(UG)-.1 E F0(and)2.5 E F1(RETURN)2.5 E F0(traps.)2.5 E F1(6.) |
| 184 516 Q F0 .805(Error tracing is enabled:)28.5 F .804 |
| (command substitution, shell functions, and subshells)5.805 F(in)220 528 |
| Q -.2(vo)-.4 G -.1(ke).2 G 2.5(dw).1 G(ith)-2.5 E F1(\()2.5 E F4 |
| (command)2.5 E F1(\))2.5 E F0(inherit the)2.5 E F1(ERR)2.5 E(OR)-.3 E F0 |
| (trap.)2.5 E F1(extglob)144 540 Q F0 .4(If set, the e)8.89 F .4 |
| (xtended pattern matching features described abo)-.15 F .7 -.15(ve u) |
| -.15 H(nder).15 E F1 -.1(Pa)2.9 G .4(thname Expan-).1 F(sion)184 552 Q |
| F0(are enabled.)2.5 E F1(extquote)144 564 Q F0 2.473(If set,)184 576 R |
| F1($)4.973 E F0<08>A F4(string)A F0 4.973<0861>C(nd)-4.973 E F1($)4.973 |
| E F0(")A F4(string)A F0 4.973("q)C 2.473(uoting is performed within) |
| -4.973 F F1(${)4.973 E F4(par)A(ameter)-.15 E F1(})A F0 -.15(ex)4.973 G |
| (pansions).15 E(enclosed in double quotes.)184 588 Q |
| (This option is enabled by def)5 E(ault.)-.1 E F1(failglob)144 600 Q F0 |
| 1.424(If set, patterns which f)7.77 F 1.425 |
| (ail to match \214lenames during pathname e)-.1 F 1.425 |
| (xpansion result in an)-.15 F -.15(ex)184 612 S(pansion error).15 E(.) |
| -.55 E F1 -.25(fo)144 624 S -.18(rc).25 G(e_\214gnor).18 E(e)-.18 E F0 |
| .937(If set, the suf)184 636 R<8c78>-.25 E .936(es speci\214ed by the) |
| -.15 F F2(FIGNORE)3.436 E F0 .936(shell v)3.186 F .936(ariable cause w) |
| -.25 F .936(ords to be ignored)-.1 F .32(when performing w)184 648 R .32 |
| (ord completion e)-.1 F -.15(ve)-.25 G 2.82(ni).15 G 2.82(ft)-2.82 G .32 |
| (he ignored w)-2.82 F .32(ords are the only possible com-)-.1 F 2.948 |
| (pletions. See)184 660 R F2 .448(SHELL V)2.948 F(ARIABLES)-1.215 E F0 |
| (abo)2.698 E .748 -.15(ve f)-.15 H .448(or a description of).15 F F2 |
| (FIGNORE)2.947 E F3(.)A F0 .447(This option is)4.947 F(enabled by def) |
| 184 672 Q(ault.)-.1 E F1(globstar)144 684 Q F0 .178(If set, the pattern) |
| 5 F F1(**)2.678 E F0 .178(used in a pathname e)2.678 F .178 |
| (xpansion conte)-.15 F .179(xt will match a \214les and zero or)-.15 F |
| 1.298(more directories and subdirectories.)184 696 R 1.298 |
| (If the pattern is follo)6.298 F 1.298(wed by a)-.25 F F1(/)3.797 E F0 |
| 3.797(,o)C 1.297(nly directories)-3.797 F(and subdirectories match.)184 |
| 708 Q(GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(64)185.955 E 0 Cg |
| EP |
| %%Page: 65 65 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(gnu_errfmt)144 84 Q F0(If set, shell error\ |
| messages are written in the standard GNU error message format.)184 96 Q |
| F1(histappend)144 108 Q F0 .676 |
| (If set, the history list is appended to the \214le named by the v)184 |
| 120 R .676(alue of the)-.25 F/F2 9/Times-Bold@0 SF(HISTFILE)3.177 E F0 |
| -.25(va)2.927 G(ri-).25 E(able when the shell e)184 132 Q |
| (xits, rather than o)-.15 E -.15(ve)-.15 G(rwriting the \214le.).15 E F1 |
| (histr)144 144 Q(eedit)-.18 E F0 .576(If set, and)184 156 R F1 -.18(re) |
| 3.076 G(adline).18 E F0 .575(is being used, a user is gi)3.076 F -.15 |
| (ve)-.25 G 3.075(nt).15 G .575(he opportunity to re-edit a f)-3.075 F |
| .575(ailed his-)-.1 F(tory substitution.)184 168 Q F1(histv)144 180 Q |
| (erify)-.1 E F0 .402(If set, and)184 192 R F1 -.18(re)2.903 G(adline).18 |
| E F0 .403 |
| (is being used, the results of history substitution are not immediately) |
| 2.903 F .662(passed to the shell parser)184 204 R 5.662(.I)-.55 G .661 |
| (nstead, the resulting line is loaded into the)-5.662 F F1 -.18(re)3.161 |
| G(adline).18 E F0(editing)3.161 E -.2(bu)184 216 S -.25(ff).2 G(er).25 E |
| 2.5(,a)-.4 G(llo)-2.5 E(wing further modi\214cation.)-.25 E F1 |
| (hostcomplete)144 228 Q F0 1.181(If set, and)184 240 R F1 -.18(re)3.681 |
| G(adline).18 E F0 1.181(is being used,)3.681 F F1(bash)3.682 E F0 1.182 |
| (will attempt to perform hostname completion)3.682 F 1.381(when a w)184 |
| 252 R 1.381(ord containing a)-.1 F F1(@)3.881 E F0 1.381 |
| (is being completed \(see)3.881 F F1(Completing)3.88 E F0(under)3.88 E |
| F2(READLINE)3.88 E F0(abo)184 264 Q -.15(ve)-.15 G 2.5(\). This).15 F |
| (is enabled by def)2.5 E(ault.)-.1 E F1(huponexit)144 276 Q F0(If set,) |
| 184 288 Q F1(bash)2.5 E F0(will send)2.5 E F2(SIGHUP)2.5 E F0 |
| (to all jobs when an interacti)2.25 E .3 -.15(ve l)-.25 H(ogin shell e) |
| .15 E(xits.)-.15 E F1(interacti)144 300 Q -.1(ve)-.1 G(_comments).1 E F0 |
| .33(If set, allo)184 312 R 2.83(waw)-.25 G .33(ord be)-2.93 F .33 |
| (ginning with)-.15 F F1(#)2.83 E F0 .33(to cause that w)2.83 F .33 |
| (ord and all remaining characters on)-.1 F .967 |
| (that line to be ignored in an interacti)184 324 R 1.267 -.15(ve s)-.25 |
| H .967(hell \(see).15 F F2(COMMENTS)3.467 E F0(abo)3.217 E -.15(ve)-.15 |
| G 3.467(\). This).15 F .967(option is)3.467 F(enabled by def)184 336 Q |
| (ault.)-.1 E F1(lithist)144 348 Q F0 .654(If set, and the)15.55 F F1 |
| (cmdhist)3.154 E F0 .654(option is enabled, multi-line commands are sa) |
| 3.154 F -.15(ve)-.2 G 3.155(dt).15 G 3.155(ot)-3.155 G .655(he history) |
| -3.155 F(with embedded ne)184 360 Q |
| (wlines rather than using semicolon separators where possible.)-.25 E F1 |
| (login_shell)144 372 Q F0 .486 |
| (The shell sets this option if it is started as a login shell \(see)184 |
| 384 R F2(INV)2.986 E(OCA)-.405 E(TION)-.855 E F0(abo)2.736 E -.15(ve) |
| -.15 G 2.986(\). The).15 F -.25(va)184 396 S(lue may not be changed.).25 |
| E F1(mailwar)144 408 Q(n)-.15 E F0 .814(If set, and a \214le that)184 |
| 420 R F1(bash)3.314 E F0 .815 |
| (is checking for mail has been accessed since the last time it)3.314 F |
| -.1(wa)184 432 S 2.5(sc).1 G(heck)-2.5 E(ed, the message `)-.1 E |
| (`The mail in)-.74 E/F3 10/Times-Italic@0 SF(mail\214le)2.5 E F0 |
| (has been read')2.5 E 2.5('i)-.74 G 2.5(sd)-2.5 G(isplayed.)-2.5 E F1 |
| (no_empty_cmd_completion)144 444 Q F0 .325(If set, and)184 456 R F1 -.18 |
| (re)2.825 G(adline).18 E F0 .325(is being used,)2.825 F F1(bash)2.824 E |
| F0 .324(will not attempt to search the)2.824 F F2 -.666(PA)2.824 G(TH) |
| -.189 E F0 .324(for possible)2.574 F |
| (completions when completion is attempted on an empty line.)184 468 Q F1 |
| (nocaseglob)144 480 Q F0 .436(If set,)184 492 R F1(bash)2.936 E F0 .436 |
| (matches \214lenames in a case\255insensiti)2.936 F .737 -.15(ve f)-.25 |
| H .437(ashion when performing pathname).05 F -.15(ex)184 504 S |
| (pansion \(see).15 E F1 -.1(Pa)2.5 G(thname Expansion).1 E F0(abo)2.5 E |
| -.15(ve)-.15 G(\).).15 E F1(nocasematch)144 516 Q F0 1.194(If set,)184 |
| 528 R F1(bash)3.694 E F0 1.194(matches patterns in a case\255insensiti) |
| 3.694 F 1.493 -.15(ve f)-.25 H 1.193(ashion when performing matching).05 |
| F(while e)184 540 Q -.15(xe)-.15 G(cuting).15 E F1(case)2.5 E F0(or)2.5 |
| E F1([[)2.5 E F0(conditional commands.)2.5 E F1(nullglob)144 552 Q F0 |
| .854(If set,)184 564 R F1(bash)3.354 E F0(allo)3.354 E .855 |
| (ws patterns which match no \214les \(see)-.25 F F1 -.1(Pa)3.355 G .855 |
| (thname Expansion).1 F F0(abo)3.355 E -.15(ve)-.15 G 3.355(\)t).15 G(o) |
| -3.355 E -.15(ex)184 576 S(pand to a null string, rather than themselv) |
| .15 E(es.)-.15 E F1(pr)144 588 Q(ogcomp)-.18 E F0 .677 |
| (If set, the programmable completion f)184 600 R .677(acilities \(see) |
| -.1 F F1(Pr)3.176 E .676(ogrammable Completion)-.18 F F0(abo)3.176 E |
| -.15(ve)-.15 G(\)).15 E(are enabled.)184 612 Q |
| (This option is enabled by def)5 E(ault.)-.1 E F1(pr)144 624 Q(omptv) |
| -.18 E(ars)-.1 E F0 1.447(If set, prompt strings under)184 636 R 1.448 |
| (go parameter e)-.18 F 1.448(xpansion, command substitution, arithmetic) |
| -.15 F -.15(ex)184 648 S .171(pansion, and quote remo).15 F -.25(va)-.15 |
| G 2.67(la).25 G .17(fter being e)-2.67 F .17(xpanded as described in) |
| -.15 F F2(PR)2.67 E(OMPTING)-.27 E F0(abo)2.42 E -.15(ve)-.15 G(.).15 E |
| (This option is enabled by def)184 660 Q(ault.)-.1 E F1 -.18(re)144 672 |
| S(stricted_shell).18 E F0 1.069 |
| (The shell sets this option if it is started in restricted mode \(see) |
| 184 684 R F2 1.069(RESTRICTED SHELL)3.569 F F0(belo)184 696 Q 4.178 |
| (w\). The)-.25 F -.25(va)4.178 G 1.678(lue may not be changed.).25 F |
| 1.678(This is not reset when the startup \214les are)6.678 F -.15(exe) |
| 184 708 S(cuted, allo).15 E(wing the startup \214les to disco)-.25 E |
| -.15(ve)-.15 G 2.5(rw).15 G(hether or not a shell is restricted.)-2.5 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(65)185.955 E 0 Cg EP |
| %%Page: 66 66 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(shift_v)144 84 Q(erbose)-.1 E F0 .501 |
| (If set, the)184 96 R F1(shift)3.001 E F0 -.2(bu)3.001 G .501 |
| (iltin prints an error message when the shift count e).2 F .502 |
| (xceeds the number)-.15 F(of positional parameters.)184 108 Q F1(sour) |
| 144 120 Q(cepath)-.18 E F0 .771(If set, the)184 132 R F1(sour)3.271 E |
| (ce)-.18 E F0(\()3.271 E F1(.)A F0 3.271(\)b)C .771(uiltin uses the v) |
| -3.471 F .771(alue of)-.25 F/F2 9/Times-Bold@0 SF -.666(PA)3.27 G(TH) |
| -.189 E F0 .77(to \214nd the directory containing the)3.02 F |
| (\214le supplied as an ar)184 144 Q 2.5(gument. This)-.18 F |
| (option is enabled by def)2.5 E(ault.)-.1 E F1(xpg_echo)144 156 Q F0 |
| (If set, the)184 168 Q F1(echo)2.5 E F0 -.2(bu)2.5 G(iltin e).2 E |
| (xpands backslash-escape sequences by def)-.15 E(ault.)-.1 E F1(suspend) |
| 108 180 Q F0([)2.5 E F1<ad66>A F0(])A 1.001(Suspend the e)144 192 R -.15 |
| (xe)-.15 G 1.001(cution of this shell until it recei).15 F -.15(ve)-.25 |
| G 3.501(sa).15 G F2(SIGCONT)A F0 3.502(signal. A)3.252 F 1.002 |
| (login shell cannot be)3.502 F .023(suspended; the)144 204 R F1<ad66> |
| 2.523 E F0 .023(option can be used to o)2.523 F -.15(ve)-.15 G .022 |
| (rride this and force the suspension.).15 F .022(The return status is) |
| 5.022 F 2.5(0u)144 216 S(nless the shell is a login shell and)-2.5 E F1 |
| <ad66>2.5 E F0(is not supplied, or if job control is not enabled.)2.5 E |
| F1(test)108 228 Q/F3 10/Times-Italic@0 SF -.2(ex)2.5 G(pr).2 E F1([)108 |
| 240 Q F3 -.2(ex)2.5 G(pr).2 E F1(])2.5 E F0 1.15 |
| (Return a status of 0 or 1 depending on the e)6.77 F -.25(va)-.25 G 1.15 |
| (luation of the conditional e).25 F(xpression)-.15 E F3 -.2(ex)3.65 G |
| (pr).2 E F0 6.15(.E).73 G(ach)-6.15 E 1.188 |
| (operator and operand must be a separate ar)144 252 R 3.688 |
| (gument. Expressions)-.18 F 1.187(are composed of the primaries)3.688 F |
| 1.889(described abo)144 264 R 2.189 -.15(ve u)-.15 H(nder).15 E F2 |
| (CONDITION)4.389 E 1.889(AL EXPRESSIONS)-.18 F/F4 9/Times-Roman@0 SF(.)A |
| F1(test)6.389 E F0 1.89(does not accept an)4.389 F 4.39(yo)-.15 G 1.89 |
| (ptions, nor)-4.39 F(does it accept and ignore an ar)144 276 Q |
| (gument of)-.18 E F1<adad>2.5 E F0(as signifying the end of options.)2.5 |
| E .786(Expressions may be combined using the follo)144 294 R .785 |
| (wing operators, listed in decreasing order of prece-)-.25 F 2.5 |
| (dence. The)144 306 R -.25(eva)2.5 G |
| (luation depends on the number of ar).25 E(guments; see belo)-.18 E -.65 |
| (w.)-.25 G F1(!)144 318 Q F3 -.2(ex)2.5 G(pr).2 E F0 -.35(Tr)12.6 G |
| (ue if).35 E F3 -.2(ex)2.5 G(pr).2 E F0(is f)3.23 E(alse.)-.1 E F1(\() |
| 144 330 Q F3 -.2(ex)2.5 G(pr).2 E F1(\))2.5 E F0 .26(Returns the v)6.77 |
| F .26(alue of)-.25 F F3 -.2(ex)2.76 G(pr).2 E F0 5.26(.T)C .26 |
| (his may be used to o)-5.26 F -.15(ve)-.15 G .26 |
| (rride the normal precedence of opera-).15 F(tors.)180 342 Q F3 -.2(ex) |
| 144 354 S(pr1).2 E F0<ad>2.5 E F1(a)A F3 -.2(ex)2.5 G(pr2).2 E F0 -.35 |
| (Tr)180 366 S(ue if both).35 E F3 -.2(ex)2.5 G(pr1).2 E F0(and)2.5 E F3 |
| -.2(ex)2.5 G(pr2).2 E F0(are true.)2.52 E F3 -.2(ex)144 378 S(pr1).2 E |
| F0<ad>2.5 E F1(o)A F3 -.2(ex)2.5 G(pr2).2 E F0 -.35(Tr)180 390 S |
| (ue if either).35 E F3 -.2(ex)2.5 G(pr1).2 E F0(or)2.5 E F3 -.2(ex)2.5 G |
| (pr2).2 E F0(is true.)2.52 E F1(test)144 406.8 Q F0(and)2.5 E F1([)2.5 E |
| F0 -.25(eva)2.5 G(luate conditional e).25 E |
| (xpressions using a set of rules based on the number of ar)-.15 E |
| (guments.)-.18 E 2.5(0a)144 424.8 S -.18(rg)-2.5 G(uments).18 E(The e) |
| 180 436.8 Q(xpression is f)-.15 E(alse.)-.1 E 2.5(1a)144 448.8 S -.18 |
| (rg)-2.5 G(ument).18 E(The e)180 460.8 Q |
| (xpression is true if and only if the ar)-.15 E(gument is not null.)-.18 |
| E 2.5(2a)144 472.8 S -.18(rg)-2.5 G(uments).18 E .37(If the \214rst ar) |
| 180 484.8 R .37(gument is)-.18 F F1(!)2.87 E F0 2.87(,t)C .37(he e)-2.87 |
| F .37(xpression is true if and only if the second ar)-.15 F .37 |
| (gument is null.)-.18 F .379(If the \214rst ar)180 496.8 R .38 |
| (gument is one of the unary conditional operators listed abo)-.18 F .68 |
| -.15(ve u)-.15 H(nder).15 E F2(CONDI-)2.88 E(TION)180 508.8 Q .553 |
| (AL EXPRESSIONS)-.18 F F4(,)A F0 .552(the e)2.802 F .552 |
| (xpression is true if the unary test is true.)-.15 F .552 |
| (If the \214rst ar)5.552 F(gu-)-.18 E(ment is not a v)180 520.8 Q |
| (alid unary conditional operator)-.25 E 2.5(,t)-.4 G(he e)-2.5 E |
| (xpression is f)-.15 E(alse.)-.1 E 2.5(3a)144 532.8 S -.18(rg)-2.5 G |
| (uments).18 E .023(If the second ar)180 544.8 R .023 |
| (gument is one of the binary conditional operators listed abo)-.18 F |
| .324 -.15(ve u)-.15 H(nder).15 E F2(CON-)2.524 E(DITION)180 556.8 Q |
| 1.478(AL EXPRESSIONS)-.18 F F4(,)A F0 1.477(the result of the e)3.727 F |
| 1.477(xpression is the result of the binary test)-.15 F .513 |
| (using the \214rst and third ar)180 568.8 R .513(guments as operands.) |
| -.18 F(The)5.513 E F1<ad61>3.013 E F0(and)3.013 E F1<ad6f>3.013 E F0 |
| .513(operators are considered)3.013 F .972 |
| (binary operators when there are three ar)180 580.8 R 3.472(guments. If) |
| -.18 F .972(the \214rst ar)3.472 F .972(gument is)-.18 F F1(!)3.472 E F0 |
| 3.472(,t)C .972(he v)-3.472 F .972(alue is)-.25 F .883(the ne)180 592.8 |
| R -.05(ga)-.15 G .883(tion of the tw).05 F(o-ar)-.1 E .884 |
| (gument test using the second and third ar)-.18 F 3.384(guments. If)-.18 |
| F .884(the \214rst)3.384 F(ar)180 604.8 Q .875(gument is e)-.18 F |
| (xactly)-.15 E F1(\()3.375 E F0 .875(and the third ar)3.375 F .875 |
| (gument is e)-.18 F(xactly)-.15 E F1(\))3.375 E F0 3.374(,t)C .874 |
| (he result is the one-ar)-3.374 F(gument)-.18 E(test of the second ar) |
| 180 616.8 Q 2.5(gument. Otherwise,)-.18 F(the e)2.5 E(xpression is f) |
| -.15 E(alse.)-.1 E 2.5(4a)144 628.8 S -.18(rg)-2.5 G(uments).18 E .384 |
| (If the \214rst ar)180 640.8 R .384(gument is)-.18 F F1(!)2.884 E F0 |
| 2.885(,t)C .385(he result is the ne)-2.885 F -.05(ga)-.15 G .385 |
| (tion of the three-ar).05 F .385(gument e)-.18 F .385(xpression com-) |
| -.15 F 1.648(posed of the remaining ar)180 652.8 R 4.147 |
| (guments. Otherwise,)-.18 F 1.647(the e)4.147 F 1.647 |
| (xpression is parsed and e)-.15 F -.25(va)-.25 G(luated).25 E |
| (according to precedence using the rules listed abo)180 664.8 Q -.15(ve) |
| -.15 G(.).15 E 2.5(5o)144 676.8 S 2.5(rm)-2.5 G(ore ar)-2.5 E(guments) |
| -.18 E 1.635(The e)180 688.8 R 1.635(xpression is parsed and e)-.15 F |
| -.25(va)-.25 G 1.635 |
| (luated according to precedence using the rules listed).25 F(abo)180 |
| 700.8 Q -.15(ve)-.15 G(.).15 E F1(times)108 717.6 Q F0 1.229(Print the \ |
| accumulated user and system times for the shell and for processes run f\ |
| rom the shell.)13.23 F(The return status is 0.)144 729.6 Q(GNU Bash-4.1) |
| 72 768 Q(2009 December 29)135.965 E(66)185.955 E 0 Cg EP |
| %%Page: 67 67 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF(trap)108 84 Q F0([)2.5 E F1(\255lp)A F0 2.5 |
| (][)C([)-2.5 E/F2 10/Times-Italic@0 SF(ar)A(g)-.37 E F0(])A F2(sigspec) |
| 2.5 E F0(...])2.5 E .702(The command)144 96 R F2(ar)3.532 E(g)-.37 E F0 |
| .702(is to be read and e)3.422 F -.15(xe)-.15 G .702 |
| (cuted when the shell recei).15 F -.15(ve)-.25 G 3.203(ss).15 G |
| (ignal\(s\))-3.203 E F2(sigspec)3.203 E F0 5.703(.I).31 G(f)-5.703 E F2 |
| (ar)3.533 E(g)-.37 E F0(is)3.423 E .609(absent \(and there is a single) |
| 144 108 R F2(sigspec)3.108 E F0 3.108(\)o)C(r)-3.108 E F1<ad>3.108 E F0 |
| 3.108(,e)C .608 |
| (ach speci\214ed signal is reset to its original disposition)-3.108 F |
| .658(\(the v)144 120 R .658(alue it had upon entrance to the shell\).) |
| -.25 F(If)5.658 E F2(ar)3.488 E(g)-.37 E F0 .659 |
| (is the null string the signal speci\214ed by each)3.378 F F2(sigspec) |
| 144.34 132 Q F0 .581(is ignored by the shell and by the commands it in) |
| 3.391 F -.2(vo)-.4 G -.1(ke).2 G 3.08(s. If).1 F F2(ar)3.41 E(g)-.37 E |
| F0 .58(is not present and)3.3 F F1<ad70>3.08 E F0(has)3.08 E 1.214 |
| (been supplied, then the trap commands associated with each)144 144 R F2 |
| (sigspec)4.054 E F0 1.215(are displayed.)4.024 F 1.215(If no ar)6.215 F |
| (gu-)-.18 E .86(ments are supplied or if only)144 156 R F1<ad70>3.36 E |
| F0 .86(is gi)3.36 F -.15(ve)-.25 G(n,).15 E F1(trap)3.36 E F0 .86 |
| (prints the list of commands associated with each)3.36 F 2.83 |
| (signal. The)144 168 R F1<ad6c>2.83 E F0 .33(option causes the shell to\ |
| print a list of signal names and their corresponding num-)2.83 F 4.311 |
| (bers. Each)144 180 R F2(sigspec)4.651 E F0 1.811 |
| (is either a signal name de\214ned in <)4.621 F F2(signal.h)A F0 1.81 |
| (>, or a signal number)B 6.81(.S)-.55 G(ignal)-6.81 E |
| (names are case insensiti)144 192 Q .3 -.15(ve a)-.25 H |
| (nd the SIG pre\214x is optional.).15 E 1.648(If a)144 210 R F2(sigspec) |
| 4.488 E F0(is)4.458 E/F3 9/Times-Bold@0 SF(EXIT)4.148 E F0 1.648 |
| (\(0\) the command)3.898 F F2(ar)4.479 E(g)-.37 E F0 1.649(is e)4.369 F |
| -.15(xe)-.15 G 1.649(cuted on e).15 F 1.649(xit from the shell.)-.15 F |
| 1.649(If a)6.649 F F2(sigspec)4.489 E F0(is)4.459 E F3(DEB)144 222 Q(UG) |
| -.09 E/F4 9/Times-Roman@0 SF(,)A F0 1.168(the command)3.418 F F2(ar) |
| 3.998 E(g)-.37 E F0 1.168(is e)3.888 F -.15(xe)-.15 G 1.167 |
| (cuted before e).15 F -.15(ve)-.25 G(ry).15 E F2 1.167(simple command) |
| 3.667 F F0(,)A F2(for)3.667 E F0(command,)3.667 E F2(case)3.667 E F0 |
| (com-)3.667 E(mand,)144 234 Q F2(select)2.646 E F0 .146(command, e)2.646 |
| F -.15(ve)-.25 G .146(ry arithmetic).15 F F2(for)2.646 E F0 .147 |
| (command, and before the \214rst command e)2.646 F -.15(xe)-.15 G .147 |
| (cutes in a).15 F .146(shell function \(see)144 246 R F3 .146 |
| (SHELL GRAMMAR)2.646 F F0(abo)2.396 E -.15(ve)-.15 G 2.646(\). Refer).15 |
| F .146(to the description of the)2.646 F F1(extdeb)2.645 E(ug)-.2 E F0 |
| .145(option to)2.645 F(the)144 258 Q F1(shopt)3.2 E F0 -.2(bu)3.2 G .7 |
| (iltin for details of its ef).2 F .7(fect on the)-.25 F F1(DEB)3.2 E(UG) |
| -.1 E F0 3.2(trap. If)3.2 F(a)3.2 E F2(sigspec)3.54 E F0(is)3.51 E F3 |
| (RETURN)3.2 E F4(,)A F0 .701(the com-)2.951 F(mand)144 270 Q F2(ar)3.474 |
| E(g)-.37 E F0 .644(is e)3.364 F -.15(xe)-.15 G .643 |
| (cuted each time a shell function or a script e).15 F -.15(xe)-.15 G |
| .643(cuted with the).15 F F1(.)3.143 E F0(or)3.143 E F1(sour)3.143 E(ce) |
| -.18 E F0 -.2(bu)3.143 G(iltins).2 E(\214nishes e)144 282 Q -.15(xe)-.15 |
| G(cuting.).15 E .928(If a)144 300 R F2(sigspec)3.768 E F0(is)3.738 E F3 |
| (ERR)3.429 E F4(,)A F0 .929(the command)3.179 F F2(ar)3.759 E(g)-.37 E |
| F0 .929(is e)3.649 F -.15(xe)-.15 G .929(cuted whene).15 F -.15(ve)-.25 |
| G 3.429(ras).15 G .929(imple command has a non\255zero)-3.429 F -.15(ex) |
| 144 312 S 1.009(it status, subject to the follo).15 F 1.009 |
| (wing conditions.)-.25 F(The)6.009 E F3(ERR)3.509 E F0 1.009 |
| (trap is not e)3.259 F -.15(xe)-.15 G 1.008(cuted if the f).15 F 1.008 |
| (ailed com-)-.1 F .324 |
| (mand is part of the command list immediately follo)144 324 R .324 |
| (wing a)-.25 F F1(while)2.824 E F0(or)2.824 E F1(until)2.824 E F0 -.1 |
| (ke)2.824 G(yw)-.05 E .324(ord, part of the test)-.1 F 1.129(in an)144 |
| 336 R F2(if)3.639 E F0 1.129(statement, part of a command e)5.589 F -.15 |
| (xe)-.15 G 1.129(cuted in a).15 F F1(&&)3.629 E F0(or)3.629 E/F5 10 |
| /Symbol SF<efef>3.629 E F0 1.129(list, or if the command')3.629 F 3.628 |
| (sr)-.55 G(eturn)-3.628 E -.25(va)144 348 S(lue is being in).25 E -.15 |
| (ve)-.4 G(rted via).15 E F1(!)2.5 E F0 5(.T)C |
| (hese are the same conditions obe)-5 E(yed by the)-.15 E F1(err)2.5 E |
| (exit)-.18 E F0(option.)2.5 E 1.095 |
| (Signals ignored upon entry to the shell cannot be trapped or reset.)144 |
| 366 R -.35(Tr)6.095 G 1.095(apped signals that are not).35 F .662 |
| (being ignored are reset to their original v)144 378 R .662 |
| (alues in a subshell or subshell en)-.25 F .661(vironment when one is) |
| -.4 F 2.5(created. The)144 390 R(return status is f)2.5 E(alse if an)-.1 |
| E(y)-.15 E F2(sigspec)2.84 E F0(is in)2.81 E -.25(va)-.4 G |
| (lid; otherwise).25 E F1(trap)2.5 E F0(returns true.)2.5 E F1(type)108 |
| 406.8 Q F0([)2.5 E F1(\255aftpP)A F0(])A F2(name)2.5 E F0([)2.5 E F2 |
| (name)A F0(...])2.5 E -.4(Wi)144 418.8 S .173 |
| (th no options, indicate ho).4 F 2.673(we)-.25 G(ach)-2.673 E F2(name) |
| 3.033 E F0 -.1(wo)2.853 G .174 |
| (uld be interpreted if used as a command name.).1 F .174(If the)5.174 F |
| F1<ad74>144 430.8 Q F0 .843(option is used,)3.343 F F1(type)3.343 E F0 |
| .843(prints a string which is one of)3.343 F F2(alias)3.343 E F0(,).27 E |
| F2 -.1(ke)3.343 G(ywor)-.2 E(d)-.37 E F0(,).77 E F2(function)3.343 E F0 |
| (,).24 E F2 -.2(bu)3.342 G(iltin).2 E F0 3.342(,o).24 G(r)-3.342 E F2 |
| (\214le)5.252 E F0(if)3.522 E F2(name)144.36 442.8 Q F0 .086 |
| (is an alias, shell reserv)2.766 F .086(ed w)-.15 F .086 |
| (ord, function, b)-.1 F .087(uiltin, or disk \214le, respecti)-.2 F -.15 |
| (ve)-.25 G(ly).15 E 5.087(.I)-.65 G 2.587(ft)-5.087 G(he)-2.587 E F2 |
| (name)2.947 E F0 .087(is not)2.767 F .119 |
| (found, then nothing is printed, and an e)144 454.8 R .118 |
| (xit status of f)-.15 F .118(alse is returned.)-.1 F .118(If the)5.118 F |
| F1<ad70>2.618 E F0 .118(option is used,)2.618 F F1(type)2.618 E F0 .855 |
| (either returns the name of the disk \214le that w)144 466.8 R .855 |
| (ould be e)-.1 F -.15(xe)-.15 G .855(cuted if).15 F F2(name)3.715 E F0 |
| .855(were speci\214ed as a com-)3.535 F .641(mand name, or nothing if) |
| 144 478.8 R/F6 10/Courier@0 SF .641(type -t name)3.141 F F0 -.1(wo)3.141 |
| G .641(uld not return).1 F F2(\214le)3.14 E F0 5.64(.T).18 G(he)-5.64 E |
| F1<ad50>3.14 E F0 .64(option forces a)3.14 F F3 -.666(PA)3.14 G(TH)-.189 |
| E F0 .112(search for each)144 490.8 R F2(name)2.612 E F0 2.612(,e)C -.15 |
| (ve)-2.862 G 2.613(ni).15 G(f)-2.613 E F6 .113(type -t name)2.613 F F0 |
| -.1(wo)2.613 G .113(uld not return).1 F F2(\214le)2.613 E F0 5.113(.I) |
| .18 G 2.613(fac)-5.113 G .113(ommand is hashed,)-2.613 F F1<ad70>2.613 E |
| F0(and)144 502.8 Q F1<ad50>2.945 E F0 .445(print the hashed v)2.945 F |
| .444(alue, not necessarily the \214le that appears \214rst in)-.25 F F3 |
| -.666(PA)2.944 G(TH)-.189 E F4(.)A F0 .444(If the)4.944 F F1<ad61>2.944 |
| E F0(option)2.944 E .265(is used,)144 514.8 R F1(type)2.765 E F0 .265 |
| (prints all of the places that contain an e)2.765 F -.15(xe)-.15 G .265 |
| (cutable named).15 F F2(name)2.765 E F0 5.265(.T).18 G .265 |
| (his includes aliases)-5.265 F .427(and functions, if and only if the) |
| 144 526.8 R F1<ad70>2.926 E F0 .426(option is not also used.)2.926 F |
| .426(The table of hashed commands is not)5.426 F .548 |
| (consulted when using)144 538.8 R F1<ad61>3.048 E F0 5.548(.T)C(he) |
| -5.548 E F1<ad66>3.048 E F0 .549 |
| (option suppresses shell function lookup, as with the)3.048 F F1 |
| (command)3.049 E F0 -.2(bu)144 550.8 S(iltin.).2 E F1(type)5 E F0 |
| (returns true if all of the ar)2.5 E(guments are found, f)-.18 E |
| (alse if an)-.1 E 2.5(ya)-.15 G(re not found.)-2.5 E F1(ulimit)108 567.6 |
| Q F0([)2.5 E F1(\255HST)A(abcde\214lmnpqrstuvx)-.92 E F0([)2.5 E F2 |
| (limit)A F0(]])A(Pro)144 579.6 Q .244(vides control o)-.15 F -.15(ve) |
| -.15 G 2.744(rt).15 G .244(he resources a)-2.744 F -.25(va)-.2 G .244 |
| (ilable to the shell and to processes started by it, on systems).25 F |
| .943(that allo)144 591.6 R 3.443(ws)-.25 G .943(uch control.)-3.443 F |
| (The)5.943 E F1<ad48>3.443 E F0(and)3.443 E F1<ad53>3.444 E F0 .944 |
| (options specify that the hard or soft limit is set for the)3.444 F(gi) |
| 144 603.6 Q -.15(ve)-.25 G 2.709(nr).15 G 2.709(esource. A)-2.709 F .208 |
| (hard limit cannot be increased by a non-root user once it is set; a so\ |
| ft limit may)2.709 F .425(be increased up to the v)144 615.6 R .425 |
| (alue of the hard limit.)-.25 F .426(If neither)5.425 F F1<ad48>2.926 E |
| F0(nor)2.926 E F1<ad53>2.926 E F0 .426 |
| (is speci\214ed, both the soft and)2.926 F .139(hard limits are set.)144 |
| 627.6 R .139(The v)5.139 F .139(alue of)-.25 F F2(limit)2.729 E F0 .139 |
| (can be a number in the unit speci\214ed for the resource or one)3.319 F |
| .741(of the special v)144 639.6 R(alues)-.25 E F1(hard)3.241 E F0(,)A F1 |
| (soft)3.241 E F0 3.241(,o)C(r)-3.241 E F1(unlimited)3.241 E F0 3.241(,w) |
| C .741(hich stand for the current hard limit, the current)-3.241 F .78 |
| (soft limit, and no limit, respecti)144 651.6 R -.15(ve)-.25 G(ly).15 E |
| 5.78(.I)-.65 G(f)-5.78 E F2(limit)3.37 E F0 .78 |
| (is omitted, the current v)3.96 F .78(alue of the soft limit of the)-.25 |
| F .498(resource is printed, unless the)144 663.6 R F1<ad48>2.999 E F0 |
| .499(option is gi)2.999 F -.15(ve)-.25 G 2.999(n. When).15 F .499 |
| (more than one resource is speci\214ed, the)2.999 F |
| (limit name and unit are printed before the v)144 675.6 Q 2.5 |
| (alue. Other)-.25 F(options are interpreted as follo)2.5 E(ws:)-.25 E F1 |
| <ad61>144 687.6 Q F0(All current limits are reported)25.3 E F1<ad62>144 |
| 699.6 Q F0(The maximum sock)24.74 E(et b)-.1 E(uf)-.2 E(fer size)-.25 E |
| F1<ad63>144 711.6 Q F0(The maximum size of core \214les created)25.86 E |
| (GNU Bash-4.1)72 768 Q(2009 December 29)135.965 E(67)185.955 E 0 Cg EP |
| %%Page: 68 68 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E/F1 10/Times-Bold@0 SF<ad64>144 84 Q F0 |
| (The maximum size of a process')24.74 E 2.5(sd)-.55 G(ata se)-2.5 E |
| (gment)-.15 E F1<ad65>144 96 Q F0 |
| (The maximum scheduling priority \("nice"\))25.86 E F1<ad66>144 108 Q F0 |
| (The maximum size of \214les written by the shell and its children)26.97 |
| E F1<ad69>144 120 Q F0(The maximum number of pending signals)27.52 E F1 |
| <ad6c>144 132 Q F0(The maximum size that may be lock)27.52 E |
| (ed into memory)-.1 E F1<ad6d>144 144 Q F0 |
| (The maximum resident set size \(man)21.97 E 2.5(ys)-.15 G |
| (ystems do not honor this limit\))-2.5 E F1<ad6e>144 156 Q F0 .791(The \ |
| maximum number of open \214le descriptors \(most systems do not allo) |
| 24.74 F 3.29(wt)-.25 G .79(his v)-3.29 F .79(alue to)-.25 F(be set\))180 |
| 168 Q F1<ad70>144 180 Q F0 |
| (The pipe size in 512-byte blocks \(this may not be set\))24.74 E F1 |
| <ad71>144 192 Q F0(The maximum number of bytes in POSIX message queues) |
| 24.74 E F1<ad72>144 204 Q F0(The maximum real-time scheduling priority) |
| 25.86 E F1<ad73>144 216 Q F0(The maximum stack size)26.41 E F1<ad74>144 |
| 228 Q F0(The maximum amount of cpu time in seconds)26.97 E F1<ad75>144 |
| 240 Q F0(The maximum number of processes a)24.74 E -.25(va)-.2 G |
| (ilable to a single user).25 E F1<ad76>144 252 Q F0 |
| (The maximum amount of virtual memory a)25.3 E -.25(va)-.2 G |
| (ilable to the shell).25 E F1<ad78>144 264 Q F0 |
| (The maximum number of \214le locks)25.3 E F1<ad54>144 276 Q F0 |
| (The maximum number of threads)23.63 E(If)144 292.8 Q/F2 10 |
| /Times-Italic@0 SF(limit)2.933 E F0 .343(is gi)3.523 F -.15(ve)-.25 G |
| .343(n, it is the ne).15 F 2.843(wv)-.25 G .343 |
| (alue of the speci\214ed resource \(the)-3.093 F F1<ad61>2.843 E F0 .343 |
| (option is display only\).)2.843 F .343(If no)5.343 F .176(option is gi) |
| 144 304.8 R -.15(ve)-.25 G .176(n, then).15 F F1<ad66>2.676 E F0 .175 |
| (is assumed.)2.676 F -1.11(Va)5.175 G .175 |
| (lues are in 1024-byte increments, e)1.11 F .175(xcept for)-.15 F F1 |
| <ad74>2.675 E F0 2.675(,w)C .175(hich is in)-2.675 F(seconds,)144 316.8 |
| Q F1<ad70>2.515 E F0 2.515(,w)C .015 |
| (hich is in units of 512-byte blocks, and)-2.515 F F1<ad54>2.516 E F0(,) |
| A F1<ad62>2.516 E F0(,)A F1<ad6e>2.516 E F0 2.516(,a)C(nd)-2.516 E F1 |
| <ad75>2.516 E F0 2.516(,w)C .016(hich are unscaled v)-2.516 F(al-)-.25 E |
| 3.788(ues. The)144 328.8 R 1.287(return status is 0 unless an in)3.787 F |
| -.25(va)-.4 G 1.287(lid option or ar).25 F 1.287 |
| (gument is supplied, or an error occurs)-.18 F(while setting a ne)144 |
| 340.8 Q 2.5(wl)-.25 G(imit.)-2.5 E F1(umask)108 357.6 Q F0([)2.5 E F1 |
| <ad70>A F0 2.5(][)C F1<ad53>-2.5 E F0 2.5(][)C F2(mode)-2.5 E F0(])A .2 |
| (The user \214le-creation mask is set to)144 369.6 R F2(mode)2.7 E F0 |
| 5.2(.I).18 G(f)-5.2 E F2(mode)3.08 E F0(be)2.88 E .2 |
| (gins with a digit, it is interpreted as an octal)-.15 F .066(number; o\ |
| therwise it is interpreted as a symbolic mode mask similar to that acce\ |
| pted by)144 381.6 R F2 -.15(ch)2.566 G(mod).15 E F0(\(1\).).77 E(If)144 |
| 393.6 Q F2(mode)3.262 E F0 .382(is omitted, the current v)3.062 F .382 |
| (alue of the mask is printed.)-.25 F(The)5.382 E F1<ad53>2.882 E F0 .382 |
| (option causes the mask to be)2.882 F .547 |
| (printed in symbolic form; the def)144 405.6 R .547 |
| (ault output is an octal number)-.1 F 5.547(.I)-.55 G 3.047(ft)-5.547 G |
| (he)-3.047 E F1<ad70>3.047 E F0 .547(option is supplied, and)3.047 F F2 |
| (mode)144.38 417.6 Q F0 .551 |
| (is omitted, the output is in a form that may be reused as input.)3.231 |
| F .552(The return status is 0 if the)5.552 F(mode w)144 429.6 Q |
| (as successfully changed or if no)-.1 E F2(mode)2.5 E F0(ar)2.5 E |
| (gument w)-.18 E(as supplied, and f)-.1 E(alse otherwise.)-.1 E F1 |
| (unalias)108 446.4 Q F0<5bad>2.5 E F1(a)A F0 2.5(][)C F2(name)-2.5 E F0 |
| (...])2.5 E(Remo)144 458.4 Q 1.955 -.15(ve e)-.15 H(ach).15 E F2(name) |
| 4.155 E F0 1.655(from the list of de\214ned aliases.)4.155 F(If)6.655 E |
| F1<ad61>4.155 E F0 1.655(is supplied, all alias de\214nitions are)4.155 |
| F(remo)144 470.4 Q -.15(ve)-.15 G 2.5(d. The).15 F(return v)2.5 E |
| (alue is true unless a supplied)-.25 E F2(name)2.86 E F0 |
| (is not a de\214ned alias.)2.68 E F1(unset)108 487.2 Q F0<5bad>2.5 E F1 |
| (fv)A F0 2.5(][)C F2(name)-2.5 E F0(...])2.5 E -.15(Fo)144 499.2 S 3.106 |
| (re).15 G(ach)-3.106 E F2(name)3.106 E F0 3.106(,r).18 G(emo)-3.106 E |
| .906 -.15(ve t)-.15 H .606(he corresponding v).15 F .607 |
| (ariable or function.)-.25 F .607(If no options are supplied, or the) |
| 5.607 F F1<ad76>144 511.2 Q F0 .305(option is gi)2.805 F -.15(ve)-.25 G |
| .305(n, each).15 F F2(name)3.165 E F0 .305(refers to a shell v)2.985 F |
| 2.805(ariable. Read-only)-.25 F -.25(va)2.805 G .304 |
| (riables may not be unset.).25 F(If)5.304 E F1<ad66>144 523.2 Q F0 .459 |
| (is speci\214ed, each)2.959 F F2(name)3.319 E F0 .459 |
| (refers to a shell function, and the function de\214nition is remo)3.139 |
| F -.15(ve)-.15 G 2.96(d. Each).15 F .903(unset v)144 535.2 R .903 |
| (ariable or function is remo)-.25 F -.15(ve)-.15 G 3.402(df).15 G .902 |
| (rom the en)-3.402 F .902(vironment passed to subsequent commands.)-.4 F |
| (If)5.902 E(an)144 547.2 Q 6.915(yo)-.15 G(f)-6.915 E/F3 9/Times-Bold@0 |
| SF(COMP_W)6.915 E(ORDBREAKS)-.09 E/F4 9/Times-Roman@0 SF(,)A F3(RANDOM) |
| 6.665 E F4(,)A F3(SECONDS)6.665 E F4(,)A F3(LINENO)6.665 E F4(,)A F3 |
| (HISTCMD)6.666 E F4(,)A F3(FUNCN)6.666 E(AME)-.18 E F4(,)A F3(GR)144 |
| 559.2 Q(OUPS)-.27 E F4(,)A F0(or)2.523 E F3(DIRST)2.773 E -.495(AC)-.81 |
| G(K).495 E F0 .272(are unset, the)2.522 F 2.772(yl)-.15 G .272 |
| (ose their special properties, e)-2.772 F -.15(ve)-.25 G 2.772(ni).15 G |
| 2.772(ft)-2.772 G(he)-2.772 E 2.772(ya)-.15 G .272(re subsequently) |
| -2.772 F 2.5(reset. The)144 571.2 R -.15(ex)2.5 G |
| (it status is true unless a).15 E F2(name)2.86 E F0(is readonly)2.68 E |
| (.)-.65 E F1(wait)108 588 Q F0([)2.5 E F2 2.5(n.)C(..)-2.5 E F0(])A -.8 |
| (Wa)144 600 S .288 |
| (it for each speci\214ed process and return its termination status.).8 F |
| (Each)5.288 E F2(n)3.148 E F0 .288(may be a process ID or a)3.028 F .722 |
| (job speci\214cation; if a job spec is gi)144 612 R -.15(ve)-.25 G .722 |
| (n, all processes in that job').15 F 3.222(sp)-.55 G .722(ipeline are w) |
| -3.222 F .722(aited for)-.1 F 5.722(.I)-.55 G(f)-5.722 E F2(n)3.582 E F0 |
| (is)3.462 E 1.265(not gi)144 624 R -.15(ve)-.25 G 1.265 |
| (n, all currently acti).15 F 1.565 -.15(ve c)-.25 H 1.265 |
| (hild processes are w).15 F 1.265(aited for)-.1 F 3.765(,a)-.4 G 1.266 |
| (nd the return status is zero.)-3.765 F(If)6.266 E F2(n)4.126 E F0 .457 |
| (speci\214es a non-e)144 636 R .457 |
| (xistent process or job, the return status is 127.)-.15 F .457 |
| (Otherwise, the return status is the)5.457 F -.15(ex)144 648 S |
| (it status of the last process or job w).15 E(aited for)-.1 E(.)-.55 E |
| /F5 10.95/Times-Bold@0 SF(RESTRICTED SHELL)72 664.8 Q F0(If)108 676.8 Q |
| F1(bash)4.396 E F0 1.896(is started with the name)4.396 F F1(rbash)4.397 |
| E F0 4.397(,o)C 4.397(rt)-4.397 G(he)-4.397 E F1<ad72>4.397 E F0 1.897 |
| (option is supplied at in)4.397 F -.2(vo)-.4 G 1.897 |
| (cation, the shell becomes).2 F 3.446(restricted. A)108 688.8 R .945 |
| (restricted shell is used to set up an en)3.446 F .945 |
| (vironment more controlled than the standard shell.)-.4 F(It)5.945 E |
| (beha)108 700.8 Q -.15(ve)-.2 G 2.5(si).15 G(dentically to)-2.5 E F1 |
| (bash)2.5 E F0(with the e)2.5 E(xception that the follo)-.15 E |
| (wing are disallo)-.25 E(wed or not performed:)-.25 E 32.5<8363>108 |
| 717.6 S(hanging directories with)-32.5 E F1(cd)2.5 E F0(GNU Bash-4.1)72 |
| 768 Q(2009 December 29)135.965 E(68)185.955 E 0 Cg EP |
| %%Page: 69 69 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E 32.5<8373>108 84 S(etting or unsetting the v)-32.5 E(alues of) |
| -.25 E/F1 9/Times-Bold@0 SF(SHELL)2.5 E/F2 9/Times-Roman@0 SF(,)A F1 |
| -.666(PA)2.25 G(TH)-.189 E F2(,)A F1(ENV)2.25 E F2(,)A F0(or)2.25 E F1 |
| -.27(BA)2.5 G(SH_ENV).27 E F0 32.5<8373>108 100.8 S |
| (pecifying command names containing)-32.5 E/F3 10/Times-Bold@0 SF(/)2.5 |
| E F0 32.5<8373>108 117.6 S(pecifying a \214le name containing a)-32.5 E |
| F3(/)2.5 E F0(as an ar)2.5 E(gument to the)-.18 E F3(.)2.5 E F0 -.2(bu)5 |
| G(iltin command).2 E 32.5<8353>108 134.4 S .351 |
| (pecifying a \214lename containing a slash as an ar)-32.5 F .351 |
| (gument to the)-.18 F F3<ad70>2.851 E F0 .351(option to the)2.851 F F3 |
| (hash)2.852 E F0 -.2(bu)2.852 G .352(iltin com-).2 F(mand)144 146.4 Q |
| 32.5<8369>108 163.2 S(mporting function de\214nitions from the shell en) |
| -32.5 E(vironment at startup)-.4 E 32.5<8370>108 180 S(arsing the v) |
| -32.5 E(alue of)-.25 E F1(SHELLOPTS)2.5 E F0(from the shell en)2.25 E |
| (vironment at startup)-.4 E 32.5<8372>108 196.8 S(edirecting output usi\ |
| ng the >, >|, <>, >&, &>, and >> redirection operators)-32.5 E 32.5 |
| <8375>108 213.6 S(sing the)-32.5 E F3(exec)2.5 E F0 -.2(bu)2.5 G |
| (iltin command to replace the shell with another command).2 E 32.5<8361> |
| 108 230.4 S(dding or deleting b)-32.5 E(uiltin commands with the)-.2 E |
| F3<ad66>2.5 E F0(and)2.5 E F3<ad64>2.5 E F0(options to the)2.5 E F3 |
| (enable)2.5 E F0 -.2(bu)2.5 G(iltin command).2 E 32.5<8355>108 247.2 S |
| (sing the)-32.5 E F3(enable)2.5 E F0 -.2(bu)2.5 G |
| (iltin command to enable disabled shell b).2 E(uiltins)-.2 E 32.5<8373> |
| 108 264 S(pecifying the)-32.5 E F3<ad70>2.5 E F0(option to the)2.5 E F3 |
| (command)2.5 E F0 -.2(bu)2.5 G(iltin command).2 E 32.5<8374>108 280.8 S |
| (urning of)-32.5 E 2.5(fr)-.25 G(estricted mode with)-2.5 E F3(set +r) |
| 2.5 E F0(or)2.5 E F3(set +o r)2.5 E(estricted)-.18 E F0(.)A |
| (These restrictions are enforced after an)108 297.6 Q 2.5(ys)-.15 G |
| (tartup \214les are read.)-2.5 E 1.566 |
| (When a command that is found to be a shell script is e)108 314.4 R -.15 |
| (xe)-.15 G 1.566(cuted \(see).15 F F1 1.566(COMMAND EXECUTION)4.066 F F0 |
| (abo)3.816 E -.15(ve)-.15 G(\),).15 E F3(rbash)108 326.4 Q F0(turns of) |
| 2.5 E 2.5(fa)-.25 G .3 -.15(ny r)-2.5 H(estrictions in the shell spa).15 |
| E(wned to e)-.15 E -.15(xe)-.15 G(cute the script.).15 E/F4 10.95 |
| /Times-Bold@0 SF(SEE ALSO)72 343.2 Q/F5 10/Times-Italic@0 SF(Bash Refer) |
| 108 355.2 Q(ence Manual)-.37 E F0 2.5(,B)C(rian F)-2.5 E |
| (ox and Chet Rame)-.15 E(y)-.15 E F5(The Gnu Readline Libr)108 367.2 Q |
| (ary)-.15 E F0 2.5(,B)C(rian F)-2.5 E(ox and Chet Rame)-.15 E(y)-.15 E |
| F5(The Gnu History Libr)108 379.2 Q(ary)-.15 E F0 2.5(,B)C(rian F)-2.5 E |
| (ox and Chet Rame)-.15 E(y)-.15 E F5 -.8(Po)108 391.2 S(rtable Oper).8 E |
| (ating System Interface \(POSIX\) P)-.15 E(art 2: Shell and Utilities) |
| -.8 E F0 2.5(,I)C(EEE)-2.5 E F5(sh)108 403.2 Q F0(\(1\),)A F5(ksh)2.5 E |
| F0(\(1\),)A F5(csh)2.5 E F0(\(1\))A F5(emacs)108 415.2 Q F0(\(1\),)A F5 |
| (vi)2.5 E F0(\(1\))A F5 -.37(re)108 427.2 S(adline).37 E F0(\(3\))A F4 |
| (FILES)72 444 Q F5(/bin/bash)109.666 456 Q F0(The)144 468 Q F3(bash)2.5 |
| E F0 -.15(exe)2.5 G(cutable).15 E F5(/etc/pr)109.666 480 Q(o\214le)-.45 |
| E F0(The systemwide initialization \214le, e)144 492 Q -.15(xe)-.15 G |
| (cuted for login shells).15 E F5(~/.bash_pr)109.666 504 Q(o\214le)-.45 E |
| F0(The personal initialization \214le, e)144 516 Q -.15(xe)-.15 G |
| (cuted for login shells).15 E F5(~/.bashr)109.666 528 Q(c)-.37 E F0 |
| (The indi)144 540 Q(vidual per)-.25 E(-interacti)-.2 E -.15(ve)-.25 G |
| (-shell startup \214le).15 E F5(~/.bash_lo)109.666 552 Q(gout)-.1 E F0 |
| (The indi)144 564 Q(vidual login shell cleanup \214le, e)-.25 E -.15(xe) |
| -.15 G(cuted when a login shell e).15 E(xits)-.15 E F5(~/.inputr)109.666 |
| 576 Q(c)-.37 E F0(Indi)144 588 Q(vidual)-.25 E F5 -.37(re)2.5 G(adline) |
| .37 E F0(initialization \214le)2.5 E F4 -.548(AU)72 604.8 S(THORS).548 E |
| F0(Brian F)108 616.8 Q(ox, Free Softw)-.15 E(are F)-.1 E(oundation)-.15 |
| E(bfox@gnu.or)108 628.8 Q(g)-.18 E(Chet Rame)108 645.6 Q 1.3 -.65(y, C) |
| -.15 H(ase W).65 E(estern Reserv)-.8 E 2.5(eU)-.15 G(ni)-2.5 E -.15(ve) |
| -.25 G(rsity).15 E(chet.rame)108 657.6 Q(y@case.edu)-.15 E F4 -.11(BU)72 |
| 674.4 S 2.738(GR).11 G(EPOR)-2.738 E(TS)-.438 E F0 .567 |
| (If you \214nd a b)108 686.4 R .568(ug in)-.2 F F3(bash,)3.068 E F0 .568 |
| (you should report it.)3.068 F .568(But \214rst, you should mak)5.568 F |
| 3.068(es)-.1 G .568(ure that it really is a b)-3.068 F .568(ug, and)-.2 |
| F 5.626(that it appears in the latest v)108 698.4 R 5.625(ersion of)-.15 |
| F F3(bash)8.125 E F0 10.625(.T)C 5.625(he latest v)-10.625 F 5.625 |
| (ersion is al)-.15 F -.1(wa)-.1 G 5.625(ys a).1 F -.25(va)-.2 G 5.625 |
| (ilable from).25 F F5(ftp://ftp.gnu.or)108 710.4 Q(g/pub/bash/)-.37 E F0 |
| (.)A .41(Once you ha)108 727.2 R .71 -.15(ve d)-.2 H .41 |
| (etermined that a b).15 F .41(ug actually e)-.2 F .411(xists, use the) |
| -.15 F F5(bashb)3.181 E(ug)-.2 E F0 .411(command to submit a b)3.131 F |
| .411(ug report.)-.2 F(If)5.411 E(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(69)185.955 E 0 Cg EP |
| %%Page: 70 70 |
| %%BeginPageSetup |
| BP |
| %%EndPageSetup |
| /F0 10/Times-Roman@0 SF -.35(BA)72 48 S 389.54(SH\(1\) B).35 F(ASH\(1\)) |
| -.35 E .595(you ha)108 84 R .895 -.15(ve a \214)-.2 H .595 |
| (x, you are encouraged to mail that as well!).15 F .594 |
| (Suggestions and `philosophical' b)5.595 F .594(ug reports may)-.2 F |
| (be mailed to)108 96 Q/F1 10/Times-Italic@0 SF -.2(bu)2.5 G |
| (g-bash@gnu.or).2 E(g)-.37 E F0(or posted to the Usenet ne)2.5 E |
| (wsgroup)-.25 E/F2 10/Times-Bold@0 SF(gnu.bash.b)2.5 E(ug)-.2 E F0(.)A |
| (ALL b)108 112.8 Q(ug reports should include:)-.2 E(The v)108 129.6 Q |
| (ersion number of)-.15 E F2(bash)2.5 E F0(The hardw)108 141.6 Q |
| (are and operating system)-.1 E(The compiler used to compile)108 153.6 Q |
| 2.5(Ad)108 165.6 S(escription of the b)-2.5 E(ug beha)-.2 E(viour)-.2 E |
| 2.5(As)108 177.6 S(hort script or `recipe' which e)-2.5 E -.15(xe)-.15 G |
| (rcises the b).15 E(ug)-.2 E F1(bashb)108.27 194.4 Q(ug)-.2 E F0 |
| (inserts the \214rst three items automatically into the template it pro) |
| 2.72 E(vides for \214ling a b)-.15 E(ug report.)-.2 E(Comments and b)108 |
| 211.2 Q(ug reports concerning this manual page should be directed to)-.2 |
| E F1 -.15(ch)2.5 G(et@po.cwru.edu).15 E F0(.).25 E/F3 10.95/Times-Bold@0 |
| SF -.11(BU)72 228 S(GS).11 E F0(It')108 240 Q 2.5(st)-.55 G |
| (oo big and too slo)-2.5 E -.65(w.)-.25 G 1.868 |
| (There are some subtle dif)108 256.8 R 1.868(ferences between)-.25 F F2 |
| (bash)4.369 E F0 1.869(and traditional v)4.369 F 1.869(ersions of)-.15 F |
| F2(sh)4.369 E F0 4.369(,m)C 1.869(ostly because of the)-4.369 F/F4 9 |
| /Times-Bold@0 SF(POSIX)108 268.8 Q F0(speci\214cation.)2.25 E |
| (Aliases are confusing in some uses.)108 285.6 Q(Shell b)108 302.4 Q |
| (uiltin commands and functions are not stoppable/restartable.)-.2 E |
| 1.315(Compound commands and command sequences of the form `a ; b ; c' a\ |
| re not handled gracefully when)108 319.2 R .389 |
| (process suspension is attempted.)108 331.2 R .389 |
| (When a process is stopped, the shell immediately e)5.389 F -.15(xe)-.15 |
| G .39(cutes the ne).15 F .39(xt com-)-.15 F .193(mand in the sequence.) |
| 108 343.2 R .192(It suf)5.193 F .192(\214ces to place the sequence of c\ |
| ommands between parentheses to force it into a)-.25 F |
| (subshell, which may be stopped as a unit.)108 355.2 Q(Array v)108 372 Q |
| (ariables may not \(yet\) be e)-.25 E(xported.)-.15 E |
| (There may be only one acti)108 388.8 Q .3 -.15(ve c)-.25 H |
| (oprocess at a time.).15 E(GNU Bash-4.1)72 768 Q(2009 December 29) |
| 135.965 E(70)185.955 E 0 Cg EP |
| %%Trailer |
| end |
| %%EOF |